mirror of
https://github.com/optim-enterprises-bv/kubernetes.git
synced 2025-11-07 13:54:19 +00:00
Update hcsshim and gowinio for Windows Overlay
This commit is contained in:
274
vendor/github.com/Microsoft/go-winio/ea.go
generated
vendored
274
vendor/github.com/Microsoft/go-winio/ea.go
generated
vendored
@@ -1,137 +1,137 @@
|
||||
package winio
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"encoding/binary"
|
||||
"errors"
|
||||
)
|
||||
|
||||
type fileFullEaInformation struct {
|
||||
NextEntryOffset uint32
|
||||
Flags uint8
|
||||
NameLength uint8
|
||||
ValueLength uint16
|
||||
}
|
||||
|
||||
var (
|
||||
fileFullEaInformationSize = binary.Size(&fileFullEaInformation{})
|
||||
|
||||
errInvalidEaBuffer = errors.New("invalid extended attribute buffer")
|
||||
errEaNameTooLarge = errors.New("extended attribute name too large")
|
||||
errEaValueTooLarge = errors.New("extended attribute value too large")
|
||||
)
|
||||
|
||||
// ExtendedAttribute represents a single Windows EA.
|
||||
type ExtendedAttribute struct {
|
||||
Name string
|
||||
Value []byte
|
||||
Flags uint8
|
||||
}
|
||||
|
||||
func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) {
|
||||
var info fileFullEaInformation
|
||||
err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info)
|
||||
if err != nil {
|
||||
err = errInvalidEaBuffer
|
||||
return
|
||||
}
|
||||
|
||||
nameOffset := fileFullEaInformationSize
|
||||
nameLen := int(info.NameLength)
|
||||
valueOffset := nameOffset + int(info.NameLength) + 1
|
||||
valueLen := int(info.ValueLength)
|
||||
nextOffset := int(info.NextEntryOffset)
|
||||
if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) {
|
||||
err = errInvalidEaBuffer
|
||||
return
|
||||
}
|
||||
|
||||
ea.Name = string(b[nameOffset : nameOffset+nameLen])
|
||||
ea.Value = b[valueOffset : valueOffset+valueLen]
|
||||
ea.Flags = info.Flags
|
||||
if info.NextEntryOffset != 0 {
|
||||
nb = b[info.NextEntryOffset:]
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION
|
||||
// buffer retrieved from BackupRead, ZwQueryEaFile, etc.
|
||||
func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) {
|
||||
for len(b) != 0 {
|
||||
ea, nb, err := parseEa(b)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
eas = append(eas, ea)
|
||||
b = nb
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error {
|
||||
if int(uint8(len(ea.Name))) != len(ea.Name) {
|
||||
return errEaNameTooLarge
|
||||
}
|
||||
if int(uint16(len(ea.Value))) != len(ea.Value) {
|
||||
return errEaValueTooLarge
|
||||
}
|
||||
entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value))
|
||||
withPadding := (entrySize + 3) &^ 3
|
||||
nextOffset := uint32(0)
|
||||
if !last {
|
||||
nextOffset = withPadding
|
||||
}
|
||||
info := fileFullEaInformation{
|
||||
NextEntryOffset: nextOffset,
|
||||
Flags: ea.Flags,
|
||||
NameLength: uint8(len(ea.Name)),
|
||||
ValueLength: uint16(len(ea.Value)),
|
||||
}
|
||||
|
||||
err := binary.Write(buf, binary.LittleEndian, &info)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err = buf.Write([]byte(ea.Name))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
err = buf.WriteByte(0)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err = buf.Write(ea.Value)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize])
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION
|
||||
// buffer for use with BackupWrite, ZwSetEaFile, etc.
|
||||
func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) {
|
||||
var buf bytes.Buffer
|
||||
for i := range eas {
|
||||
last := false
|
||||
if i == len(eas)-1 {
|
||||
last = true
|
||||
}
|
||||
|
||||
err := writeEa(&buf, &eas[i], last)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
return buf.Bytes(), nil
|
||||
}
|
||||
package winio
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"encoding/binary"
|
||||
"errors"
|
||||
)
|
||||
|
||||
type fileFullEaInformation struct {
|
||||
NextEntryOffset uint32
|
||||
Flags uint8
|
||||
NameLength uint8
|
||||
ValueLength uint16
|
||||
}
|
||||
|
||||
var (
|
||||
fileFullEaInformationSize = binary.Size(&fileFullEaInformation{})
|
||||
|
||||
errInvalidEaBuffer = errors.New("invalid extended attribute buffer")
|
||||
errEaNameTooLarge = errors.New("extended attribute name too large")
|
||||
errEaValueTooLarge = errors.New("extended attribute value too large")
|
||||
)
|
||||
|
||||
// ExtendedAttribute represents a single Windows EA.
|
||||
type ExtendedAttribute struct {
|
||||
Name string
|
||||
Value []byte
|
||||
Flags uint8
|
||||
}
|
||||
|
||||
func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) {
|
||||
var info fileFullEaInformation
|
||||
err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info)
|
||||
if err != nil {
|
||||
err = errInvalidEaBuffer
|
||||
return
|
||||
}
|
||||
|
||||
nameOffset := fileFullEaInformationSize
|
||||
nameLen := int(info.NameLength)
|
||||
valueOffset := nameOffset + int(info.NameLength) + 1
|
||||
valueLen := int(info.ValueLength)
|
||||
nextOffset := int(info.NextEntryOffset)
|
||||
if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) {
|
||||
err = errInvalidEaBuffer
|
||||
return
|
||||
}
|
||||
|
||||
ea.Name = string(b[nameOffset : nameOffset+nameLen])
|
||||
ea.Value = b[valueOffset : valueOffset+valueLen]
|
||||
ea.Flags = info.Flags
|
||||
if info.NextEntryOffset != 0 {
|
||||
nb = b[info.NextEntryOffset:]
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION
|
||||
// buffer retrieved from BackupRead, ZwQueryEaFile, etc.
|
||||
func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) {
|
||||
for len(b) != 0 {
|
||||
ea, nb, err := parseEa(b)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
eas = append(eas, ea)
|
||||
b = nb
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error {
|
||||
if int(uint8(len(ea.Name))) != len(ea.Name) {
|
||||
return errEaNameTooLarge
|
||||
}
|
||||
if int(uint16(len(ea.Value))) != len(ea.Value) {
|
||||
return errEaValueTooLarge
|
||||
}
|
||||
entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value))
|
||||
withPadding := (entrySize + 3) &^ 3
|
||||
nextOffset := uint32(0)
|
||||
if !last {
|
||||
nextOffset = withPadding
|
||||
}
|
||||
info := fileFullEaInformation{
|
||||
NextEntryOffset: nextOffset,
|
||||
Flags: ea.Flags,
|
||||
NameLength: uint8(len(ea.Name)),
|
||||
ValueLength: uint16(len(ea.Value)),
|
||||
}
|
||||
|
||||
err := binary.Write(buf, binary.LittleEndian, &info)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err = buf.Write([]byte(ea.Name))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
err = buf.WriteByte(0)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err = buf.Write(ea.Value)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize])
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION
|
||||
// buffer for use with BackupWrite, ZwSetEaFile, etc.
|
||||
func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) {
|
||||
var buf bytes.Buffer
|
||||
for i := range eas {
|
||||
last := false
|
||||
if i == len(eas)-1 {
|
||||
last = true
|
||||
}
|
||||
|
||||
err := writeEa(&buf, &eas[i], last)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
return buf.Bytes(), nil
|
||||
}
|
||||
|
||||
3
vendor/github.com/Microsoft/go-winio/file.go
generated
vendored
3
vendor/github.com/Microsoft/go-winio/file.go
generated
vendored
@@ -16,7 +16,6 @@ import (
|
||||
//sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort
|
||||
//sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus
|
||||
//sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes
|
||||
//sys timeBeginPeriod(period uint32) (n int32) = winmm.timeBeginPeriod
|
||||
|
||||
type atomicBool int32
|
||||
|
||||
@@ -153,8 +152,6 @@ func (f *win32File) prepareIo() (*ioOperation, error) {
|
||||
|
||||
// ioCompletionProcessor processes completed async IOs forever
|
||||
func ioCompletionProcessor(h syscall.Handle) {
|
||||
// Set the timer resolution to 1. This fixes a performance regression in golang 1.6.
|
||||
timeBeginPeriod(1)
|
||||
for {
|
||||
var bytes uint32
|
||||
var key uintptr
|
||||
|
||||
3
vendor/github.com/Microsoft/go-winio/fileinfo.go
generated
vendored
3
vendor/github.com/Microsoft/go-winio/fileinfo.go
generated
vendored
@@ -20,7 +20,8 @@ const (
|
||||
// FileBasicInfo contains file access time and file attributes information.
|
||||
type FileBasicInfo struct {
|
||||
CreationTime, LastAccessTime, LastWriteTime, ChangeTime syscall.Filetime
|
||||
FileAttributes uintptr // includes padding
|
||||
FileAttributes uint32
|
||||
pad uint32 // padding
|
||||
}
|
||||
|
||||
// GetFileBasicInfo retrieves times and attributes for a file.
|
||||
|
||||
121
vendor/github.com/Microsoft/go-winio/pipe.go
generated
vendored
121
vendor/github.com/Microsoft/go-winio/pipe.go
generated
vendored
@@ -15,13 +15,13 @@ import (
|
||||
//sys connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) = ConnectNamedPipe
|
||||
//sys createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateNamedPipeW
|
||||
//sys createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateFileW
|
||||
//sys waitNamedPipe(name string, timeout uint32) (err error) = WaitNamedPipeW
|
||||
//sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo
|
||||
//sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW
|
||||
//sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc
|
||||
|
||||
const (
|
||||
cERROR_PIPE_BUSY = syscall.Errno(231)
|
||||
cERROR_NO_DATA = syscall.Errno(232)
|
||||
cERROR_PIPE_CONNECTED = syscall.Errno(535)
|
||||
cERROR_SEM_TIMEOUT = syscall.Errno(121)
|
||||
|
||||
@@ -120,6 +120,11 @@ func (f *win32MessageBytePipe) Read(b []byte) (int, error) {
|
||||
// zero-byte message, ensure that all future Read() calls
|
||||
// also return EOF.
|
||||
f.readEOF = true
|
||||
} else if err == syscall.ERROR_MORE_DATA {
|
||||
// ERROR_MORE_DATA indicates that the pipe's read mode is message mode
|
||||
// and the message still has more bytes. Treat this as a success, since
|
||||
// this package presents all named pipes as byte streams.
|
||||
err = nil
|
||||
}
|
||||
return n, err
|
||||
}
|
||||
@@ -133,12 +138,14 @@ func (s pipeAddress) String() string {
|
||||
}
|
||||
|
||||
// DialPipe connects to a named pipe by path, timing out if the connection
|
||||
// takes longer than the specified duration. If timeout is nil, then the timeout
|
||||
// is the default timeout established by the pipe server.
|
||||
// takes longer than the specified duration. If timeout is nil, then we use
|
||||
// a default timeout of 5 seconds. (We do not use WaitNamedPipe.)
|
||||
func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
|
||||
var absTimeout time.Time
|
||||
if timeout != nil {
|
||||
absTimeout = time.Now().Add(*timeout)
|
||||
} else {
|
||||
absTimeout = time.Now().Add(time.Second * 2)
|
||||
}
|
||||
var err error
|
||||
var h syscall.Handle
|
||||
@@ -147,22 +154,13 @@ func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
|
||||
if err != cERROR_PIPE_BUSY {
|
||||
break
|
||||
}
|
||||
now := time.Now()
|
||||
var ms uint32
|
||||
if absTimeout.IsZero() {
|
||||
ms = cNMPWAIT_USE_DEFAULT_WAIT
|
||||
} else if now.After(absTimeout) {
|
||||
ms = cNMPWAIT_NOWAIT
|
||||
} else {
|
||||
ms = uint32(absTimeout.Sub(now).Nanoseconds() / 1000 / 1000)
|
||||
}
|
||||
err = waitNamedPipe(path, ms)
|
||||
if err != nil {
|
||||
if err == cERROR_SEM_TIMEOUT {
|
||||
return nil, ErrTimeout
|
||||
}
|
||||
break
|
||||
if time.Now().After(absTimeout) {
|
||||
return nil, ErrTimeout
|
||||
}
|
||||
|
||||
// Wait 10 msec and try again. This is a rather simplistic
|
||||
// view, as we always try each 10 milliseconds.
|
||||
time.Sleep(time.Millisecond * 10)
|
||||
}
|
||||
if err != nil {
|
||||
return nil, &os.PathError{Op: "open", Path: path, Err: err}
|
||||
@@ -174,16 +172,6 @@ func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
var state uint32
|
||||
err = getNamedPipeHandleState(h, &state, nil, nil, nil, nil, 0)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if state&cPIPE_READMODE_MESSAGE != 0 {
|
||||
return nil, &os.PathError{Op: "open", Path: path, Err: errors.New("message readmode pipes not supported")}
|
||||
}
|
||||
|
||||
f, err := makeWin32File(h)
|
||||
if err != nil {
|
||||
syscall.Close(h)
|
||||
@@ -254,6 +242,36 @@ func (l *win32PipeListener) makeServerPipe() (*win32File, error) {
|
||||
return f, nil
|
||||
}
|
||||
|
||||
func (l *win32PipeListener) makeConnectedServerPipe() (*win32File, error) {
|
||||
p, err := l.makeServerPipe()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// Wait for the client to connect.
|
||||
ch := make(chan error)
|
||||
go func(p *win32File) {
|
||||
ch <- connectPipe(p)
|
||||
}(p)
|
||||
|
||||
select {
|
||||
case err = <-ch:
|
||||
if err != nil {
|
||||
p.Close()
|
||||
p = nil
|
||||
}
|
||||
case <-l.closeCh:
|
||||
// Abort the connect request by closing the handle.
|
||||
p.Close()
|
||||
p = nil
|
||||
err = <-ch
|
||||
if err == nil || err == ErrFileClosed {
|
||||
err = ErrPipeListenerClosed
|
||||
}
|
||||
}
|
||||
return p, err
|
||||
}
|
||||
|
||||
func (l *win32PipeListener) listenerRoutine() {
|
||||
closed := false
|
||||
for !closed {
|
||||
@@ -261,31 +279,20 @@ func (l *win32PipeListener) listenerRoutine() {
|
||||
case <-l.closeCh:
|
||||
closed = true
|
||||
case responseCh := <-l.acceptCh:
|
||||
p, err := l.makeServerPipe()
|
||||
if err == nil {
|
||||
// Wait for the client to connect.
|
||||
ch := make(chan error)
|
||||
go func(p *win32File) {
|
||||
ch <- connectPipe(p)
|
||||
}(p)
|
||||
select {
|
||||
case err = <-ch:
|
||||
if err != nil {
|
||||
p.Close()
|
||||
p = nil
|
||||
}
|
||||
case <-l.closeCh:
|
||||
// Abort the connect request by closing the handle.
|
||||
p.Close()
|
||||
p = nil
|
||||
err = <-ch
|
||||
if err == nil || err == ErrFileClosed {
|
||||
err = ErrPipeListenerClosed
|
||||
}
|
||||
closed = true
|
||||
var (
|
||||
p *win32File
|
||||
err error
|
||||
)
|
||||
for {
|
||||
p, err = l.makeConnectedServerPipe()
|
||||
// If the connection was immediately closed by the client, try
|
||||
// again.
|
||||
if err != cERROR_NO_DATA {
|
||||
break
|
||||
}
|
||||
}
|
||||
responseCh <- acceptResponse{p, err}
|
||||
closed = err == ErrPipeListenerClosed
|
||||
}
|
||||
}
|
||||
syscall.Close(l.firstHandle)
|
||||
@@ -334,13 +341,23 @@ func ListenPipe(path string, c *PipeConfig) (net.Listener, error) {
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Immediately open and then close a client handle so that the named pipe is
|
||||
// created but not currently accepting connections.
|
||||
// Create a client handle and connect it. This results in the pipe
|
||||
// instance always existing, so that clients see ERROR_PIPE_BUSY
|
||||
// rather than ERROR_FILE_NOT_FOUND. This ties the first instance
|
||||
// up so that no other instances can be used. This would have been
|
||||
// cleaner if the Win32 API matched CreateFile with ConnectNamedPipe
|
||||
// instead of CreateNamedPipe. (Apparently created named pipes are
|
||||
// considered to be in listening state regardless of whether any
|
||||
// active calls to ConnectNamedPipe are outstanding.)
|
||||
h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
|
||||
if err != nil {
|
||||
syscall.Close(h)
|
||||
return nil, err
|
||||
}
|
||||
// Close the client handle. The server side of the instance will
|
||||
// still be busy, leading to ERROR_PIPE_BUSY instead of
|
||||
// ERROR_NOT_FOUND, as long as we don't close the server handle,
|
||||
// or disconnect the client with DisconnectNamedPipe.
|
||||
syscall.Close(h2)
|
||||
l := &win32PipeListener{
|
||||
firstHandle: h,
|
||||
|
||||
8
vendor/github.com/Microsoft/go-winio/zsyscall_windows.go
generated
vendored
8
vendor/github.com/Microsoft/go-winio/zsyscall_windows.go
generated
vendored
@@ -38,14 +38,12 @@ func errnoErr(e syscall.Errno) error {
|
||||
|
||||
var (
|
||||
modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
|
||||
modwinmm = windows.NewLazySystemDLL("winmm.dll")
|
||||
modadvapi32 = windows.NewLazySystemDLL("advapi32.dll")
|
||||
|
||||
procCancelIoEx = modkernel32.NewProc("CancelIoEx")
|
||||
procCreateIoCompletionPort = modkernel32.NewProc("CreateIoCompletionPort")
|
||||
procGetQueuedCompletionStatus = modkernel32.NewProc("GetQueuedCompletionStatus")
|
||||
procSetFileCompletionNotificationModes = modkernel32.NewProc("SetFileCompletionNotificationModes")
|
||||
proctimeBeginPeriod = modwinmm.NewProc("timeBeginPeriod")
|
||||
procConnectNamedPipe = modkernel32.NewProc("ConnectNamedPipe")
|
||||
procCreateNamedPipeW = modkernel32.NewProc("CreateNamedPipeW")
|
||||
procCreateFileW = modkernel32.NewProc("CreateFileW")
|
||||
@@ -122,12 +120,6 @@ func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err erro
|
||||
return
|
||||
}
|
||||
|
||||
func timeBeginPeriod(period uint32) (n int32) {
|
||||
r0, _, _ := syscall.Syscall(proctimeBeginPeriod.Addr(), 1, uintptr(period), 0, 0)
|
||||
n = int32(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0)
|
||||
if r1 == 0 {
|
||||
|
||||
1
vendor/github.com/Microsoft/hcsshim/.gitignore
generated
vendored
Normal file
1
vendor/github.com/Microsoft/hcsshim/.gitignore
generated
vendored
Normal file
@@ -0,0 +1 @@
|
||||
*.exe
|
||||
17
vendor/github.com/Microsoft/hcsshim/.gometalinter.json
generated
vendored
Normal file
17
vendor/github.com/Microsoft/hcsshim/.gometalinter.json
generated
vendored
Normal file
@@ -0,0 +1,17 @@
|
||||
{
|
||||
"Vendor": true,
|
||||
"Deadline": "2m",
|
||||
"Sort": [
|
||||
"linter",
|
||||
"severity",
|
||||
"path",
|
||||
"line"
|
||||
],
|
||||
"Skip": [
|
||||
"internal\\schema2"
|
||||
],
|
||||
"EnableGC": true,
|
||||
"Enable": [
|
||||
"gofmt"
|
||||
]
|
||||
}
|
||||
73
vendor/github.com/Microsoft/hcsshim/BUILD
generated
vendored
73
vendor/github.com/Microsoft/hcsshim/BUILD
generated
vendored
@@ -3,54 +3,37 @@ load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = [
|
||||
"activatelayer.go",
|
||||
"baselayer.go",
|
||||
"callback.go",
|
||||
"cgo.go",
|
||||
"container.go",
|
||||
"createlayer.go",
|
||||
"createsandboxlayer.go",
|
||||
"deactivatelayer.go",
|
||||
"destroylayer.go",
|
||||
"errors.go",
|
||||
"expandsandboxsize.go",
|
||||
"exportlayer.go",
|
||||
"getlayermountpath.go",
|
||||
"getsharedbaseimages.go",
|
||||
"guid.go",
|
||||
"hcsshim.go",
|
||||
"hnsendpoint.go",
|
||||
"hnsfuncs.go",
|
||||
"hnsglobals.go",
|
||||
"hnsnetwork.go",
|
||||
"hnspolicy.go",
|
||||
"hnspolicylist.go",
|
||||
"importlayer.go",
|
||||
"hnssupport.go",
|
||||
"interface.go",
|
||||
"layerexists.go",
|
||||
"layerutils.go",
|
||||
"legacy.go",
|
||||
"legacy18.go",
|
||||
"legacy19.go",
|
||||
"nametoguid.go",
|
||||
"preparelayer.go",
|
||||
"layer.go",
|
||||
"process.go",
|
||||
"processimage.go",
|
||||
"safeopen.go",
|
||||
"unpreparelayer.go",
|
||||
"utils.go",
|
||||
"version.go",
|
||||
"waithelper.go",
|
||||
"zhcsshim.go",
|
||||
"zsyscall_windows.go",
|
||||
],
|
||||
cgo = True,
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim",
|
||||
importpath = "github.com/Microsoft/hcsshim",
|
||||
visibility = ["//visibility:public"],
|
||||
deps = [
|
||||
"//vendor/github.com/Microsoft/go-winio:go_default_library",
|
||||
"//vendor/github.com/sirupsen/logrus:go_default_library",
|
||||
"//vendor/golang.org/x/sys/windows:go_default_library",
|
||||
],
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/guid:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/hcs:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/hcserror:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/hns:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/mergemaps:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/schema1:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/wclayer:go_default_library",
|
||||
] + select({
|
||||
"@io_bazel_rules_go//go/platform:windows": [
|
||||
"//vendor/golang.org/x/sys/windows:go_default_library",
|
||||
],
|
||||
"//conditions:default": [],
|
||||
}),
|
||||
)
|
||||
|
||||
filegroup(
|
||||
@@ -62,7 +45,27 @@ filegroup(
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
srcs = [
|
||||
":package-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/hcn:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/cni:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/guestrequest:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/guid:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/hcs:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/hcserror:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/hns:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/interop:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/logfields:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/longpath:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/mergemaps:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/regstate:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/runhcs:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/safefile:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/schema1:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/schema2:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/timeout:all-srcs",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/wclayer:all-srcs",
|
||||
],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
|
||||
18
vendor/github.com/Microsoft/hcsshim/README.md
generated
vendored
18
vendor/github.com/Microsoft/hcsshim/README.md
generated
vendored
@@ -1,12 +1,13 @@
|
||||
# hcsshim
|
||||
|
||||
This package supports launching Windows Server containers from Go. It is
|
||||
primarily used in the [Docker Engine](https://github.com/docker/docker) project,
|
||||
but it can be freely used by other projects as well.
|
||||
[](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master)
|
||||
|
||||
This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS).
|
||||
|
||||
It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well.
|
||||
|
||||
## Contributing
|
||||
---------------
|
||||
|
||||
This project welcomes contributions and suggestions. Most contributions require you to agree to a
|
||||
Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us
|
||||
the rights to use your contribution. For details, visit https://cla.microsoft.com.
|
||||
@@ -19,6 +20,11 @@ This project has adopted the [Microsoft Open Source Code of Conduct](https://ope
|
||||
For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or
|
||||
contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments.
|
||||
|
||||
## Dependencies
|
||||
|
||||
This project requires Golang 1.9 or newer to build.
|
||||
|
||||
For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements).
|
||||
|
||||
## Reporting Security Issues
|
||||
|
||||
@@ -29,5 +35,7 @@ email to ensure we received your original message. Further information, includin
|
||||
[MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in
|
||||
the [Security TechCenter](https://technet.microsoft.com/en-us/security/default).
|
||||
|
||||
-------------------------------------------
|
||||
For additional details, see [Report a Computer Security Vulnerability](https://technet.microsoft.com/en-us/security/ff852094.aspx) on Technet
|
||||
|
||||
---------------
|
||||
Copyright (c) 2018 Microsoft Corp. All rights reserved.
|
||||
|
||||
28
vendor/github.com/Microsoft/hcsshim/activatelayer.go
generated
vendored
28
vendor/github.com/Microsoft/hcsshim/activatelayer.go
generated
vendored
@@ -1,28 +0,0 @@
|
||||
package hcsshim
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
// ActivateLayer will find the layer with the given id and mount it's filesystem.
|
||||
// For a read/write layer, the mounted filesystem will appear as a volume on the
|
||||
// host, while a read-only layer is generally expected to be a no-op.
|
||||
// An activated layer must later be deactivated via DeactivateLayer.
|
||||
func ActivateLayer(info DriverInfo, id string) error {
|
||||
title := "hcsshim::ActivateLayer "
|
||||
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
|
||||
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = activateLayer(&infop, id)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" - succeeded id=%s flavour=%d", id, info.Flavour)
|
||||
return nil
|
||||
}
|
||||
28
vendor/github.com/Microsoft/hcsshim/appveyor.yml
generated
vendored
Normal file
28
vendor/github.com/Microsoft/hcsshim/appveyor.yml
generated
vendored
Normal file
@@ -0,0 +1,28 @@
|
||||
version: 0.1.{build}
|
||||
|
||||
image: Visual Studio 2017
|
||||
|
||||
clone_folder: c:\gopath\src\github.com\Microsoft\hcsshim
|
||||
|
||||
environment:
|
||||
GOPATH: c:\gopath
|
||||
PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%GOPATH%\bin;%PATH%
|
||||
|
||||
build_script:
|
||||
- go get -u github.com/alecthomas/gometalinter
|
||||
- gometalinter.exe --install
|
||||
- gometalinter.exe --config .gometalinter.json ./...
|
||||
- go get -v -d -t -tags "functional integration admin" ./...
|
||||
- go build ./cmd/wclayer
|
||||
- go build ./cmd/runhcs
|
||||
- go build ./cmd/tar2ext4
|
||||
- go test -v ./... -tags admin
|
||||
- go test -c ./test/functional/ -tags functional
|
||||
- go test -c ./test/runhcs/ -tags integration
|
||||
|
||||
artifacts:
|
||||
- path: 'wclayer.exe'
|
||||
- path: 'runhcs.exe'
|
||||
- path: 'tar2ext4.exe'
|
||||
- path: 'functional.test.exe'
|
||||
- path: 'runhcs.test.exe'
|
||||
79
vendor/github.com/Microsoft/hcsshim/callback.go
generated
vendored
79
vendor/github.com/Microsoft/hcsshim/callback.go
generated
vendored
@@ -1,79 +0,0 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"sync"
|
||||
"syscall"
|
||||
)
|
||||
|
||||
var (
|
||||
nextCallback uintptr
|
||||
callbackMap = map[uintptr]*notifcationWatcherContext{}
|
||||
callbackMapLock = sync.RWMutex{}
|
||||
|
||||
notificationWatcherCallback = syscall.NewCallback(notificationWatcher)
|
||||
|
||||
// Notifications for HCS_SYSTEM handles
|
||||
hcsNotificationSystemExited hcsNotification = 0x00000001
|
||||
hcsNotificationSystemCreateCompleted hcsNotification = 0x00000002
|
||||
hcsNotificationSystemStartCompleted hcsNotification = 0x00000003
|
||||
hcsNotificationSystemPauseCompleted hcsNotification = 0x00000004
|
||||
hcsNotificationSystemResumeCompleted hcsNotification = 0x00000005
|
||||
|
||||
// Notifications for HCS_PROCESS handles
|
||||
hcsNotificationProcessExited hcsNotification = 0x00010000
|
||||
|
||||
// Common notifications
|
||||
hcsNotificationInvalid hcsNotification = 0x00000000
|
||||
hcsNotificationServiceDisconnect hcsNotification = 0x01000000
|
||||
)
|
||||
|
||||
type hcsNotification uint32
|
||||
type notificationChannel chan error
|
||||
|
||||
type notifcationWatcherContext struct {
|
||||
channels notificationChannels
|
||||
handle hcsCallback
|
||||
}
|
||||
|
||||
type notificationChannels map[hcsNotification]notificationChannel
|
||||
|
||||
func newChannels() notificationChannels {
|
||||
channels := make(notificationChannels)
|
||||
|
||||
channels[hcsNotificationSystemExited] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationProcessExited] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1)
|
||||
return channels
|
||||
}
|
||||
func closeChannels(channels notificationChannels) {
|
||||
close(channels[hcsNotificationSystemExited])
|
||||
close(channels[hcsNotificationSystemCreateCompleted])
|
||||
close(channels[hcsNotificationSystemStartCompleted])
|
||||
close(channels[hcsNotificationSystemPauseCompleted])
|
||||
close(channels[hcsNotificationSystemResumeCompleted])
|
||||
close(channels[hcsNotificationProcessExited])
|
||||
close(channels[hcsNotificationServiceDisconnect])
|
||||
}
|
||||
|
||||
func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr {
|
||||
var result error
|
||||
if int32(notificationStatus) < 0 {
|
||||
result = syscall.Errno(win32FromHresult(notificationStatus))
|
||||
}
|
||||
|
||||
callbackMapLock.RLock()
|
||||
context := callbackMap[callbackNumber]
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
if context == nil {
|
||||
return 0
|
||||
}
|
||||
|
||||
context.channels[notificationType] <- result
|
||||
|
||||
return 0
|
||||
}
|
||||
748
vendor/github.com/Microsoft/hcsshim/container.go
generated
vendored
748
vendor/github.com/Microsoft/hcsshim/container.go
generated
vendored
@@ -1,800 +1,192 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"os"
|
||||
"sync"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/hcs"
|
||||
"github.com/Microsoft/hcsshim/internal/mergemaps"
|
||||
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||
)
|
||||
|
||||
var (
|
||||
defaultTimeout = time.Minute * 4
|
||||
)
|
||||
|
||||
const (
|
||||
pendingUpdatesQuery = `{ "PropertyTypes" : ["PendingUpdates"]}`
|
||||
statisticsQuery = `{ "PropertyTypes" : ["Statistics"]}`
|
||||
processListQuery = `{ "PropertyTypes" : ["ProcessList"]}`
|
||||
mappedVirtualDiskQuery = `{ "PropertyTypes" : ["MappedVirtualDisk"]}`
|
||||
)
|
||||
|
||||
type container struct {
|
||||
handleLock sync.RWMutex
|
||||
handle hcsSystem
|
||||
id string
|
||||
callbackNumber uintptr
|
||||
}
|
||||
|
||||
// ContainerProperties holds the properties for a container and the processes running in that container
|
||||
type ContainerProperties struct {
|
||||
ID string `json:"Id"`
|
||||
Name string
|
||||
SystemType string
|
||||
Owner string
|
||||
SiloGUID string `json:"SiloGuid,omitempty"`
|
||||
RuntimeID string `json:"RuntimeId,omitempty"`
|
||||
IsRuntimeTemplate bool `json:",omitempty"`
|
||||
RuntimeImagePath string `json:",omitempty"`
|
||||
Stopped bool `json:",omitempty"`
|
||||
ExitType string `json:",omitempty"`
|
||||
AreUpdatesPending bool `json:",omitempty"`
|
||||
ObRoot string `json:",omitempty"`
|
||||
Statistics Statistics `json:",omitempty"`
|
||||
ProcessList []ProcessListItem `json:",omitempty"`
|
||||
MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
|
||||
}
|
||||
type ContainerProperties = schema1.ContainerProperties
|
||||
|
||||
// MemoryStats holds the memory statistics for a container
|
||||
type MemoryStats struct {
|
||||
UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"`
|
||||
UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
|
||||
UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
|
||||
}
|
||||
type MemoryStats = schema1.MemoryStats
|
||||
|
||||
// ProcessorStats holds the processor statistics for a container
|
||||
type ProcessorStats struct {
|
||||
TotalRuntime100ns uint64 `json:",omitempty"`
|
||||
RuntimeUser100ns uint64 `json:",omitempty"`
|
||||
RuntimeKernel100ns uint64 `json:",omitempty"`
|
||||
}
|
||||
type ProcessorStats = schema1.ProcessorStats
|
||||
|
||||
// StorageStats holds the storage statistics for a container
|
||||
type StorageStats struct {
|
||||
ReadCountNormalized uint64 `json:",omitempty"`
|
||||
ReadSizeBytes uint64 `json:",omitempty"`
|
||||
WriteCountNormalized uint64 `json:",omitempty"`
|
||||
WriteSizeBytes uint64 `json:",omitempty"`
|
||||
}
|
||||
type StorageStats = schema1.StorageStats
|
||||
|
||||
// NetworkStats holds the network statistics for a container
|
||||
type NetworkStats struct {
|
||||
BytesReceived uint64 `json:",omitempty"`
|
||||
BytesSent uint64 `json:",omitempty"`
|
||||
PacketsReceived uint64 `json:",omitempty"`
|
||||
PacketsSent uint64 `json:",omitempty"`
|
||||
DroppedPacketsIncoming uint64 `json:",omitempty"`
|
||||
DroppedPacketsOutgoing uint64 `json:",omitempty"`
|
||||
EndpointId string `json:",omitempty"`
|
||||
InstanceId string `json:",omitempty"`
|
||||
}
|
||||
type NetworkStats = schema1.NetworkStats
|
||||
|
||||
// Statistics is the structure returned by a statistics call on a container
|
||||
type Statistics struct {
|
||||
Timestamp time.Time `json:",omitempty"`
|
||||
ContainerStartTime time.Time `json:",omitempty"`
|
||||
Uptime100ns uint64 `json:",omitempty"`
|
||||
Memory MemoryStats `json:",omitempty"`
|
||||
Processor ProcessorStats `json:",omitempty"`
|
||||
Storage StorageStats `json:",omitempty"`
|
||||
Network []NetworkStats `json:",omitempty"`
|
||||
}
|
||||
type Statistics = schema1.Statistics
|
||||
|
||||
// ProcessList is the structure of an item returned by a ProcessList call on a container
|
||||
type ProcessListItem struct {
|
||||
CreateTimestamp time.Time `json:",omitempty"`
|
||||
ImageName string `json:",omitempty"`
|
||||
KernelTime100ns uint64 `json:",omitempty"`
|
||||
MemoryCommitBytes uint64 `json:",omitempty"`
|
||||
MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"`
|
||||
MemoryWorkingSetSharedBytes uint64 `json:",omitempty"`
|
||||
ProcessId uint32 `json:",omitempty"`
|
||||
UserTime100ns uint64 `json:",omitempty"`
|
||||
}
|
||||
type ProcessListItem = schema1.ProcessListItem
|
||||
|
||||
// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
|
||||
type MappedVirtualDiskController struct {
|
||||
MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
|
||||
}
|
||||
type MappedVirtualDiskController = schema1.MappedVirtualDiskController
|
||||
|
||||
// Type of Request Support in ModifySystem
|
||||
type RequestType string
|
||||
type RequestType = schema1.RequestType
|
||||
|
||||
// Type of Resource Support in ModifySystem
|
||||
type ResourceType string
|
||||
type ResourceType = schema1.ResourceType
|
||||
|
||||
// RequestType const
|
||||
const (
|
||||
Add RequestType = "Add"
|
||||
Remove RequestType = "Remove"
|
||||
Network ResourceType = "Network"
|
||||
Add = schema1.Add
|
||||
Remove = schema1.Remove
|
||||
Network = schema1.Network
|
||||
)
|
||||
|
||||
// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
|
||||
// Supported resource types are Network and Request Types are Add/Remove
|
||||
type ResourceModificationRequestResponse struct {
|
||||
Resource ResourceType `json:"ResourceType"`
|
||||
Data interface{} `json:"Settings"`
|
||||
Request RequestType `json:"RequestType,omitempty"`
|
||||
type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
|
||||
|
||||
type container struct {
|
||||
system *hcs.System
|
||||
}
|
||||
|
||||
// createContainerAdditionalJSON is read from the environment at initialisation
|
||||
// createComputeSystemAdditionalJSON is read from the environment at initialisation
|
||||
// time. It allows an environment variable to define additional JSON which
|
||||
// is merged in the CreateContainer call to HCS.
