mirror of
				https://github.com/optim-enterprises-bv/kubernetes.git
				synced 2025-11-04 04:08:16 +00:00 
			
		
		
		
	Remove outdated network plugin code
The code was added to support rktnetes and non-CRI docker integrations. These legacy integrations have already been removed from the codebase. This change removes the compatibility code existing soley for the legacy integrations.
This commit is contained in:
		@@ -359,7 +359,6 @@ func UnsecuredDependencies(s *options.KubeletServer) (*kubelet.Dependencies, err
 | 
			
		||||
		ExternalKubeClient:  nil,
 | 
			
		||||
		EventClient:         nil,
 | 
			
		||||
		Mounter:             mounter,
 | 
			
		||||
		NetworkPlugins:      ProbeNetworkPlugins(s.CNIConfDir, cni.SplitDirs(s.CNIBinDir)),
 | 
			
		||||
		OOMAdjuster:         oom.NewOOMAdjuster(),
 | 
			
		||||
		OSInterface:         kubecontainer.RealOS{},
 | 
			
		||||
		Writer:              writer,
 | 
			
		||||
@@ -1112,7 +1111,6 @@ func RunDockershim(f *options.KubeletFlags, c *kubeletconfiginternal.KubeletConf
 | 
			
		||||
	}
 | 
			
		||||
 | 
			
		||||
	// Initialize network plugin settings.
 | 
			
		||||
	nh := &kubelet.NoOpLegacyHost{}
 | 
			
		||||
	pluginSettings := dockershim.NetworkPluginSettings{
 | 
			
		||||
		HairpinMode:       kubeletconfiginternal.HairpinMode(c.HairpinMode),
 | 
			
		||||
		NonMasqueradeCIDR: f.NonMasqueradeCIDR,
 | 
			
		||||
@@ -1120,7 +1118,6 @@ func RunDockershim(f *options.KubeletFlags, c *kubeletconfiginternal.KubeletConf
 | 
			
		||||
		PluginConfDir:     r.CNIConfDir,
 | 
			
		||||
		PluginBinDirs:     cni.SplitDirs(r.CNIBinDir),
 | 
			
		||||
		MTU:               int(r.NetworkPluginMTU),
 | 
			
		||||
		LegacyRuntimeHost: nh,
 | 
			
		||||
	}
 | 
			
		||||
 | 
			
		||||
	// Initialize streaming configuration. (Not using TLS now)
 | 
			
		||||
 
 | 
			
		||||
@@ -120,13 +120,6 @@ type NetworkPluginSettings struct {
 | 
			
		||||
	PluginConfDir string
 | 
			
		||||
	// MTU is the desired MTU for network devices created by the plugin.
 | 
			
		||||
	MTU int
 | 
			
		||||
 | 
			
		||||
	// RuntimeHost is an interface that serves as a trap-door from plugin back
 | 
			
		||||
	// into the kubelet.
 | 
			
		||||
	// TODO: This shouldn't be required, remove once we move host ports into CNI
 | 
			
		||||
	// and figure out bandwidth shaping. See corresponding comments above
 | 
			
		||||
	// network.Host interface.
 | 
			
		||||
	LegacyRuntimeHost network.LegacyHost
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// namespaceGetter is a wrapper around the dockerService that implements
 | 
			
		||||
@@ -153,7 +146,6 @@ func (p *portMappingGetter) GetPodPortMappings(containerID string) ([]*hostport.
 | 
			
		||||
// and dockerServices which implements the rest of the network host interfaces.
 | 
			
		||||
// The legacy host methods are slated for deletion.
 | 
			
		||||
type dockerNetworkHost struct {
 | 
			
		||||
	network.LegacyHost
 | 
			
		||||
	*namespaceGetter
 | 
			
		||||
	*portMappingGetter
 | 
			
		||||
}
 | 
			
		||||
@@ -232,7 +224,6 @@ func NewDockerService(config *ClientConfig, podSandboxImage string, streamingCon
 | 
			
		||||
	cniPlugins := cni.ProbeNetworkPlugins(pluginSettings.PluginConfDir, pluginSettings.PluginBinDirs)
 | 
			
		||||
	cniPlugins = append(cniPlugins, kubenet.NewPlugin(pluginSettings.PluginBinDirs))
 | 
			
		||||
	netHost := &dockerNetworkHost{
 | 
			
		||||
		pluginSettings.LegacyRuntimeHost,
 | 
			
		||||
		&namespaceGetter{ds},
 | 
			
		||||
		&portMappingGetter{ds},
 | 
			
		||||
	}
 | 
			
		||||
 
 | 
			
		||||
@@ -76,7 +76,6 @@ import (
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/logs"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/metrics"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/metrics/collectors"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/network"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/network/cni"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/network/dns"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/pleg"
 | 
			
		||||
@@ -238,7 +237,6 @@ type Dependencies struct {
 | 
			
		||||
	KubeClient              clientset.Interface
 | 
			
		||||
	ExternalKubeClient      clientset.Interface
 | 
			
		||||
	Mounter                 mount.Interface
 | 
			
		||||
	NetworkPlugins          []network.NetworkPlugin
 | 
			
		||||
	OOMAdjuster             *oom.OOMAdjuster
 | 
			
		||||
	OSInterface             kubecontainer.OSInterface
 | 
			
		||||
	PodConfig               *config.PodConfig
 | 
			
		||||
@@ -545,7 +543,7 @@ func NewMainKubelet(kubeCfg *kubeletconfiginternal.KubeletConfiguration,
 | 
			
		||||
		glog.Infof("Experimental host user namespace defaulting is enabled.")
 | 
			
		||||
	}
 | 
			
		||||
 | 
			
		||||
	hairpinMode, err := effectiveHairpinMode(kubeletconfiginternal.HairpinMode(kubeCfg.HairpinMode), containerRuntime, crOptions.NetworkPluginName)
 | 
			
		||||
	hairpinMode, err := effectiveHairpinMode(kubeletconfiginternal.HairpinMode(kubeCfg.HairpinMode), crOptions.NetworkPluginName)
 | 
			
		||||
	if err != nil {
 | 
			
		||||
		// This is a non-recoverable error. Returning it up the callstack will just
 | 
			