|
||||
var createContainerAdditionalJSON string
|
||||
// is merged in the CreateComputeSystem call to HCS.
|
||||
var createContainerAdditionalJSON []byte
|
||||
|
||||
func init() {
|
||||
createContainerAdditionalJSON = os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON")
|
||||
createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON"))
|
||||
}
|
||||
|
||||
// CreateContainer creates a new container with the given configuration but does not start it.
|
||||
func CreateContainer(id string, c *ContainerConfig) (Container, error) {
|
||||
return createContainerWithJSON(id, c, "")
|
||||
}
|
||||
|
||||
// CreateContainerWithJSON creates a new container with the given configuration but does not start it.
|
||||
// It is identical to CreateContainer except that optional additional JSON can be merged before passing to HCS.
|
||||
func CreateContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) {
|
||||
return createContainerWithJSON(id, c, additionalJSON)
|
||||
}
|
||||
|
||||
func createContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) {
|
||||
operation := "CreateContainer"
|
||||
title := "HCSShim::" + operation
|
||||
|
||||
container := &container{
|
||||
id: id,
|
||||
fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
|
||||
}
|
||||
|
||||
configurationb, err := json.Marshal(c)
|
||||
system, err := hcs.CreateComputeSystem(id, fullConfig)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
configuration := string(configurationb)
|
||||
logrus.Debugf(title+" id=%s config=%s", id, configuration)
|
||||
|
||||
// Merge any additional JSON. Priority is given to what is passed in explicitly,
|
||||
// falling back to what's set in the environment.
|
||||
if additionalJSON == "" && createContainerAdditionalJSON != "" {
|
||||
additionalJSON = createContainerAdditionalJSON
|
||||
}
|
||||
if additionalJSON != "" {
|
||||
configurationMap := map[string]interface{}{}
|
||||
if err := json.Unmarshal([]byte(configuration), &configurationMap); err != nil {
|
||||
return nil, fmt.Errorf("failed to unmarshal %s: %s", configuration, err)
|
||||
}
|
||||
|
||||
additionalMap := map[string]interface{}{}
|
||||
if err := json.Unmarshal([]byte(additionalJSON), &additionalMap); err != nil {
|
||||
return nil, fmt.Errorf("failed to unmarshal %s: %s", additionalJSON, err)
|
||||
}
|
||||
|
||||
mergedMap := mergeMaps(additionalMap, configurationMap)
|
||||
mergedJSON, err := json.Marshal(mergedMap)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to marshal merged configuration map %+v: %s", mergedMap, err)
|
||||
}
|
||||
|
||||
configuration = string(mergedJSON)
|
||||
logrus.Debugf(title+" id=%s merged config=%s", id, configuration)
|
||||
}
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
identity syscall.Handle
|
||||
)
|
||||
createError := hcsCreateComputeSystem(id, configuration, identity, &container.handle, &resultp)
|
||||
|
||||
if createError == nil || IsPending(createError) {
|
||||
if err := container.registerCallback(); err != nil {
|
||||
// Terminate the container if it still exists. We're okay to ignore a failure here.
|
||||
container.Terminate()
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
}
|
||||
}
|
||||
|
||||
err = processAsyncHcsResult(createError, resultp, container.callbackNumber, hcsNotificationSystemCreateCompleted, &defaultTimeout)
|
||||
if err != nil {
|
||||
if err == ErrTimeout {
|
||||
// Terminate the container if it still exists. We're okay to ignore a failure here.
|
||||
container.Terminate()
|
||||
}
|
||||
return nil, makeContainerError(container, operation, configuration, err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s handle=%d", id, container.handle)
|
||||
return container, nil
|
||||
}
|
||||
|
||||
// mergeMaps recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
|
||||
// in ToMap are overwritten. Values in fromMap are added to ToMap.
|
||||
// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
|
||||
func mergeMaps(fromMap, ToMap interface{}) interface{} {
|
||||
switch fromMap := fromMap.(type) {
|
||||
case map[string]interface{}:
|
||||
ToMap, ok := ToMap.(map[string]interface{})
|
||||
if !ok {
|
||||
return fromMap
|
||||
}
|
||||
for keyToMap, valueToMap := range ToMap {
|
||||
if valueFromMap, ok := fromMap[keyToMap]; ok {
|
||||
fromMap[keyToMap] = mergeMaps(valueFromMap, valueToMap)
|
||||
} else {
|
||||
fromMap[keyToMap] = valueToMap
|
||||
}
|
||||
}
|
||||
case nil:
|
||||
// merge(nil, map[string]interface{...}) -> map[string]interface{...}
|
||||
ToMap, ok := ToMap.(map[string]interface{})
|
||||
if ok {
|
||||
return ToMap
|
||||
}
|
||||
}
|
||||
return fromMap
|
||||
return &container{system}, err
|
||||
}
|
||||
|
||||
// OpenContainer opens an existing container by ID.
|
||||
func OpenContainer(id string) (Container, error) {
|
||||
operation := "OpenContainer"
|
||||
title := "HCSShim::" + operation
|
||||
logrus.Debugf(title+" id=%s", id)
|
||||
|
||||
container := &container{
|
||||
id: id,
|
||||
}
|
||||
|
||||
var (
|
||||
handle hcsSystem
|
||||
resultp *uint16
|
||||
)
|
||||
err := hcsOpenComputeSystem(id, &handle, &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
system, err := hcs.OpenComputeSystem(id)
|
||||
if err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
return nil, err
|
||||
}
|
||||
|
||||
container.handle = handle
|
||||
|
||||
if err := container.registerCallback(); err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle)
|
||||
return container, nil
|
||||
return &container{system}, err
|
||||
}
|
||||
|
||||
// GetContainers gets a list of the containers on the system that match the query
|
||||
func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
|
||||
operation := "GetContainers"
|
||||
title := "HCSShim::" + operation
|
||||
|
||||
queryb, err := json.Marshal(q)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
query := string(queryb)
|
||||
logrus.Debugf(title+" query=%s", query)
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
computeSystemsp *uint16
|
||||
)
|
||||
err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if computeSystemsp == nil {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
computeSystemsRaw := convertAndFreeCoTaskMemBytes(computeSystemsp)
|
||||
computeSystems := []ContainerProperties{}
|
||||
if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
logrus.Debugf(title + " succeeded")
|
||||
return computeSystems, nil
|
||||
return hcs.GetComputeSystems(q)
|
||||
}
|
||||
|
||||
// Start synchronously starts the container.
|
||||
func (container *container) Start() error {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "Start"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
err := hcsStartComputeSystem(container.handle, "", &resultp)
|
||||
err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemStartCompleted, &defaultTimeout)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
return convertSystemError(container.system.Start(), container)
|
||||
}
|
||||
|
||||
// Shutdown requests a container shutdown, if IsPending() on the error returned is true,
|
||||
// it may not actually be shut down until Wait() succeeds.
|
||||
// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
|
||||
func (container *container) Shutdown() error {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "Shutdown"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
err := hcsShutdownComputeSystem(container.handle, "", &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
return convertSystemError(container.system.Shutdown(), container)
|
||||
}
|
||||
|
||||
// Terminate requests a container terminate, if IsPending() on the error returned is true,
|
||||
// it may not actually be shut down until Wait() succeeds.
|
||||
// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
|
||||
func (container *container) Terminate() error {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "Terminate"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
err := hcsTerminateComputeSystem(container.handle, "", &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
return convertSystemError(container.system.Terminate(), container)
|
||||
}
|
||||
|
||||
// Wait synchronously waits for the container to shutdown or terminate.
|
||||
// Waits synchronously waits for the container to shutdown or terminate.
|
||||
func (container *container) Wait() error {
|
||||
operation := "Wait"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, nil)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
return convertSystemError(container.system.Wait(), container)
|
||||
}
|
||||
|
||||
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse.
|
||||
// If the timeout expires, IsTimeout(err) == true
|
||||
func (container *container) WaitTimeout(timeout time.Duration) error {
|
||||
operation := "WaitTimeout"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, &timeout)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
|
||||
// returns false if timeout occurs.
|
||||
func (container *container) WaitTimeout(t time.Duration) error {
|
||||
return convertSystemError(container.system.WaitTimeout(t), container)
|
||||
}
|
||||
|
||||
func (container *container) properties(query string) (*ContainerProperties, error) {
|
||||
var (
|
||||
resultp *uint16
|
||||
propertiesp *uint16
|
||||
)
|
||||
err := hcsGetComputeSystemProperties(container.handle, query, &propertiesp, &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Pause pauses the execution of a container.
|
||||
func (container *container) Pause() error {
|
||||
return convertSystemError(container.system.Pause(), container)
|
||||
}
|
||||
|
||||
if propertiesp == nil {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp)
|
||||
properties := &ContainerProperties{}
|
||||
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return properties, nil
|
||||
// Resume resumes the execution of a container.
|
||||
func (container *container) Resume() error {
|
||||
return convertSystemError(container.system.Resume(), container)
|
||||
}
|
||||
|
||||
// HasPendingUpdates returns true if the container has updates pending to install
|
||||
func (container *container) HasPendingUpdates() (bool, error) {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "HasPendingUpdates"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return false, makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
properties, err := container.properties(pendingUpdatesQuery)
|
||||
if err != nil {
|
||||
return false, makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return properties.AreUpdatesPending, nil
|
||||
return false, nil
|
||||
}
|
||||
|
||||
// Statistics returns statistics for the container
|
||||
// Statistics returns statistics for the container. This is a legacy v1 call
|
||||
func (container *container) Statistics() (Statistics, error) {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "Statistics"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return Statistics{}, makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
properties, err := container.properties(statisticsQuery)
|
||||
properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
|
||||
if err != nil {
|
||||
return Statistics{}, makeContainerError(container, operation, "", err)
|
||||
return Statistics{}, convertSystemError(err, container)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return properties.Statistics, nil
|
||||
}
|
||||
|
||||
// ProcessList returns an array of ProcessListItems for the container
|
||||
// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
|
||||
func (container *container) ProcessList() ([]ProcessListItem, error) {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "ProcessList"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
properties, err := container.properties(processListQuery)
|
||||
properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
|
||||
if err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return properties.ProcessList, nil
|
||||
}
|
||||
|
||||
// MappedVirtualDisks returns a map of the controllers and the disks mapped
|
||||
// to a container.
|
||||
//
|
||||
// Example of JSON returned by the query.
|
||||
//{
|
||||
// "Id":"1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3_svm",
|
||||
// "SystemType":"Container",
|
||||
// "RuntimeOsType":"Linux",
|
||||
// "RuntimeId":"00000000-0000-0000-0000-000000000000",
|
||||
// "State":"Running",
|
||||
// "MappedVirtualDiskControllers":{
|
||||
// "0":{
|
||||
// "MappedVirtualDisks":{
|
||||
// "2":{
|
||||
// "HostPath":"C:\\lcow\\lcow\\scratch\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3.vhdx",
|
||||
// "ContainerPath":"/mnt/gcs/LinuxServiceVM/scratch",
|
||||
// "Lun":2,
|
||||
// "CreateInUtilityVM":true
|
||||
// },
|
||||
// "3":{
|
||||
// "HostPath":"C:\\lcow\\lcow\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3\\sandbox.vhdx",
|
||||
// "Lun":3,
|
||||
// "CreateInUtilityVM":true,
|
||||
// "AttachOnly":true
|
||||
// }
|
||||
// }
|
||||
// }
|
||||
// }
|
||||
//}
|
||||
// This is a legacy v1 call
|
||||
func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "MappedVirtualDiskList"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
properties, err := container.properties(mappedVirtualDiskQuery)
|
||||
properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
|
||||
if err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return properties.MappedVirtualDiskControllers, nil
|
||||
}
|
||||
|
||||
// Pause pauses the execution of the container. This feature is not enabled in TP5.
|
||||
func (container *container) Pause() error {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "Pause"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
err := hcsPauseComputeSystem(container.handle, "", &resultp)
|
||||
err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemPauseCompleted, &defaultTimeout)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
}
|
||||
|
||||
// Resume resumes the execution of the container. This feature is not enabled in TP5.
|
||||
func (container *container) Resume() error {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "Resume"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
if container.handle == 0 {
|
||||
return makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
err := hcsResumeComputeSystem(container.handle, "", &resultp)
|
||||
err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemResumeCompleted, &defaultTimeout)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
}
|
||||
|
||||
// CreateProcess launches a new process within the container.
|
||||
func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "CreateProcess"
|
||||
title := "HCSShim::Container::" + operation
|
||||
var (
|
||||
processInfo hcsProcessInformation
|
||||
processHandle hcsProcess
|
||||
resultp *uint16
|
||||
)
|
||||
|
||||
if container.handle == 0 {
|
||||
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
// If we are not emulating a console, ignore any console size passed to us
|
||||
if !c.EmulateConsole {
|
||||
c.ConsoleSize[0] = 0
|
||||
c.ConsoleSize[1] = 0
|
||||
}
|
||||
|
||||
configurationb, err := json.Marshal(c)
|
||||
p, err := container.system.CreateProcess(c)
|
||||
if err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
|
||||
configuration := string(configurationb)
|
||||
logrus.Debugf(title+" id=%s config=%s", container.id, configuration)
|
||||
|
||||
err = hcsCreateProcess(container.handle, configuration, &processInfo, &processHandle, &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
if err != nil {
|
||||
return nil, makeContainerError(container, operation, configuration, err)
|
||||
}
|
||||
|
||||
process := &process{
|
||||
handle: processHandle,
|
||||
processID: int(processInfo.ProcessId),
|
||||
container: container,
|
||||
cachedPipes: &cachedPipes{
|
||||
stdIn: processInfo.StdInput,
|
||||
stdOut: processInfo.StdOutput,
|
||||
stdErr: processInfo.StdError,
|
||||
},
|
||||
}
|
||||
|
||||
if err := process.registerCallback(); err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s processid=%d", container.id, process.processID)
|
||||
return process, nil
|
||||
return &process{p}, nil
|
||||
}
|
||||
|
||||
// OpenProcess gets an interface to an existing process within the container.
|
||||
func (container *container) OpenProcess(pid int) (Process, error) {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "OpenProcess"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s, processid=%d", container.id, pid)
|
||||
var (
|
||||
processHandle hcsProcess
|
||||
resultp *uint16
|
||||
)
|
||||
|
||||
if container.handle == 0 {
|
||||
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
err := hcsOpenProcess(container.handle, uint32(pid), &processHandle, &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
p, err := container.system.OpenProcess(pid)
|
||||
if err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
|
||||
process := &process{
|
||||
handle: processHandle,
|
||||
processID: pid,
|
||||
container: container,
|
||||
}
|
||||
|
||||
if err := process.registerCallback(); err != nil {
|
||||
return nil, makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s processid=%s", container.id, process.processID)
|
||||
return process, nil
|
||||
return &process{p}, nil
|
||||
}
|
||||
|
||||
// Close cleans up any state associated with the container but does not terminate or wait for it.
|
||||
func (container *container) Close() error {
|
||||
container.handleLock.Lock()
|
||||
defer container.handleLock.Unlock()
|
||||
operation := "Close"
|
||||
title := "HCSShim::Container::" + operation
|
||||
logrus.Debugf(title+" id=%s", container.id)
|
||||
|
||||
// Don't double free this
|
||||
if container.handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
if err := container.unregisterCallback(); err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
if err := hcsCloseComputeSystem(container.handle); err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
|
||||
container.handle = 0
|
||||
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
return convertSystemError(container.system.Close(), container)
|
||||
}
|
||||
|
||||
func (container *container) registerCallback() error {
|
||||
context := ¬ifcationWatcherContext{
|
||||
channels: newChannels(),
|
||||
}
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackNumber := nextCallback
|
||||
nextCallback++
|
||||
callbackMap[callbackNumber] = context
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
var callbackHandle hcsCallback
|
||||
err := hcsRegisterComputeSystemCallback(container.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
context.handle = callbackHandle
|
||||
container.callbackNumber = callbackNumber
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (container *container) unregisterCallback() error {
|
||||
callbackNumber := container.callbackNumber
|
||||
|
||||
callbackMapLock.RLock()
|
||||
context := callbackMap[callbackNumber]
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
if context == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
handle := context.handle
|
||||
|
||||
if handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
// hcsUnregisterComputeSystemCallback has its own syncronization
|
||||
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||
err := hcsUnregisterComputeSystemCallback(handle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
closeChannels(context.channels)
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackMap[callbackNumber] = nil
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
handle = 0
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Modifies the System by sending a request to HCS
|
||||
// Modify the System
|
||||
func (container *container) Modify(config *ResourceModificationRequestResponse) error {
|
||||
container.handleLock.RLock()
|
||||
defer container.handleLock.RUnlock()
|
||||
operation := "Modify"
|
||||
title := "HCSShim::Container::" + operation
|
||||
|
||||
if container.handle == 0 {
|
||||
return makeContainerError(container, operation, "", ErrAlreadyClosed)
|
||||
}
|
||||
|
||||
requestJSON, err := json.Marshal(config)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
requestString := string(requestJSON)
|
||||
logrus.Debugf(title+" id=%s request=%s", container.id, requestString)
|
||||
|
||||
var resultp *uint16
|
||||
err = hcsModifyComputeSystem(container.handle, requestString, &resultp)
|
||||
err = processHcsResult(err, resultp)
|
||||
if err != nil {
|
||||
return makeContainerError(container, operation, "", err)
|
||||
}
|
||||
logrus.Debugf(title+" succeeded id=%s", container.id)
|
||||
return nil
|
||||
return convertSystemError(container.system.Modify(config), container)
|
||||
}
|
||||
|
||||
27
vendor/github.com/Microsoft/hcsshim/createlayer.go
generated
vendored
27
vendor/github.com/Microsoft/hcsshim/createlayer.go
generated
vendored
@@ -1,27 +0,0 @@
|
||||
package hcsshim
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
// CreateLayer creates a new, empty, read-only layer on the filesystem based on
|
||||
// the parent layer provided.
|
||||
func CreateLayer(info DriverInfo, id, parent string) error {
|
||||
title := "hcsshim::CreateLayer "
|
||||
logrus.Debugf(title+"Flavour %d ID %s parent %s", info.Flavour, id, parent)
|
||||
|
||||
// Convert info to API calling convention
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = createLayer(&infop, id, parent)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "id=%s parent=%s flavour=%d", id, parent, info.Flavour)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+" - succeeded id=%s parent=%s flavour=%d", id, parent, info.Flavour)
|
||||
return nil
|
||||
}
|
||||
35
vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go
generated
vendored
35
vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go
generated
vendored
@@ -1,35 +0,0 @@
|
||||
package hcsshim
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
// CreateSandboxLayer creates and populates new read-write layer for use by a container.
|
||||
// This requires both the id of the direct parent layer, as well as the full list
|
||||
// of paths to all parent layers up to the base (and including the direct parent
|
||||
// whose id was provided).
|
||||
func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error {
|
||||
title := "hcsshim::CreateSandboxLayer "
|
||||
logrus.Debugf(title+"layerId %s parentId %s", layerId, parentId)
|
||||
|
||||
// Generate layer descriptors
|
||||
layers, err := layerPathsToDescriptors(parentLayerPaths)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Convert info to API calling convention
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = createSandboxLayer(&infop, layerId, parentId, layers)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "layerId=%s parentId=%s", layerId, parentId)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+"- succeeded layerId=%s parentId=%s", layerId, parentId)
|
||||
return nil
|
||||
}
|
||||
26
vendor/github.com/Microsoft/hcsshim/deactivatelayer.go
generated
vendored
26
vendor/github.com/Microsoft/hcsshim/deactivatelayer.go
generated
vendored
@@ -1,26 +0,0 @@
|
||||
package hcsshim
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
// DeactivateLayer will dismount a layer that was mounted via ActivateLayer.
|
||||
func DeactivateLayer(info DriverInfo, id string) error {
|
||||
title := "hcsshim::DeactivateLayer "
|
||||
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
|
||||
|
||||
// Convert info to API calling convention
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = deactivateLayer(&infop, id)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id)
|
||||
return nil
|
||||
}
|
||||
27
vendor/github.com/Microsoft/hcsshim/destroylayer.go
generated
vendored
27
vendor/github.com/Microsoft/hcsshim/destroylayer.go
generated
vendored
@@ -1,27 +0,0 @@
|
||||
package hcsshim
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
// DestroyLayer will remove the on-disk files representing the layer with the given
|
||||
// id, including that layer's containing folder, if any.
|
||||
func DestroyLayer(info DriverInfo, id string) error {
|
||||
title := "hcsshim::DestroyLayer "
|
||||
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
|
||||
|
||||
// Convert info to API calling convention
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = destroyLayer(&infop, id)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id)
|
||||
return nil
|
||||
}
|
||||
128
vendor/github.com/Microsoft/hcsshim/errors.go
generated
vendored
128
vendor/github.com/Microsoft/hcsshim/errors.go
generated
vendored
@@ -1,92 +1,83 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/hcs"
|
||||
"github.com/Microsoft/hcsshim/internal/hcserror"
|
||||
)
|
||||
|
||||
var (
|
||||
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
|
||||
ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
|
||||
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist
|
||||
ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist
|
||||
|
||||
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||
ErrElementNotFound = syscall.Errno(0x490)
|
||||
ErrElementNotFound = hcs.ErrElementNotFound
|
||||
|
||||
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||
ErrNotSupported = syscall.Errno(0x32)
|
||||
ErrNotSupported = hcs.ErrNotSupported
|
||||
|
||||
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
|
||||
// decimal -2147024883 / hex 0x8007000d
|
||||
ErrInvalidData = syscall.Errno(0xd)
|
||||
ErrInvalidData = hcs.ErrInvalidData
|
||||
|
||||
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
|
||||
ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
|
||||
ErrHandleClose = hcs.ErrHandleClose
|
||||
|
||||
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
|
||||
ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
|
||||
ErrAlreadyClosed = hcs.ErrAlreadyClosed
|
||||
|
||||
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
|
||||
ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
|
||||
ErrInvalidNotificationType = hcs.ErrInvalidNotificationType
|
||||
|
||||
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
|
||||
ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
|
||||
ErrInvalidProcessState = hcs.ErrInvalidProcessState
|
||||
|
||||
// ErrTimeout is an error encountered when waiting on a notification times out
|
||||
ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
|
||||
ErrTimeout = hcs.ErrTimeout
|
||||
|
||||
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
|
||||
// a different expected notification
|
||||
ErrUnexpectedContainerExit = errors.New("unexpected container exit")
|
||||
ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit
|
||||
|
||||
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
|
||||
// is lost while waiting for a notification
|
||||
ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
|
||||
ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort
|
||||
|
||||
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
|
||||
ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
|
||||
ErrUnexpectedValue = hcs.ErrUnexpectedValue
|
||||
|
||||
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
|
||||
ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
|
||||
ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped
|
||||
|
||||
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
|
||||
ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
|
||||
ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending
|
||||
|
||||
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
|
||||
ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
|
||||
ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState
|
||||
|
||||
// ErrProcNotFound is an error encountered when the the process cannot be found
|
||||
ErrProcNotFound = syscall.Errno(0x7f)
|
||||
ErrProcNotFound = hcs.ErrProcNotFound
|
||||
|
||||
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
|
||||
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
|
||||
ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
|
||||
ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied
|
||||
|
||||
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
|
||||
ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
|
||||
ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON
|
||||
|
||||
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
|
||||
ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
|
||||
ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage
|
||||
|
||||
// ErrNotSupported is an error encountered when hcs doesn't support the request
|
||||
ErrPlatformNotSupported = errors.New("unsupported platform request")
|
||||
ErrPlatformNotSupported = hcs.ErrPlatformNotSupported
|
||||
)
|
||||
|
||||
type EndpointNotFoundError struct {
|
||||
EndpointName string
|
||||
}
|
||||
|
||||
func (e EndpointNotFoundError) Error() string {
|
||||
return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
|
||||
}
|
||||
|
||||
type NetworkNotFoundError struct {
|
||||
NetworkName string
|
||||
}
|
||||
|
||||
func (e NetworkNotFoundError) Error() string {
|
||||
return fmt.Sprintf("Network %s not found", e.NetworkName)
|
||||
}
|
||||
type EndpointNotFoundError = hns.EndpointNotFoundError
|
||||
type NetworkNotFoundError = hns.NetworkNotFoundError
|
||||
|
||||
// ProcessError is an error encountered in HCS during an operation on a Process object
|
||||
type ProcessError struct {
|
||||
@@ -94,6 +85,7 @@ type ProcessError struct {
|
||||
Operation string
|
||||
ExtraInfo string
|
||||
Err error
|
||||
Events []hcs.ErrorEvent
|
||||
}
|
||||
|
||||
// ContainerError is an error encountered in HCS during an operation on a Container object
|
||||
@@ -102,6 +94,7 @@ type ContainerError struct {
|
||||
Operation string
|
||||
ExtraInfo string
|
||||
Err error
|
||||
Events []hcs.ErrorEvent
|
||||
}
|
||||
|
||||
func (e *ContainerError) Error() string {
|
||||
@@ -113,7 +106,7 @@ func (e *ContainerError) Error() string {
|
||||
return "unexpected nil container for error: " + e.Err.Error()
|
||||
}
|
||||
|
||||
s := "container " + e.Container.id
|
||||
s := "container " + e.Container.system.ID()
|
||||
|
||||
if e.Operation != "" {
|
||||
s += " encountered an error during " + e.Operation
|
||||
@@ -123,11 +116,15 @@ func (e *ContainerError) Error() string {
|
||||
case nil:
|
||||
break
|
||||
case syscall.Errno:
|
||||
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err))
|
||||
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
|
||||
default:
|
||||
s += fmt.Sprintf(": %s", e.Err.Error())
|
||||
}
|
||||
|
||||
for _, ev := range e.Events {
|
||||
s += "\n" + ev.String()
|
||||
}
|
||||
|
||||
if e.ExtraInfo != "" {
|
||||
s += " extra info: " + e.ExtraInfo
|
||||
}
|
||||
@@ -153,12 +150,7 @@ func (e *ProcessError) Error() string {
|
||||
return "Unexpected nil process for error: " + e.Err.Error()
|
||||
}
|
||||
|
||||
s := fmt.Sprintf("process %d", e.Process.processID)
|
||||
|
||||
if e.Process.container != nil {
|
||||
s += " in container " + e.Process.container.id
|
||||
}
|
||||
|
||||
s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID())
|
||||
if e.Operation != "" {
|
||||
s += " encountered an error during " + e.Operation
|
||||
}
|
||||
@@ -167,11 +159,15 @@ func (e *ProcessError) Error() string {
|
||||
case nil:
|
||||
break
|
||||
case syscall.Errno:
|
||||
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err))
|
||||
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
|
||||
default:
|
||||
s += fmt.Sprintf(": %s", e.Err.Error())
|
||||
}
|
||||
|
||||
for _, ev := range e.Events {
|
||||
s += "\n" + ev.String()
|
||||
}
|
||||
|
||||
return s
|
||||
}
|
||||
|
||||
@@ -189,37 +185,31 @@ func makeProcessError(process *process, operation string, extraInfo string, err
|
||||
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||
func IsNotExist(err error) bool {
|
||||
err = getInnerError(err)
|
||||
if _, ok := err.(EndpointNotFoundError); ok {
|
||||
return true
|
||||
}
|
||||
if _, ok := err.(NetworkNotFoundError); ok {
|
||||
return true
|
||||
}
|
||||
return err == ErrComputeSystemDoesNotExist ||
|
||||
err == ErrElementNotFound ||
|
||||
err == ErrProcNotFound
|
||||
return hcs.IsNotExist(getInnerError(err))
|
||||
}
|
||||
|
||||
// IsAlreadyClosed checks if an error is caused by the Container or Process having been
|
||||
// already closed by a call to the Close() method.
|
||||
func IsAlreadyClosed(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrAlreadyClosed
|
||||
return hcs.IsAlreadyClosed(getInnerError(err))
|
||||
}
|
||||
|
||||
// IsPending returns a boolean indicating whether the error is that
|
||||
// the requested operation is being completed in the background.