		||||
		// lead to retries of the same failure, so just fail hard.
 | 
			
		||||
@@ -553,11 +551,6 @@ func NewMainKubelet(kubeCfg *kubeletconfiginternal.KubeletConfiguration,
 | 
			
		||||
	}
 | 
			
		||||
	glog.Infof("Hairpin mode set to %q", hairpinMode)
 | 
			
		||||
 | 
			
		||||
	plug, err := network.InitNetworkPlugin(kubeDeps.NetworkPlugins, crOptions.NetworkPluginName, &criNetworkHost{&networkHost{klet}, &network.NoopPortMappingGetter{}}, hairpinMode, nonMasqueradeCIDR, int(crOptions.NetworkPluginMTU))
 | 
			
		||||
	if err != nil {
 | 
			
		||||
		return nil, err
 | 
			
		||||
	}
 | 
			
		||||
	klet.networkPlugin = plug
 | 
			
		||||
	machineInfo, err := klet.cadvisor.MachineInfo()
 | 
			
		||||
	if err != nil {
 | 
			
		||||
		return nil, err
 | 
			
		||||
@@ -591,21 +584,10 @@ func NewMainKubelet(kubeCfg *kubeletconfiginternal.KubeletConfiguration,
 | 
			
		||||
 | 
			
		||||
	klet.resourceAnalyzer = serverstats.NewResourceAnalyzer(klet, kubeCfg.VolumeStatsAggPeriod.Duration)
 | 
			
		||||
 | 
			
		||||
	// Remote runtime shim just cannot talk back to kubelet, so it doesn't
 | 
			
		||||
	// support bandwidth shaping or hostports till #35457. To enable legacy
 | 
			
		||||
	// features, replace with networkHost.
 | 
			
		||||
	var nl *NoOpLegacyHost
 | 
			
		||||
	pluginSettings.LegacyRuntimeHost = nl
 | 
			
		||||
 | 
			
		||||
	if containerRuntime == "rkt" {
 | 
			
		||||
		glog.Fatalln("rktnetes has been deprecated in favor of rktlet. Please see https://github.com/kubernetes-incubator/rktlet for more information.")
 | 
			
		||||
	}
 | 
			
		||||
 | 
			
		||||
	// kubelet defers to the runtime shim to setup networking. Setting
 | 
			
		||||
	// this to nil will prevent it from trying to invoke the plugin.
 | 
			
		||||
	// It's easier to always probe and initialize plugins till cri
 | 
			
		||||
	// becomes the default.
 | 
			
		||||
	klet.networkPlugin = nil
 | 
			
		||||
	// if left at nil, that means it is unneeded
 | 
			
		||||
	var legacyLogProvider kuberuntime.LegacyLogProvider
 | 
			
		||||
 | 
			
		||||
@@ -940,9 +922,6 @@ type Kubelet struct {
 | 
			
		||||
	// Volume plugins.
 | 
			
		||||
	volumePluginMgr *volume.VolumePluginMgr
 | 
			
		||||
 | 
			
		||||
	// Network plugin.
 | 
			
		||||
	networkPlugin network.NetworkPlugin
 | 
			
		||||
 | 
			
		||||
	// Handles container probing.
 | 
			
		||||
	probeManager prober.Manager
 | 
			
		||||
	// Manages container health check results.
 | 
			
		||||
@@ -1330,7 +1309,6 @@ func (kl *Kubelet) Run(updates <-chan kubetypes.PodUpdate) {
 | 
			
		||||
		// Start syncing node status immediately, this may set up things the runtime needs to run.
 | 
			
		||||
		go wait.Until(kl.syncNodeStatus, kl.nodeStatusUpdateFrequency, wait.NeverStop)
 | 
			
		||||
	}
 | 
			
		||||
	go wait.Until(kl.syncNetworkStatus, 30*time.Second, wait.NeverStop)
 | 
			
		||||
	go wait.Until(kl.updateRuntimeUp, 5*time.Second, wait.NeverStop)
 | 
			
		||||
 | 
			
		||||
	// Start loop to sync iptables util rules
 | 
			
		||||
 
 | 
			
		||||
@@ -21,12 +21,8 @@ import (
 | 
			
		||||
 | 
			
		||||
	"github.com/golang/glog"
 | 
			
		||||
	"k8s.io/api/core/v1"
 | 
			
		||||
	clientset "k8s.io/client-go/kubernetes"
 | 
			
		||||
	runtimeapi "k8s.io/kubernetes/pkg/kubelet/apis/cri/runtime/v1alpha2"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/apis/kubeletconfig"
 | 
			
		||||
	kubecontainer "k8s.io/kubernetes/pkg/kubelet/container"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/network"
 | 
			
		||||
	kubetypes "k8s.io/kubernetes/pkg/kubelet/types"
 | 
			
		||||
	utiliptables "k8s.io/kubernetes/pkg/util/iptables"
 | 
			
		||||
)
 | 
			
		||||
 | 
			
		||||
@@ -45,80 +41,9 @@ const (
 | 
			
		||||
	KubeFirewallChain utiliptables.Chain = "KUBE-FIREWALL"
 | 
			
		||||
)
 | 
			
		||||
 | 
			
		||||
// This just exports required functions from kubelet proper, for use by network
 | 
			
		||||
// plugins.
 | 
			
		||||
// TODO(#35457): get rid of this backchannel to the kubelet. The scope of
 | 
			
		||||
// the back channel is restricted to host-ports/testing, and restricted
 | 
			
		||||
// to kubenet. No other network plugin wrapper needs it. Other plugins
 | 
			
		||||
// only require a way to access namespace information, which they can do
 | 
			
		||||
// directly through the methods implemented by criNetworkHost.
 | 
			
		||||
type networkHost struct {
 | 
			
		||||
	kubelet *Kubelet
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
func (nh *networkHost) GetPodByName(name, namespace string) (*v1.Pod, bool) {
 | 
			
		||||
	return nh.kubelet.GetPodByName(name, namespace)
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
func (nh *networkHost) GetKubeClient() clientset.Interface {
 | 
			
		||||
	return nh.kubelet.kubeClient
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
func (nh *networkHost) GetRuntime() kubecontainer.Runtime {
 | 
			
		||||
	return nh.kubelet.getRuntime()
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
func (nh *networkHost) SupportsLegacyFeatures() bool {
 | 
			
		||||
	return true
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// criNetworkHost implements the part of network.Host required by the
 | 
			
		||||
// cri (NamespaceGetter). It leechs off networkHost for all other
 | 
			
		||||
// methods, because networkHost is slated for deletion.
 | 
			
		||||
type criNetworkHost struct {
 | 
			
		||||
	*networkHost
 | 
			
		||||
	// criNetworkHost currently support legacy features. Hence no need to support PortMappingGetter
 | 
			
		||||
	*network.NoopPortMappingGetter
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// GetNetNS returns the network namespace of the given containerID.
 | 
			
		||||
// This method satisfies the network.NamespaceGetter interface for
 | 
			
		||||
// networkHost. It's only meant to be used from network plugins
 | 
			
		||||
// that are directly invoked by the kubelet (aka: legacy, pre-cri).
 | 
			
		||||
// Any network plugin invoked by a cri must implement NamespaceGetter
 | 
			
		||||
// to talk directly to the runtime instead.
 | 
			
		||||
func (c *criNetworkHost) GetNetNS(containerID string) (string, error) {
 | 
			
		||||
	return c.kubelet.getRuntime().GetNetNS(kubecontainer.ContainerID{Type: "", ID: containerID})
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// NoOpLegacyHost implements the network.LegacyHost interface for the remote
 | 
			
		||||
// runtime shim by just returning empties. It doesn't support legacy features
 | 
			
		||||
// like host port and bandwidth shaping.
 | 
			
		||||
type NoOpLegacyHost struct{}
 | 
			
		||||
 | 
			
		||||
// GetPodByName always returns "nil, true" for 'NoOpLegacyHost'
 | 
			
		||||
func (n *NoOpLegacyHost) GetPodByName(namespace, name string) (*v1.Pod, bool) {
 | 
			
		||||
	return nil, true
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// GetKubeClient always returns "nil" for 'NoOpLegacyHost'
 | 
			
		||||
func (n *NoOpLegacyHost) GetKubeClient() clientset.Interface {
 | 
			
		||||
	return nil
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// getRuntime always returns "nil" for 'NoOpLegacyHost'
 | 
			
		||||
func (n *NoOpLegacyHost) GetRuntime() kubecontainer.Runtime {
 | 
			
		||||
	return nil
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// SupportsLegacyFeatures always returns "false" for 'NoOpLegacyHost'
 | 
			
		||||
func (n *NoOpLegacyHost) SupportsLegacyFeatures() bool {
 | 
			
		||||
	return false
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// effectiveHairpinMode determines the effective hairpin mode given the
 | 
			
		||||
// configured mode, container runtime, and whether cbr0 should be configured.
 | 
			
		||||
func effectiveHairpinMode(hairpinMode kubeletconfig.HairpinMode, containerRuntime string, networkPlugin string) (kubeletconfig.HairpinMode, error) {
 | 
			
		||||
func effectiveHairpinMode(hairpinMode kubeletconfig.HairpinMode, networkPlugin string) (kubeletconfig.HairpinMode, error) {
 | 
			
		||||
	// The hairpin mode setting doesn't matter if:
 | 
			
		||||
	// - We're not using a bridge network. This is hard to check because we might
 | 
			
		||||
	//   be using a plugin.
 | 
			
		||||
@@ -127,11 +52,6 @@ func effectiveHairpinMode(hairpinMode kubeletconfig.HairpinMode, containerRuntim
 | 
			
		||||
	//   docker runtime is the only one that understands this.
 | 
			
		||||
	// - It's set to "none".
 | 
			
		||||
	if hairpinMode == kubeletconfig.PromiscuousBridge || hairpinMode == kubeletconfig.HairpinVeth {
 | 
			
		||||
		// Only on docker.
 | 
			
		||||
		if containerRuntime != kubetypes.DockerContainerRuntime {
 | 
			
		||||
			glog.Warningf("Hairpin mode set to %q but container runtime is %q, ignoring", hairpinMode, containerRuntime)
 | 
			
		||||
			return kubeletconfig.HairpinNone, nil
 | 
			
		||||
		}
 | 
			
		||||
		if hairpinMode == kubeletconfig.PromiscuousBridge && networkPlugin != "kubenet" {
 | 
			
		||||
			// This is not a valid combination, since promiscuous-bridge only works on kubenet. Users might be using the
 | 
			
		||||
			// default values (from before the hairpin-mode flag existed) and we
 | 
			
		||||
@@ -159,16 +79,6 @@ func (kl *Kubelet) providerRequiresNetworkingConfiguration() bool {
 | 
			
		||||
	return supported
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// syncNetworkStatus updates the network state
 | 
			
		||||
func (kl *Kubelet) syncNetworkStatus() {
 | 
			
		||||
	// For cri integration, network state will be updated in updateRuntimeUp,
 | 
			
		||||
	// we'll get runtime network status through cri directly.
 | 
			
		||||
	// TODO: Remove this once we completely switch to cri integration.
 | 
			
		||||
	if kl.networkPlugin != nil {
 | 
			
		||||
		kl.runtimeState.setNetworkState(kl.networkPlugin.Status())
 | 
			
		||||
	}
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// updatePodCIDR updates the pod CIDR in the runtime state if it is different
 | 
			
		||||
// from the current CIDR.
 | 
			
		||||
func (kl *Kubelet) updatePodCIDR(cidr string) {
 | 
			
		||||
@@ -178,14 +88,6 @@ func (kl *Kubelet) updatePodCIDR(cidr string) {
 | 
			
		||||
		return
 | 
			
		||||
	}
 | 
			
		||||
 | 
			
		||||
	// kubelet -> network plugin
 | 
			
		||||
	// cri runtime shims are responsible for their own network plugins
 | 
			
		||||
	if kl.networkPlugin != nil {
 | 
			
		||||
		details := make(map[string]interface{})
 | 
			
		||||
		details[network.NET_PLUGIN_EVENT_POD_CIDR_CHANGE_DETAIL_CIDR] = cidr
 | 
			
		||||
		kl.networkPlugin.Event(network.NET_PLUGIN_EVENT_POD_CIDR_CHANGE, details)
 | 
			