|
||||
func IsPending(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrVmcomputeOperationPending
|
||||
return hcs.IsPending(getInnerError(err))
|
||||
}
|
||||
|
||||
// IsTimeout returns a boolean indicating whether the error is caused by
|
||||
// a timeout waiting for the operation to complete.
|
||||
func IsTimeout(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrTimeout
|
||||
return hcs.IsTimeout(getInnerError(err))
|
||||
}
|
||||
|
||||
// IsAlreadyStopped returns a boolean indicating whether the error is caused by
|
||||
@@ -228,10 +218,7 @@ func IsTimeout(err error) bool {
|
||||
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||
func IsAlreadyStopped(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrVmcomputeAlreadyStopped ||
|
||||
err == ErrElementNotFound ||
|
||||
err == ErrProcNotFound
|
||||
return hcs.IsAlreadyStopped(getInnerError(err))
|
||||
}
|
||||
|
||||
// IsNotSupported returns a boolean indicating whether the error is caused by
|
||||
@@ -240,12 +227,7 @@ func IsAlreadyStopped(err error) bool {
|
||||
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
|
||||
// is thrown from the Platform
|
||||
func IsNotSupported(err error) bool {
|
||||
err = getInnerError(err)
|
||||
// If Platform doesn't recognize or support the request sent, below errors are seen
|
||||
return err == ErrVmcomputeInvalidJSON ||
|
||||
err == ErrInvalidData ||
|
||||
err == ErrNotSupported ||
|
||||
err == ErrVmcomputeUnknownMessage
|
||||
return hcs.IsNotSupported(getInnerError(err))
|
||||
}
|
||||
|
||||
func getInnerError(err error) error {
|
||||
@@ -259,3 +241,17 @@ func getInnerError(err error) error {
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
func convertSystemError(err error, c *container) error {
|
||||
if serr, ok := err.(*hcs.SystemError); ok {
|
||||
return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events}
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
func convertProcessError(err error, p *process) error {
|
||||
if perr, ok := err.(*hcs.ProcessError); ok {
|
||||
return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events}
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
26
vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go
generated
vendored
26
vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go
generated
vendored
@@ -1,26 +0,0 @@
|
||||
package hcsshim
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
// ExpandSandboxSize expands the size of a layer to at least size bytes.
|
||||
func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error {
|
||||
title := "hcsshim::ExpandSandboxSize "
|
||||
logrus.Debugf(title+"layerId=%s size=%d", layerId, size)
|
||||
|
||||
// Convert info to API calling convention
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = expandSandboxSize(&infop, layerId, size)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "layerId=%s size=%d", layerId, size)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+"- succeeded layerId=%s size=%d", layerId, size)
|
||||
return nil
|
||||
}
|
||||
156
vendor/github.com/Microsoft/hcsshim/exportlayer.go
generated
vendored
156
vendor/github.com/Microsoft/hcsshim/exportlayer.go
generated
vendored
@@ -1,156 +0,0 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"io"
|
||||
"io/ioutil"
|
||||
"os"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/go-winio"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// ExportLayer will create a folder at exportFolderPath and fill that folder with
|
||||
// the transport format version of the layer identified by layerId. This transport
|
||||
// format includes any metadata required for later importing the layer (using
|
||||
// ImportLayer), and requires the full list of parent layer paths in order to
|
||||
// perform the export.
|
||||
func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error {
|
||||
title := "hcsshim::ExportLayer "
|
||||
logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerId, exportFolderPath)
|
||||
|
||||
// Generate layer descriptors
|
||||
layers, err := layerPathsToDescriptors(parentLayerPaths)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Convert info to API calling convention
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = exportLayer(&infop, layerId, exportFolderPath, layers)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerId, info.Flavour, exportFolderPath)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerId, exportFolderPath)
|
||||
return nil
|
||||
}
|
||||
|
||||
type LayerReader interface {
|
||||
Next() (string, int64, *winio.FileBasicInfo, error)
|
||||
Read(b []byte) (int, error)
|
||||
Close() error
|
||||
}
|
||||
|
||||
// FilterLayerReader provides an interface for extracting the contents of an on-disk layer.
|
||||
type FilterLayerReader struct {
|
||||
context uintptr
|
||||
}
|
||||
|
||||
// Next reads the next available file from a layer, ensuring that parent directories are always read
|
||||
// before child files and directories.
|
||||
//
|
||||
// Next returns the file's relative path, size, and basic file metadata. Read() should be used to
|
||||
// extract a Win32 backup stream with the remainder of the metadata and the data.
|
||||
func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error) {
|
||||
var fileNamep *uint16
|
||||
fileInfo := &winio.FileBasicInfo{}
|
||||
var deleted uint32
|
||||
var fileSize int64
|
||||
err := exportLayerNext(r.context, &fileNamep, fileInfo, &fileSize, &deleted)
|
||||
if err != nil {
|
||||
if err == syscall.ERROR_NO_MORE_FILES {
|
||||
err = io.EOF
|
||||
} else {
|
||||
err = makeError(err, "ExportLayerNext", "")
|
||||
}
|
||||
return "", 0, nil, err
|
||||
}
|
||||
fileName := convertAndFreeCoTaskMemString(fileNamep)
|
||||
if deleted != 0 {
|
||||
fileInfo = nil
|
||||
}
|
||||
if fileName[0] == '\\' {
|
||||
fileName = fileName[1:]
|
||||
}
|
||||
return fileName, fileSize, fileInfo, nil
|
||||
}
|
||||
|
||||
// Read reads from the current file's Win32 backup stream.
|
||||
func (r *FilterLayerReader) Read(b []byte) (int, error) {
|
||||
var bytesRead uint32
|
||||
err := exportLayerRead(r.context, b, &bytesRead)
|
||||
if err != nil {
|
||||
return 0, makeError(err, "ExportLayerRead", "")
|
||||
}
|
||||
if bytesRead == 0 {
|
||||
return 0, io.EOF
|
||||
}
|
||||
return int(bytesRead), nil
|
||||
}
|
||||
|
||||
// Close frees resources associated with the layer reader. It will return an
|
||||
// error if there was an error while reading the layer or of the layer was not
|
||||
// completely read.
|
||||
func (r *FilterLayerReader) Close() (err error) {
|
||||
if r.context != 0 {
|
||||
err = exportLayerEnd(r.context)
|
||||
if err != nil {
|
||||
err = makeError(err, "ExportLayerEnd", "")
|
||||
}
|
||||
r.context = 0
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer.
|
||||
// The caller must have taken the SeBackupPrivilege privilege
|
||||
// to call this and any methods on the resulting LayerReader.
|
||||
func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) {
|
||||
if procExportLayerBegin.Find() != nil {
|
||||
// The new layer reader is not available on this Windows build. Fall back to the
|
||||
// legacy export code path.
|
||||
path, err := ioutil.TempDir("", "hcs")
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
err = ExportLayer(info, layerID, path, parentLayerPaths)
|
||||
if err != nil {
|
||||
os.RemoveAll(path)
|
||||
return nil, err
|
||||
}
|
||||
return &legacyLayerReaderWrapper{newLegacyLayerReader(path)}, nil
|
||||
}
|
||||
|
||||
layers, err := layerPathsToDescriptors(parentLayerPaths)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
r := &FilterLayerReader{}
|
||||
err = exportLayerBegin(&infop, layerID, layers, &r.context)
|
||||
if err != nil {
|
||||
return nil, makeError(err, "ExportLayerBegin", "")
|
||||
}
|
||||
return r, err
|
||||
}
|
||||
|
||||
type legacyLayerReaderWrapper struct {
|
||||
*legacyLayerReader
|
||||
}
|
||||
|
||||
func (r *legacyLayerReaderWrapper) Close() error {
|
||||
err := r.legacyLayerReader.Close()
|
||||
os.RemoveAll(r.root)
|
||||
return err
|
||||
}
|
||||
12
vendor/github.com/Microsoft/hcsshim/functional_tests.ps1
generated
vendored
Normal file
12
vendor/github.com/Microsoft/hcsshim/functional_tests.ps1
generated
vendored
Normal file
@@ -0,0 +1,12 @@
|
||||
# Requirements so far:
|
||||
# dockerd running
|
||||
# - image microsoft/nanoserver (matching host base image) docker load -i c:\baseimages\nanoserver.tar
|
||||
# - image alpine (linux) docker pull --platform=linux alpine
|
||||
|
||||
|
||||
# TODO: Add this a parameter for debugging. ie "functional-tests -debug=$true"
|
||||
#$env:HCSSHIM_FUNCTIONAL_TESTS_DEBUG="yes please"
|
||||
|
||||
#pushd uvm
|
||||
go test -v -tags "functional uvmcreate uvmscratch uvmscsi uvmvpmem uvmvsmb uvmp9" ./...
|
||||
#popd
|
||||
55
vendor/github.com/Microsoft/hcsshim/getlayermountpath.go
generated
vendored
55
vendor/github.com/Microsoft/hcsshim/getlayermountpath.go
generated
vendored
@@ -1,55 +0,0 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// GetLayerMountPath will look for a mounted layer with the given id and return
|
||||
// the path at which that layer can be accessed. This path may be a volume path
|
||||
// if the layer is a mounted read-write layer, otherwise it is expected to be the
|
||||
// folder path at which the layer is stored.
|
||||
func GetLayerMountPath(info DriverInfo, id string) (string, error) {
|
||||
title := "hcsshim::GetLayerMountPath "
|
||||
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
|
||||
|
||||
// Convert info to API calling convention
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return "", err
|
||||
}
|
||||
|
||||
var mountPathLength uintptr
|
||||
mountPathLength = 0
|
||||
|
||||
// Call the procedure itself.
|
||||
logrus.Debugf("Calling proc (1)")
|
||||
err = getLayerMountPath(&infop, id, &mountPathLength, nil)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "(first call) id=%s flavour=%d", id, info.Flavour)
|
||||
logrus.Error(err)
|
||||
return "", err
|
||||
}
|
||||
|
||||
// Allocate a mount path of the returned length.
|
||||
if mountPathLength == 0 {
|
||||
return "", nil
|
||||
}
|
||||
mountPathp := make([]uint16, mountPathLength)
|
||||
mountPathp[0] = 0
|
||||
|
||||
// Call the procedure again
|
||||
logrus.Debugf("Calling proc (2)")
|
||||
err = getLayerMountPath(&infop, id, &mountPathLength, &mountPathp[0])
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "(second call) id=%s flavour=%d", id, info.Flavour)
|
||||
logrus.Error(err)
|
||||
return "", err
|
||||
}
|
||||
|
||||
path := syscall.UTF16ToString(mountPathp[0:])
|
||||
logrus.Debugf(title+"succeeded flavour=%d id=%s path=%s", info.Flavour, id, path)
|
||||
return path, nil
|
||||
}
|
||||
22
vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go
generated
vendored
22
vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go
generated
vendored
@@ -1,22 +0,0 @@
|
||||
package hcsshim
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
// GetSharedBaseImages will enumerate the images stored in the common central
|
||||
// image store and return descriptive info about those images for the purpose
|
||||
// of registering them with the graphdriver, graph, and tagstore.
|
||||
func GetSharedBaseImages() (imageData string, err error) {
|
||||
title := "hcsshim::GetSharedBaseImages "
|
||||
|
||||
logrus.Debugf("Calling proc")
|
||||
var buffer *uint16
|
||||
err = getBaseImages(&buffer)
|
||||
if err != nil {
|
||||
err = makeError(err, title, "")
|
||||
logrus.Error(err)
|
||||
return
|
||||
}
|
||||
imageData = convertAndFreeCoTaskMemString(buffer)
|
||||
logrus.Debugf(title+" - succeeded output=%s", imageData)
|
||||
return
|
||||
}
|
||||
19
vendor/github.com/Microsoft/hcsshim/guid.go
generated
vendored
19
vendor/github.com/Microsoft/hcsshim/guid.go
generated
vendored
@@ -1,19 +0,0 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"crypto/sha1"
|
||||
"fmt"
|
||||
)
|
||||
|
||||
type GUID [16]byte
|
||||
|
||||
func NewGUID(source string) *GUID {
|
||||
h := sha1.Sum([]byte(source))
|
||||
var g GUID
|
||||
copy(g[0:], h[0:16])
|
||||
return &g
|
||||
}
|
||||
|
||||
func (g *GUID) ToString() string {
|
||||
return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
|
||||
}
|
||||
48
vendor/github.com/Microsoft/hcsshim/hcn/BUILD
generated
vendored
Normal file
48
vendor/github.com/Microsoft/hcsshim/hcn/BUILD
generated
vendored
Normal file
@@ -0,0 +1,48 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = [
|
||||
"hcn.go",
|
||||
"hcnendpoint.go",
|
||||
"hcnerrors.go",
|
||||
"hcnglobals.go",
|
||||
"hcnloadbalancer.go",
|
||||
"hcnnamespace.go",
|
||||
"hcnnetwork.go",
|
||||
"hcnpolicy.go",
|
||||
"hcnsupport.go",
|
||||
"zsyscall_windows.go",
|
||||
],
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/hcn",
|
||||
importpath = "github.com/Microsoft/hcsshim/hcn",
|
||||
visibility = ["//visibility:public"],
|
||||
deps = [
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/cni:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/guid:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/hcserror:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/interop:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/regstate:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/runhcs:go_default_library",
|
||||
"//vendor/github.com/sirupsen/logrus:go_default_library",
|
||||
] + select({
|
||||
"@io_bazel_rules_go//go/platform:windows": [
|
||||
"//vendor/golang.org/x/sys/windows:go_default_library",
|
||||
],
|
||||
"//conditions:default": [],
|
||||
}),
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
168
vendor/github.com/Microsoft/hcsshim/hcn/hcn.go
generated
vendored
Normal file
168
vendor/github.com/Microsoft/hcsshim/hcn/hcn.go
generated
vendored
Normal file
@@ -0,0 +1,168 @@
|
||||
// Package hcn is a shim for the Host Compute Networking (HCN) service, which manages networking for Windows Server
|
||||
// containers and Hyper-V containers. Previous to RS5, HCN was referred to as Host Networking Service (HNS).
|
||||
package hcn
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/guid"
|
||||
)
|
||||
|
||||
//go:generate go run ../mksyscall_windows.go -output zsyscall_windows.go hcn.go
|
||||
|
||||
/// HNS V1 API
|
||||
|
||||
//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId
|
||||
//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
|
||||
|
||||
/// HCN V2 API
|
||||
|
||||
// Network
|
||||
//sys hcnEnumerateNetworks(query string, networks **uint16, result **uint16) (hr error) = computenetwork.HcnEnumerateNetworks?
|
||||
//sys hcnCreateNetwork(id *_guid, settings string, network *hcnNetwork, result **uint16) (hr error) = computenetwork.HcnCreateNetwork?
|
||||
//sys hcnOpenNetwork(id *_guid, network *hcnNetwork, result **uint16) (hr error) = computenetwork.HcnOpenNetwork?
|
||||
//sys hcnModifyNetwork(network hcnNetwork, settings string, result **uint16) (hr error) = computenetwork.HcnModifyNetwork?
|
||||
//sys hcnQueryNetworkProperties(network hcnNetwork, query string, properties **uint16, result **uint16) (hr error) = computenetwork.HcnQueryNetworkProperties?
|
||||
//sys hcnDeleteNetwork(id *_guid, result **uint16) (hr error) = computenetwork.HcnDeleteNetwork?
|
||||
//sys hcnCloseNetwork(network hcnNetwork) (hr error) = computenetwork.HcnCloseNetwork?
|
||||
|
||||
// Endpoint
|
||||
//sys hcnEnumerateEndpoints(query string, endpoints **uint16, result **uint16) (hr error) = computenetwork.HcnEnumerateEndpoints?
|
||||
//sys hcnCreateEndpoint(network hcnNetwork, id *_guid, settings string, endpoint *hcnEndpoint, result **uint16) (hr error) = computenetwork.HcnCreateEndpoint?
|
||||
//sys hcnOpenEndpoint(id *_guid, endpoint *hcnEndpoint, result **uint16) (hr error) = computenetwork.HcnOpenEndpoint?
|
||||
//sys hcnModifyEndpoint(endpoint hcnEndpoint, settings string, result **uint16) (hr error) = computenetwork.HcnModifyEndpoint?
|
||||
//sys hcnQueryEndpointProperties(endpoint hcnEndpoint, query string, properties **uint16, result **uint16) (hr error) = computenetwork.HcnQueryEndpointProperties?
|
||||
//sys hcnDeleteEndpoint(id *_guid, result **uint16) (hr error) = computenetwork.HcnDeleteEndpoint?
|
||||
//sys hcnCloseEndpoint(endpoint hcnEndpoint) (hr error) = computenetwork.HcnCloseEndpoint?
|
||||
|
||||
// Namespace
|
||||
//sys hcnEnumerateNamespaces(query string, namespaces **uint16, result **uint16) (hr error) = computenetwork.HcnEnumerateNamespaces?
|
||||
//sys hcnCreateNamespace(id *_guid, settings string, namespace *hcnNamespace, result **uint16) (hr error) = computenetwork.HcnCreateNamespace?
|
||||
//sys hcnOpenNamespace(id *_guid, namespace *hcnNamespace, result **uint16) (hr error) = computenetwork.HcnOpenNamespace?
|
||||
//sys hcnModifyNamespace(namespace hcnNamespace, settings string, result **uint16) (hr error) = computenetwork.HcnModifyNamespace?
|
||||
//sys hcnQueryNamespaceProperties(namespace hcnNamespace, query string, properties **uint16, result **uint16) (hr error) = computenetwork.HcnQueryNamespaceProperties?
|
||||
//sys hcnDeleteNamespace(id *_guid, result **uint16) (hr error) = computenetwork.HcnDeleteNamespace?
|
||||
//sys hcnCloseNamespace(namespace hcnNamespace) (hr error) = computenetwork.HcnCloseNamespace?
|
||||
|
||||
// LoadBalancer
|
||||
//sys hcnEnumerateLoadBalancers(query string, loadBalancers **uint16, result **uint16) (hr error) = computenetwork.HcnEnumerateLoadBalancers?
|
||||
//sys hcnCreateLoadBalancer(id *_guid, settings string, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) = computenetwork.HcnCreateLoadBalancer?
|
||||
//sys hcnOpenLoadBalancer(id *_guid, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) = computenetwork.HcnOpenLoadBalancer?
|
||||
//sys hcnModifyLoadBalancer(loadBalancer hcnLoadBalancer, settings string, result **uint16) (hr error) = computenetwork.HcnModifyLoadBalancer?
|
||||
//sys hcnQueryLoadBalancerProperties(loadBalancer hcnLoadBalancer, query string, properties **uint16, result **uint16) (hr error) = computenetwork.HcnQueryLoadBalancerProperties?
|
||||
//sys hcnDeleteLoadBalancer(id *_guid, result **uint16) (hr error) = computenetwork.HcnDeleteLoadBalancer?
|
||||
//sys hcnCloseLoadBalancer(loadBalancer hcnLoadBalancer) (hr error) = computenetwork.HcnCloseLoadBalancer?
|
||||
|
||||
// Service
|
||||
//sys hcnOpenService(service *hcnService, result **uint16) (hr error) = computenetwork.HcnOpenService?
|
||||
//sys hcnRegisterServiceCallback(service hcnService, callback int32, context int32, callbackHandle *hcnCallbackHandle) (hr error) = computenetwork.HcnRegisterServiceCallback?
|
||||
//sys hcnUnregisterServiceCallback(callbackHandle hcnCallbackHandle) (hr error) = computenetwork.HcnUnregisterServiceCallback?
|
||||
//sys hcnCloseService(service hcnService) (hr error) = computenetwork.HcnCloseService?
|
||||
|
||||
type _guid = guid.GUID
|
||||
|
||||
type hcnNetwork syscall.Handle
|
||||
type hcnEndpoint syscall.Handle
|
||||
type hcnNamespace syscall.Handle
|
||||
type hcnLoadBalancer syscall.Handle
|
||||
type hcnService syscall.Handle
|
||||
type hcnCallbackHandle syscall.Handle
|
||||
|
||||
// SchemaVersion for HCN Objects/Queries.
|
||||
type SchemaVersion = Version // hcnglobals.go
|
||||
|
||||
// HostComputeQueryFlags are passed in to a HostComputeQuery to determine which
|
||||
// properties of an object are returned.
|
||||
type HostComputeQueryFlags uint32
|
||||
|
||||
var (
|
||||
// HostComputeQueryFlagsNone returns an object with the standard properties.
|
||||
HostComputeQueryFlagsNone HostComputeQueryFlags
|
||||
// HostComputeQueryFlagsDetailed returns an object with all properties.
|
||||
HostComputeQueryFlagsDetailed HostComputeQueryFlags = 1
|
||||
)
|
||||
|
||||
// HostComputeQuery is the format for HCN queries.
|
||||
type HostComputeQuery struct {
|
||||
SchemaVersion SchemaVersion `json:""`
|
||||
Flags HostComputeQueryFlags `json:",omitempty"`
|
||||
Filter string `json:",omitempty"`
|
||||
}
|
||||
|
||||
// defaultQuery generates HCN Query.
|
||||
// Passed into get/enumerate calls to filter results.
|
||||
func defaultQuery() HostComputeQuery {
|
||||
query := HostComputeQuery{
|
||||
SchemaVersion: SchemaVersion{
|
||||
Major: 2,
|
||||
Minor: 0,
|
||||
},
|
||||
Flags: HostComputeQueryFlagsNone,
|
||||
}
|
||||
return query
|
||||
}
|
||||
|
||||
func defaultQueryJson() string {
|
||||
query := defaultQuery()
|
||||
queryJson, err := json.Marshal(query)
|
||||
if err != nil {
|
||||
return ""
|
||||
}
|
||||
return string(queryJson)
|
||||
}
|
||||
|
||||
// PlatformDoesNotSupportError happens when users are attempting to use a newer shim on an older OS
|
||||
func platformDoesNotSupportError(featureName string) error {
|
||||
return fmt.Errorf("Platform does not support feature %s", featureName)
|
||||
}
|
||||
|
||||
// V2ApiSupported returns an error if the HCN version does not support the V2 Apis.
|
||||
func V2ApiSupported() error {
|
||||
supported := GetSupportedFeatures()
|
||||
if supported.Api.V2 {
|
||||
return nil
|
||||
}
|
||||
return platformDoesNotSupportError("V2 Api/Schema")
|
||||
}
|
||||
|
||||
func V2SchemaVersion() SchemaVersion {
|
||||
return SchemaVersion{
|
||||
Major: 2,
|
||||
Minor: 0,
|
||||
}
|
||||
}
|
||||
|
||||
// RemoteSubnetSupported returns an error if the HCN version does not support Remote Subnet policies.
|
||||
func RemoteSubnetSupported() error {
|
||||
supported := GetSupportedFeatures()
|
||||
if supported.RemoteSubnet {
|
||||
return nil
|
||||
}
|
||||
return platformDoesNotSupportError("Remote Subnet")
|
||||
}
|
||||
|
||||
// DSRSupported returns an error if the HCN version does not support Direct Server Return.
|
||||
func DSRSupported() error {
|
||||
supported := GetSupportedFeatures()
|
||||
if supported.DSR {
|
||||
return nil
|
||||
}
|
||||
return platformDoesNotSupportError("Direct Server Return (DSR)")
|
||||
}
|
||||
|
||||
// RequestType are the different operations performed to settings.
|
||||
// Used to update the settings of Endpoint/Namespace objects.
|
||||
type RequestType string
|
||||
|
||||
var (
|
||||
// RequestTypeAdd adds the provided settings object.
|
||||
RequestTypeAdd RequestType = "Add"
|
||||
// RequestTypeRemove removes the provided settings object.
|
||||
RequestTypeRemove RequestType = "Remove"
|
||||
// RequestTypeUpdate replaces settings with the ones provided.
|
||||
RequestTypeUpdate RequestType = "Update"
|
||||
// RequestTypeRefresh refreshes the settings provided.
|
||||
RequestTypeRefresh RequestType = "Refresh"
|
||||
)
|
||||
366
vendor/github.com/Microsoft/hcsshim/hcn/hcnendpoint.go
generated
vendored
Normal file
366
vendor/github.com/Microsoft/hcsshim/hcn/hcnendpoint.go
generated
vendored
Normal file
@@ -0,0 +1,366 @@
|
||||
package hcn
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/guid"
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// IpConfig is assoicated with an endpoint
|
||||
type IpConfig struct {
|
||||
IpAddress string `json:",omitempty"`
|
||||
PrefixLength uint8 `json:",omitempty"`
|
||||
}
|
||||
|
||||
// EndpointFlags are special settings on an endpoint.
|
||||
type EndpointFlags uint32
|
||||
|
||||
var (
|
||||
// EndpointFlagsNone is the default.
|
||||
EndpointFlagsNone EndpointFlags
|
||||
// EndpointFlagsRemoteEndpoint means that an endpoint is on another host.
|
||||
EndpointFlagsRemoteEndpoint EndpointFlags = 1
|
||||
)
|
||||
|
||||
// HostComputeEndpoint represents a network endpoint
|
||||
type HostComputeEndpoint struct {
|
||||
Id string `json:"ID,omitempty"`
|
||||
Name string `json:",omitempty"`
|
||||
HostComputeNetwork string `json:",omitempty"` // GUID
|
||||
HostComputeNamespace string `json:",omitempty"` // GUID
|
||||
Policies []EndpointPolicy `json:",omitempty"`
|
||||
IpConfigurations []IpConfig `json:",omitempty"`
|
||||
Dns Dns `json:",omitempty"`
|
||||
Routes []Route `json:",omitempty"`
|
||||
MacAddress string `json:",omitempty"`
|
||||
Flags EndpointFlags `json:",omitempty"`
|
||||
SchemaVersion SchemaVersion `json:",omitempty"`
|
||||
}
|
||||
|
||||
// EndpointResourceType are the two different Endpoint settings resources.
|
||||
type EndpointResourceType string
|
||||
|
||||
var (
|
||||
// EndpointResourceTypePolicy is for Endpoint Policies. Ex: ACL, NAT
|
||||
EndpointResourceTypePolicy EndpointResourceType = "Policy"
|
||||
// EndpointResourceTypePort is for Endpoint Port settings.
|
||||
EndpointResourceTypePort EndpointResourceType = "Port"
|
||||
)
|
||||
|
||||
// ModifyEndpointSettingRequest is the structure used to send request to modify an endpoint.
|
||||
// Used to update policy/port on an endpoint.
|
||||
type ModifyEndpointSettingRequest struct {
|
||||
ResourceType EndpointResourceType `json:",omitempty"` // Policy, Port
|
||||
RequestType RequestType `json:",omitempty"` // Add, Remove, Update, Refresh
|
||||
Settings json.RawMessage `json:",omitempty"`
|
||||
}
|
||||
|
||||
type PolicyEndpointRequest struct {
|
||||
Policies []EndpointPolicy `json:",omitempty"`
|
||||
}
|
||||
|
||||
func getEndpoint(endpointGuid guid.GUID, query string) (*HostComputeEndpoint, error) {
|
||||
// Open endpoint.
|
||||
var (
|
||||
endpointHandle hcnEndpoint
|
||||
resultBuffer *uint16
|
||||
propertiesBuffer *uint16
|
||||
)
|
||||
hr := hcnOpenEndpoint(&endpointGuid, &endpointHandle, &resultBuffer)
|
||||
if err := checkForErrors("hcnOpenEndpoint", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Query endpoint.
|
||||
hr = hcnQueryEndpointProperties(endpointHandle, query, &propertiesBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnQueryEndpointProperties", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer)
|
||||
// Close endpoint.
|
||||
hr = hcnCloseEndpoint(endpointHandle)
|
||||
if err := checkForErrors("hcnCloseEndpoint", hr, nil); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Convert output to HostComputeEndpoint
|
||||
var outputEndpoint HostComputeEndpoint
|
||||
if err := json.Unmarshal([]byte(properties), &outputEndpoint); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &outputEndpoint, nil
|
||||
}
|
||||
|
||||
func enumerateEndpoints(query string) ([]HostComputeEndpoint, error) {
|
||||
// Enumerate all Endpoint Guids
|
||||
var (
|
||||
resultBuffer *uint16
|
||||
endpointBuffer *uint16
|
||||
)
|
||||
hr := hcnEnumerateEndpoints(query, &endpointBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnEnumerateEndpoints", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
endpoints := interop.ConvertAndFreeCoTaskMemString(endpointBuffer)
|
||||
var endpointIds []guid.GUID
|
||||
err := json.Unmarshal([]byte(endpoints), &endpointIds)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
var outputEndpoints []HostComputeEndpoint
|
||||
for _, endpointGuid := range endpointIds {
|
||||
endpoint, err := getEndpoint(endpointGuid, query)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
outputEndpoints = append(outputEndpoints, *endpoint)
|
||||
}
|
||||
return outputEndpoints, nil
|
||||
}
|
||||
|
||||
func createEndpoint(networkId string, endpointSettings string) (*HostComputeEndpoint, error) {
|
||||
networkGuid := guid.FromString(networkId)
|
||||
// Open network.
|
||||
var networkHandle hcnNetwork
|
||||
var resultBuffer *uint16
|
||||
hr := hcnOpenNetwork(&networkGuid, &networkHandle, &resultBuffer)
|
||||
if err := checkForErrors("hcnOpenNetwork", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Create endpoint.
|
||||
endpointId := guid.GUID{}
|
||||
var endpointHandle hcnEndpoint
|
||||
hr = hcnCreateEndpoint(networkHandle, &endpointId, endpointSettings, &endpointHandle, &resultBuffer)
|
||||
if err := checkForErrors("hcnCreateEndpoint", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Query endpoint.
|
||||
hcnQuery := defaultQuery()
|
||||
query, err := json.Marshal(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
var propertiesBuffer *uint16
|
||||
hr = hcnQueryEndpointProperties(endpointHandle, string(query), &propertiesBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnQueryEndpointProperties", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer)
|
||||
// Close endpoint.
|
||||
hr = hcnCloseEndpoint(endpointHandle)
|
||||
if err := checkForErrors("hcnCloseEndpoint", hr, nil); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Close network.
|
||||
hr = hcnCloseNetwork(networkHandle)
|
||||
if err := checkForErrors("hcnCloseNetwork", hr, nil); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Convert output to HostComputeEndpoint
|
||||
var outputEndpoint HostComputeEndpoint
|
||||
if err := json.Unmarshal([]byte(properties), &outputEndpoint); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &outputEndpoint, nil
|
||||
}
|
||||
|
||||
func modifyEndpoint(endpointId string, settings string) (*HostComputeEndpoint, error) {
|
||||
endpointGuid := guid.FromString(endpointId)
|
||||
// Open endpoint
|
||||
var (
|
||||
endpointHandle hcnEndpoint
|
||||
resultBuffer *uint16
|
||||
propertiesBuffer *uint16
|
||||
)
|
||||
hr := hcnOpenEndpoint(&endpointGuid, &endpointHandle, &resultBuffer)
|
||||
if err := checkForErrors("hcnOpenEndpoint", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Modify endpoint
|
||||
hr = hcnModifyEndpoint(endpointHandle, settings, &resultBuffer)
|
||||
if err := checkForErrors("hcnModifyEndpoint", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Query endpoint.
|
||||
hcnQuery := defaultQuery()
|
||||
query, err := json.Marshal(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hr = hcnQueryEndpointProperties(endpointHandle, string(query), &propertiesBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnQueryEndpointProperties", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer)
|
||||
// Close endpoint.
|
||||
hr = hcnCloseEndpoint(endpointHandle)
|
||||
if err := checkForErrors("hcnCloseEndpoint", hr, nil); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Convert output to HostComputeEndpoint
|
||||
var outputEndpoint HostComputeEndpoint
|
||||
if err := json.Unmarshal([]byte(properties), &outputEndpoint); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &outputEndpoint, nil
|
||||
}
|
||||
|
||||
func deleteEndpoint(endpointId string) error {
|
||||
endpointGuid := guid.FromString(endpointId)
|
||||
var resultBuffer *uint16
|
||||
hr := hcnDeleteEndpoint(&endpointGuid, &resultBuffer)
|
||||
if err := checkForErrors("hcnDeleteEndpoint", hr, resultBuffer); err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// ListEndpoints makes a call to list all available endpoints.