		||||
	}
 | 
			
		||||
 | 
			
		||||
	// kubelet -> generic runtime -> runtime shim -> network plugin
 | 
			
		||||
	// docker/non-cri implementations have a passthrough UpdatePodCIDR
 | 
			
		||||
	if err := kl.getRuntime().UpdatePodCIDR(cidr); err != nil {
 | 
			
		||||
 
 | 
			
		||||
@@ -22,73 +22,94 @@ import (
 | 
			
		||||
	"github.com/stretchr/testify/assert"
 | 
			
		||||
)
 | 
			
		||||
 | 
			
		||||
func TestNetworkHostGetsPodNotFound(t *testing.T) {
 | 
			
		||||
	testKubelet := newTestKubelet(t, true)
 | 
			
		||||
	defer testKubelet.Cleanup()
 | 
			
		||||
	nh := networkHost{testKubelet.kubelet}
 | 
			
		||||
 | 
			
		||||
	actualPod, _ := nh.GetPodByName("", "")
 | 
			
		||||
	if actualPod != nil {
 | 
			
		||||
		t.Fatalf("Was expected nil, received %v instead", actualPod)
 | 
			
		||||
func TestNodeIPParam(t *testing.T) {
 | 
			
		||||
	type test struct {
 | 
			
		||||
		nodeIP   string
 | 
			
		||||
		success  bool
 | 
			
		||||
		testName string
 | 
			
		||||
	}
 | 
			
		||||
	tests := []test{
 | 
			
		||||
		{
 | 
			
		||||
			nodeIP:   "",
 | 
			
		||||
			success:  false,
 | 
			
		||||
			testName: "IP not set",
 | 
			
		||||
		},
 | 
			
		||||
		{
 | 
			
		||||
			nodeIP:   "127.0.0.1",
 | 
			
		||||
			success:  false,
 | 
			
		||||
			testName: "IPv4 loopback address",
 | 
			
		||||
		},
 | 
			
		||||
		{
 | 
			
		||||
			nodeIP:   "::1",
 | 
			
		||||
			success:  false,
 | 
			
		||||
			testName: "IPv6 loopback address",
 | 
			
		||||
		},
 | 
			
		||||
		{
 | 
			
		||||
			nodeIP:   "224.0.0.1",
 | 
			
		||||
			success:  false,
 | 
			
		||||
			testName: "multicast IPv4 address",
 | 
			
		||||
		},
 | 
			
		||||
		{
 | 
			
		||||
			nodeIP:   "ff00::1",
 | 
			
		||||
			success:  false,
 | 
			
		||||
			testName: "multicast IPv6 address",
 | 
			
		||||
		},
 | 
			
		||||
		{
 | 
			
		||||
			nodeIP:   "169.254.0.1",
 | 
			
		||||
			success:  false,
 | 
			
		||||
			testName: "IPv4 link-local unicast address",
 | 
			
		||||
		},
 | 
			
		||||
		{
 | 
			
		||||
			nodeIP:   "fe80::0202:b3ff:fe1e:8329",
 | 
			
		||||
			success:  false,
 | 
			
		||||
			testName: "IPv6 link-local unicast address",
 | 
			
		||||
		},
 | 
			
		||||
		{
 | 
			
		||||
			nodeIP:   "0.0.0.0",
 | 
			
		||||
			success:  false,
 | 
			
		||||
			testName: "Unspecified IPv4 address",
 | 
			
		||||
		},
 | 
			
		||||
		{
 | 
			
		||||
			nodeIP:   "::",
 | 
			
		||||
			success:  false,
 | 
			
		||||
			testName: "Unspecified IPv6 address",
 | 
			
		||||
		},
 | 
			
		||||
		{
 | 
			
		||||
			nodeIP:   "1.2.3.4",
 | 
			
		||||
			success:  false,
 | 
			
		||||
			testName: "IPv4 address that doesn't belong to host",
 | 
			
		||||
		},
 | 
			
		||||
	}
 | 
			
		||||
 | 
			
		||||
func TestNetworkHostGetsKubeClient(t *testing.T) {
 | 
			
		||||
	testKubelet := newTestKubelet(t, true)
 | 
			
		||||
	defer testKubelet.Cleanup()
 | 
			
		||||
	nh := networkHost{testKubelet.kubelet}
 | 
			
		||||
 | 
			
		||||
	if nh.GetKubeClient() != testKubelet.fakeKubeClient {
 | 
			
		||||
		t.Fatalf("NetworkHost client does not match testKubelet's client")
 | 
			
		||||
	addrs, err := net.InterfaceAddrs()
 | 
			
		||||
	if err != nil {
 | 
			
		||||
		assert.Error(t, err, fmt.Sprintf(
 | 
			
		||||
			"Unable to obtain a list of the node's unicast interface addresses."))
 | 
			
		||||
	}
 | 
			
		||||
	for _, addr := range addrs {
 | 
			
		||||
		var ip net.IP
 | 
			
		||||
		switch v := addr.(type) {
 | 
			
		||||
		case *net.IPNet:
 | 
			
		||||
			ip = v.IP
 | 
			
		||||
		case *net.IPAddr:
 | 
			
		||||
			ip = v.IP
 | 
			
		||||
		}
 | 
			
		||||
 | 
			
		||||
func TestNetworkHostGetsRuntime(t *testing.T) {
 | 
			
		||||
	testKubelet := newTestKubelet(t, true)
 | 
			
		||||
	defer testKubelet.Cleanup()
 | 
			
		||||
	nh := networkHost{testKubelet.kubelet}
 | 
			
		||||
 | 
			
		||||
	if nh.GetRuntime() != testKubelet.fakeRuntime {
 | 
			
		||||
		t.Fatalf("NetworkHost runtime does not match testKubelet's runtime")
 | 
			
		||||
		if ip.IsLoopback() || ip.IsLinkLocalUnicast() {
 | 
			
		||||
			break
 | 
			
		||||
		}
 | 
			
		||||
		successTest := test{
 | 
			
		||||
			nodeIP:   ip.String(),
 | 
			
		||||
			success:  true,
 | 
			
		||||
			testName: fmt.Sprintf("Success test case for address %s", ip.String()),
 | 
			
		||||
		}
 | 
			
		||||
 | 
			
		||||
func TestNetworkHostSupportsLegacyFeatures(t *testing.T) {
 | 
			
		||||
	testKubelet := newTestKubelet(t, true)
 | 
			
		||||
	defer testKubelet.Cleanup()
 | 
			
		||||
	nh := networkHost{testKubelet.kubelet}
 | 
			
		||||
 | 
			
		||||
	if nh.SupportsLegacyFeatures() == false {
 | 
			
		||||
		t.Fatalf("SupportsLegacyFeatures should not be false")
 | 
			
		||||
		tests = append(tests, successTest)
 | 
			
		||||
	}
 | 
			
		||||
	for _, test := range tests {
 | 
			
		||||
		err := validateNodeIP(net.ParseIP(test.nodeIP))
 | 
			
		||||
		if test.success {
 | 
			
		||||
			assert.NoError(t, err, "test %s", test.testName)
 | 
			
		||||
		} else {
 | 
			
		||||
			assert.Error(t, err, fmt.Sprintf("test %s", test.testName))
 | 
			
		||||
		}
 | 
			
		||||
 | 
			
		||||
func TestNoOpHostGetsName(t *testing.T) {
 | 
			
		||||
	nh := NoOpLegacyHost{}
 | 
			
		||||
	pod, err := nh.GetPodByName("", "")
 | 
			
		||||
	if pod != nil && err != true {
 | 
			
		||||
		t.Fatalf("noOpLegacyHost getpodbyname expected to be nil and true")
 | 
			
		||||
	}
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
func TestNoOpHostGetsKubeClient(t *testing.T) {
 | 
			
		||||
	nh := NoOpLegacyHost{}
 | 
			
		||||
	if nh.GetKubeClient() != nil {
 | 
			
		||||
		t.Fatalf("noOpLegacyHost client expected to be nil")
 | 
			
		||||
	}
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
func TestNoOpHostGetsRuntime(t *testing.T) {
 | 
			
		||||
	nh := NoOpLegacyHost{}
 | 
			
		||||
	if nh.GetRuntime() != nil {
 | 
			
		||||
		t.Fatalf("noOpLegacyHost runtime expected to be nil")
 | 
			
		||||
	}
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
func TestNoOpHostSupportsLegacyFeatures(t *testing.T) {
 | 
			
		||||
	nh := NoOpLegacyHost{}
 | 
			
		||||
	if nh.SupportsLegacyFeatures() != false {
 | 
			
		||||
		t.Fatalf("noOpLegacyHost legacy features expected to be false")
 | 
			
		||||
	}
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
 
 | 
			
		||||
@@ -41,7 +41,6 @@ import (
 | 
			
		||||
	"k8s.io/client-go/tools/record"
 | 
			
		||||
	"k8s.io/client-go/util/flowcontrol"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/capabilities"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/apis/kubeletconfig"
 | 
			
		||||
	cadvisortest "k8s.io/kubernetes/pkg/kubelet/cadvisor/testing"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/cm"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/config"
 | 
			
		||||
@@ -52,8 +51,6 @@ import (
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/images"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/lifecycle"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/logs"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/network"
 | 
			
		||||
	nettest "k8s.io/kubernetes/pkg/kubelet/network/testing"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/pleg"
 | 
			
		||||
	kubepod "k8s.io/kubernetes/pkg/kubelet/pod"
 | 
			
		||||
	podtest "k8s.io/kubernetes/pkg/kubelet/pod/testing"
 | 
			
		||||
@@ -168,7 +165,6 @@ func newTestKubeletWithImageList(
 | 
			
		||||
	kubelet.nodeName = types.NodeName(testKubeletHostname)
 | 
			
		||||
	kubelet.runtimeState = newRuntimeState(maxWaitForContainerRuntime)
 | 
			
		||||
	kubelet.runtimeState.setNetworkState(nil)
 | 
			
		||||
	kubelet.networkPlugin, _ = network.InitNetworkPlugin([]network.NetworkPlugin{}, "", nettest.NewFakeHost(nil), kubeletconfig.HairpinNone, "", 1440)
 | 
			
		||||
	if tempDir, err := ioutil.TempDir("/tmp", "kubelet_test."); err != nil {
 | 
			
		||||
		t.Fatalf("can't make a temp rootdir: %v", err)
 | 
			
		||||
	} else {
 | 
			
		||||
 
 | 
			
		||||
@@ -22,7 +22,6 @@ import (
 | 
			
		||||
	"fmt"
 | 
			
		||||
	"io/ioutil"
 | 
			
		||||
	"net"
 | 
			
		||||
	"path/filepath"
 | 
			
		||||
	"strings"
 | 
			
		||||
	"sync"
 | 
			
		||||
	"time"
 | 
			
		||||
@@ -33,7 +32,6 @@ import (
 | 
			
		||||
	"github.com/golang/glog"
 | 
			
		||||
	"github.com/vishvananda/netlink"
 | 
			
		||||
	"golang.org/x/sys/unix"
 | 
			
		||||
	"k8s.io/api/core/v1"
 | 
			
		||||
	utilerrors "k8s.io/apimachinery/pkg/util/errors"
 | 
			
		||||
	utilnet "k8s.io/apimachinery/pkg/util/net"
 | 
			
		||||
	utilsets "k8s.io/apimachinery/pkg/util/sets"
 | 
			
		||||
@@ -299,9 +297,7 @@ func (plugin *kubenetNetworkPlugin) Capabilities() utilsets.Int {
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// setup sets up networking through CNI using the given ns/name and sandbox ID.
 | 
			
		||||
// TODO: Don't pass the pod to this method, it only needs it for bandwidth
 | 
			
		||||
// shaping and hostport management.
 | 
			
		||||
func (plugin *kubenetNetworkPlugin) setup(namespace string, name string, id kubecontainer.ContainerID, pod *v1.Pod, annotations map[string]string) error {
 | 
			
		||||
func (plugin *kubenetNetworkPlugin) setup(namespace string, name string, id kubecontainer.ContainerID, annotations map[string]string) error {
 | 
			
		||||
	// Disable DAD so we skip the kernel delay on bringing up new interfaces.
 | 
			
		||||
	if err := plugin.disableContainerDAD(id); err != nil {
 | 
			
		||||
		glog.V(3).Infof("Failed to disable DAD in container: %v", err)
 | 
			
		||||
@@ -364,20 +360,6 @@ func (plugin *kubenetNetworkPlugin) setup(namespace string, name string, id kube
 | 
			