|
||||
func ListEndpoints() ([]HostComputeEndpoint, error) {
|
||||
hcnQuery := defaultQuery()
|
||||
endpoints, err := ListEndpointsQuery(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return endpoints, nil
|
||||
}
|
||||
|
||||
// ListEndpointsQuery makes a call to query the list of available endpoints.
|
||||
func ListEndpointsQuery(query HostComputeQuery) ([]HostComputeEndpoint, error) {
|
||||
queryJson, err := json.Marshal(query)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
endpoints, err := enumerateEndpoints(string(queryJson))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return endpoints, nil
|
||||
}
|
||||
|
||||
// ListEndpointsOfNetwork queries the list of endpoints on a network.
|
||||
func ListEndpointsOfNetwork(networkId string) ([]HostComputeEndpoint, error) {
|
||||
hcnQuery := defaultQuery()
|
||||
// TODO: Once query can convert schema, change to {HostComputeNetwork:networkId}
|
||||
mapA := map[string]string{"VirtualNetwork": networkId}
|
||||
filter, err := json.Marshal(mapA)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hcnQuery.Filter = string(filter)
|
||||
|
||||
return ListEndpointsQuery(hcnQuery)
|
||||
}
|
||||
|
||||
// GetEndpointByID returns an endpoint specified by Id
|
||||
func GetEndpointByID(endpointId string) (*HostComputeEndpoint, error) {
|
||||
hcnQuery := defaultQuery()
|
||||
mapA := map[string]string{"ID": endpointId}
|
||||
filter, err := json.Marshal(mapA)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hcnQuery.Filter = string(filter)
|
||||
|
||||
endpoints, err := ListEndpointsQuery(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
if len(endpoints) == 0 {
|
||||
return nil, EndpointNotFoundError{EndpointID: endpointId}
|
||||
}
|
||||
return &endpoints[0], err
|
||||
}
|
||||
|
||||
// GetEndpointByName returns an endpoint specified by Name
|
||||
func GetEndpointByName(endpointName string) (*HostComputeEndpoint, error) {
|
||||
hcnQuery := defaultQuery()
|
||||
mapA := map[string]string{"Name": endpointName}
|
||||
filter, err := json.Marshal(mapA)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hcnQuery.Filter = string(filter)
|
||||
|
||||
endpoints, err := ListEndpointsQuery(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
if len(endpoints) == 0 {
|
||||
return nil, EndpointNotFoundError{EndpointName: endpointName}
|
||||
}
|
||||
return &endpoints[0], err
|
||||
}
|
||||
|
||||
// Create Endpoint.
|
||||
func (endpoint *HostComputeEndpoint) Create() (*HostComputeEndpoint, error) {
|
||||
logrus.Debugf("hcn::HostComputeEndpoint::Create id=%s", endpoint.Id)
|
||||
|
||||
jsonString, err := json.Marshal(endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
logrus.Debugf("hcn::HostComputeEndpoint::Create JSON: %s", jsonString)
|
||||
endpoint, hcnErr := createEndpoint(endpoint.HostComputeNetwork, string(jsonString))
|
||||
if hcnErr != nil {
|
||||
return nil, hcnErr
|
||||
}
|
||||
return endpoint, nil
|
||||
}
|
||||
|
||||
// Delete Endpoint.
|
||||
func (endpoint *HostComputeEndpoint) Delete() error {
|
||||
logrus.Debugf("hcn::HostComputeEndpoint::Delete id=%s", endpoint.Id)
|
||||
|
||||
if err := deleteEndpoint(endpoint.Id); err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// ModifyEndpointSettings updates the Port/Policy of an Endpoint.
|
||||
func ModifyEndpointSettings(endpointId string, request *ModifyEndpointSettingRequest) error {
|
||||
logrus.Debugf("hcn::HostComputeEndpoint::ModifyEndpointSettings id=%s", endpointId)
|
||||
|
||||
endpointSettingsRequest, err := json.Marshal(request)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err = modifyEndpoint(endpointId, string(endpointSettingsRequest))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// ApplyPolicy applies a Policy (ex: ACL) on the Endpoint.
|
||||
func (endpoint *HostComputeEndpoint) ApplyPolicy(endpointPolicy PolicyEndpointRequest) error {
|
||||
logrus.Debugf("hcn::HostComputeEndpoint::ApplyPolicy id=%s", endpoint.Id)
|
||||
|
||||
settingsJson, err := json.Marshal(endpointPolicy)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
requestMessage := &ModifyEndpointSettingRequest{
|
||||
ResourceType: EndpointResourceTypePolicy,
|
||||
RequestType: RequestTypeUpdate,
|
||||
Settings: settingsJson,
|
||||
}
|
||||
|
||||
return ModifyEndpointSettings(endpoint.Id, requestMessage)
|
||||
}
|
||||
|
||||
// NamespaceAttach modifies a Namespace to add an endpoint.
|
||||
func (endpoint *HostComputeEndpoint) NamespaceAttach(namespaceId string) error {
|
||||
return AddNamespaceEndpoint(namespaceId, endpoint.Id)
|
||||
}
|
||||
|
||||
// NamespaceDetach modifies a Namespace to remove an endpoint.
|
||||
func (endpoint *HostComputeEndpoint) NamespaceDetach(namespaceId string) error {
|
||||
return RemoveNamespaceEndpoint(namespaceId, endpoint.Id)
|
||||
}
|
||||
95
vendor/github.com/Microsoft/hcsshim/hcn/hcnerrors.go
generated
vendored
Normal file
95
vendor/github.com/Microsoft/hcsshim/hcn/hcnerrors.go
generated
vendored
Normal file
@@ -0,0 +1,95 @@
|
||||
// Package hcn is a shim for the Host Compute Networking (HCN) service, which manages networking for Windows Server
|
||||
// containers and Hyper-V containers. Previous to RS5, HCN was referred to as Host Networking Service (HNS).
|
||||
package hcn
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/hcserror"
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
func checkForErrors(methodName string, hr error, resultBuffer *uint16) error {
|
||||
errorFound := false
|
||||
|
||||
if hr != nil {
|
||||
errorFound = true
|
||||
}
|
||||
|
||||
result := ""
|
||||
if resultBuffer != nil {
|
||||
result = interop.ConvertAndFreeCoTaskMemString(resultBuffer)
|
||||
if result != "" {
|
||||
errorFound = true
|
||||
}
|
||||
}
|
||||
|
||||
if errorFound {
|
||||
returnError := hcserror.New(hr, methodName, result)
|
||||
logrus.Debugf(returnError.Error()) // HCN errors logged for debugging.
|
||||
return returnError
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// NetworkNotFoundError results from a failed seach for a network by Id or Name
|
||||
type NetworkNotFoundError struct {
|
||||
NetworkName string
|
||||
NetworkID string
|
||||
}
|
||||
|
||||
func (e NetworkNotFoundError) Error() string {
|
||||
if e.NetworkName == "" {
|
||||
return fmt.Sprintf("Network Name %s not found", e.NetworkName)
|
||||
}
|
||||
return fmt.Sprintf("Network Id %s not found", e.NetworkID)
|
||||
}
|
||||
|
||||
// EndpointNotFoundError results from a failed seach for an endpoint by Id or Name
|
||||
type EndpointNotFoundError struct {
|
||||
EndpointName string
|
||||
EndpointID string
|
||||
}
|
||||
|
||||
func (e EndpointNotFoundError) Error() string {
|
||||
if e.EndpointName == "" {
|
||||
return fmt.Sprintf("Endpoint Name %s not found", e.EndpointName)
|
||||
}
|
||||
return fmt.Sprintf("Endpoint Id %s not found", e.EndpointID)
|
||||
}
|
||||
|
||||
// NamespaceNotFoundError results from a failed seach for a namsepace by Id
|
||||
type NamespaceNotFoundError struct {
|
||||
NamespaceID string
|
||||
}
|
||||
|
||||
func (e NamespaceNotFoundError) Error() string {
|
||||
return fmt.Sprintf("Namespace %s not found", e.NamespaceID)
|
||||
}
|
||||
|
||||
// LoadBalancerNotFoundError results from a failed seach for a loadbalancer by Id
|
||||
type LoadBalancerNotFoundError struct {
|
||||
LoadBalancerId string
|
||||
}
|
||||
|
||||
func (e LoadBalancerNotFoundError) Error() string {
|
||||
return fmt.Sprintf("LoadBalancer %s not found", e.LoadBalancerId)
|
||||
}
|
||||
|
||||
// IsNotFoundError returns a boolean indicating whether the error was caused by
|
||||
// a resource not being found.
|
||||
func IsNotFoundError(err error) bool {
|
||||
switch err.(type) {
|
||||
case NetworkNotFoundError:
|
||||
return true
|
||||
case EndpointNotFoundError:
|
||||
return true
|
||||
case NamespaceNotFoundError:
|
||||
return true
|
||||
case LoadBalancerNotFoundError:
|
||||
return true
|
||||
}
|
||||
return false
|
||||
}
|
||||
85
vendor/github.com/Microsoft/hcsshim/hcn/hcnglobals.go
generated
vendored
Normal file
85
vendor/github.com/Microsoft/hcsshim/hcn/hcnglobals.go
generated
vendored
Normal file
@@ -0,0 +1,85 @@
|
||||
package hcn
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/hcserror"
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// Globals are all global properties of the HCN Service.
|
||||
type Globals struct {
|
||||
Version Version `json:"Version"`
|
||||
}
|
||||
|
||||
// Version is the HCN Service version.
|
||||
type Version struct {
|
||||
Major int `json:"Major"`
|
||||
Minor int `json:"Minor"`
|
||||
}
|
||||
|
||||
var (
|
||||
// HNSVersion1803 added ACL functionality.
|
||||
HNSVersion1803 = Version{Major: 7, Minor: 2}
|
||||
// V2ApiSupport allows the use of V2 Api calls and V2 Schema.
|
||||
V2ApiSupport = Version{Major: 9, Minor: 1}
|
||||
// Remote Subnet allows for Remote Subnet policies on Overlay networks
|
||||
RemoteSubnetVersion = Version{Major: 9, Minor: 2}
|
||||
// HNS 10.2 allows for Direct Server Return for loadbalancing
|
||||
DSRVersion = Version{Major: 10, Minor: 2}
|
||||
)
|
||||
|
||||
// GetGlobals returns the global properties of the HCN Service.
|
||||
func GetGlobals() (*Globals, error) {
|
||||
var version Version
|
||||
err := hnsCall("GET", "/globals/version", "", &version)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
globals := &Globals{
|
||||
Version: version,
|
||||
}
|
||||
|
||||
return globals, nil
|
||||
}
|
||||
|
||||
type hnsResponse struct {
|
||||
Success bool
|
||||
Error string
|
||||
Output json.RawMessage
|
||||
}
|
||||
|
||||
func hnsCall(method, path, request string, returnResponse interface{}) error {
|
||||
var responseBuffer *uint16
|
||||
logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request)
|
||||
|
||||
err := _hnsCall(method, path, request, &responseBuffer)
|
||||
if err != nil {
|
||||
return hcserror.New(err, "hnsCall ", "")
|
||||
}
|
||||
response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
|
||||
|
||||
hnsresponse := &hnsResponse{}
|
||||
if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if !hnsresponse.Success {
|
||||
return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error)
|
||||
}
|
||||
|
||||
if len(hnsresponse.Output) == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
logrus.Debugf("Network Response : %s", hnsresponse.Output)
|
||||
err = json.Unmarshal(hnsresponse.Output, returnResponse)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
321
vendor/github.com/Microsoft/hcsshim/hcn/hcnloadbalancer.go
generated
vendored
Normal file
321
vendor/github.com/Microsoft/hcsshim/hcn/hcnloadbalancer.go
generated
vendored
Normal file
@@ -0,0 +1,321 @@
|
||||
package hcn
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/guid"
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// LoadBalancerPortMapping is associated with HostComputeLoadBalancer
|
||||
type LoadBalancerPortMapping struct {
|
||||
Protocol uint32 `json:",omitempty"` // EX: TCP = 6, UDP = 17
|
||||
InternalPort uint16 `json:",omitempty"`
|
||||
ExternalPort uint16 `json:",omitempty"`
|
||||
Flags uint32 `json:",omitempty"` // 0: None, 1: EnableILB, 2: LocalRoutedVip
|
||||
}
|
||||
|
||||
// HostComputeLoadBalancer represents software load balancer.
|
||||
type HostComputeLoadBalancer struct {
|
||||
Id string `json:"ID,omitempty"`
|
||||
HostComputeEndpoints []string `json:",omitempty"`
|
||||
SourceVIP string `json:",omitempty"`
|
||||
FrontendVIPs []string `json:",omitempty"`
|
||||
PortMappings []LoadBalancerPortMapping `json:",omitempty"`
|
||||
SchemaVersion SchemaVersion `json:",omitempty"`
|
||||
Flags uint32 `json:",omitempty"` // 0: None, 1: EnableDirectServerReturn
|
||||
}
|
||||
|
||||
func getLoadBalancer(loadBalancerGuid guid.GUID, query string) (*HostComputeLoadBalancer, error) {
|
||||
// Open loadBalancer.
|
||||
var (
|
||||
loadBalancerHandle hcnLoadBalancer
|
||||
resultBuffer *uint16
|
||||
propertiesBuffer *uint16
|
||||
)
|
||||
hr := hcnOpenLoadBalancer(&loadBalancerGuid, &loadBalancerHandle, &resultBuffer)
|
||||
if err := checkForErrors("hcnOpenLoadBalancer", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Query loadBalancer.
|
||||
hr = hcnQueryLoadBalancerProperties(loadBalancerHandle, query, &propertiesBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnQueryLoadBalancerProperties", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer)
|
||||
// Close loadBalancer.
|
||||
hr = hcnCloseLoadBalancer(loadBalancerHandle)
|
||||
if err := checkForErrors("hcnCloseLoadBalancer", hr, nil); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Convert output to HostComputeLoadBalancer
|
||||
var outputLoadBalancer HostComputeLoadBalancer
|
||||
if err := json.Unmarshal([]byte(properties), &outputLoadBalancer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &outputLoadBalancer, nil
|
||||
}
|
||||
|
||||
func enumerateLoadBalancers(query string) ([]HostComputeLoadBalancer, error) {
|
||||
// Enumerate all LoadBalancer Guids
|
||||
var (
|
||||
resultBuffer *uint16
|
||||
loadBalancerBuffer *uint16
|
||||
)
|
||||
hr := hcnEnumerateLoadBalancers(query, &loadBalancerBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnEnumerateLoadBalancers", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
loadBalancers := interop.ConvertAndFreeCoTaskMemString(loadBalancerBuffer)
|
||||
var loadBalancerIds []guid.GUID
|
||||
if err := json.Unmarshal([]byte(loadBalancers), &loadBalancerIds); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
var outputLoadBalancers []HostComputeLoadBalancer
|
||||
for _, loadBalancerGuid := range loadBalancerIds {
|
||||
loadBalancer, err := getLoadBalancer(loadBalancerGuid, query)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
outputLoadBalancers = append(outputLoadBalancers, *loadBalancer)
|
||||
}
|
||||
return outputLoadBalancers, nil
|
||||
}
|
||||
|
||||
func createLoadBalancer(settings string) (*HostComputeLoadBalancer, error) {
|
||||
// Create new loadBalancer.
|
||||
var (
|
||||
loadBalancerHandle hcnLoadBalancer
|
||||
resultBuffer *uint16
|
||||
propertiesBuffer *uint16
|
||||
)
|
||||
loadBalancerGuid := guid.GUID{}
|
||||
hr := hcnCreateLoadBalancer(&loadBalancerGuid, settings, &loadBalancerHandle, &resultBuffer)
|
||||
if err := checkForErrors("hcnCreateLoadBalancer", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Query loadBalancer.
|
||||
hcnQuery := defaultQuery()
|
||||
query, err := json.Marshal(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hr = hcnQueryLoadBalancerProperties(loadBalancerHandle, string(query), &propertiesBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnQueryLoadBalancerProperties", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer)
|
||||
// Close loadBalancer.
|
||||
hr = hcnCloseLoadBalancer(loadBalancerHandle)
|
||||
if err := checkForErrors("hcnCloseLoadBalancer", hr, nil); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Convert output to HostComputeLoadBalancer
|
||||
var outputLoadBalancer HostComputeLoadBalancer
|
||||
if err := json.Unmarshal([]byte(properties), &outputLoadBalancer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &outputLoadBalancer, nil
|
||||
}
|
||||
|
||||
func modifyLoadBalancer(loadBalancerId string, settings string) (*HostComputeLoadBalancer, error) {
|
||||
loadBalancerGuid := guid.FromString(loadBalancerId)
|
||||
// Open loadBalancer.
|
||||
var (
|
||||
loadBalancerHandle hcnLoadBalancer
|
||||
resultBuffer *uint16
|
||||
propertiesBuffer *uint16
|
||||
)
|
||||
hr := hcnOpenLoadBalancer(&loadBalancerGuid, &loadBalancerHandle, &resultBuffer)
|
||||
if err := checkForErrors("hcnOpenLoadBalancer", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Modify loadBalancer.
|
||||
hr = hcnModifyLoadBalancer(loadBalancerHandle, settings, &resultBuffer)
|
||||
if err := checkForErrors("hcnModifyLoadBalancer", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Query loadBalancer.
|
||||
hcnQuery := defaultQuery()
|
||||
query, err := json.Marshal(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hr = hcnQueryLoadBalancerProperties(loadBalancerHandle, string(query), &propertiesBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnQueryLoadBalancerProperties", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer)
|
||||
// Close loadBalancer.
|
||||
hr = hcnCloseLoadBalancer(loadBalancerHandle)
|
||||
if err := checkForErrors("hcnCloseLoadBalancer", hr, nil); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Convert output to LoadBalancer
|
||||
var outputLoadBalancer HostComputeLoadBalancer
|
||||
if err := json.Unmarshal([]byte(properties), &outputLoadBalancer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &outputLoadBalancer, nil
|
||||
}
|
||||
|
||||
func deleteLoadBalancer(loadBalancerId string) error {
|
||||
loadBalancerGuid := guid.FromString(loadBalancerId)
|
||||
var resultBuffer *uint16
|
||||
hr := hcnDeleteLoadBalancer(&loadBalancerGuid, &resultBuffer)
|
||||
if err := checkForErrors("hcnDeleteLoadBalancer", hr, resultBuffer); err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// ListLoadBalancers makes a call to list all available loadBalancers.
|
||||
func ListLoadBalancers() ([]HostComputeLoadBalancer, error) {
|
||||
hcnQuery := defaultQuery()
|
||||
loadBalancers, err := ListLoadBalancersQuery(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return loadBalancers, nil
|
||||
}
|
||||
|
||||
// ListLoadBalancersQuery makes a call to query the list of available loadBalancers.
|
||||
func ListLoadBalancersQuery(query HostComputeQuery) ([]HostComputeLoadBalancer, error) {
|
||||
queryJson, err := json.Marshal(query)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
loadBalancers, err := enumerateLoadBalancers(string(queryJson))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return loadBalancers, nil
|
||||
}
|
||||
|
||||
// GetLoadBalancerByID returns the LoadBalancer specified by Id.
|
||||
func GetLoadBalancerByID(loadBalancerId string) (*HostComputeLoadBalancer, error) {
|
||||
hcnQuery := defaultQuery()
|
||||
mapA := map[string]string{"ID": loadBalancerId}
|
||||
filter, err := json.Marshal(mapA)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hcnQuery.Filter = string(filter)
|
||||
|
||||
loadBalancers, err := ListLoadBalancersQuery(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
if len(loadBalancers) == 0 {
|
||||
return nil, LoadBalancerNotFoundError{LoadBalancerId: loadBalancerId}
|
||||
}
|
||||
return &loadBalancers[0], err
|
||||
}
|
||||
|
||||
// Create LoadBalancer.
|
||||
func (loadBalancer *HostComputeLoadBalancer) Create() (*HostComputeLoadBalancer, error) {
|
||||
logrus.Debugf("hcn::HostComputeLoadBalancer::Create id=%s", loadBalancer.Id)
|
||||
|
||||
jsonString, err := json.Marshal(loadBalancer)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
logrus.Debugf("hcn::HostComputeLoadBalancer::Create JSON: %s", jsonString)
|
||||
loadBalancer, hcnErr := createLoadBalancer(string(jsonString))
|
||||
if hcnErr != nil {
|
||||
return nil, hcnErr
|
||||
}
|
||||
return loadBalancer, nil
|
||||
}
|
||||
|
||||
// Delete LoadBalancer.
|
||||
func (loadBalancer *HostComputeLoadBalancer) Delete() error {
|
||||
logrus.Debugf("hcn::HostComputeLoadBalancer::Delete id=%s", loadBalancer.Id)
|
||||
|
||||
if err := deleteLoadBalancer(loadBalancer.Id); err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// AddEndpoint add an endpoint to a LoadBalancer
|
||||
func (loadBalancer *HostComputeLoadBalancer) AddEndpoint(endpoint *HostComputeEndpoint) (*HostComputeLoadBalancer, error) {
|
||||
logrus.Debugf("hcn::HostComputeLoadBalancer::AddEndpoint loadBalancer=%s endpoint=%s", loadBalancer.Id, endpoint.Id)
|
||||
|
||||
err := loadBalancer.Delete()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// Add Endpoint to the Existing List
|
||||
loadBalancer.HostComputeEndpoints = append(loadBalancer.HostComputeEndpoints, endpoint.Id)
|
||||
|
||||
return loadBalancer.Create()
|
||||
}
|
||||
|
||||
// RemoveEndpoint removes an endpoint from a LoadBalancer
|
||||
func (loadBalancer *HostComputeLoadBalancer) RemoveEndpoint(endpoint *HostComputeEndpoint) (*HostComputeLoadBalancer, error) {
|
||||
logrus.Debugf("hcn::HostComputeLoadBalancer::RemoveEndpoint loadBalancer=%s endpoint=%s", loadBalancer.Id, endpoint.Id)
|
||||
|
||||
err := loadBalancer.Delete()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// Create a list of all the endpoints besides the one being removed
|
||||
var endpoints []string
|
||||
for _, endpointReference := range loadBalancer.HostComputeEndpoints {
|
||||
if endpointReference == endpoint.Id {
|
||||
continue
|
||||
}
|
||||
endpoints = append(endpoints, endpointReference)
|
||||
}
|
||||
loadBalancer.HostComputeEndpoints = endpoints
|
||||
return loadBalancer.Create()
|
||||
}
|
||||
|
||||
// AddLoadBalancer for the specified endpoints
|
||||
func AddLoadBalancer(endpoints []HostComputeEndpoint, isILB bool, isDSR bool, sourceVIP string, frontendVIPs []string, protocol uint16, internalPort uint16, externalPort uint16) (*HostComputeLoadBalancer, error) {
|
||||
logrus.Debugf("hcn::HostComputeLoadBalancer::AddLoadBalancer endpointId=%v, isILB=%v, sourceVIP=%s, frontendVIPs=%v, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, frontendVIPs, protocol, internalPort, externalPort)
|
||||
|
||||
var portMappingFlags uint32
|
||||
portMappingFlags = 0
|
||||
if isILB {
|
||||
portMappingFlags = 1
|
||||
}
|
||||
|
||||
var lbFlags uint32
|
||||
lbFlags = 0
|
||||
if isDSR {
|
||||
lbFlags = 1 // EnableDirectServerReturn
|
||||
}
|
||||
|
||||
loadBalancer := &HostComputeLoadBalancer{
|
||||
SourceVIP: sourceVIP,
|
||||
PortMappings: []LoadBalancerPortMapping{
|
||||
{
|
||||
Protocol: uint32(protocol),
|
||||
InternalPort: internalPort,
|
||||
ExternalPort: externalPort,
|
||||
Flags: portMappingFlags,
|
||||
},
|
||||
},
|
||||
FrontendVIPs: frontendVIPs,
|
||||
SchemaVersion: SchemaVersion{
|
||||
Major: 2,
|
||||
Minor: 0,
|
||||
},
|
||||
Flags: lbFlags,
|
||||
}
|
||||
|
||||
for _, endpoint := range endpoints {
|
||||
loadBalancer.HostComputeEndpoints = append(loadBalancer.HostComputeEndpoints, endpoint.Id)
|
||||
}
|
||||
|
||||
return loadBalancer.Create()
|
||||
}
|
||||
424
vendor/github.com/Microsoft/hcsshim/hcn/hcnnamespace.go
generated
vendored
Normal file
424
vendor/github.com/Microsoft/hcsshim/hcn/hcnnamespace.go
generated
vendored
Normal file
@@ -0,0 +1,424 @@
|
||||
package hcn
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"os"
|
||||
"syscall"
|
||||
|
||||
icni "github.com/Microsoft/hcsshim/internal/cni"
|
||||
"github.com/Microsoft/hcsshim/internal/guid"
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/regstate"
|
||||
"github.com/Microsoft/hcsshim/internal/runhcs"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// NamespaceResourceEndpoint represents an Endpoint attached to a Namespace.
|
||||
type NamespaceResourceEndpoint struct {
|
||||
Id string `json:"ID,"`
|
||||
}
|
||||
|
||||
// NamespaceResourceContainer represents a Container attached to a Namespace.
|
||||
type NamespaceResourceContainer struct {
|
||||
Id string `json:"ID,"`
|
||||
}
|
||||
|
||||
// NamespaceResourceType determines whether the Namespace resource is a Container or Endpoint.
|
||||
type NamespaceResourceType string
|
||||
|
||||
var (
|
||||
// NamespaceResourceTypeContainer are contianers associated with a Namespace.
|
||||
NamespaceResourceTypeContainer NamespaceResourceType = "Container"
|
||||
// NamespaceResourceTypeEndpoint are endpoints associated with a Namespace.
|
||||
NamespaceResourceTypeEndpoint NamespaceResourceType = "Endpoint"
|
||||
)
|
||||
|
||||
// NamespaceResource is associated with a namespace
|
||||
type NamespaceResource struct {
|
||||
Type NamespaceResourceType `json:","` // Container, Endpoint
|
||||
Data json.RawMessage `json:","`
|
||||
}
|
||||
|
||||
// NamespaceType determines whether the Namespace is for a Host or Guest
|
||||
type NamespaceType string
|
||||
|
||||
var (
|
||||
// NamespaceTypeHost are host namespaces.
|
||||
NamespaceTypeHost NamespaceType = "Host"
|
||||
// NamespaceTypeHostDefault are host namespaces in the default compartment.
|
||||
NamespaceTypeHostDefault NamespaceType = "HostDefault"
|
||||
// NamespaceTypeGuest are guest namespaces.
|
||||
NamespaceTypeGuest NamespaceType = "Guest"
|
||||
// NamespaceTypeGuestDefault are guest namespaces in the default compartment.
|
||||
NamespaceTypeGuestDefault NamespaceType = "GuestDefault"
|
||||
)
|
||||
|
||||
// HostComputeNamespace represents a namespace (AKA compartment) in
|
||||
type HostComputeNamespace struct {
|
||||
Id string `json:"ID,omitempty"`
|
||||
NamespaceId uint32 `json:",omitempty"`
|
||||
Type NamespaceType `json:",omitempty"` // Host, HostDefault, Guest, GuestDefault
|
||||
Resources []NamespaceResource `json:",omitempty"`
|
||||
SchemaVersion SchemaVersion `json:",omitempty"`
|
||||
}
|
||||
|
||||
// ModifyNamespaceSettingRequest is the structure used to send request to modify a namespace.
|
||||
// Used to Add/Remove an endpoints and containers to/from a namespace.
|
||||
type ModifyNamespaceSettingRequest struct {
|
||||
ResourceType NamespaceResourceType `json:",omitempty"` // Container, Endpoint
|
||||
RequestType RequestType `json:",omitempty"` // Add, Remove, Update, Refresh
|
||||
Settings json.RawMessage `json:",omitempty"`
|
||||
}
|
||||
|
||||
func getNamespace(namespaceGuid guid.GUID, query string) (*HostComputeNamespace, error) {
|
||||
// Open namespace.
|
||||
var (
|
||||
namespaceHandle hcnNamespace
|
||||
resultBuffer *uint16
|
||||
propertiesBuffer *uint16
|
||||
)
|
||||
hr := hcnOpenNamespace(&namespaceGuid, &namespaceHandle, &resultBuffer)
|
||||
if err := checkForErrors("hcnOpenNamespace", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Query namespace.
|
||||
hr = hcnQueryNamespaceProperties(namespaceHandle, query, &propertiesBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnQueryNamespaceProperties", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer)
|
||||
// Close namespace.
|
||||
hr = hcnCloseNamespace(namespaceHandle)
|
||||
if err := checkForErrors("hcnCloseNamespace", hr, nil); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Convert output to HostComputeNamespace
|
||||
var outputNamespace HostComputeNamespace
|
||||
if err := json.Unmarshal([]byte(properties), &outputNamespace); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &outputNamespace, nil
|
||||
}
|
||||
|
||||
func enumerateNamespaces(query string) ([]HostComputeNamespace, error) {
|
||||
// Enumerate all Namespace Guids
|
||||
var (
|
||||
resultBuffer *uint16
|
||||
namespaceBuffer *uint16
|
||||
)
|
||||
hr := hcnEnumerateNamespaces(query, &namespaceBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnEnumerateNamespaces", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
namespaces := interop.ConvertAndFreeCoTaskMemString(namespaceBuffer)
|
||||
var namespaceIds []guid.GUID
|
||||
if err := json.Unmarshal([]byte(namespaces), &namespaceIds); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
var outputNamespaces []HostComputeNamespace
|
||||
for _, namespaceGuid := range namespaceIds {
|
||||
namespace, err := getNamespace(namespaceGuid, query)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
outputNamespaces = append(outputNamespaces, *namespace)
|
||||
}
|
||||
return outputNamespaces, nil
|
||||
}
|
||||
|
||||
func createNamespace(settings string) (*HostComputeNamespace, error) {
|
||||
// Create new namespace.
|
||||
var (
|
||||
namespaceHandle hcnNamespace
|
||||
resultBuffer *uint16
|
||||
propertiesBuffer *uint16
|
||||
)
|
||||
namespaceGuid := guid.GUID{}
|
||||
hr := hcnCreateNamespace(&namespaceGuid, settings, &namespaceHandle, &resultBuffer)
|
||||
if err := checkForErrors("hcnCreateNamespace", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Query namespace.
|
||||
hcnQuery := defaultQuery()
|
||||
query, err := json.Marshal(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hr = hcnQueryNamespaceProperties(namespaceHandle, string(query), &propertiesBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnQueryNamespaceProperties", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer)
|
||||
// Close namespace.
|
||||
hr = hcnCloseNamespace(namespaceHandle)
|
||||
if err := checkForErrors("hcnCloseNamespace", hr, nil); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Convert output to HostComputeNamespace
|
||||
var outputNamespace HostComputeNamespace
|
||||
if err := json.Unmarshal([]byte(properties), &outputNamespace); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &outputNamespace, nil
|
||||
}
|
||||
|
||||
func modifyNamespace(namespaceId string, settings string) (*HostComputeNamespace, error) {
|
||||
namespaceGuid := guid.FromString(namespaceId)
|
||||
// Open namespace.
|
||||
var (
|
||||
namespaceHandle hcnNamespace
|
||||
resultBuffer *uint16
|
||||
propertiesBuffer *uint16
|
||||
)
|
||||
hr := hcnOpenNamespace(&namespaceGuid, &namespaceHandle, &resultBuffer)
|
||||
if err := checkForErrors("hcnOpenNamespace", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Modify namespace.
|
||||
hr = hcnModifyNamespace(namespaceHandle, settings, &resultBuffer)
|
||||
if err := checkForErrors("hcnModifyNamespace", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Query namespace.
|
||||
hcnQuery := defaultQuery()
|
||||
query, err := json.Marshal(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hr = hcnQueryNamespaceProperties(namespaceHandle, string(query), &propertiesBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnQueryNamespaceProperties", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer)
|
||||
// Close namespace.
|
||||
hr = hcnCloseNamespace(namespaceHandle)
|
||||
if err := checkForErrors("hcnCloseNamespace", hr, nil); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Convert output to Namespace
|
||||
var outputNamespace HostComputeNamespace
|
||||
if err := json.Unmarshal([]byte(properties), &outputNamespace); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &outputNamespace, nil
|
||||
}
|
||||
|
||||
func deleteNamespace(namespaceId string) error {
|
||||
namespaceGuid := guid.FromString(namespaceId)
|
||||
var resultBuffer *uint16
|
||||
hr := hcnDeleteNamespace(&namespaceGuid, &resultBuffer)
|
||||
if err := checkForErrors("hcnDeleteNamespace", hr, resultBuffer); err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// ListNamespaces makes a call to list all available namespaces.
|
||||
func ListNamespaces() ([]HostComputeNamespace, error) {
|
||||
hcnQuery := defaultQuery()
|
||||
namespaces, err := ListNamespacesQuery(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return namespaces, nil
|
||||
}
|
||||
|
||||
// ListNamespacesQuery makes a call to query the list of available namespaces.
|
||||
func ListNamespacesQuery(query HostComputeQuery) ([]HostComputeNamespace, error) {
|
||||
queryJson, err := json.Marshal(query)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
namespaces, err := enumerateNamespaces(string(queryJson))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return namespaces, nil
|
||||
}
|
||||
|
||||
// GetNamespaceByID returns the Namespace specified by Id.
|
||||
func GetNamespaceByID(namespaceId string) (*HostComputeNamespace, error) {
|
||||
return getNamespace(guid.FromString(namespaceId), defaultQueryJson())
|
||||
}
|
||||
|
||||
// GetNamespaceEndpointIds returns the endpoints of the Namespace specified by Id.
|
||||
func GetNamespaceEndpointIds(namespaceId string) ([]string, error) {
|
||||
namespace, err := GetNamespaceByID(namespaceId)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
var endpointsIds []string
|
||||
for _, resource := range namespace.Resources {
|
||||
if resource.Type == "Endpoint" {
|
||||
var endpointResource NamespaceResourceEndpoint
|
||||
if err := json.Unmarshal([]byte(resource.Data), &endpointResource); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
endpointsIds = append(endpointsIds, endpointResource.Id)
|
||||
}
|
||||
}
|
||||
return endpointsIds, nil
|
||||
}
|
||||
|
||||
// GetNamespaceContainerIds returns the containers of the Namespace specified by Id.
|
||||
func GetNamespaceContainerIds(namespaceId string) ([]string, error) {
|
||||
namespace, err := GetNamespaceByID(namespaceId)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
var containerIds []string
|
||||
for _, resource := range namespace.Resources {
|
||||
if resource.Type == "Container" {
|
||||
var contaienrResource NamespaceResourceContainer
|
||||
if err := json.Unmarshal([]byte(resource.Data), &contaienrResource); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
containerIds = append(containerIds, contaienrResource.Id)
|
||||
}
|
||||
}
|
||||
return containerIds, nil
|
||||
}
|
||||
|
||||
// NewNamespace creates a new Namespace object
|
||||
func NewNamespace(nsType NamespaceType) *HostComputeNamespace {
|
||||
return &HostComputeNamespace{
|
||||
Type: nsType,
|
||||
SchemaVersion: V2SchemaVersion(),
|
||||
}
|
||||
}
|
||||
|
||||
// Create Namespace.
|
||||
func (namespace *HostComputeNamespace) Create() (*HostComputeNamespace, error) {
|
||||
logrus.Debugf("hcn::HostComputeNamespace::Create id=%s", namespace.Id)
|
||||
|
||||
jsonString, err := json.Marshal(namespace)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
logrus.Debugf("hcn::HostComputeNamespace::Create JSON: %s", jsonString)
|
||||
namespace, hcnErr := createNamespace(string(jsonString))
|
||||
if hcnErr != nil {
|
||||
return nil, hcnErr
|
||||
}
|
||||
return namespace, nil
|
||||
}
|
||||
|
||||
// Delete Namespace.
|
||||
func (namespace *HostComputeNamespace) Delete() error {
|
||||
logrus.Debugf("hcn::HostComputeNamespace::Delete id=%s", namespace.Id)
|
||||
|
||||
if err := deleteNamespace(namespace.Id); err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// Sync Namespace endpoints with the appropriate sandbox container holding the
|
||||
// network namespace open. If no sandbox container is found for this namespace
|
||||
// this method is determined to be a success and will not return an error in
|
||||
// this case. If the sandbox container is found and a sync is initiated any
|
||||
// failures will be returned via this method.
|
||||
//
|
||||
// This call initiates a sync between endpoints and the matching UtilityVM
|
||||
// hosting those endpoints. It is safe to call for any `NamespaceType` but
|
||||
// `NamespaceTypeGuest` is the only case when a sync will actually occur. For
|
||||
// `NamespaceTypeHost` the process container will be automatically synchronized
|
||||
// when the the endpoint is added via `AddNamespaceEndpoint`.
|
||||
//
|
||||
// Note: This method sync's both additions and removals of endpoints from a
|
||||
// `NamespaceTypeGuest` namespace.
|
||||
func (namespace *HostComputeNamespace) Sync() error {
|
||||
logrus.WithField("id", namespace.Id).Debugf("hcs::HostComputeNamespace::Sync")
|
||||
|
||||
// We only attempt a sync for namespace guest.
|
||||
if namespace.Type != NamespaceTypeGuest {
|
||||
return nil
|
||||
}
|
||||
|
||||
// Look in the registry for the key to map from namespace id to pod-id
|
||||
cfg, err := icni.LoadPersistedNamespaceConfig(namespace.Id)
|
||||
if err != nil {
|
||||
if regstate.IsNotFoundError(err) {
|
||||
return nil
|
||||
}
|
||||
return err
|
||||
}
|
||||
req := runhcs.VMRequest{
|
||||
ID: cfg.ContainerID,
|
||||
Op: runhcs.OpSyncNamespace,
|
||||
}
|
||||
shimPath := runhcs.VMPipePath(cfg.HostUniqueID)
|
||||
if err := runhcs.IssueVMRequest(shimPath, &req); err != nil {
|
||||
// The shim is likey gone. Simply ignore the sync as if it didn't exist.
|
||||
if perr, ok := err.(*os.PathError); ok && perr.Err == syscall.ERROR_FILE_NOT_FOUND {
|
||||
// Remove the reg key there is no point to try again
|
||||
cfg.Remove()
|
||||
return nil
|
||||
}
|
||||
f := map[string]interface{}{
|
||||
"id": namespace.Id,
|
||||
"container-id": cfg.ContainerID,
|
||||
}
|
||||
logrus.WithFields(f).
|
||||
WithError(err).
|
||||
Debugf("hcs::HostComputeNamespace::Sync failed to connect to shim pipe: '%s'", shimPath)
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// ModifyNamespaceSettings updates the Endpoints/Containers of a Namespace.
|
||||
func ModifyNamespaceSettings(namespaceId string, request *ModifyNamespaceSettingRequest) error {
|
||||
logrus.Debugf("hcn::HostComputeNamespace::ModifyNamespaceSettings id=%s", namespaceId)
|
||||
|
||||
namespaceSettings, err := json.Marshal(request)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err = modifyNamespace(namespaceId, string(namespaceSettings))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// AddNamespaceEndpoint adds an endpoint to a Namespace.
|
||||
func AddNamespaceEndpoint(namespaceId string, endpointId string) error {
|
||||
logrus.Debugf("hcn::HostComputeEndpoint::AddNamespaceEndpoint id=%s", endpointId)
|
||||
|
||||
mapA := map[string]string{"EndpointId": endpointId}
|
||||
settingsJson, err := json.Marshal(mapA)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
requestMessage := &ModifyNamespaceSettingRequest{
|
||||
ResourceType: NamespaceResourceTypeEndpoint,
|
||||
RequestType: RequestTypeAdd,
|
||||
Settings: settingsJson,
|
||||
}
|
||||
|
||||
return ModifyNamespaceSettings(namespaceId, requestMessage)
|
||||
}
|
||||
|
||||
// RemoveNamespaceEndpoint removes an endpoint from a Namespace.
|
||||
func RemoveNamespaceEndpoint(namespaceId string, endpointId string) error {
|
||||
logrus.Debugf("hcn::HostComputeNamespace::RemoveNamespaceEndpoint id=%s", endpointId)
|
||||
|
||||
mapA := map[string]string{"EndpointId": endpointId}
|
||||
settingsJson, err := json.Marshal(mapA)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
requestMessage := &ModifyNamespaceSettingRequest{
|
||||
ResourceType: NamespaceResourceTypeEndpoint,
|
||||
RequestType: RequestTypeRemove,
|
||||
Settings: settingsJson,
|
||||
}
|
||||
|
||||
return ModifyNamespaceSettings(namespaceId, requestMessage)
|
||||
}
|
||||
409
vendor/github.com/Microsoft/hcsshim/hcn/hcnnetwork.go
generated
vendored
Normal file
409
vendor/github.com/Microsoft/hcsshim/hcn/hcnnetwork.go
generated
vendored
Normal file
@@ -0,0 +1,409 @@
|
||||
package hcn
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/guid"
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// Route is assoicated with a subnet.
|
||||
type Route struct {
|
||||
NextHop string `json:",omitempty"`
|
||||
DestinationPrefix string `json:",omitempty"`
|
||||
Metric uint16 `json:",omitempty"`
|
||||
}
|
||||
|
||||
// Subnet is assoicated with a Ipam.
|
||||
type Subnet struct {
|
||||
IpAddressPrefix string `json:",omitempty"`
|
||||
Policies []json.RawMessage `json:",omitempty"`
|
||||
Routes []Route `json:",omitempty"`
|
||||
}
|
||||
|
||||
// Ipam (Internet Protocol Addres Management) is assoicated with a network
|
||||
// and represents the address space(s) of a network.
|
||||
type Ipam struct {
|
||||
Type string `json:",omitempty"` // Ex: Static, DHCP
|
||||
Subnets []Subnet `json:",omitempty"`
|
||||
}
|
||||
|
||||
// MacRange is associated with MacPool and respresents the start and end addresses.
|
||||
type MacRange struct {
|
||||
StartMacAddress string `json:",omitempty"`
|
||||
EndMacAddress string `json:",omitempty"`
|
||||
}
|
||||
|
||||
// MacPool is assoicated with a network and represents pool of MacRanges.
|
||||
type MacPool struct {
|
||||
Ranges []MacRange `json:",omitempty"`
|
||||
}
|
||||
|
||||
// Dns (Domain Name System is associated with a network.
|
||||
type Dns struct {
|
||||
Domain string `json:",omitempty"`
|
||||
Search []string `json:",omitempty"`
|
||||
ServerList []string `json:",omitempty"`
|
||||
Options []string `json:",omitempty"`
|
||||
}
|
||||
|
||||
// NetworkType are various networks.
|
||||
type NetworkType string
|
||||
|
||||
// NetworkType const
|
||||
const (
|
||||
NAT NetworkType = "NAT"
|
||||
Transparent NetworkType = "Transparent"
|
||||
L2Bridge NetworkType = "L2Bridge"
|
||||
L2Tunnel NetworkType = "L2Tunnel"
|
||||
ICS NetworkType = "ICS"
|
||||
Private NetworkType = "Private"
|
||||
Overlay NetworkType = "Overlay"
|
||||
)
|
||||
|
||||
// HostComputeNetwork represents a network
|
||||
type HostComputeNetwork struct {
|
||||
Id string `json:"ID,omitempty"`
|
||||
Name string `json:",omitempty"`
|
||||
Type NetworkType `json:",omitempty"`
|
||||
Policies []NetworkPolicy `json:",omitempty"`
|
||||
MacPool MacPool `json:",omitempty"`
|
||||
Dns Dns `json:",omitempty"`
|
||||
Ipams []Ipam `json:",omitempty"`
|
||||
Flags uint32 `json:",omitempty"` // 0: None
|
||||
SchemaVersion SchemaVersion `json:",omitempty"`
|
||||
}
|
||||
|
||||
// NetworkResourceType are the 3 different Network settings resources.
|
||||
type NetworkResourceType string
|
||||
|
||||
var (
|
||||
// NetworkResourceTypePolicy is for Network's policies. Ex: RemoteSubnet
|
||||
NetworkResourceTypePolicy NetworkResourceType = "Policy"
|
||||
// NetworkResourceTypeDNS is for Network's DNS settings.
|
||||
NetworkResourceTypeDNS NetworkResourceType = "DNS"
|
||||
// NetworkResourceTypeExtension is for Network's extension settings.
|
||||
NetworkResourceTypeExtension NetworkResourceType = "Extension"
|
||||
)
|
||||
|
||||
// ModifyNetworkSettingRequest is the structure used to send request to modify an network.
|
||||
// Used to update DNS/extension/policy on an network.
|
||||
type ModifyNetworkSettingRequest struct {
|
||||
ResourceType NetworkResourceType `json:",omitempty"` // Policy, DNS, Extension
|
||||
RequestType RequestType `json:",omitempty"` // Add, Remove, Update, Refresh
|
||||
Settings json.RawMessage `json:",omitempty"`
|
||||
}
|
||||
|
||||
type PolicyNetworkRequest struct {
|
||||
Policies []NetworkPolicy `json:",omitempty"`
|
||||
}
|
||||
|
||||
func getNetwork(networkGuid guid.GUID, query string) (*HostComputeNetwork, error) {
|
||||
// Open network.
|
||||
var (
|
||||
networkHandle hcnNetwork
|
||||
resultBuffer *uint16
|
||||
propertiesBuffer *uint16
|
||||
)
|
||||
hr := hcnOpenNetwork(&networkGuid, &networkHandle, &resultBuffer)
|
||||
if err := checkForErrors("hcnOpenNetwork", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Query network.
|
||||
hr = hcnQueryNetworkProperties(networkHandle, query, &propertiesBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnQueryNetworkProperties", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer)
|
||||
// Close network.
|
||||
hr = hcnCloseNetwork(networkHandle)
|
||||
if err := checkForErrors("hcnCloseNetwork", hr, nil); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Convert output to HostComputeNetwork
|
||||
var outputNetwork HostComputeNetwork
|
||||
if err := json.Unmarshal([]byte(properties), &outputNetwork); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &outputNetwork, nil
|
||||
}
|
||||
|
||||
func enumerateNetworks(query string) ([]HostComputeNetwork, error) {
|
||||
// Enumerate all Network Guids
|
||||
var (
|
||||
resultBuffer *uint16
|
||||
networkBuffer *uint16
|
||||
)
|
||||
hr := hcnEnumerateNetworks(query, &networkBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnEnumerateNetworks", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
networks := interop.ConvertAndFreeCoTaskMemString(networkBuffer)
|
||||
var networkIds []guid.GUID
|
||||
if err := json.Unmarshal([]byte(networks), &networkIds); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
var outputNetworks []HostComputeNetwork
|
||||
for _, networkGuid := range networkIds {
|
||||
network, err := getNetwork(networkGuid, query)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
outputNetworks = append(outputNetworks, *network)
|
||||
}
|
||||
return outputNetworks, nil
|
||||
}
|
||||
|
||||
func createNetwork(settings string) (*HostComputeNetwork, error) {
|
||||
// Create new network.
|
||||
var (
|
||||
networkHandle hcnNetwork
|
||||
resultBuffer *uint16
|
||||
propertiesBuffer *uint16
|
||||
)
|
||||
networkGuid := guid.GUID{}
|
||||
hr := hcnCreateNetwork(&networkGuid, settings, &networkHandle, &resultBuffer)
|
||||
if err := checkForErrors("hcnCreateNetwork", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Query network.
|
||||
hcnQuery := defaultQuery()
|
||||
query, err := json.Marshal(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hr = hcnQueryNetworkProperties(networkHandle, string(query), &propertiesBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnQueryNetworkProperties", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer)
|
||||
// Close network.
|
||||
hr = hcnCloseNetwork(networkHandle)
|
||||
if err := checkForErrors("hcnCloseNetwork", hr, nil); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Convert output to HostComputeNetwork
|
||||
var outputNetwork HostComputeNetwork
|
||||
if err := json.Unmarshal([]byte(properties), &outputNetwork); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &outputNetwork, nil
|
||||
}
|
||||
|
||||
func modifyNetwork(networkId string, settings string) (*HostComputeNetwork, error) {
|
||||
networkGuid := guid.FromString(networkId)
|
||||
// Open Network
|
||||
var (
|
||||
networkHandle hcnNetwork
|
||||
resultBuffer *uint16
|
||||
propertiesBuffer *uint16
|
||||
)
|
||||
hr := hcnOpenNetwork(&networkGuid, &networkHandle, &resultBuffer)
|
||||
if err := checkForErrors("hcnOpenNetwork", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Modify Network
|
||||
hr = hcnModifyNetwork(networkHandle, settings, &resultBuffer)
|
||||
if err := checkForErrors("hcnModifyNetwork", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Query network.
|
||||
hcnQuery := defaultQuery()
|
||||
query, err := json.Marshal(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hr = hcnQueryNetworkProperties(networkHandle, string(query), &propertiesBuffer, &resultBuffer)
|
||||
if err := checkForErrors("hcnQueryNetworkProperties", hr, resultBuffer); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer)
|
||||
// Close network.
|
||||
hr = hcnCloseNetwork(networkHandle)
|
||||
if err := checkForErrors("hcnCloseNetwork", hr, nil); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Convert output to HostComputeNetwork
|
||||
var outputNetwork HostComputeNetwork
|
||||
if err := json.Unmarshal([]byte(properties), &outputNetwork); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &outputNetwork, nil
|
||||
}
|
||||
|
||||
func deleteNetwork(networkId string) error {
|
||||
networkGuid := guid.FromString(networkId)
|
||||
var resultBuffer *uint16
|
||||
hr := hcnDeleteNetwork(&networkGuid, &resultBuffer)
|
||||
if err := checkForErrors("hcnDeleteNetwork", hr, resultBuffer); err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// ListNetworks makes a call to list all available networks.
|
||||
func ListNetworks() ([]HostComputeNetwork, error) {
|
||||
hcnQuery := defaultQuery()
|
||||
networks, err := ListNetworksQuery(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return networks, nil
|
||||
}
|
||||
|
||||
// ListNetworksQuery makes a call to query the list of available networks.
|
||||
func ListNetworksQuery(query HostComputeQuery) ([]HostComputeNetwork, error) {
|
||||
queryJson, err := json.Marshal(query)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
networks, err := enumerateNetworks(string(queryJson))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return networks, nil
|
||||
}
|
||||
|
||||
// GetNetworkByID returns the network specified by Id.
|
||||
func GetNetworkByID(networkID string) (*HostComputeNetwork, error) {
|
||||
hcnQuery := defaultQuery()
|
||||
mapA := map[string]string{"ID": networkID}
|
||||
filter, err := json.Marshal(mapA)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hcnQuery.Filter = string(filter)
|
||||
|
||||
networks, err := ListNetworksQuery(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
if len(networks) == 0 {
|
||||
return nil, NetworkNotFoundError{NetworkID: networkID}
|
||||
}
|
||||
return &networks[0], err
|
||||
}
|
||||
|
||||
// GetNetworkByName returns the network specified by Name.
|
||||
func GetNetworkByName(networkName string) (*HostComputeNetwork, error) {
|
||||
hcnQuery := defaultQuery()
|
||||
mapA := map[string]string{"Name": networkName}
|
||||
filter, err := json.Marshal(mapA)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hcnQuery.Filter = string(filter)
|
||||
|
||||
networks, err := ListNetworksQuery(hcnQuery)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
if len(networks) == 0 {
|
||||
return nil, NetworkNotFoundError{NetworkName: networkName}
|
||||
}
|
||||
return &networks[0], err
|
||||
}
|
||||
|
||||
// Create Network.
|
||||
func (network *HostComputeNetwork) Create() (*HostComputeNetwork, error) {
|
||||
logrus.Debugf("hcn::HostComputeNetwork::Create id=%s", network.Id)
|
||||
|
||||
jsonString, err := json.Marshal(network)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
logrus.Debugf("hcn::HostComputeNetwork::Create JSON: %s", jsonString)
|
||||
network, hcnErr := createNetwork(string(jsonString))
|
||||
if hcnErr != nil {
|
||||
return nil, hcnErr
|
||||
}
|
||||
return network, nil
|
||||
}
|
||||
|
||||
// Delete Network.
|
||||
func (network *HostComputeNetwork) Delete() error {
|
||||
logrus.Debugf("hcn::HostComputeNetwork::Delete id=%s", network.Id)
|
||||
|
||||
if err := deleteNetwork(network.Id); err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// ModifyNetworkSettings updates the Policy for a network.
|
||||
func (network *HostComputeNetwork) ModifyNetworkSettings(request *ModifyNetworkSettingRequest) error {
|
||||
logrus.Debugf("hcn::HostComputeNetwork::ModifyNetworkSettings id=%s", network.Id)
|
||||
|
||||
networkSettingsRequest, err := json.Marshal(request)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err = modifyNetwork(network.Id, string(networkSettingsRequest))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// AddPolicy applies a Policy (ex: RemoteSubnet) on the Network.
|
||||
func (network *HostComputeNetwork) AddPolicy(networkPolicy PolicyNetworkRequest) error {
|
||||
logrus.Debugf("hcn::HostComputeNetwork::AddPolicy id=%s", network.Id)
|
||||
|
||||
settingsJson, err := json.Marshal(networkPolicy)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
requestMessage := &ModifyNetworkSettingRequest{
|
||||
ResourceType: NetworkResourceTypePolicy,
|
||||
RequestType: RequestTypeAdd,
|
||||
Settings: settingsJson,
|
||||
}
|
||||
|
||||
return network.ModifyNetworkSettings(requestMessage)
|
||||
}
|
||||
|
||||
// RemovePolicy removes a Policy (ex: RemoteSubnet) from the Network.
|
||||
func (network *HostComputeNetwork) RemovePolicy(networkPolicy PolicyNetworkRequest) error {
|
||||
logrus.Debugf("hcn::HostComputeNetwork::RemovePolicy id=%s", network.Id)
|
||||
|
||||
settingsJson, err := json.Marshal(networkPolicy)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
requestMessage := &ModifyNetworkSettingRequest{
|
||||
ResourceType: NetworkResourceTypePolicy,
|
||||
RequestType: RequestTypeRemove,
|
||||
Settings: settingsJson,
|
||||
}
|
||||
|
||||
return network.ModifyNetworkSettings(requestMessage)
|
||||
}
|
||||
|
||||
// CreateEndpoint creates an endpoint on the Network.
|
||||
func (network *HostComputeNetwork) CreateEndpoint(endpoint *HostComputeEndpoint) (*HostComputeEndpoint, error) {
|
||||
isRemote := endpoint.Flags&EndpointFlagsRemoteEndpoint != 0
|
||||
logrus.Debugf("hcn::HostComputeNetwork::CreatEndpoint, networkId=%s remote=%t", network.Id, isRemote)
|
||||
|
||||
endpoint.HostComputeNetwork = network.Id
|
||||
endpointSettings, err := json.Marshal(endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
newEndpoint, err := createEndpoint(network.Id, string(endpointSettings))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return newEndpoint, nil
|
||||
}
|
||||
|
||||
// CreateRemoteEndpoint creates a remote endpoint on the Network.
|
||||
func (network *HostComputeNetwork) CreateRemoteEndpoint(endpoint *HostComputeEndpoint) (*HostComputeEndpoint, error) {
|
||||
endpoint.Flags = EndpointFlagsRemoteEndpoint | endpoint.Flags
|
||||
return network.CreateEndpoint(endpoint)
|
||||
}
|
||||
216
vendor/github.com/Microsoft/hcsshim/hcn/hcnpolicy.go
generated
vendored
Normal file
216
vendor/github.com/Microsoft/hcsshim/hcn/hcnpolicy.go
generated
vendored
Normal file
@@ -0,0 +1,216 @@
|
||||
package hcn
|
||||
|
||||
import "encoding/json"
|
||||
|
||||
// EndpointPolicyType are the potential Policies that apply to Endpoints.
|
||||
type EndpointPolicyType string
|
||||
|
||||
// EndpointPolicyType const
|
||||
const (
|
||||
PortMapping EndpointPolicyType = "PortMapping"
|
||||
ACL EndpointPolicyType = "ACL"
|
||||
QOS EndpointPolicyType = "QOS"
|
||||
L2Driver EndpointPolicyType = "L2Driver"
|
||||
OutBoundNAT EndpointPolicyType = "OutBoundNAT"
|
||||
SDNRoute EndpointPolicyType = "SDNRoute"
|
||||
L4Proxy EndpointPolicyType = "L4Proxy"
|
||||
PortName EndpointPolicyType = "PortName"
|
||||
EncapOverhead EndpointPolicyType = "EncapOverhead"
|
||||
// Endpoint and Network have InterfaceConstraint and ProviderAddress
|
||||
NetworkProviderAddress EndpointPolicyType = "ProviderAddress"
|
||||
NetworkInterfaceConstraint EndpointPolicyType = "InterfaceConstraint"
|
||||
)
|
||||
|
||||
// EndpointPolicy is a collection of Policy settings for an Endpoint.
|
||||
type EndpointPolicy struct {
|
||||
Type EndpointPolicyType `json:""`
|
||||
Settings json.RawMessage `json:",omitempty"`
|
||||
}
|
||||
|
||||
// NetworkPolicyType are the potential Policies that apply to Networks.
|
||||
type NetworkPolicyType string
|
||||
|
||||
// NetworkPolicyType const
|
||||
const (
|
||||
SourceMacAddress NetworkPolicyType = "SourceMacAddress"
|
||||
NetAdapterName NetworkPolicyType = "NetAdapterName"
|
||||
VSwitchExtension NetworkPolicyType = "VSwitchExtension"
|
||||
DrMacAddress NetworkPolicyType = "DrMacAddress"
|
||||
AutomaticDNS NetworkPolicyType = "AutomaticDNS"
|
||||
InterfaceConstraint NetworkPolicyType = "InterfaceConstraint"
|
||||
ProviderAddress NetworkPolicyType = "ProviderAddress"
|
||||
RemoteSubnetRoute NetworkPolicyType = "RemoteSubnetRoute"
|
||||
)
|
||||
|
||||
// NetworkPolicy is a collection of Policy settings for a Network.
|
||||
type NetworkPolicy struct {
|
||||
Type NetworkPolicyType `json:""`
|
||||
Settings json.RawMessage `json:",omitempty"`
|
||||
}
|
||||
|
||||
// SubnetPolicyType are the potential Policies that apply to Subnets.
|
||||
type SubnetPolicyType string
|
||||
|
||||
// SubnetPolicyType const
|
||||
const (
|
||||
VLAN SubnetPolicyType = "VLAN"
|
||||
VSID SubnetPolicyType = "VSID"
|
||||
)
|
||||
|
||||
// SubnetPolicy is a collection of Policy settings for a Subnet.
|
||||
type SubnetPolicy struct {
|
||||
Type SubnetPolicyType `json:""`
|
||||
Settings json.RawMessage `json:",omitempty"`
|
||||
}
|
||||
|
||||
/// Endpoint Policy objects
|
||||
|
||||
// PortMappingPolicySetting defines Port Mapping (NAT)
|
||||
type PortMappingPolicySetting struct {
|
||||
Protocol uint32 `json:",omitempty"` // EX: TCP = 6, UDP = 17
|
||||
InternalPort uint16 `json:",omitempty"`
|
||||
ExternalPort uint16 `json:",omitempty"`
|
||||
VIP string `json:",omitempty"`
|
||||
}
|
||||
|
||||
// ActionType associated with ACLs. Value is either Allow or Block.
|
||||
type ActionType string
|
||||
|
||||
// DirectionType associated with ACLs. Value is either In or Out.
|
||||
type DirectionType string
|
||||
|
||||
// RuleType associated with ACLs. Value is either Host (WFP) or Switch (VFP).
|
||||
type RuleType string
|
||||
|
||||
const (
|
||||
// Allow traffic
|
||||
ActionTypeAllow ActionType = "Allow"
|
||||
// Block traffic
|
||||
ActionTypeBlock ActionType = "Block"
|
||||
|
||||
// In is traffic coming to the Endpoint
|
||||
DirectionTypeIn DirectionType = "In"
|
||||
// Out is traffic leaving the Endpoint
|
||||
DirectionTypeOut DirectionType = "Out"
|
||||
|
||||
// Host creates WFP (Windows Firewall) rules
|
||||
RuleTypeHost RuleType = "Host"
|
||||
// Switch creates VFP (Virtual Filter Platform) rules
|
||||
RuleTypeSwitch RuleType = "Switch"
|
||||
)
|
||||
|
||||
// AclPolicySetting creates firewall rules on an endpoint
|
||||
type AclPolicySetting struct {
|
||||
Protocols string `json:",omitempty"` // EX: 6 (TCP), 17 (UDP), 1 (ICMPv4), 58 (ICMPv6), 2 (IGMP)
|
||||
Action ActionType `json:","`
|
||||
Direction DirectionType `json:","`
|
||||
LocalAddresses string `json:",omitempty"`
|
||||
RemoteAddresses string `json:",omitempty"`
|
||||
LocalPorts string `json:",omitempty"`
|
||||
RemotePorts string `json:",omitempty"`
|
||||
RuleType RuleType `json:",omitempty"`
|
||||
Priority uint16 `json:",omitempty"`
|
||||
}
|
||||
|
||||
// QosPolicySetting sets Quality of Service bandwidth caps on an Endpoint.
|
||||
type QosPolicySetting struct {
|
||||
MaximumOutgoingBandwidthInBytes uint64
|
||||
}
|
||||
|
||||
// OutboundNatPolicySetting sets outbound Network Address Translation on an Endpoint.
|
||||
type OutboundNatPolicySetting struct {
|
||||
VirtualIP string `json:",omitempty"`
|
||||
Exceptions []string `json:",omitempty"`
|
||||
}
|
||||
|
||||
// SDNRoutePolicySetting sets SDN Route on an Endpoint.
|
||||
type SDNRoutePolicySetting struct {
|
||||
DestinationPrefix string `json:",omitempty"`
|
||||
NextHop string `json:",omitempty"`
|
||||
NeedEncap bool `json:",omitempty"`
|
||||
}
|
||||
|
||||
// L4ProxyPolicySetting sets Layer-4 Proxy on an endpoint.
|
||||
type L4ProxyPolicySetting struct {
|
||||
IP string `json:",omitempty"`
|
||||
Port string `json:",omitempty"`
|
||||
Protocol uint32 `json:",omitempty"` // EX: TCP = 6, UDP = 17
|
||||
ExceptionList []string `json:",omitempty"`
|
||||
Destination string `json:","`
|
||||
OutboundNat bool `json:",omitempty"`
|
||||
}
|
||||
|
||||
// PortnameEndpointPolicySetting sets the port name for an endpoint.
|
||||
type PortnameEndpointPolicySetting struct {
|
||||
Name string `json:",omitempty"`
|
||||
}
|
||||
|
||||
// EncapOverheadEndpointPolicySetting sets the encap overhead for an endpoint.
|
||||
type EncapOverheadEndpointPolicySetting struct {
|
||||
Overhead uint16 `json:",omitempty"`
|
||||
}
|
||||
|
||||
/// Endpoint and Network Policy objects
|
||||
|
||||
// ProviderAddressEndpointPolicySetting sets the PA for an endpoint.
|
||||
type ProviderAddressEndpointPolicySetting struct {
|
||||
ProviderAddress string `json:",omitempty"`
|
||||
}
|
||||
|
||||
// InterfaceConstraintPolicySetting limits an Endpoint or Network to a specific Nic.
|
||||
type InterfaceConstraintPolicySetting struct {
|
||||
InterfaceGuid string `json:",omitempty"`
|
||||
InterfaceLuid uint64 `json:",omitempty"`
|
||||
InterfaceIndex uint32 `json:",omitempty"`
|
||||
InterfaceMediaType uint32 `json:",omitempty"`
|
||||
InterfaceAlias string `json:",omitempty"`
|
||||
InterfaceDescription string `json:",omitempty"`
|
||||
}
|
||||
|
||||
/// Network Policy objects
|
||||
|
||||
// SourceMacAddressNetworkPolicySetting sets source MAC for a network.