		||||
		}
 | 
			
		||||
	}
 | 
			
		||||
 | 
			
		||||
	// The host can choose to not support "legacy" features. The remote
 | 
			
		||||
	// shim doesn't support it (#35457), but the kubelet does.
 | 
			
		||||
	if plugin.host.SupportsLegacyFeatures() {
 | 
			
		||||
		// Open any hostport the pod's containers want
 | 
			
		||||
		activePodPortMappings, err := plugin.getPodPortMappings()
 | 
			
		||||
		if err != nil {
 | 
			
		||||
			return err
 | 
			
		||||
		}
 | 
			
		||||
 | 
			
		||||
		newPodPortMapping := hostport.ConstructPodPortMapping(pod, ip4)
 | 
			
		||||
		if err := plugin.hostportSyncer.OpenPodHostportsAndSync(newPodPortMapping, BridgeName, activePodPortMappings); err != nil {
 | 
			
		||||
			return err
 | 
			
		||||
		}
 | 
			
		||||
	} else {
 | 
			
		||||
	// TODO: replace with CNI port-forwarding plugin
 | 
			
		||||
	portMappings, err := plugin.host.GetPodPortMappings(id.ID)
 | 
			
		||||
	if err != nil {
 | 
			
		||||
@@ -394,7 +376,6 @@ func (plugin *kubenetNetworkPlugin) setup(namespace string, name string, id kube
 | 
			
		||||
			return err
 | 
			
		||||
		}
 | 
			
		||||
	}
 | 
			
		||||
	}
 | 
			
		||||
	return nil
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
@@ -407,38 +388,17 @@ func (plugin *kubenetNetworkPlugin) SetUpPod(namespace string, name string, id k
 | 
			
		||||
		glog.V(4).Infof("SetUpPod took %v for %s/%s", time.Since(start), namespace, name)
 | 
			
		||||
	}()
 | 
			
		||||
 | 
			
		||||
	// TODO: Entire pod object only required for bw shaping and hostport.
 | 
			
		||||
	pod, ok := plugin.host.GetPodByName(namespace, name)
 | 
			
		||||
	if !ok {
 | 
			
		||||
		return fmt.Errorf("pod %q cannot be found", name)
 | 
			
		||||
	}
 | 
			
		||||
 | 
			
		||||
	if err := plugin.Status(); err != nil {
 | 
			
		||||
		return fmt.Errorf("Kubenet cannot SetUpPod: %v", err)
 | 
			
		||||
	}
 | 
			
		||||
 | 
			
		||||
	if err := plugin.setup(namespace, name, id, pod, annotations); err != nil {
 | 
			
		||||
	if err := plugin.setup(namespace, name, id, annotations); err != nil {
 | 
			
		||||
		// Make sure everything gets cleaned up on errors
 | 
			
		||||
		podIP, _ := plugin.podIPs[id]
 | 
			
		||||
		if err := plugin.teardown(namespace, name, id, podIP); err != nil {
 | 
			
		||||
			// Not a hard error or warning
 | 
			
		||||
			glog.V(4).Infof("Failed to clean up %s/%s after SetUpPod failure: %v", namespace, name, err)
 | 
			
		||||
		}
 | 
			
		||||
 | 
			
		||||
		// TODO(#34278): Figure out if we need IP GC through the cri.
 | 
			
		||||
		// The cri should always send us teardown events for stale sandboxes,
 | 
			
		||||
		// this obviates the need for GC in the common case, for kubenet.
 | 
			
		||||
		if plugin.host.SupportsLegacyFeatures() {
 | 
			
		||||
 | 
			
		||||
			// TODO: Remove this hack once we've figured out how to retrieve the netns
 | 
			
		||||
			// of an exited container. Currently, restarting docker will leak a bunch of
 | 
			
		||||
			// ips. This will exhaust available ip space unless we cleanup old ips. At the
 | 
			
		||||
			// same time we don't want to try GC'ing them periodically as that could lead
 | 
			
		||||
			// to a performance regression in starting pods. So on each setup failure, try
 | 
			
		||||
			// GC on the assumption that the kubelet is going to retry pod creation, and
 | 
			
		||||
			// when it does, there will be ips.
 | 
			
		||||
			plugin.ipamGarbageCollection()
 | 
			
		||||
		}
 | 
			
		||||
		return err
 | 
			
		||||
	}
 | 
			
		||||
 | 
			
		||||
@@ -475,17 +435,6 @@ func (plugin *kubenetNetworkPlugin) teardown(namespace string, name string, id k
 | 
			
		||||
		}
 | 
			
		||||
	}
 | 
			
		||||
 | 
			
		||||
	// The host can choose to not support "legacy" features. The remote
 | 
			
		||||
	// shim doesn't support it (#35457), but the kubelet does.
 | 
			
		||||
	if plugin.host.SupportsLegacyFeatures() {
 | 
			
		||||
		activePodPortMapping, err := plugin.getPodPortMappings()
 | 
			
		||||
		if err == nil {
 | 
			
		||||
			err = plugin.hostportSyncer.SyncHostports(BridgeName, activePodPortMapping)
 | 
			
		||||
		}
 | 
			
		||||
		if err != nil {
 | 
			
		||||
			errList = append(errList, err)
 | 
			
		||||
		}
 | 
			
		||||
	} else {
 | 
			
		||||
	portMappings, err := plugin.host.GetPodPortMappings(id.ID)
 | 
			
		||||
	if err != nil {
 | 
			
		||||
		errList = append(errList, err)
 | 
			
		||||
@@ -499,7 +448,6 @@ func (plugin *kubenetNetworkPlugin) teardown(namespace string, name string, id k
 | 
			
		||||
			errList = append(errList, err)
 | 
			
		||||
		}
 | 
			
		||||
	}
 | 
			
		||||
	}
 | 
			
		||||
	return utilerrors.NewAggregate(errList)
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
@@ -599,119 +547,6 @@ func (plugin *kubenetNetworkPlugin) checkRequiredCNIPluginsInOneDir(dir string)
 | 
			
		||||
	return true
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// getNonExitedPods returns a list of pods that have at least one running container.
 | 
			