|
||||
type SourceMacAddressNetworkPolicySetting struct {
|
||||
SourceMacAddress string `json:",omitempty"`
|
||||
}
|
||||
|
||||
// NetAdapterNameNetworkPolicySetting sets network adapter of a network.
|
||||
type NetAdapterNameNetworkPolicySetting struct {
|
||||
NetworkAdapterName string `json:",omitempty"`
|
||||
}
|
||||
|
||||
// VSwitchExtensionNetworkPolicySetting enables/disabled VSwitch extensions for a network.
|
||||
type VSwitchExtensionNetworkPolicySetting struct {
|
||||
ExtensionID string `json:",omitempty"`
|
||||
Enable bool `json:",omitempty"`
|
||||
}
|
||||
|
||||
// DrMacAddressNetworkPolicySetting sets the DR MAC for a network.
|
||||
type DrMacAddressNetworkPolicySetting struct {
|
||||
Address string `json:",omitempty"`
|
||||
}
|
||||
|
||||
// AutomaticDNSNetworkPolicySetting enables/disables automatic DNS on a network.
|
||||
type AutomaticDNSNetworkPolicySetting struct {
|
||||
Enable bool `json:",omitempty"`
|
||||
}
|
||||
|
||||
/// Subnet Policy objects
|
||||
|
||||
// VlanPolicySetting isolates a subnet with VLAN tagging.
|
||||
type VlanPolicySetting struct {
|
||||
IsolationId uint32 `json:","`
|
||||
}
|
||||
|
||||
// VsidPolicySetting isolates a subnet with VSID tagging.
|
||||
type VsidPolicySetting struct {
|
||||
IsolationId uint32 `json:","`
|
||||
}
|
||||
|
||||
// RemoteSubnetRoutePolicySetting creates remote subnet route rules on a network
|
||||
type RemoteSubnetRoutePolicySetting struct {
|
||||
DestinationPrefix string
|
||||
IsolationId uint16
|
||||
ProviderAddress string
|
||||
DistributedRouterMacAddress string
|
||||
}
|
||||
69
vendor/github.com/Microsoft/hcsshim/hcn/hcnsupport.go
generated
vendored
Normal file
69
vendor/github.com/Microsoft/hcsshim/hcn/hcnsupport.go
generated
vendored
Normal file
@@ -0,0 +1,69 @@
|
||||
package hcn
|
||||
|
||||
import (
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// SupportedFeatures are the features provided by the Service.
|
||||
type SupportedFeatures struct {
|
||||
Acl AclFeatures `json:"ACL"`
|
||||
Api ApiSupport `json:"API"`
|
||||
RemoteSubnet bool `json:"RemoteSubnet"`
|
||||
DSR bool `json:"DSR"`
|
||||
}
|
||||
|
||||
// AclFeatures are the supported ACL possibilities.
|
||||
type AclFeatures struct {
|
||||
AclAddressLists bool `json:"AclAddressLists"`
|
||||
AclNoHostRulePriority bool `json:"AclHostRulePriority"`
|
||||
AclPortRanges bool `json:"AclPortRanges"`
|
||||
AclRuleId bool `json:"AclRuleId"`
|
||||
}
|
||||
|
||||
// ApiSupport lists the supported API versions.
|
||||
type ApiSupport struct {
|
||||
V1 bool `json:"V1"`
|
||||
V2 bool `json:"V2"`
|
||||
}
|
||||
|
||||
// GetSupportedFeatures returns the features supported by the Service.
|
||||
func GetSupportedFeatures() SupportedFeatures {
|
||||
var features SupportedFeatures
|
||||
|
||||
globals, err := GetGlobals()
|
||||
if err != nil {
|
||||
// Expected on pre-1803 builds, all features will be false/unsupported
|
||||
logrus.Debugf("Unable to obtain globals: %s", err)
|
||||
return features
|
||||
}
|
||||
|
||||
features.Acl = AclFeatures{
|
||||
AclAddressLists: isFeatureSupported(globals.Version, HNSVersion1803),
|
||||
AclNoHostRulePriority: isFeatureSupported(globals.Version, HNSVersion1803),
|
||||
AclPortRanges: isFeatureSupported(globals.Version, HNSVersion1803),
|
||||
AclRuleId: isFeatureSupported(globals.Version, HNSVersion1803),
|
||||
}
|
||||
|
||||
features.Api = ApiSupport{
|
||||
V2: isFeatureSupported(globals.Version, V2ApiSupport),
|
||||
V1: true, // HNSCall is still available.
|
||||
}
|
||||
|
||||
features.RemoteSubnet = isFeatureSupported(globals.Version, RemoteSubnetVersion)
|
||||
features.DSR = isFeatureSupported(globals.Version, DSRVersion)
|
||||
|
||||
return features
|
||||
}
|
||||
|
||||
func isFeatureSupported(currentVersion Version, minVersionSupported Version) bool {
|
||||
if currentVersion.Major < minVersionSupported.Major {
|
||||
return false
|
||||
}
|
||||
if currentVersion.Major > minVersionSupported.Major {
|
||||
return true
|
||||
}
|
||||
if currentVersion.Minor < minVersionSupported.Minor {
|
||||
return false
|
||||
}
|
||||
return true
|
||||
}
|
||||
714
vendor/github.com/Microsoft/hcsshim/hcn/zsyscall_windows.go
generated
vendored
Normal file
714
vendor/github.com/Microsoft/hcsshim/hcn/zsyscall_windows.go
generated
vendored
Normal file
@@ -0,0 +1,714 @@
|
||||
// Code generated mksyscall_windows.exe DO NOT EDIT
|
||||
|
||||
package hcn
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
var _ unsafe.Pointer
|
||||
|
||||
// Do the interface allocations only once for common
|
||||
// Errno values.
|
||||
const (
|
||||
errnoERROR_IO_PENDING = 997
|
||||
)
|
||||
|
||||
var (
|
||||
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||
)
|
||||
|
||||
// errnoErr returns common boxed Errno values, to prevent
|
||||
// allocations at runtime.
|
||||
func errnoErr(e syscall.Errno) error {
|
||||
switch e {
|
||||
case 0:
|
||||
return nil
|
||||
case errnoERROR_IO_PENDING:
|
||||
return errERROR_IO_PENDING
|
||||
}
|
||||
// TODO: add more here, after collecting data on the common
|
||||
// error values see on Windows. (perhaps when running
|
||||
// all.bat?)
|
||||
return e
|
||||
}
|
||||
|
||||
var (
|
||||
modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll")
|
||||
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
|
||||
modcomputenetwork = windows.NewLazySystemDLL("computenetwork.dll")
|
||||
|
||||
procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId")
|
||||
procHNSCall = modvmcompute.NewProc("HNSCall")
|
||||
procHcnEnumerateNetworks = modcomputenetwork.NewProc("HcnEnumerateNetworks")
|
||||
procHcnCreateNetwork = modcomputenetwork.NewProc("HcnCreateNetwork")
|
||||
procHcnOpenNetwork = modcomputenetwork.NewProc("HcnOpenNetwork")
|
||||
procHcnModifyNetwork = modcomputenetwork.NewProc("HcnModifyNetwork")
|
||||
procHcnQueryNetworkProperties = modcomputenetwork.NewProc("HcnQueryNetworkProperties")
|
||||
procHcnDeleteNetwork = modcomputenetwork.NewProc("HcnDeleteNetwork")
|
||||
procHcnCloseNetwork = modcomputenetwork.NewProc("HcnCloseNetwork")
|
||||
procHcnEnumerateEndpoints = modcomputenetwork.NewProc("HcnEnumerateEndpoints")
|
||||
procHcnCreateEndpoint = modcomputenetwork.NewProc("HcnCreateEndpoint")
|
||||
procHcnOpenEndpoint = modcomputenetwork.NewProc("HcnOpenEndpoint")
|
||||
procHcnModifyEndpoint = modcomputenetwork.NewProc("HcnModifyEndpoint")
|
||||
procHcnQueryEndpointProperties = modcomputenetwork.NewProc("HcnQueryEndpointProperties")
|
||||
procHcnDeleteEndpoint = modcomputenetwork.NewProc("HcnDeleteEndpoint")
|
||||
procHcnCloseEndpoint = modcomputenetwork.NewProc("HcnCloseEndpoint")
|
||||
procHcnEnumerateNamespaces = modcomputenetwork.NewProc("HcnEnumerateNamespaces")
|
||||
procHcnCreateNamespace = modcomputenetwork.NewProc("HcnCreateNamespace")
|
||||
procHcnOpenNamespace = modcomputenetwork.NewProc("HcnOpenNamespace")
|
||||
procHcnModifyNamespace = modcomputenetwork.NewProc("HcnModifyNamespace")
|
||||
procHcnQueryNamespaceProperties = modcomputenetwork.NewProc("HcnQueryNamespaceProperties")
|
||||
procHcnDeleteNamespace = modcomputenetwork.NewProc("HcnDeleteNamespace")
|
||||
procHcnCloseNamespace = modcomputenetwork.NewProc("HcnCloseNamespace")
|
||||
procHcnEnumerateLoadBalancers = modcomputenetwork.NewProc("HcnEnumerateLoadBalancers")
|
||||
procHcnCreateLoadBalancer = modcomputenetwork.NewProc("HcnCreateLoadBalancer")
|
||||
procHcnOpenLoadBalancer = modcomputenetwork.NewProc("HcnOpenLoadBalancer")
|
||||
procHcnModifyLoadBalancer = modcomputenetwork.NewProc("HcnModifyLoadBalancer")
|
||||
procHcnQueryLoadBalancerProperties = modcomputenetwork.NewProc("HcnQueryLoadBalancerProperties")
|
||||
procHcnDeleteLoadBalancer = modcomputenetwork.NewProc("HcnDeleteLoadBalancer")
|
||||
procHcnCloseLoadBalancer = modcomputenetwork.NewProc("HcnCloseLoadBalancer")
|
||||
procHcnOpenService = modcomputenetwork.NewProc("HcnOpenService")
|
||||
procHcnRegisterServiceCallback = modcomputenetwork.NewProc("HcnRegisterServiceCallback")
|
||||
procHcnUnregisterServiceCallback = modcomputenetwork.NewProc("HcnUnregisterServiceCallback")
|
||||
procHcnCloseService = modcomputenetwork.NewProc("HcnCloseService")
|
||||
)
|
||||
|
||||
func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) {
|
||||
r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func _hnsCall(method string, path string, object string, response **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(method)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
var _p1 *uint16
|
||||
_p1, hr = syscall.UTF16PtrFromString(path)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
var _p2 *uint16
|
||||
_p2, hr = syscall.UTF16PtrFromString(object)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return __hnsCall(_p0, _p1, _p2, response)
|
||||
}
|
||||
|
||||
func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) {
|
||||
if hr = procHNSCall.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnEnumerateNetworks(query string, networks **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(query)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnEnumerateNetworks(_p0, networks, result)
|
||||
}
|
||||
|
||||
func _hcnEnumerateNetworks(query *uint16, networks **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcnEnumerateNetworks.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnEnumerateNetworks.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(networks)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnCreateNetwork(id *_guid, settings string, network *hcnNetwork, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(settings)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnCreateNetwork(id, _p0, network, result)
|
||||
}
|
||||
|
||||
func _hcnCreateNetwork(id *_guid, settings *uint16, network *hcnNetwork, result **uint16) (hr error) {
|
||||
if hr = procHcnCreateNetwork.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcnCreateNetwork.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(network)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnOpenNetwork(id *_guid, network *hcnNetwork, result **uint16) (hr error) {
|
||||
if hr = procHcnOpenNetwork.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnOpenNetwork.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(network)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnModifyNetwork(network hcnNetwork, settings string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(settings)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnModifyNetwork(network, _p0, result)
|
||||
}
|
||||
|
||||
func _hcnModifyNetwork(network hcnNetwork, settings *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcnModifyNetwork.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnModifyNetwork.Addr(), 3, uintptr(network), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnQueryNetworkProperties(network hcnNetwork, query string, properties **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(query)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnQueryNetworkProperties(network, _p0, properties, result)
|
||||
}
|
||||
|
||||
func _hcnQueryNetworkProperties(network hcnNetwork, query *uint16, properties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcnQueryNetworkProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcnQueryNetworkProperties.Addr(), 4, uintptr(network), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnDeleteNetwork(id *_guid, result **uint16) (hr error) {
|
||||
if hr = procHcnDeleteNetwork.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnDeleteNetwork.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnCloseNetwork(network hcnNetwork) (hr error) {
|
||||
if hr = procHcnCloseNetwork.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnCloseNetwork.Addr(), 1, uintptr(network), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnEnumerateEndpoints(query string, endpoints **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(query)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnEnumerateEndpoints(_p0, endpoints, result)
|
||||
}
|
||||
|
||||
func _hcnEnumerateEndpoints(query *uint16, endpoints **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcnEnumerateEndpoints.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnEnumerateEndpoints.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(endpoints)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnCreateEndpoint(network hcnNetwork, id *_guid, settings string, endpoint *hcnEndpoint, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(settings)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnCreateEndpoint(network, id, _p0, endpoint, result)
|
||||
}
|
||||
|
||||
func _hcnCreateEndpoint(network hcnNetwork, id *_guid, settings *uint16, endpoint *hcnEndpoint, result **uint16) (hr error) {
|
||||
if hr = procHcnCreateEndpoint.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcnCreateEndpoint.Addr(), 5, uintptr(network), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(endpoint)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnOpenEndpoint(id *_guid, endpoint *hcnEndpoint, result **uint16) (hr error) {
|
||||
if hr = procHcnOpenEndpoint.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnOpenEndpoint.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(endpoint)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnModifyEndpoint(endpoint hcnEndpoint, settings string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(settings)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnModifyEndpoint(endpoint, _p0, result)
|
||||
}
|
||||
|
||||
func _hcnModifyEndpoint(endpoint hcnEndpoint, settings *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcnModifyEndpoint.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnModifyEndpoint.Addr(), 3, uintptr(endpoint), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnQueryEndpointProperties(endpoint hcnEndpoint, query string, properties **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(query)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnQueryEndpointProperties(endpoint, _p0, properties, result)
|
||||
}
|
||||
|
||||
func _hcnQueryEndpointProperties(endpoint hcnEndpoint, query *uint16, properties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcnQueryEndpointProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcnQueryEndpointProperties.Addr(), 4, uintptr(endpoint), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnDeleteEndpoint(id *_guid, result **uint16) (hr error) {
|
||||
if hr = procHcnDeleteEndpoint.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnDeleteEndpoint.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnCloseEndpoint(endpoint hcnEndpoint) (hr error) {
|
||||
if hr = procHcnCloseEndpoint.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnCloseEndpoint.Addr(), 1, uintptr(endpoint), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnEnumerateNamespaces(query string, namespaces **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(query)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnEnumerateNamespaces(_p0, namespaces, result)
|
||||
}
|
||||
|
||||
func _hcnEnumerateNamespaces(query *uint16, namespaces **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcnEnumerateNamespaces.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnEnumerateNamespaces.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(namespaces)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnCreateNamespace(id *_guid, settings string, namespace *hcnNamespace, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(settings)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnCreateNamespace(id, _p0, namespace, result)
|
||||
}
|
||||
|
||||
func _hcnCreateNamespace(id *_guid, settings *uint16, namespace *hcnNamespace, result **uint16) (hr error) {
|
||||
if hr = procHcnCreateNamespace.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcnCreateNamespace.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(namespace)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnOpenNamespace(id *_guid, namespace *hcnNamespace, result **uint16) (hr error) {
|
||||
if hr = procHcnOpenNamespace.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnOpenNamespace.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(namespace)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnModifyNamespace(namespace hcnNamespace, settings string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(settings)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnModifyNamespace(namespace, _p0, result)
|
||||
}
|
||||
|
||||
func _hcnModifyNamespace(namespace hcnNamespace, settings *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcnModifyNamespace.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnModifyNamespace.Addr(), 3, uintptr(namespace), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnQueryNamespaceProperties(namespace hcnNamespace, query string, properties **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(query)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnQueryNamespaceProperties(namespace, _p0, properties, result)
|
||||
}
|
||||
|
||||
func _hcnQueryNamespaceProperties(namespace hcnNamespace, query *uint16, properties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcnQueryNamespaceProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcnQueryNamespaceProperties.Addr(), 4, uintptr(namespace), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnDeleteNamespace(id *_guid, result **uint16) (hr error) {
|
||||
if hr = procHcnDeleteNamespace.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnDeleteNamespace.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnCloseNamespace(namespace hcnNamespace) (hr error) {
|
||||
if hr = procHcnCloseNamespace.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnCloseNamespace.Addr(), 1, uintptr(namespace), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnEnumerateLoadBalancers(query string, loadBalancers **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(query)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnEnumerateLoadBalancers(_p0, loadBalancers, result)
|
||||
}
|
||||
|
||||
func _hcnEnumerateLoadBalancers(query *uint16, loadBalancers **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcnEnumerateLoadBalancers.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnEnumerateLoadBalancers.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(loadBalancers)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnCreateLoadBalancer(id *_guid, settings string, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(settings)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnCreateLoadBalancer(id, _p0, loadBalancer, result)
|
||||
}
|
||||
|
||||
func _hcnCreateLoadBalancer(id *_guid, settings *uint16, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) {
|
||||
if hr = procHcnCreateLoadBalancer.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcnCreateLoadBalancer.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(loadBalancer)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnOpenLoadBalancer(id *_guid, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) {
|
||||
if hr = procHcnOpenLoadBalancer.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnOpenLoadBalancer.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(loadBalancer)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnModifyLoadBalancer(loadBalancer hcnLoadBalancer, settings string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(settings)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnModifyLoadBalancer(loadBalancer, _p0, result)
|
||||
}
|
||||
|
||||
func _hcnModifyLoadBalancer(loadBalancer hcnLoadBalancer, settings *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcnModifyLoadBalancer.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnModifyLoadBalancer.Addr(), 3, uintptr(loadBalancer), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnQueryLoadBalancerProperties(loadBalancer hcnLoadBalancer, query string, properties **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(query)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcnQueryLoadBalancerProperties(loadBalancer, _p0, properties, result)
|
||||
}
|
||||
|
||||
func _hcnQueryLoadBalancerProperties(loadBalancer hcnLoadBalancer, query *uint16, properties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcnQueryLoadBalancerProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcnQueryLoadBalancerProperties.Addr(), 4, uintptr(loadBalancer), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnDeleteLoadBalancer(id *_guid, result **uint16) (hr error) {
|
||||
if hr = procHcnDeleteLoadBalancer.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnDeleteLoadBalancer.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnCloseLoadBalancer(loadBalancer hcnLoadBalancer) (hr error) {
|
||||
if hr = procHcnCloseLoadBalancer.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnCloseLoadBalancer.Addr(), 1, uintptr(loadBalancer), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnOpenService(service *hcnService, result **uint16) (hr error) {
|
||||
if hr = procHcnOpenService.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnOpenService.Addr(), 2, uintptr(unsafe.Pointer(service)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnRegisterServiceCallback(service hcnService, callback int32, context int32, callbackHandle *hcnCallbackHandle) (hr error) {
|
||||
if hr = procHcnRegisterServiceCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcnRegisterServiceCallback.Addr(), 4, uintptr(service), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnUnregisterServiceCallback(callbackHandle hcnCallbackHandle) (hr error) {
|
||||
if hr = procHcnUnregisterServiceCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnUnregisterServiceCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcnCloseService(service hcnService) (hr error) {
|
||||
if hr = procHcnCloseService.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcnCloseService.Addr(), 1, uintptr(service), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
146
vendor/github.com/Microsoft/hcsshim/hcsshim.go
generated
vendored
146
vendor/github.com/Microsoft/hcsshim/hcsshim.go
generated
vendored
@@ -4,80 +4,20 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/hcserror"
|
||||
)
|
||||
|
||||
//go:generate go run mksyscall_windows.go -output zhcsshim.go hcsshim.go safeopen.go
|
||||
//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go
|
||||
|
||||
//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree
|
||||
//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId
|
||||
|
||||
//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer?
|
||||
//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer?
|
||||
//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer?
|
||||
//sys createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer?
|
||||
//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize?
|
||||
//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer?
|
||||
//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer?
|
||||
//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer?
|
||||
//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath?
|
||||
//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages?
|
||||
//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer?
|
||||
//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists?
|
||||
//sys nameToGuid(name string, guid *GUID) (hr error) = vmcompute.NameToGuid?
|
||||
//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer?
|
||||
//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer?
|
||||
//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage?
|
||||
//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage?
|
||||
|
||||
//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin?
|
||||
//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext?
|
||||
//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite?
|
||||
//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd?
|
||||
|
||||
//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin?
|
||||
//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext?
|
||||
//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead?
|
||||
//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd?
|
||||
|
||||
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
|
||||
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
|
||||
//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
|
||||
//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
|
||||
//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
|
||||
//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
|
||||
//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
|
||||
//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
|
||||
//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
|
||||
//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
|
||||
//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
|
||||
//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
|
||||
//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
|
||||
|
||||
//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
|
||||
//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
|
||||
//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
|
||||
//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
|
||||
//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
|
||||
//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
|
||||
//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
|
||||
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
|
||||
//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
|
||||
//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
|
||||
|
||||
//sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings?
|
||||
|
||||
//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
|
||||
|
||||
const (
|
||||
// Specific user-visible exit codes
|
||||
WaitErrExecFailed = 32767
|
||||
|
||||
ERROR_GEN_FAILURE = syscall.Errno(31)
|
||||
ERROR_GEN_FAILURE = hcserror.ERROR_GEN_FAILURE
|
||||
ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115)
|
||||
WSAEINVAL = syscall.Errno(10022)
|
||||
|
||||
@@ -85,82 +25,4 @@ const (
|
||||
TimeoutInfinite = 0xFFFFFFFF
|
||||
)
|
||||
|
||||
type HcsError struct {
|
||||
title string
|
||||
rest string
|
||||
Err error
|
||||
}
|
||||
|
||||
type hcsSystem syscall.Handle
|
||||
type hcsProcess syscall.Handle
|
||||
type hcsCallback syscall.Handle
|
||||
|
||||
type hcsProcessInformation struct {
|
||||
ProcessId uint32
|
||||
Reserved uint32
|
||||
StdInput syscall.Handle
|
||||
StdOutput syscall.Handle
|
||||
StdError syscall.Handle
|
||||
}
|
||||
|
||||
func makeError(err error, title, rest string) error {
|
||||
// Pass through DLL errors directly since they do not originate from HCS.
|
||||
if _, ok := err.(*syscall.DLLError); ok {
|
||||
return err
|
||||
}
|
||||
return &HcsError{title, rest, err}
|
||||
}
|
||||
|
||||
func makeErrorf(err error, title, format string, a ...interface{}) error {
|
||||
return makeError(err, title, fmt.Sprintf(format, a...))
|
||||
}
|
||||
|
||||
func win32FromError(err error) uint32 {
|
||||
if herr, ok := err.(*HcsError); ok {
|
||||
return win32FromError(herr.Err)
|
||||
}
|
||||
if code, ok := err.(syscall.Errno); ok {
|
||||
return uint32(code)
|
||||
}
|
||||
return uint32(ERROR_GEN_FAILURE)
|
||||
}
|
||||
|
||||
func win32FromHresult(hr uintptr) uintptr {
|
||||
if hr&0x1fff0000 == 0x00070000 {
|
||||
return hr & 0xffff
|
||||
}
|
||||
return hr
|
||||
}
|
||||
|
||||
func (e *HcsError) Error() string {
|
||||
s := e.title
|
||||
if len(s) > 0 && s[len(s)-1] != ' ' {
|
||||
s += " "
|
||||
}
|
||||
s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, win32FromError(e.Err))
|
||||
if e.rest != "" {
|
||||
if e.rest[0] != ' ' {
|
||||
s += " "
|
||||
}
|
||||
s += e.rest
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
func convertAndFreeCoTaskMemString(buffer *uint16) string {
|
||||
str := syscall.UTF16ToString((*[1 << 30]uint16)(unsafe.Pointer(buffer))[:])
|
||||
coTaskMemFree(unsafe.Pointer(buffer))
|
||||
return str
|
||||
}
|
||||
|
||||
func convertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
|
||||
return []byte(convertAndFreeCoTaskMemString(buffer))
|
||||
}
|
||||
|
||||
func processHcsResult(err error, resultp *uint16) error {
|
||||
if resultp != nil {
|
||||
result := convertAndFreeCoTaskMemString(resultp)
|
||||
logrus.Debugf("Result: %s", result)
|
||||
}
|
||||
return err
|
||||
}
|
||||
type HcsError = hcserror.HcsError
|
||||
|
||||
251
vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
generated
vendored
251
vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
generated
vendored
@@ -1,29 +1,14 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"net"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
// HNSEndpoint represents a network endpoint in HNS
|
||||
type HNSEndpoint struct {
|
||||
Id string `json:"ID,omitempty"`
|
||||
Name string `json:",omitempty"`
|
||||
VirtualNetwork string `json:",omitempty"`
|
||||
VirtualNetworkName string `json:",omitempty"`
|
||||
Policies []json.RawMessage `json:",omitempty"`
|
||||
MacAddress string `json:",omitempty"`
|
||||
IPAddress net.IP `json:",omitempty"`
|
||||
DNSSuffix string `json:",omitempty"`
|
||||
DNSServerList string `json:",omitempty"`
|
||||
GatewayAddress string `json:",omitempty"`
|
||||
EnableInternalDNS bool `json:",omitempty"`
|
||||
DisableICC bool `json:",omitempty"`
|
||||
PrefixLength uint8 `json:",omitempty"`
|
||||
IsRemoteEndpoint bool `json:",omitempty"`
|
||||
}
|
||||
type HNSEndpoint = hns.HNSEndpoint
|
||||
|
||||
// Namespace represents a Compartment.
|
||||
type Namespace = hns.Namespace
|
||||
|
||||
//SystemType represents the type of the system on which actions are done
|
||||
type SystemType string
|
||||
@@ -37,39 +22,19 @@ const (
|
||||
|
||||
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
|
||||
// Supported resource types are Network and Request Types are Add/Remove
|
||||
type EndpointAttachDetachRequest struct {
|
||||
ContainerID string `json:"ContainerId,omitempty"`
|
||||
SystemType SystemType `json:"SystemType"`
|
||||
CompartmentID uint16 `json:"CompartmentId,omitempty"`
|
||||
VirtualNICName string `json:"VirtualNicName,omitempty"`
|
||||
}
|
||||
type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest
|
||||
|
||||
// EndpointResquestResponse is object to get the endpoint request response
|
||||
type EndpointResquestResponse struct {
|
||||
Success bool
|
||||
Error string
|
||||
}
|
||||
type EndpointResquestResponse = hns.EndpointResquestResponse
|
||||
|
||||
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
|
||||
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
|
||||
endpoint := &HNSEndpoint{}
|
||||
err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return endpoint, nil
|
||||
return hns.HNSEndpointRequest(method, path, request)
|
||||
}
|
||||
|
||||
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
|
||||
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
|
||||
var endpoint []HNSEndpoint
|
||||
err := hnsCall("GET", "/endpoints/", "", &endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return endpoint, nil
|
||||
return hns.HNSListEndpointRequest()
|
||||
}
|
||||
|
||||
// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
|
||||
@@ -120,204 +85,10 @@ func modifyNetworkEndpoint(containerID string, endpointID string, request Reques
|
||||
|
||||
// GetHNSEndpointByID get the Endpoint by ID
|
||||
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
|
||||
return HNSEndpointRequest("GET", endpointID, "")
|
||||
return hns.GetHNSEndpointByID(endpointID)
|
||||
}
|
||||
|
||||
// GetHNSEndpointByName gets the endpoint filtered by Name
|
||||
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
|
||||
hnsResponse, err := HNSListEndpointRequest()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
for _, hnsEndpoint := range hnsResponse {
|
||||
if hnsEndpoint.Name == endpointName {
|
||||
return &hnsEndpoint, nil
|
||||
}
|
||||
}
|
||||
return nil, EndpointNotFoundError{EndpointName: endpointName}
|
||||
}
|
||||
|
||||
// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
|
||||
func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
|
||||
operation := "Create"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
jsonString, err := json.Marshal(endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return HNSEndpointRequest("POST", "", string(jsonString))
|
||||
}
|
||||
|
||||
// Delete Endpoint by sending EndpointRequest to HNS
|
||||
func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
|
||||
operation := "Delete"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
return HNSEndpointRequest("DELETE", endpoint.Id, "")
|
||||
}
|
||||
|
||||
// Update Endpoint
|
||||
func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
|
||||
operation := "Update"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
jsonString, err := json.Marshal(endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
|
||||
|
||||
return endpoint, err
|
||||
}
|
||||
|
||||
// ContainerHotAttach attaches an endpoint to a running container
|
||||
func (endpoint *HNSEndpoint) ContainerHotAttach(containerID string) error {
|
||||
operation := "ContainerHotAttach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)
|
||||
|
||||
return modifyNetworkEndpoint(containerID, endpoint.Id, Add)
|
||||
}
|
||||
|
||||
// ContainerHotDetach detaches an endpoint from a running container
|
||||
func (endpoint *HNSEndpoint) ContainerHotDetach(containerID string) error {
|
||||
operation := "ContainerHotDetach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)
|
||||
|
||||
return modifyNetworkEndpoint(containerID, endpoint.Id, Remove)
|
||||
}
|
||||
|
||||
// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
|
||||
func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
|
||||
operation := "ApplyACLPolicy"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
for _, policy := range policies {
|
||||
if policy == nil {
|
||||
continue
|
||||
}
|
||||
jsonString, err := json.Marshal(policy)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
endpoint.Policies = append(endpoint.Policies, jsonString)
|
||||
}
|
||||
|
||||
_, err := endpoint.Update()
|
||||
return err
|
||||
}
|
||||
|
||||
// ContainerAttach attaches an endpoint to container
|
||||
func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
|
||||
operation := "ContainerAttach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
ContainerID: containerID,
|
||||
CompartmentID: compartmentID,
|
||||
SystemType: ContainerType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// ContainerDetach detaches an endpoint from container
|
||||
func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
|
||||
operation := "ContainerDetach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
ContainerID: containerID,
|
||||
SystemType: ContainerType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// HostAttach attaches a nic on the host
|
||||
func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
|
||||
operation := "HostAttach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
CompartmentID: compartmentID,
|
||||
SystemType: HostType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||
|
||||
}
|
||||
|
||||
// HostDetach detaches a nic on the host
|
||||
func (endpoint *HNSEndpoint) HostDetach() error {
|
||||
operation := "HostDetach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
SystemType: HostType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// VirtualMachineNICAttach attaches a endpoint to a virtual machine
|
||||
func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
|
||||
operation := "VirtualMachineNicAttach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
VirtualNICName: virtualMachineNICName,
|
||||
SystemType: VirtualMachineType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// VirtualMachineNICDetach detaches a endpoint from a virtual machine
|
||||
func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
|
||||
operation := "VirtualMachineNicDetach"
|
||||
title := "HCSShim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
SystemType: VirtualMachineType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||
return hns.GetHNSEndpointByName(endpointName)
|
||||
}
|
||||
|
||||
16
vendor/github.com/Microsoft/hcsshim/hnsglobals.go
generated
vendored
Normal file
16
vendor/github.com/Microsoft/hcsshim/hnsglobals.go
generated
vendored
Normal file
@@ -0,0 +1,16 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
type HNSGlobals = hns.HNSGlobals
|
||||
type HNSVersion = hns.HNSVersion
|
||||
|
||||
var (
|
||||
HNSVersion1803 = hns.HNSVersion1803
|
||||
)
|
||||
|
||||
func GetHNSGlobals() (*HNSGlobals, error) {
|
||||
return hns.GetHNSGlobals()
|
||||
}
|
||||
121
vendor/github.com/Microsoft/hcsshim/hnsnetwork.go
generated
vendored
121
vendor/github.com/Microsoft/hcsshim/hnsnetwork.go
generated
vendored
@@ -1,141 +1,36 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"net"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
// Subnet is assoicated with a network and represents a list
|
||||
// of subnets available to the network
|
||||
type Subnet struct {
|
||||
AddressPrefix string `json:",omitempty"`
|
||||
GatewayAddress string `json:",omitempty"`
|
||||
Policies []json.RawMessage `json:",omitempty"`
|
||||
}
|
||||
type Subnet = hns.Subnet
|
||||
|
||||
// MacPool is assoicated with a network and represents a list
|
||||
// of macaddresses available to the network
|
||||
type MacPool struct {
|
||||
StartMacAddress string `json:",omitempty"`
|
||||
EndMacAddress string `json:",omitempty"`
|
||||
}
|
||||
type MacPool = hns.MacPool
|
||||
|
||||
// HNSNetwork represents a network in HNS
|
||||
type HNSNetwork struct {
|
||||
Id string `json:"ID,omitempty"`
|
||||
Name string `json:",omitempty"`
|
||||
Type string `json:",omitempty"`
|
||||
NetworkAdapterName string `json:",omitempty"`
|
||||
SourceMac string `json:",omitempty"`
|
||||
Policies []json.RawMessage `json:",omitempty"`
|
||||
MacPools []MacPool `json:",omitempty"`
|
||||
Subnets []Subnet `json:",omitempty"`
|
||||
DNSSuffix string `json:",omitempty"`
|
||||
DNSServerList string `json:",omitempty"`
|
||||
DNSServerCompartment uint32 `json:",omitempty"`
|
||||
ManagementIP string `json:",omitempty"`
|
||||
AutomaticDNS bool `json:",omitempty"`
|
||||
}
|
||||
|
||||
type hnsNetworkResponse struct {
|
||||
Success bool
|
||||
Error string
|
||||
Output HNSNetwork
|
||||
}
|
||||
|
||||
type hnsResponse struct {
|
||||
Success bool
|
||||
Error string
|
||||
Output json.RawMessage
|
||||
}
|
||||
type HNSNetwork = hns.HNSNetwork
|
||||
|
||||
// HNSNetworkRequest makes a call into HNS to update/query a single network
|
||||
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
|
||||
var network HNSNetwork
|
||||
err := hnsCall(method, "/networks/"+path, request, &network)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return &network, nil
|
||||
return hns.HNSNetworkRequest(method, path, request)
|
||||
}
|
||||
|
||||
// HNSListNetworkRequest makes a HNS call to query the list of available networks
|
||||
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
|
||||
var network []HNSNetwork
|
||||
err := hnsCall(method, "/networks/"+path, request, &network)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return network, nil
|
||||
return hns.HNSListNetworkRequest(method, path, request)
|
||||
}
|
||||
|
||||
// GetHNSNetworkByID
|
||||
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
|
||||
return HNSNetworkRequest("GET", networkID, "")
|
||||
return hns.GetHNSNetworkByID(networkID)
|
||||
}
|
||||
|
||||
// GetHNSNetworkName filtered by Name
|
||||
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
|
||||
hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
for _, hnsnetwork := range hsnnetworks {
|
||||
if hnsnetwork.Name == networkName {
|
||||
return &hnsnetwork, nil
|
||||
}
|
||||
}
|
||||
return nil, NetworkNotFoundError{NetworkName: networkName}
|
||||
}
|
||||
|
||||
// Create Network by sending NetworkRequest to HNS.
|
||||
func (network *HNSNetwork) Create() (*HNSNetwork, error) {
|
||||
operation := "Create"
|
||||
title := "HCSShim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s", network.Id)
|
||||
|
||||
jsonString, err := json.Marshal(network)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return HNSNetworkRequest("POST", "", string(jsonString))
|
||||
}
|
||||
|
||||
// Delete Network by sending NetworkRequest to HNS
|
||||
func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
|
||||
operation := "Delete"
|
||||
title := "HCSShim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s", network.Id)
|
||||
|
||||
return HNSNetworkRequest("DELETE", network.Id, "")
|
||||
}
|
||||
|
||||
// Creates an endpoint on the Network.
|
||||
func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
|
||||
return &HNSEndpoint{
|
||||
VirtualNetwork: network.Id,
|
||||
IPAddress: ipAddress,
|
||||
MacAddress: string(macAddress),
|
||||
}
|
||||
}
|
||||
|
||||
func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
|
||||
operation := "CreateEndpoint"
|
||||
title := "HCSShim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
|
||||
|
||||
endpoint.VirtualNetwork = network.Id
|
||||
return endpoint.Create()
|
||||
}
|
||||
|
||||
func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
|
||||
operation := "CreateRemoteEndpoint"
|
||||
title := "HCSShim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s", network.Id)
|
||||
endpoint.IsRemoteEndpoint = true
|
||||
return network.CreateEndpoint(endpoint)
|
||||
return hns.GetHNSNetworkByName(networkName)
|
||||
}
|
||||
|
||||
107
vendor/github.com/Microsoft/hcsshim/hnspolicy.go
generated
vendored
107
vendor/github.com/Microsoft/hcsshim/hnspolicy.go
generated
vendored
@@ -1,94 +1,57 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
// Type of Request Support in ModifySystem
|
||||
type PolicyType string
|
||||
type PolicyType = hns.PolicyType
|
||||
|
||||
// RequestType const
|
||||
const (
|
||||
Nat PolicyType = "NAT"
|
||||
ACL PolicyType = "ACL"
|
||||
PA PolicyType = "PA"
|
||||
VLAN PolicyType = "VLAN"
|
||||
VSID PolicyType = "VSID"
|
||||
VNet PolicyType = "VNET"
|
||||
L2Driver PolicyType = "L2Driver"
|
||||
Isolation PolicyType = "Isolation"
|
||||
QOS PolicyType = "QOS"
|
||||
OutboundNat PolicyType = "OutBoundNAT"
|
||||
ExternalLoadBalancer PolicyType = "ELB"
|
||||
Route PolicyType = "ROUTE"
|
||||
Nat = hns.Nat
|
||||
ACL = hns.ACL
|
||||
PA = hns.PA
|
||||
VLAN = hns.VLAN
|
||||
VSID = hns.VSID
|
||||
VNet = hns.VNet
|
||||
L2Driver = hns.L2Driver
|
||||
Isolation = hns.Isolation
|
||||
QOS = hns.QOS
|
||||
OutboundNat = hns.OutboundNat
|
||||
ExternalLoadBalancer = hns.ExternalLoadBalancer
|
||||
Route = hns.Route
|
||||
)
|
||||
|
||||
type NatPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
Protocol string
|
||||
InternalPort uint16
|
||||
ExternalPort uint16
|
||||
}
|
||||
type NatPolicy = hns.NatPolicy
|
||||
|
||||
type QosPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
MaximumOutgoingBandwidthInBytes uint64
|
||||
}
|
||||
type QosPolicy = hns.QosPolicy
|
||||
|
||||
type IsolationPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
VLAN uint
|
||||
VSID uint
|
||||
InDefaultIsolation bool
|
||||
}
|
||||
type IsolationPolicy = hns.IsolationPolicy
|
||||
|
||||
type VlanPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
VLAN uint
|
||||
}
|
||||
type VlanPolicy = hns.VlanPolicy
|
||||
|
||||
type VsidPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
VSID uint
|
||||
}
|
||||
type VsidPolicy = hns.VsidPolicy
|
||||
|
||||
type PaPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
PA string `json:"PA"`
|
||||
}
|
||||
type PaPolicy = hns.PaPolicy
|
||||
|
||||
type OutboundNatPolicy struct {
|
||||
Policy
|
||||
VIP string `json:"VIP,omitempty"`
|
||||
Exceptions []string `json:"ExceptionList,omitempty"`
|
||||
}
|
||||
type OutboundNatPolicy = hns.OutboundNatPolicy
|
||||
|
||||
type ActionType string
|
||||
type DirectionType string
|
||||
type RuleType string
|
||||
type ActionType = hns.ActionType
|
||||
type DirectionType = hns.DirectionType
|
||||
type RuleType = hns.RuleType
|
||||
|
||||
const (
|
||||
Allow ActionType = "Allow"
|
||||
Block ActionType = "Block"
|
||||
Allow = hns.Allow
|
||||
Block = hns.Block
|
||||
|
||||
In DirectionType = "In"
|
||||
Out DirectionType = "Out"
|
||||
In = hns.In
|
||||
Out = hns.Out
|
||||
|
||||
Host RuleType = "Host"
|
||||
Switch RuleType = "Switch"
|
||||
Host = hns.Host
|
||||
Switch = hns.Switch
|
||||
)
|
||||
|
||||
type ACLPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
Protocol uint16
|
||||
InternalPort uint16
|
||||
Action ActionType
|
||||
Direction DirectionType
|
||||
LocalAddresses string
|
||||
RemoteAddresses string
|
||||
LocalPort uint16
|
||||
RemotePort uint16
|
||||
RuleType RuleType `json:"RuleType,omitempty"`
|
||||
Priority uint16
|
||||
ServiceName string
|
||||
}
|
||||
type ACLPolicy = hns.ACLPolicy
|
||||
|
||||
type Policy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
}
|
||||
type Policy = hns.Policy
|
||||
|
||||
175
vendor/github.com/Microsoft/hcsshim/hnspolicylist.go
generated
vendored
175
vendor/github.com/Microsoft/hcsshim/hnspolicylist.go
generated
vendored
@@ -1,200 +1,47 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
// RoutePolicy is a structure defining schema for Route based Policy
|
||||
type RoutePolicy struct {
|
||||
Policy
|
||||
DestinationPrefix string `json:"DestinationPrefix,omitempty"`
|
||||
NextHop string `json:"NextHop,omitempty"`
|
||||
EncapEnabled bool `json:"NeedEncap,omitempty"`
|
||||
}
|
||||
type RoutePolicy = hns.RoutePolicy
|
||||
|
||||
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
|
||||
type ELBPolicy struct {
|
||||
LBPolicy
|
||||
SourceVIP string `json:"SourceVIP,omitempty"`
|
||||
VIPs []string `json:"VIPs,omitempty"`
|
||||
ILB bool `json:"ILB,omitempty"`
|
||||
}
|
||||
type ELBPolicy = hns.ELBPolicy
|
||||
|
||||
// LBPolicy is a structure defining schema for LoadBalancing based Policy
|
||||
type LBPolicy struct {
|
||||
Policy
|
||||
Protocol uint16 `json:"Protocol,omitempty"`
|
||||
InternalPort uint16
|
||||
ExternalPort uint16
|
||||
}
|
||||
type LBPolicy = hns.LBPolicy
|
||||
|
||||
// PolicyList is a structure defining schema for Policy list request
|
||||
type PolicyList struct {
|
||||
ID string `json:"ID,omitempty"`
|
||||
EndpointReferences []string `json:"References,omitempty"`
|
||||
Policies []json.RawMessage `json:"Policies,omitempty"`
|
||||
}
|
||||
type PolicyList = hns.PolicyList
|
||||
|
||||
// HNSPolicyListRequest makes a call into HNS to update/query a single network
|
||||
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
|
||||
var policy PolicyList
|
||||
err := hnsCall(method, "/policylists/"+path, request, &policy)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return &policy, nil
|
||||
return hns.HNSPolicyListRequest(method, path, request)
|
||||
}
|
||||
|
||||
// HNSListPolicyListRequest gets all the policy list
|
||||
func HNSListPolicyListRequest() ([]PolicyList, error) {
|
||||
var plist []PolicyList
|
||||
err := hnsCall("GET", "/policylists/", "", &plist)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return plist, nil
|
||||
return hns.HNSListPolicyListRequest()
|
||||
}
|
||||
|
||||
// PolicyListRequest makes a HNS call to modify/query a network policy list
|
||||
func PolicyListRequest(method, path, request string) (*PolicyList, error) {
|
||||
policylist := &PolicyList{}
|
||||
err := hnsCall(method, "/policylists/"+path, request, &policylist)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return policylist, nil
|
||||
return hns.PolicyListRequest(method, path, request)
|
||||
}
|
||||
|
||||
// GetPolicyListByID get the policy list by ID
|
||||
func GetPolicyListByID(policyListID string) (*PolicyList, error) {
|
||||
return PolicyListRequest("GET", policyListID, "")
|
||||
}
|
||||
|
||||
// Create PolicyList by sending PolicyListRequest to HNS.
|
||||
func (policylist *PolicyList) Create() (*PolicyList, error) {
|
||||
operation := "Create"
|
||||
title := "HCSShim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s", policylist.ID)
|
||||
jsonString, err := json.Marshal(policylist)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return PolicyListRequest("POST", "", string(jsonString))
|
||||
}
|
||||
|
||||
// Delete deletes PolicyList
|
||||
func (policylist *PolicyList) Delete() (*PolicyList, error) {
|
||||
operation := "Delete"
|
||||
title := "HCSShim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s", policylist.ID)
|
||||
|
||||
return PolicyListRequest("DELETE", policylist.ID, "")
|
||||
}
|
||||
|
||||
// AddEndpoint add an endpoint to a Policy List
|
||||
func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
|
||||
operation := "AddEndpoint"
|
||||
title := "HCSShim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
|
||||
|
||||
_, err := policylist.Delete()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// Add Endpoint to the Existing List
|
||||
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
|
||||
|
||||
return policylist.Create()
|
||||
}
|
||||
|
||||
// RemoveEndpoint removes an endpoint from the Policy List
|
||||
func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
|
||||
operation := "RemoveEndpoint"
|
||||
title := "HCSShim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
|
||||
|
||||
_, err := policylist.Delete()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
elementToRemove := "/endpoints/" + endpoint.Id
|
||||
|
||||
var references []string
|
||||
|
||||
for _, endpointReference := range policylist.EndpointReferences {
|
||||
if endpointReference == elementToRemove {
|
||||
continue
|
||||
}
|
||||
references = append(references, endpointReference)
|
||||
}
|
||||
policylist.EndpointReferences = references
|
||||
return policylist.Create()
|
||||
return hns.GetPolicyListByID(policyListID)
|
||||
}
|
||||
|
||||
// AddLoadBalancer policy list for the specified endpoints
|
||||
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
|
||||
operation := "AddLoadBalancer"
|
||||
title := "HCSShim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
|
||||
|
||||
policylist := &PolicyList{}
|
||||
|
||||
elbPolicy := &ELBPolicy{
|
||||
SourceVIP: sourceVIP,
|
||||
ILB: isILB,
|
||||
}
|
||||
|
||||
if len(vip) > 0 {
|
||||
elbPolicy.VIPs = []string{vip}
|
||||
}
|
||||
elbPolicy.Type = ExternalLoadBalancer
|
||||
elbPolicy.Protocol = protocol
|
||||
elbPolicy.InternalPort = internalPort
|
||||
elbPolicy.ExternalPort = externalPort
|
||||
|
||||
for _, endpoint := range endpoints {
|
||||
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
|
||||
}
|
||||
|
||||
jsonString, err := json.Marshal(elbPolicy)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
policylist.Policies = append(policylist.Policies, jsonString)
|
||||
return policylist.Create()
|
||||
return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
|
||||
}
|
||||
|
||||
// AddRoute adds route policy list for the specified endpoints
|
||||
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
|
||||
operation := "AddRoute"
|
||||
title := "HCSShim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
|
||||
|
||||
policylist := &PolicyList{}
|
||||
|
||||
rPolicy := &RoutePolicy{
|
||||
DestinationPrefix: destinationPrefix,
|
||||
NextHop: nextHop,
|
||||
EncapEnabled: encapEnabled,
|
||||
}
|
||||
rPolicy.Type = Route
|
||||
|
||||
for _, endpoint := range endpoints {
|
||||
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
|
||||
}
|
||||
|
||||
jsonString, err := json.Marshal(rPolicy)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
policylist.Policies = append(policylist.Policies, jsonString)
|
||||
return policylist.Create()
|
||||
return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled)
|
||||
}
|
||||
|
||||
13
vendor/github.com/Microsoft/hcsshim/hnssupport.go
generated
vendored
Normal file
13
vendor/github.com/Microsoft/hcsshim/hnssupport.go
generated
vendored
Normal file
@@ -0,0 +1,13 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
type HNSSupportedFeatures = hns.HNSSupportedFeatures
|
||||
|
||||
type HNSAclFeatures = hns.HNSAclFeatures
|
||||
|
||||
func GetHNSSupportedFeatures() HNSSupportedFeatures {
|
||||
return hns.GetHNSSupportedFeatures()
|
||||
}
|
||||
222
vendor/github.com/Microsoft/hcsshim/importlayer.go
generated
vendored
222
vendor/github.com/Microsoft/hcsshim/importlayer.go
generated
vendored
@@ -1,222 +0,0 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"io/ioutil"
|
||||
"os"
|
||||
"path/filepath"
|
||||
|
||||
"github.com/Microsoft/go-winio"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// ImportLayer will take the contents of the folder at importFolderPath and import
|
||||
// that into a layer with the id layerId. Note that in order to correctly populate
|
||||
// the layer and interperet the transport format, all parent layers must already
|
||||
// be present on the system at the paths provided in parentLayerPaths.
|
||||
func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error {
|
||||
title := "hcsshim::ImportLayer "
|
||||
logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerID, importFolderPath)
|
||||
|
||||
// Generate layer descriptors
|
||||
layers, err := layerPathsToDescriptors(parentLayerPaths)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Convert info to API calling convention
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
err = importLayer(&infop, layerID, importFolderPath, layers)
|
||||
if err != nil {
|
||||
err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerID, info.Flavour, importFolderPath)
|
||||
logrus.Error(err)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerID, importFolderPath)
|
||||
return nil
|
||||
}
|
||||
|
||||
// LayerWriter is an interface that supports writing a new container image layer.
|
||||
type LayerWriter interface {
|
||||
// Add adds a file to the layer with given metadata.
|
||||
Add(name string, fileInfo *winio.FileBasicInfo) error
|
||||
// AddLink adds a hard link to the layer. The target must already have been added.
|
||||
AddLink(name string, target string) error
|
||||
// Remove removes a file that was present in a parent layer from the layer.
|
||||
Remove(name string) error
|
||||
// Write writes data to the current file. The data must be in the format of a Win32
|
||||
// backup stream.
|
||||
Write(b []byte) (int, error)
|
||||
// Close finishes the layer writing process and releases any resources.
|
||||
Close() error
|
||||
}
|
||||
|
||||
// FilterLayerWriter provides an interface to write the contents of a layer to the file system.
|
||||
type FilterLayerWriter struct {
|
||||
context uintptr
|
||||
}
|
||||
|
||||
// Add adds a file or directory to the layer. The file's parent directory must have already been added.
|
||||
//
|
||||
// name contains the file's relative path. fileInfo contains file times and file attributes; the rest
|
||||
// of the file metadata and the file data must be written as a Win32 backup stream to the Write() method.
|
||||
// winio.BackupStreamWriter can be used to facilitate this.
|
||||
func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error {
|
||||
if name[0] != '\\' {
|
||||
name = `\` + name
|
||||
}
|
||||
err := importLayerNext(w.context, name, fileInfo)
|
||||
if err != nil {
|
||||
return makeError(err, "ImportLayerNext", "")
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// AddLink adds a hard link to the layer. The target of the link must have already been added.
|
||||
func (w *FilterLayerWriter) AddLink(name string, target string) error {
|
||||
return errors.New("hard links not yet supported")
|
||||
}
|
||||
|
||||
// Remove removes a file from the layer. The file must have been present in the parent layer.
|
||||
//
|
||||
// name contains the file's relative path.
|
||||
func (w *FilterLayerWriter) Remove(name string) error {
|
||||
if name[0] != '\\' {
|
||||
name = `\` + name
|
||||
}
|
||||
err := importLayerNext(w.context, name, nil)
|
||||
if err != nil {
|
||||
return makeError(err, "ImportLayerNext", "")
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// Write writes more backup stream data to the current file.
|
||||
func (w *FilterLayerWriter) Write(b []byte) (int, error) {
|
||||
err := importLayerWrite(w.context, b)
|
||||
if err != nil {
|
||||
err = makeError(err, "ImportLayerWrite", "")
|
||||
return 0, err
|
||||
}
|
||||
return len(b), err
|
||||
}
|
||||
|
||||
// Close completes the layer write operation. The error must be checked to ensure that the
|
||||
// operation was successful.
|
||||
func (w *FilterLayerWriter) Close() (err error) {
|
||||
if w.context != 0 {
|
||||
err = importLayerEnd(w.context)
|
||||
if err != nil {
|
||||
err = makeError(err, "ImportLayerEnd", "")
|
||||
}
|
||||
w.context = 0
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
type legacyLayerWriterWrapper struct {
|
||||
*legacyLayerWriter
|
||||
info DriverInfo
|
||||
layerID string
|
||||
path string
|
||||
parentLayerPaths []string
|
||||
}
|
||||
|
||||
func (r *legacyLayerWriterWrapper) Close() error {
|
||||
defer os.RemoveAll(r.root.Name())
|
||||
defer r.legacyLayerWriter.CloseRoots()
|
||||
err := r.legacyLayerWriter.Close()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
info := r.info
|
||||
info.HomeDir = ""
|
||||
if err = ImportLayer(info, r.destRoot.Name(), r.path, r.parentLayerPaths); err != nil {
|
||||
return err
|
||||
}
|
||||
for _, name := range r.Tombstones {
|
||||
if err = removeRelative(name, r.destRoot); err != nil && !os.IsNotExist(err) {
|
||||
return err
|
||||
}
|
||||
}
|
||||
// Add any hard links that were collected.
|
||||
for _, lnk := range r.PendingLinks {
|
||||
if err = removeRelative(lnk.Path, r.destRoot); err != nil && !os.IsNotExist(err) {
|
||||
return err
|
||||
}
|
||||
if err = linkRelative(lnk.Target, lnk.TargetRoot, lnk.Path, r.destRoot); err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
// Prepare the utility VM for use if one is present in the layer.
|
||||
if r.HasUtilityVM {
|
||||
err := ensureNotReparsePointRelative("UtilityVM", r.destRoot)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
err = ProcessUtilityVMImage(filepath.Join(r.destRoot.Name(), "UtilityVM"))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// NewLayerWriter returns a new layer writer for creating a layer on disk.
|
||||
// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges
|
||||
// to call this and any methods on the resulting LayerWriter.
|
||||
func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) {
|
||||
if len(parentLayerPaths) == 0 {
|
||||
// This is a base layer. It gets imported differently.
|
||||
f, err := openRoot(filepath.Join(info.HomeDir, layerID))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &baseLayerWriter{
|
||||
root: f,
|
||||
}, nil
|
||||
}
|
||||
|
||||
if procImportLayerBegin.Find() != nil {
|
||||
// The new layer reader is not available on this Windows build. Fall back to the
|
||||
// legacy export code path.
|
||||
path, err := ioutil.TempDir("", "hcs")
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
w, err := newLegacyLayerWriter(path, parentLayerPaths, filepath.Join(info.HomeDir, layerID))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &legacyLayerWriterWrapper{
|
||||
legacyLayerWriter: w,
|
||||
info: info,
|
||||
layerID: layerID,
|
||||
path: path,
|
||||
parentLayerPaths: parentLayerPaths,
|
||||
}, nil
|
||||
}
|
||||
layers, err := layerPathsToDescriptors(parentLayerPaths)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
infop, err := convertDriverInfo(info)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
w := &FilterLayerWriter{}
|
||||
err = importLayerBegin(&infop, layerID, layers, &w.context)
|
||||
if err != nil {
|
||||
return nil, makeError(err, "ImportLayerStart", "")
|
||||
}
|
||||
return w, nil
|
||||
}
|
||||
102
vendor/github.com/Microsoft/hcsshim/interface.go
generated
vendored
102
vendor/github.com/Microsoft/hcsshim/interface.go
generated
vendored
@@ -1,106 +1,32 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"io"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||
)
|
||||
|
||||
// ProcessConfig is used as both the input of Container.CreateProcess
|
||||
// and to convert the parameters to JSON for passing onto the HCS
|
||||
type ProcessConfig struct {
|
||||
ApplicationName string `json:",omitempty"`
|
||||
CommandLine string `json:",omitempty"`
|
||||
CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows
|
||||
User string `json:",omitempty"`
|
||||
WorkingDirectory string `json:",omitempty"`
|
||||
Environment map[string]string `json:",omitempty"`
|
||||
EmulateConsole bool `json:",omitempty"`
|
||||
CreateStdInPipe bool `json:",omitempty"`
|
||||
CreateStdOutPipe bool `json:",omitempty"`
|
||||
CreateStdErrPipe bool `json:",omitempty"`
|
||||
ConsoleSize [2]uint `json:",omitempty"`
|
||||
CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows
|
||||
OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows
|
||||
}
|
||||
type ProcessConfig = schema1.ProcessConfig
|
||||
|
||||
type Layer struct {
|
||||
ID string
|
||||
Path string
|
||||
}
|
||||
type Layer = schema1.Layer
|
||||
type MappedDir = schema1.MappedDir
|
||||
type MappedPipe = schema1.MappedPipe
|
||||
type HvRuntime = schema1.HvRuntime
|
||||
type MappedVirtualDisk = schema1.MappedVirtualDisk
|
||||
|
||||
type MappedDir struct {
|
||||
HostPath string
|
||||
ContainerPath string
|
||||
ReadOnly bool
|
||||
BandwidthMaximum uint64
|
||||
IOPSMaximum uint64
|
||||
CreateInUtilityVM bool
|
||||
}
|
||||
|
||||
type MappedPipe struct {
|
||||
HostPath string
|
||||
ContainerPipeName string
|
||||
}
|
||||
|
||||
type HvRuntime struct {
|
||||
ImagePath string `json:",omitempty"`
|
||||
SkipTemplate bool `json:",omitempty"`
|
||||
LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
|
||||
LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
|
||||
LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
|
||||
BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
|
||||
WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD
|
||||
}
|
||||
|
||||
type MappedVirtualDisk struct {
|
||||
HostPath string `json:",omitempty"` // Path to VHD on the host
|
||||
ContainerPath string // Platform-specific mount point path in the container
|
||||
CreateInUtilityVM bool `json:",omitempty"`
|
||||
ReadOnly bool `json:",omitempty"`
|
||||
Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
|
||||
AttachOnly bool `json:",omitempty:`
|
||||
}
|
||||
// AssignedDevice represents a device that has been directly assigned to a container
|
||||
//
|
||||
// NOTE: Support added in RS5
|
||||
type AssignedDevice = schema1.AssignedDevice
|
||||
|
||||
// ContainerConfig is used as both the input of CreateContainer
|
||||
// and to convert the parameters to JSON for passing onto the HCS
|
||||
type ContainerConfig struct {
|
||||
SystemType string // HCS requires this to be hard-coded to "Container"
|
||||
Name string // Name of the container. We use the docker ID.
|
||||
Owner string `json:",omitempty"` // The management platform that created this container
|
||||
VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
|
||||
IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows
|
||||
LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID
|
||||
Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
|
||||
Credentials string `json:",omitempty"` // Credentials information
|
||||
ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container.
|
||||
ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
|
||||
ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
|
||||
StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS
|
||||
StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
|
||||
StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
|
||||
MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes
|
||||
HostName string `json:",omitempty"` // Hostname
|
||||
MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts)
|
||||
MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes
|
||||
HvPartition bool // True if it a Hyper-V Container
|
||||
NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
|
||||
EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container
|
||||
HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
|
||||
Servicing bool `json:",omitempty"` // True if this container is for servicing
|
||||
AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution
|
||||
DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
|
||||
ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
|
||||
TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
|
||||
MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
|
||||
}
|
||||
type ContainerConfig = schema1.ContainerConfig
|
||||
|
||||
type ComputeSystemQuery struct {
|
||||
IDs []string `json:"Ids,omitempty"`
|
||||
Types []string `json:",omitempty"`
|
||||
Names []string `json:",omitempty"`
|
||||
Owners []string `json:",omitempty"`
|
||||
}
|
||||
type ComputeSystemQuery = schema1.ComputeSystemQuery
|
||||
|
||||
// Container represents a created (but not necessarily running) container.
|
||||
type Container interface {
|
||||
|
||||
27
vendor/github.com/Microsoft/hcsshim/internal/cni/BUILD
generated
vendored
Normal file
27
vendor/github.com/Microsoft/hcsshim/internal/cni/BUILD
generated
vendored
Normal file
@@ -0,0 +1,27 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = ["registry.go"],
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/internal/cni",
|
||||
importpath = "github.com/Microsoft/hcsshim/internal/cni",
|
||||
visibility = ["//vendor/github.com/Microsoft/hcsshim:__subpackages__"],
|
||||
deps = [
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/guid:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/regstate:go_default_library",
|
||||
],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
110
vendor/github.com/Microsoft/hcsshim/internal/cni/registry.go
generated
vendored
Normal file
110
vendor/github.com/Microsoft/hcsshim/internal/cni/registry.go
generated
vendored
Normal file
@@ -0,0 +1,110 @@
|
||||
package cni
|
||||
|
||||
import (
|
||||
"errors"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/guid"
|
||||
"github.com/Microsoft/hcsshim/internal/regstate"
|
||||
)
|
||||
|
||||
const (
|
||||
cniRoot = "cni"
|
||||
cniKey = "cfg"
|
||||
)
|
||||
|
||||
// PersistedNamespaceConfig is the registry version of the `NamespaceID` to UVM
|
||||
// map.
|
||||
type PersistedNamespaceConfig struct {
|
||||
namespaceID string
|
||||
stored bool
|
||||
|
||||
ContainerID string
|
||||
HostUniqueID guid.GUID
|
||||
}
|
||||
|
||||
// NewPersistedNamespaceConfig creates an in-memory namespace config that can be
|
||||
// persisted to the registry.
|
||||
func NewPersistedNamespaceConfig(namespaceID, containerID string, containerHostUniqueID guid.GUID) *PersistedNamespaceConfig {
|
||||
return &PersistedNamespaceConfig{
|
||||
namespaceID: namespaceID,
|
||||
ContainerID: containerID,
|
||||
HostUniqueID: containerHostUniqueID,
|
||||
}
|
||||
}
|
||||
|
||||
// LoadPersistedNamespaceConfig loads a persisted config from the registry that matches
|
||||
// `namespaceID`. If not found returns `regstate.NotFoundError`
|
||||
func LoadPersistedNamespaceConfig(namespaceID string) (*PersistedNamespaceConfig, error) {
|
||||
sk, err := regstate.Open(cniRoot, false)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
defer sk.Close()
|
||||
|
||||
pnc := PersistedNamespaceConfig{
|
||||
namespaceID: namespaceID,
|
||||
stored: true,
|
||||
}
|
||||
if err := sk.Get(namespaceID, cniKey, &pnc); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &pnc, nil
|
||||
}
|
||||
|
||||
// Store stores or updates the in-memory config to its registry state. If the
|
||||
// store failes returns the store error.
|
||||
func (pnc *PersistedNamespaceConfig) Store() error {
|
||||
if pnc.namespaceID == "" {
|
||||
return errors.New("invalid namespaceID ''")
|
||||
}
|
||||
if pnc.ContainerID == "" {
|
||||
return errors.New("invalid containerID ''")
|
||||
}
|
||||
empty := guid.GUID{}
|
||||
if pnc.HostUniqueID == empty {
|
||||
return errors.New("invalid containerHostUniqueID 'empy'")
|
||||
}
|
||||
sk, err := regstate.Open(cniRoot, false)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
defer sk.Close()
|
||||
|
||||
if pnc.stored {
|
||||
if err := sk.Set(pnc.namespaceID, cniKey, pnc); err != nil {
|
||||
return err
|
||||
}
|
||||
} else {
|
||||
if err := sk.Create(pnc.namespaceID, cniKey, pnc); err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
pnc.stored = true
|
||||
return nil
|
||||
}
|
||||
|
||||
// Remove removes any persisted state associated with this config. If the config
|
||||
// is not found in the registery `Remove` returns no error.