		||||
func (plugin *kubenetNetworkPlugin) getNonExitedPods() ([]*kubecontainer.Pod, error) {
 | 
			
		||||
	ret := []*kubecontainer.Pod{}
 | 
			
		||||
	pods, err := plugin.host.GetRuntime().GetPods(true)
 | 
			
		||||
	if err != nil {
 | 
			
		||||
		return nil, fmt.Errorf("Failed to retrieve pods from runtime: %v", err)
 | 
			
		||||
	}
 | 
			
		||||
	for _, p := range pods {
 | 
			
		||||
		if podIsExited(p) {
 | 
			
		||||
			continue
 | 
			
		||||
		}
 | 
			
		||||
		ret = append(ret, p)
 | 
			
		||||
	}
 | 
			
		||||
	return ret, nil
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
func (plugin *kubenetNetworkPlugin) getPodPortMappings() ([]*hostport.PodPortMapping, error) {
 | 
			
		||||
	pods, err := plugin.getNonExitedPods()
 | 
			
		||||
	if err != nil {
 | 
			
		||||
		return nil, err
 | 
			
		||||
	}
 | 
			
		||||
	activePodPortMappings := make([]*hostport.PodPortMapping, 0)
 | 
			
		||||
	for _, p := range pods {
 | 
			
		||||
		containerID, err := plugin.host.GetRuntime().GetPodContainerID(p)
 | 
			
		||||
		if err != nil {
 | 
			
		||||
			continue
 | 
			
		||||
		}
 | 
			
		||||
		ipString, ok := plugin.podIPs[containerID]
 | 
			
		||||
		if !ok {
 | 
			
		||||
			continue
 | 
			
		||||
		}
 | 
			
		||||
		podIP := net.ParseIP(ipString)
 | 
			
		||||
		if podIP == nil {
 | 
			
		||||
			continue
 | 
			
		||||
		}
 | 
			
		||||
		if pod, ok := plugin.host.GetPodByName(p.Namespace, p.Name); ok {
 | 
			
		||||
			activePodPortMappings = append(activePodPortMappings, hostport.ConstructPodPortMapping(pod, podIP))
 | 
			
		||||
		}
 | 
			
		||||
	}
 | 
			
		||||
	return activePodPortMappings, nil
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// ipamGarbageCollection will release unused IP.
 | 
			
		||||
// kubenet uses the CNI bridge plugin, which stores allocated ips on file. Each
 | 
			
		||||
// file created under defaultIPAMDir has the format: ip/container-hash. So this
 | 
			
		||||
// routine looks for hashes that are not reported by the currently running docker,
 | 
			
		||||
// and invokes DelNetwork on each one. Note that this will only work for the
 | 
			
		||||
// current CNI bridge plugin, because we have no way of finding the NetNs.
 | 
			
		||||
func (plugin *kubenetNetworkPlugin) ipamGarbageCollection() {
 | 
			
		||||
	glog.V(2).Infof("Starting IP garbage collection")
 | 
			
		||||
 | 
			
		||||
	ipamDir := filepath.Join(defaultIPAMDir, KubenetPluginName)
 | 
			
		||||
	files, err := ioutil.ReadDir(ipamDir)
 | 
			
		||||
	if err != nil {
 | 
			
		||||
		glog.Errorf("Failed to list files in %q: %v", ipamDir, err)
 | 
			
		||||
		return
 | 
			
		||||
	}
 | 
			
		||||
 | 
			
		||||
	// gather containerIDs for allocated ips
 | 
			
		||||
	ipContainerIdMap := make(map[string]string)
 | 
			
		||||
	for _, file := range files {
 | 
			
		||||
		// skip non checkpoint file
 | 
			
		||||
		if ip := net.ParseIP(file.Name()); ip == nil {
 | 
			
		||||
			continue
 | 
			
		||||
		}
 | 
			
		||||
 | 
			
		||||
		content, err := ioutil.ReadFile(filepath.Join(ipamDir, file.Name()))
 | 
			
		||||
		if err != nil {
 | 
			
		||||
			glog.Errorf("Failed to read file %v: %v", file, err)
 | 
			
		||||
		}
 | 
			
		||||
		ipContainerIdMap[file.Name()] = strings.TrimSpace(string(content))
 | 
			
		||||
	}
 | 
			
		||||
 | 
			
		||||
	// gather infra container IDs of current running Pods
 | 
			
		||||
	runningContainerIDs := utilsets.String{}
 | 
			
		||||
	pods, err := plugin.getNonExitedPods()
 | 
			
		||||
	if err != nil {
 | 
			
		||||
		glog.Errorf("Failed to get pods: %v", err)
 | 
			
		||||
		return
 | 
			
		||||
	}
 | 
			
		||||
	for _, pod := range pods {
 | 
			
		||||
		containerID, err := plugin.host.GetRuntime().GetPodContainerID(pod)
 | 
			
		||||
		if err != nil {
 | 
			
		||||
			glog.Warningf("Failed to get infra containerID of %q/%q: %v", pod.Namespace, pod.Name, err)
 | 
			
		||||
			continue
 | 
			
		||||
		}
 | 
			
		||||
 | 
			
		||||
		runningContainerIDs.Insert(strings.TrimSpace(containerID.ID))
 | 
			
		||||
	}
 | 
			
		||||
 | 
			
		||||
	// release leaked ips
 | 
			
		||||
	for ip, containerID := range ipContainerIdMap {
 | 
			
		||||
		// if the container is not running, release IP
 | 
			
		||||
		if runningContainerIDs.Has(containerID) {
 | 
			
		||||
			continue
 | 
			
		||||
		}
 | 
			
		||||
		// CNI requires all config to be presented, although only containerID is needed in this case
 | 
			
		||||
		rt := &libcni.RuntimeConf{
 | 
			
		||||
			ContainerID: containerID,
 | 
			
		||||
			IfName:      network.DefaultInterfaceName,
 | 
			
		||||
			// TODO: How do we find the NetNs of an exited container? docker inspect
 | 
			
		||||
			// doesn't show us the pid, so we probably need to checkpoint
 | 
			
		||||
			NetNS: "",
 | 
			
		||||
		}
 | 
			
		||||
 | 
			
		||||
		glog.V(2).Infof("Releasing IP %q allocated to %q.", ip, containerID)
 | 
			
		||||
		// CNI bridge plugin should try to release IP and then return
 | 
			
		||||
		if err := plugin.cniConfig.DelNetwork(plugin.netConfig, rt); err != nil {
 | 
			
		||||
			glog.Errorf("Error while releasing IP: %v", err)
 | 
			
		||||
		}
 | 
			
		||||
	}
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// podIsExited returns true if the pod is exited (all containers inside are exited).
 | 
			
		||||
func podIsExited(p *kubecontainer.Pod) bool {
 | 
			
		||||
	for _, c := range p.Containers {
 | 
			
		||||
 
 | 
			
		||||
@@ -24,12 +24,10 @@ import (
 | 
			
		||||
	"time"
 | 
			
		||||
 | 
			
		||||
	"github.com/golang/glog"
 | 
			
		||||
	"k8s.io/api/core/v1"
 | 
			
		||||
	metav1 "k8s.io/apimachinery/pkg/apis/meta/v1"
 | 
			
		||||
	utilerrors "k8s.io/apimachinery/pkg/util/errors"
 | 
			
		||||
	utilsets "k8s.io/apimachinery/pkg/util/sets"
 | 
			
		||||
	"k8s.io/apimachinery/pkg/util/validation"
 | 
			
		||||
	clientset "k8s.io/client-go/kubernetes"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/apis/kubeletconfig"
 | 
			
		||||
	kubecontainer "k8s.io/kubernetes/pkg/kubelet/container"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/network/hostport"
 | 
			
		||||
@@ -91,29 +89,6 @@ type PodNetworkStatus struct {
 | 
			
		||||
	IP net.IP `json:"ip" description:"Primary IP address of the pod"`
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// LegacyHost implements the methods required by network plugins that
 | 
			
		||||
// were directly invoked by the kubelet. Implementations of this interface
 | 
			
		||||
// that do not wish to support these features can simply return false
 | 
			
		||||
// to SupportsLegacyFeatures.
 | 
			
		||||
type LegacyHost interface {
 | 
			
		||||
	// Get the pod structure by its name, namespace
 | 
			
		||||
	// Only used for hostport management and bw shaping
 | 
			
		||||
	GetPodByName(namespace, name string) (*v1.Pod, bool)
 | 
			
		||||
 | 
			
		||||
	// GetKubeClient returns a client interface
 | 
			
		||||
	// Only used in testing
 | 
			
		||||
	GetKubeClient() clientset.Interface
 | 
			
		||||
 | 
			
		||||
	// GetContainerRuntime returns the container runtime that implements the containers (e.g. docker/rkt)
 | 
			
		||||
	// Only used for hostport management
 | 
			
		||||
	GetRuntime() kubecontainer.Runtime
 | 
			
		||||
 | 
			
		||||
	// SupportsLegacyFeatures returns true if the network host support GetPodByName, KubeClient interface and kubelet
 | 
			
		||||
	// runtime interface. These interfaces will no longer be implemented by CRI shims.
 | 
			
		||||
	// This function helps network plugins to choose their behavior based on runtime.
 | 
			
		||||
	SupportsLegacyFeatures() bool
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// Host is an interface that plugins can use to access the kubelet.
 | 
			
		||||
// TODO(#35457): get rid of this backchannel to the kubelet. The scope of
 | 
			
		||||
// the back channel is restricted to host-ports/testing, and restricted
 | 
			
		||||
@@ -126,12 +101,6 @@ type Host interface {
 | 
			
		||||
 | 
			
		||||
	// PortMappingGetter is a getter for sandbox port mapping information.
 | 
			
		||||
	PortMappingGetter
 | 
			
		||||
 | 
			
		||||
	// LegacyHost contains methods that trap back into the Kubelet. Dependence
 | 
			
		||||
	// *do not* add more dependencies in this interface. In a post-cri world,
 | 
			
		||||
	// network plugins will be invoked by the runtime shim, and should only
 | 
			
		||||
	// require GetNetNS and GetPodPortMappings.
 | 
			
		||||
	LegacyHost
 | 
			
		||||
}
 | 
			
		||||
 | 
			
		||||
// NamespaceGetter is an interface to retrieve namespace information for a given
 | 
			
		||||
 
 | 
			
		||||
@@ -30,15 +30,12 @@ import (
 | 
			
		||||
	"k8s.io/client-go/kubernetes/fake"
 | 
			
		||||
	"k8s.io/client-go/tools/record"
 | 
			
		||||
	utiltesting "k8s.io/client-go/util/testing"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/apis/kubeletconfig"
 | 
			
		||||
	cadvisortest "k8s.io/kubernetes/pkg/kubelet/cadvisor/testing"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/cm"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/configmap"
 | 
			
		||||
	kubecontainer "k8s.io/kubernetes/pkg/kubelet/container"
 | 
			
		||||
	containertest "k8s.io/kubernetes/pkg/kubelet/container/testing"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/eviction"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/network"
 | 
			
		||||
	nettest "k8s.io/kubernetes/pkg/kubelet/network/testing"
 | 
			
		||||
	kubepod "k8s.io/kubernetes/pkg/kubelet/pod"
 | 
			
		||||
	podtest "k8s.io/kubernetes/pkg/kubelet/pod/testing"
 | 
			
		||||
	"k8s.io/kubernetes/pkg/kubelet/secret"
 | 
			
		||||
@@ -111,7 +108,6 @@ func TestRunOnce(t *testing.T) {
 | 
			
		||||
		false, /* experimentalCheckNodeCapabilitiesBeforeMount */
 | 
			
		||||
		false /* keepTerminatedPodVolumes */)
 | 
			
		||||
 | 
			
		||||
	kb.networkPlugin, _ = network.InitNetworkPlugin([]network.NetworkPlugin{}, "", nettest.NewFakeHost(nil), kubeletconfig.HairpinNone, "", network.UseDefaultMTU)
 | 
			
		||||
	// TODO: Factor out "StatsProvider" from Kubelet so we don't have a cyclic dependency
 | 
			
		||||
	volumeStatsAggPeriod := time.Second * 10
 | 
			
		||||
	kb.resourceAnalyzer = stats.NewResourceAnalyzer(kb, volumeStatsAggPeriod)
 | 
			
		||||
 
 | 
			
		||||
		Reference in New Issue
	
	Block a user