|
||||
func (pnc *PersistedNamespaceConfig) Remove() error {
|
||||
if pnc.stored {
|
||||
sk, err := regstate.Open(cniRoot, false)
|
||||
if err != nil {
|
||||
if regstate.IsNotFoundError(err) {
|
||||
pnc.stored = false
|
||||
return nil
|
||||
}
|
||||
return err
|
||||
}
|
||||
defer sk.Close()
|
||||
|
||||
if err := sk.Remove(pnc.namespaceID); err != nil {
|
||||
if regstate.IsNotFoundError(err) {
|
||||
pnc.stored = false
|
||||
return nil
|
||||
}
|
||||
return err
|
||||
}
|
||||
}
|
||||
pnc.stored = false
|
||||
return nil
|
||||
}
|
||||
24
vendor/github.com/Microsoft/hcsshim/internal/guestrequest/BUILD
generated
vendored
Normal file
24
vendor/github.com/Microsoft/hcsshim/internal/guestrequest/BUILD
generated
vendored
Normal file
@@ -0,0 +1,24 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = ["types.go"],
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/internal/guestrequest",
|
||||
importpath = "github.com/Microsoft/hcsshim/internal/guestrequest",
|
||||
visibility = ["//vendor/github.com/Microsoft/hcsshim:__subpackages__"],
|
||||
deps = ["//vendor/github.com/Microsoft/hcsshim/internal/schema2:go_default_library"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
100
vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
generated
vendored
Normal file
100
vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
generated
vendored
Normal file
@@ -0,0 +1,100 @@
|
||||
package guestrequest
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/schema2"
|
||||
)
|
||||
|
||||
// Arguably, many of these (at least CombinedLayers) should have been generated
|
||||
// by swagger.
|
||||
//
|
||||
// This will also change package name due to an inbound breaking change.
|
||||
|
||||
// This class is used by a modify request to add or remove a combined layers
|
||||
// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath
|
||||
// using the specified layers as the parent content. Ignores property ScratchPath
|
||||
// since the container path is already the scratch path. For linux, the GCS unions
|
||||
// the specified layers and ScratchPath together, placing the resulting union
|
||||
// filesystem at ContainerRootPath.
|
||||
type CombinedLayers struct {
|
||||
ContainerRootPath string `json:"ContainerRootPath,omitempty"`
|
||||
Layers []hcsschema.Layer `json:"Layers,omitempty"`
|
||||
ScratchPath string `json:"ScratchPath,omitempty"`
|
||||
}
|
||||
|
||||
// Defines the schema for hosted settings passed to GCS and/or OpenGCS
|
||||
|
||||
// SCSI. Scratch space for remote file-system commands, or R/W layer for containers
|
||||
type LCOWMappedVirtualDisk struct {
|
||||
MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM
|
||||
Lun uint8 `json:"Lun,omitempty"`
|
||||
Controller uint8 `json:"Controller,omitempty"`
|
||||
ReadOnly bool `json:"ReadOnly,omitempty"`
|
||||
}
|
||||
|
||||
type WCOWMappedVirtualDisk struct {
|
||||
ContainerPath string `json:"ContainerPath,omitempty"`
|
||||
Lun int32 `json:"Lun,omitempty"`
|
||||
}
|
||||
|
||||
type LCOWMappedDirectory struct {
|
||||
MountPath string `json:"MountPath,omitempty"`
|
||||
Port int32 `json:"Port,omitempty"`
|
||||
ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported)
|
||||
ReadOnly bool `json:"ReadOnly,omitempty"`
|
||||
}
|
||||
|
||||
// Read-only layers over VPMem
|
||||
type LCOWMappedVPMemDevice struct {
|
||||
DeviceNumber uint32 `json:"DeviceNumber,omitempty"`
|
||||
MountPath string `json:"MountPath,omitempty"` // /tmp/pN
|
||||
}
|
||||
|
||||
type LCOWNetworkAdapter struct {
|
||||
NamespaceID string `json:",omitempty"`
|
||||
ID string `json:",omitempty"`
|
||||
MacAddress string `json:",omitempty"`
|
||||
IPAddress string `json:",omitempty"`
|
||||
PrefixLength uint8 `json:",omitempty"`
|
||||
GatewayAddress string `json:",omitempty"`
|
||||
DNSSuffix string `json:",omitempty"`
|
||||
DNSServerList string `json:",omitempty"`
|
||||
EnableLowMetric bool `json:",omitempty"`
|
||||
EncapOverhead uint16 `json:",omitempty"`
|
||||
}
|
||||
|
||||
type ResourceType string
|
||||
|
||||
const (
|
||||
// These are constants for v2 schema modify guest requests.
|
||||
ResourceTypeMappedDirectory ResourceType = "MappedDirectory"
|
||||
ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk"
|
||||
ResourceTypeNetwork ResourceType = "Network"
|
||||
ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace"
|
||||
ResourceTypeCombinedLayers ResourceType = "CombinedLayers"
|
||||
ResourceTypeVPMemDevice ResourceType = "VPMemDevice"
|
||||
)
|
||||
|
||||
// GuestRequest is for modify commands passed to the guest.
|
||||
type GuestRequest struct {
|
||||
RequestType string `json:"RequestType,omitempty"`
|
||||
ResourceType ResourceType `json:"ResourceType,omitempty"`
|
||||
Settings interface{} `json:"Settings,omitempty"`
|
||||
}
|
||||
|
||||
type NetworkModifyRequest struct {
|
||||
AdapterId string `json:"AdapterId,omitempty"`
|
||||
RequestType string `json:"RequestType,omitempty"`
|
||||
Settings interface{} `json:"Settings,omitempty"`
|
||||
}
|
||||
|
||||
type RS4NetworkModifyRequest struct {
|
||||
AdapterInstanceId string `json:"AdapterInstanceId,omitempty"`
|
||||
RequestType string `json:"RequestType,omitempty"`
|
||||
Settings interface{} `json:"Settings,omitempty"`
|
||||
}
|
||||
|
||||
// SignalProcessOptions is the options passed to either WCOW or LCOW
|
||||
// to signal a given process.
|
||||
type SignalProcessOptions struct {
|
||||
Signal int `json:,omitempty`
|
||||
}
|
||||
23
vendor/github.com/Microsoft/hcsshim/internal/guid/BUILD
generated
vendored
Normal file
23
vendor/github.com/Microsoft/hcsshim/internal/guid/BUILD
generated
vendored
Normal file
@@ -0,0 +1,23 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = ["guid.go"],
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/internal/guid",
|
||||
importpath = "github.com/Microsoft/hcsshim/internal/guid",
|
||||
visibility = ["//vendor/github.com/Microsoft/hcsshim:__subpackages__"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
69
vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go
generated
vendored
Normal file
69
vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go
generated
vendored
Normal file
@@ -0,0 +1,69 @@
|
||||
package guid
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"io"
|
||||
"strconv"
|
||||
"strings"
|
||||
)
|
||||
|
||||
var _ = (json.Marshaler)(&GUID{})
|
||||
var _ = (json.Unmarshaler)(&GUID{})
|
||||
|
||||
type GUID [16]byte
|
||||
|
||||
func New() GUID {
|
||||
g := GUID{}
|
||||
_, err := io.ReadFull(rand.Reader, g[:])
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
return g
|
||||
}
|
||||
|
||||
func (g GUID) String() string {
|
||||
return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
|
||||
}
|
||||
|
||||
func FromString(s string) GUID {
|
||||
if len(s) != 36 {
|
||||
panic(fmt.Sprintf("invalid GUID length: %d", len(s)))
|
||||
}
|
||||
if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
|
||||
panic("invalid GUID format")
|
||||
}
|
||||
indexOrder := [16]int{
|
||||
0, 2, 4, 6,
|
||||
9, 11,
|
||||
14, 16,
|
||||
19, 21,
|
||||
24, 26, 28, 30, 32, 34,
|
||||
}
|
||||
byteOrder := [16]int{
|
||||
3, 2, 1, 0,
|
||||
5, 4,
|
||||
7, 6,
|
||||
8, 9,
|
||||
10, 11, 12, 13, 14, 15,
|
||||
}
|
||||
var g GUID
|
||||
for i, x := range indexOrder {
|
||||
b, err := strconv.ParseInt(s[x:x+2], 16, 16)
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
g[byteOrder[i]] = byte(b)
|
||||
}
|
||||
return g
|
||||
}
|
||||
|
||||
func (g GUID) MarshalJSON() ([]byte, error) {
|
||||
return json.Marshal(g.String())
|
||||
}
|
||||
|
||||
func (g *GUID) UnmarshalJSON(data []byte) error {
|
||||
*g = FromString(strings.Trim(string(data), "\""))
|
||||
return nil
|
||||
}
|
||||
50
vendor/github.com/Microsoft/hcsshim/internal/hcs/BUILD
generated
vendored
Normal file
50
vendor/github.com/Microsoft/hcsshim/internal/hcs/BUILD
generated
vendored
Normal file
@@ -0,0 +1,50 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = [
|
||||
"callback.go",
|
||||
"cgo.go",
|
||||
"errors.go",
|
||||
"hcs.go",
|
||||
"log.go",
|
||||
"process.go",
|
||||
"system.go",
|
||||
"utils.go",
|
||||
"waithelper.go",
|
||||
"watcher.go",
|
||||
"zsyscall_windows.go",
|
||||
],
|
||||
cgo = True,
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/internal/hcs",
|
||||
importpath = "github.com/Microsoft/hcsshim/internal/hcs",
|
||||
visibility = ["//vendor/github.com/Microsoft/hcsshim:__subpackages__"],
|
||||
deps = [
|
||||
"//vendor/github.com/Microsoft/go-winio:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/guestrequest:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/interop:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/logfields:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/schema1:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/timeout:go_default_library",
|
||||
"//vendor/github.com/sirupsen/logrus:go_default_library",
|
||||
] + select({
|
||||
"@io_bazel_rules_go//go/platform:windows": [
|
||||
"//vendor/golang.org/x/sys/windows:go_default_library",
|
||||
],
|
||||
"//conditions:default": [],
|
||||
}),
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
104
vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go
generated
vendored
Normal file
104
vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go
generated
vendored
Normal file
@@ -0,0 +1,104 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"sync"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
var (
|
||||
nextCallback uintptr
|
||||
callbackMap = map[uintptr]*notifcationWatcherContext{}
|
||||
callbackMapLock = sync.RWMutex{}
|
||||
|
||||
notificationWatcherCallback = syscall.NewCallback(notificationWatcher)
|
||||
|
||||
// Notifications for HCS_SYSTEM handles
|
||||
hcsNotificationSystemExited hcsNotification = 0x00000001
|
||||
hcsNotificationSystemCreateCompleted hcsNotification = 0x00000002
|
||||
hcsNotificationSystemStartCompleted hcsNotification = 0x00000003
|
||||
hcsNotificationSystemPauseCompleted hcsNotification = 0x00000004
|
||||
hcsNotificationSystemResumeCompleted hcsNotification = 0x00000005
|
||||
hcsNotificationSystemCrashReport hcsNotification = 0x00000006
|
||||
hcsNotificationSystemSiloJobCreated hcsNotification = 0x00000007
|
||||
hcsNotificationSystemSaveCompleted hcsNotification = 0x00000008
|
||||
hcsNotificationSystemRdpEnhancedModeStateChanged hcsNotification = 0x00000009
|
||||
hcsNotificationSystemShutdownFailed hcsNotification = 0x0000000A
|
||||
hcsNotificationSystemGetPropertiesCompleted hcsNotification = 0x0000000B
|
||||
hcsNotificationSystemModifyCompleted hcsNotification = 0x0000000C
|
||||
hcsNotificationSystemCrashInitiated hcsNotification = 0x0000000D
|
||||
hcsNotificationSystemGuestConnectionClosed hcsNotification = 0x0000000E
|
||||
|
||||
// Notifications for HCS_PROCESS handles
|
||||
hcsNotificationProcessExited hcsNotification = 0x00010000
|
||||
|
||||
// Common notifications
|
||||
hcsNotificationInvalid hcsNotification = 0x00000000
|
||||
hcsNotificationServiceDisconnect hcsNotification = 0x01000000
|
||||
)
|
||||
|
||||
type hcsNotification uint32
|
||||
type notificationChannel chan error
|
||||
|
||||
type notifcationWatcherContext struct {
|
||||
channels notificationChannels
|
||||
handle hcsCallback
|
||||
}
|
||||
|
||||
type notificationChannels map[hcsNotification]notificationChannel
|
||||
|
||||
func newChannels() notificationChannels {
|
||||
channels := make(notificationChannels)
|
||||
|
||||
channels[hcsNotificationSystemExited] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationProcessExited] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1)
|
||||
|
||||
return channels
|
||||
}
|
||||
|
||||
func closeChannels(channels notificationChannels) {
|
||||
for _, c := range channels {
|
||||
close(c)
|
||||
}
|
||||
}
|
||||
|
||||
func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr {
|
||||
var result error
|
||||
if int32(notificationStatus) < 0 {
|
||||
result = interop.Win32FromHresult(notificationStatus)
|
||||
}
|
||||
|
||||
callbackMapLock.RLock()
|
||||
context := callbackMap[callbackNumber]
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
if context == nil {
|
||||
return 0
|
||||
}
|
||||
|
||||
if channel, ok := context.channels[notificationType]; ok {
|
||||
channel <- result
|
||||
} else {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"notification-type": notificationType,
|
||||
}).Warn("Received a callback of an unsupported type")
|
||||
}
|
||||
|
||||
return 0
|
||||
}
|
||||
@@ -1,4 +1,4 @@
|
||||
package hcsshim
|
||||
package hcs
|
||||
|
||||
import "C"
|
||||
|
||||
287
vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go
generated
vendored
Normal file
287
vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go
generated
vendored
Normal file
@@ -0,0 +1,287 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"fmt"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
var (
|
||||
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
|
||||
ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
|
||||
|
||||
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||
ErrElementNotFound = syscall.Errno(0x490)
|
||||
|
||||
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||
ErrNotSupported = syscall.Errno(0x32)
|
||||
|
||||
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
|
||||
// decimal -2147024883 / hex 0x8007000d
|
||||
ErrInvalidData = syscall.Errno(0xd)
|
||||
|
||||
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
|
||||
ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
|
||||
|
||||
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
|
||||
ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
|
||||
|
||||
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
|
||||
ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
|
||||
|
||||
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
|
||||
ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
|
||||
|
||||
// ErrTimeout is an error encountered when waiting on a notification times out
|
||||
ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
|
||||
|
||||
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
|
||||
// a different expected notification
|
||||
ErrUnexpectedContainerExit = errors.New("unexpected container exit")
|
||||
|
||||
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
|
||||
// is lost while waiting for a notification
|
||||
ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
|
||||
|
||||
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
|
||||
ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
|
||||
|
||||
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
|
||||
ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
|
||||
|
||||
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
|
||||
ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
|
||||
|
||||
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
|
||||
ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
|
||||
|
||||
// ErrProcNotFound is an error encountered when the the process cannot be found
|
||||
ErrProcNotFound = syscall.Errno(0x7f)
|
||||
|
||||
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
|
||||
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
|
||||
ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
|
||||
|
||||
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
|
||||
ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
|
||||
|
||||
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
|
||||
ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
|
||||
|
||||
// ErrVmcomputeUnexpectedExit is an error encountered when the compute system terminates unexpectedly
|
||||
ErrVmcomputeUnexpectedExit = syscall.Errno(0xC0370106)
|
||||
|
||||
// ErrNotSupported is an error encountered when hcs doesn't support the request
|
||||
ErrPlatformNotSupported = errors.New("unsupported platform request")
|
||||
)
|
||||
|
||||
type ErrorEvent struct {
|
||||
Message string `json:"Message,omitempty"` // Fully formated error message
|
||||
StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form
|
||||
Provider string `json:"Provider,omitempty"`
|
||||
EventID uint16 `json:"EventId,omitempty"`
|
||||
Flags uint32 `json:"Flags,omitempty"`
|
||||
Source string `json:"Source,omitempty"`
|
||||
//Data []EventData `json:"Data,omitempty"` // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function)
|
||||
}
|
||||
|
||||
type hcsResult struct {
|
||||
Error int32
|
||||
ErrorMessage string
|
||||
ErrorEvents []ErrorEvent `json:"ErrorEvents,omitempty"`
|
||||
}
|
||||
|
||||
func (ev *ErrorEvent) String() string {
|
||||
evs := "[Event Detail: " + ev.Message
|
||||
if ev.StackTrace != "" {
|
||||
evs += " Stack Trace: " + ev.StackTrace
|
||||
}
|
||||
if ev.Provider != "" {
|
||||
evs += " Provider: " + ev.Provider
|
||||
}
|
||||
if ev.EventID != 0 {
|
||||
evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID)
|
||||
}
|
||||
if ev.Flags != 0 {
|
||||
evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags)
|
||||
}
|
||||
if ev.Source != "" {
|
||||
evs += " Source: " + ev.Source
|
||||
}
|
||||
evs += "]"
|
||||
return evs
|
||||
}
|
||||
|
||||
func processHcsResult(resultp *uint16) []ErrorEvent {
|
||||
if resultp != nil {
|
||||
resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
|
||||
logrus.WithField(logfields.JSON, resultj).
|
||||
Debug("HCS Result")
|
||||
result := &hcsResult{}
|
||||
if err := json.Unmarshal([]byte(resultj), result); err != nil {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
logfields.JSON: resultj,
|
||||
logrus.ErrorKey: err,
|
||||
}).Warning("Could not unmarshal HCS result")
|
||||
return nil
|
||||
}
|
||||
return result.ErrorEvents
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
type HcsError struct {
|
||||
Op string
|
||||
Err error
|
||||
Events []ErrorEvent
|
||||
}
|
||||
|
||||
func (e *HcsError) Error() string {
|
||||
s := e.Op + ": " + e.Err.Error()
|
||||
for _, ev := range e.Events {
|
||||
s += "\n" + ev.String()
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
// ProcessError is an error encountered in HCS during an operation on a Process object
|
||||
type ProcessError struct {
|
||||
SystemID string
|
||||
Pid int
|
||||
Op string
|
||||
Err error
|
||||
Events []ErrorEvent
|
||||
}
|
||||
|
||||
// SystemError is an error encountered in HCS during an operation on a Container object
|
||||
type SystemError struct {
|
||||
ID string
|
||||
Op string
|
||||
Err error
|
||||
Extra string
|
||||
Events []ErrorEvent
|
||||
}
|
||||
|
||||
func (e *SystemError) Error() string {
|
||||
s := e.Op + " " + e.ID + ": " + e.Err.Error()
|
||||
for _, ev := range e.Events {
|
||||
s += "\n" + ev.String()
|
||||
}
|
||||
if e.Extra != "" {
|
||||
s += "\n(extra info: " + e.Extra + ")"
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
|
||||
// Don't double wrap errors
|
||||
if _, ok := err.(*SystemError); ok {
|
||||
return err
|
||||
}
|
||||
return &SystemError{
|
||||
ID: system.ID(),
|
||||
Op: op,
|
||||
Extra: extra,
|
||||
Err: err,
|
||||
Events: events,
|
||||
}
|
||||
}
|
||||
|
||||
func (e *ProcessError) Error() string {
|
||||
s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error())
|
||||
for _, ev := range e.Events {
|
||||
s += "\n" + ev.String()
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
|
||||
// Don't double wrap errors
|
||||
if _, ok := err.(*ProcessError); ok {
|
||||
return err
|
||||
}
|
||||
return &ProcessError{
|
||||
Pid: process.Pid(),
|
||||
SystemID: process.SystemID(),
|
||||
Op: op,
|
||||
Err: err,
|
||||
Events: events,
|
||||
}
|
||||
}
|
||||
|
||||
// IsNotExist checks if an error is caused by the Container or Process not existing.
|
||||
// Note: Currently, ErrElementNotFound can mean that a Process has either
|
||||
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||
func IsNotExist(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrComputeSystemDoesNotExist ||
|
||||
err == ErrElementNotFound ||
|
||||
err == ErrProcNotFound
|
||||
}
|
||||
|
||||
// IsAlreadyClosed checks if an error is caused by the Container or Process having been
|
||||
// already closed by a call to the Close() method.
|
||||
func IsAlreadyClosed(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrAlreadyClosed
|
||||
}
|
||||
|
||||
// IsPending returns a boolean indicating whether the error is that
|
||||
// the requested operation is being completed in the background.
|
||||
func IsPending(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrVmcomputeOperationPending
|
||||
}
|
||||
|
||||
// IsTimeout returns a boolean indicating whether the error is caused by
|
||||
// a timeout waiting for the operation to complete.
|
||||
func IsTimeout(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrTimeout
|
||||
}
|
||||
|
||||
// IsAlreadyStopped returns a boolean indicating whether the error is caused by
|
||||
// a Container or Process being already stopped.
|
||||
// Note: Currently, ErrElementNotFound can mean that a Process has either
|
||||
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||
func IsAlreadyStopped(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrVmcomputeAlreadyStopped ||
|
||||
err == ErrElementNotFound ||
|
||||
err == ErrProcNotFound
|
||||
}
|
||||
|
||||
// IsNotSupported returns a boolean indicating whether the error is caused by
|
||||
// unsupported platform requests
|
||||
// Note: Currently Unsupported platform requests can be mean either
|
||||
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
|
||||
// is thrown from the Platform
|
||||
func IsNotSupported(err error) bool {
|
||||
err = getInnerError(err)
|
||||
// If Platform doesn't recognize or support the request sent, below errors are seen
|
||||
return err == ErrVmcomputeInvalidJSON ||
|
||||
err == ErrInvalidData ||
|
||||
err == ErrNotSupported ||
|
||||
err == ErrVmcomputeUnknownMessage
|
||||
}
|
||||
|
||||
func getInnerError(err error) error {
|
||||
switch pe := err.(type) {
|
||||
case nil:
|
||||
return nil
|
||||
case *HcsError:
|
||||
err = pe.Err
|
||||
case *SystemError:
|
||||
err = pe.Err
|
||||
case *ProcessError:
|
||||
err = pe.Err
|
||||
}
|
||||
return err
|
||||
}
|
||||
48
vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go
generated
vendored
Normal file
48
vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go
generated
vendored
Normal file
@@ -0,0 +1,48 @@
|
||||
// Shim for the Host Compute Service (HCS) to manage Windows Server
|
||||
// containers and Hyper-V containers.
|
||||
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
)
|
||||
|
||||
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
|
||||
|
||||
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
|
||||
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
|
||||
//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
|
||||
//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
|
||||
//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
|
||||
//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
|
||||
//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
|
||||
//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
|
||||
//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
|
||||
//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
|
||||
//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
|
||||
//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
|
||||
//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
|
||||
|
||||
//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
|
||||
//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
|
||||
//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
|
||||
//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
|
||||
//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
|
||||
//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
|
||||
//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
|
||||
//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
|
||||
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
|
||||
//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
|
||||
//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
|
||||
|
||||
type hcsSystem syscall.Handle
|
||||
type hcsProcess syscall.Handle
|
||||
type hcsCallback syscall.Handle
|
||||
|
||||
type hcsProcessInformation struct {
|
||||
ProcessId uint32
|
||||
Reserved uint32
|
||||
StdInput syscall.Handle
|
||||
StdOutput syscall.Handle
|
||||
StdError syscall.Handle
|
||||
}
|
||||
15
vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go
generated
vendored
Normal file
15
vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go
generated
vendored
Normal file
@@ -0,0 +1,15 @@
|
||||
package hcs
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
func logOperationBegin(ctx logrus.Fields, msg string) {
|
||||
logrus.WithFields(ctx).Debug(msg)
|
||||
}
|
||||
|
||||
func logOperationEnd(ctx logrus.Fields, msg string, err error) {
|
||||
if err == nil {
|
||||
logrus.WithFields(ctx).Debug(msg)
|
||||
} else {
|
||||
logrus.WithFields(ctx).WithError(err).Error(msg)
|
||||
}
|
||||
}
|
||||
462
vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go
generated
vendored
Normal file
462
vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go
generated
vendored
Normal file
@@ -0,0 +1,462 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"io"
|
||||
"sync"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/guestrequest"
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// ContainerError is an error encountered in HCS
|
||||
type Process struct {
|
||||
handleLock sync.RWMutex
|
||||
handle hcsProcess
|
||||
processID int
|
||||
system *System
|
||||
cachedPipes *cachedPipes
|
||||
callbackNumber uintptr
|
||||
|
||||
logctx logrus.Fields
|
||||
}
|
||||
|
||||
func newProcess(process hcsProcess, processID int, computeSystem *System) *Process {
|
||||
return &Process{
|
||||
handle: process,
|
||||
processID: processID,
|
||||
system: computeSystem,
|
||||
logctx: logrus.Fields{
|
||||
logfields.HCSOperation: "",
|
||||
logfields.ContainerID: computeSystem.ID(),
|
||||
logfields.ProcessID: processID,
|
||||
},
|
||||
}
|
||||
}
|
||||
|
||||
type cachedPipes struct {
|
||||
stdIn syscall.Handle
|
||||
stdOut syscall.Handle
|
||||
stdErr syscall.Handle
|
||||
}
|
||||
|
||||
type processModifyRequest struct {
|
||||
Operation string
|
||||
ConsoleSize *consoleSize `json:",omitempty"`
|
||||
CloseHandle *closeHandle `json:",omitempty"`
|
||||
}
|
||||
|
||||
type consoleSize struct {
|
||||
Height uint16
|
||||
Width uint16
|
||||
}
|
||||
|
||||
type closeHandle struct {
|
||||
Handle string
|
||||
}
|
||||
|
||||
type ProcessStatus struct {
|
||||
ProcessID uint32
|
||||
Exited bool
|
||||
ExitCode uint32
|
||||
LastWaitResult int32
|
||||
}
|
||||
|
||||
const (
|
||||
stdIn string = "StdIn"
|
||||
stdOut string = "StdOut"
|
||||
stdErr string = "StdErr"
|
||||
)
|
||||
|
||||
const (
|
||||
modifyConsoleSize string = "ConsoleSize"
|
||||
modifyCloseHandle string = "CloseHandle"
|
||||
)
|
||||
|
||||
// Pid returns the process ID of the process within the container.
|
||||
func (process *Process) Pid() int {
|
||||
return process.processID
|
||||
}
|
||||
|
||||
// SystemID returns the ID of the process's compute system.
|
||||
func (process *Process) SystemID() string {
|
||||
return process.system.ID()
|
||||
}
|
||||
|
||||
func (process *Process) logOperationBegin(operation string) {
|
||||
process.logctx[logfields.HCSOperation] = operation
|
||||
logOperationBegin(
|
||||
process.logctx,
|
||||
"hcsshim::Process - Begin Operation")
|
||||
}
|
||||
|
||||
func (process *Process) logOperationEnd(err error) {
|
||||
var result string
|
||||
if err == nil {
|
||||
result = "Success"
|
||||
} else {
|
||||
result = "Error"
|
||||
}
|
||||
|
||||
logOperationEnd(
|
||||
process.logctx,
|
||||
"hcsshim::Process - End Operation - "+result,
|
||||
err)
|
||||
process.logctx[logfields.HCSOperation] = ""
|
||||
}
|
||||
|
||||
// Signal signals the process with `options`.
|
||||
func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Signal"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
optionsb, err := json.Marshal(options)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
optionsStr := string(optionsb)
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(process.logctx, func() {
|
||||
err = hcsSignalProcess(process.handle, optionsStr, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Kill signals the process to terminate but does not wait for it to finish terminating.
|
||||
func (process *Process) Kill() (err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Kill"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(process.logctx, func() {
|
||||
err = hcsTerminateProcess(process.handle, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Wait waits for the process to exit.
|
||||
func (process *Process) Wait() (err error) {
|
||||
operation := "hcsshim::Process::Wait"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(err) }()
|
||||
|
||||
err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// WaitTimeout waits for the process to exit or the duration to elapse. It returns
|
||||
// false if timeout occurs.
|
||||
func (process *Process) WaitTimeout(timeout time.Duration) (err error) {
|
||||
operation := "hcssshim::Process::WaitTimeout"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(err) }()
|
||||
|
||||
err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// ResizeConsole resizes the console of the process.
|
||||
func (process *Process) ResizeConsole(width, height uint16) (err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::ResizeConsole"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
modifyRequest := processModifyRequest{
|
||||
Operation: modifyConsoleSize,
|
||||
ConsoleSize: &consoleSize{
|
||||
Height: height,
|
||||
Width: width,
|
||||
},
|
||||
}
|
||||
|
||||
modifyRequestb, err := json.Marshal(modifyRequest)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
modifyRequestStr := string(modifyRequestb)
|
||||
|
||||
var resultp *uint16
|
||||
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (process *Process) Properties() (_ *ProcessStatus, err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Properties"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
propertiesp *uint16
|
||||
)
|
||||
syscallWatcher(process.logctx, func() {
|
||||
err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
if propertiesp == nil {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
|
||||
|
||||
properties := &ProcessStatus{}
|
||||
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
|
||||
return nil, makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return properties, nil
|
||||
}
|
||||
|
||||
// ExitCode returns the exit code of the process. The process must have
|
||||
// already terminated.
|
||||
func (process *Process) ExitCode() (_ int, err error) {
|
||||
operation := "hcsshim::Process::ExitCode"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(err) }()
|
||||
|
||||
properties, err := process.Properties()
|
||||
if err != nil {
|
||||
return 0, makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
if properties.Exited == false {
|
||||
return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
|
||||
}
|
||||
|
||||
if properties.LastWaitResult != 0 {
|
||||
return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
|
||||
}
|
||||
|
||||
return int(properties.ExitCode), nil
|
||||
}
|
||||
|
||||
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
|
||||
// these pipes does not close the underlying pipes; it should be possible to
|
||||
// call this multiple times to get multiple interfaces.
|
||||
func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Stdio"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var stdIn, stdOut, stdErr syscall.Handle
|
||||
|
||||
if process.cachedPipes == nil {
|
||||
var (
|
||||
processInfo hcsProcessInformation
|
||||
resultp *uint16
|
||||
)
|
||||
err = hcsGetProcessInfo(process.handle, &processInfo, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, nil, nil, makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
|
||||
} else {
|
||||
// Use cached pipes
|
||||
stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
|
||||
|
||||
// Invalidate the cache
|
||||
process.cachedPipes = nil
|
||||
}
|
||||
|
||||
pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
|
||||
if err != nil {
|
||||
return nil, nil, nil, makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return pipes[0], pipes[1], pipes[2], nil
|
||||
}
|
||||
|
||||
// CloseStdin closes the write side of the stdin pipe so that the process is
|
||||
// notified on the read side that there is no more data in stdin.
|
||||
func (process *Process) CloseStdin() (err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::CloseStdin"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
modifyRequest := processModifyRequest{
|
||||
Operation: modifyCloseHandle,
|
||||
CloseHandle: &closeHandle{
|
||||
Handle: stdIn,
|
||||
},
|
||||
}
|
||||
|
||||
modifyRequestb, err := json.Marshal(modifyRequest)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
modifyRequestStr := string(modifyRequestb)
|
||||
|
||||
var resultp *uint16
|
||||
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Close cleans up any state associated with the process but does not kill
|
||||
// or wait on it.
|
||||
func (process *Process) Close() (err error) {
|
||||
process.handleLock.Lock()
|
||||
defer process.handleLock.Unlock()
|
||||
|
||||
operation := "hcsshim::Process::Close"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(err) }()
|
||||
|
||||
// Don't double free this
|
||||
if process.handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
if err = process.unregisterCallback(); err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
if err = hcsCloseProcess(process.handle); err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
process.handle = 0
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (process *Process) registerCallback() error {
|
||||
context := ¬ifcationWatcherContext{
|
||||
channels: newChannels(),
|
||||
}
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackNumber := nextCallback
|
||||
nextCallback++
|
||||
callbackMap[callbackNumber] = context
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
var callbackHandle hcsCallback
|
||||
err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
context.handle = callbackHandle
|
||||
process.callbackNumber = callbackNumber
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (process *Process) unregisterCallback() error {
|
||||
callbackNumber := process.callbackNumber
|
||||
|
||||
callbackMapLock.RLock()
|
||||
context := callbackMap[callbackNumber]
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
if context == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
handle := context.handle
|
||||
|
||||
if handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
// hcsUnregisterProcessCallback has its own syncronization
|
||||
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||
err := hcsUnregisterProcessCallback(handle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
closeChannels(context.channels)
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackMap[callbackNumber] = nil
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
handle = 0
|
||||
|
||||
return nil
|
||||
}
|
||||
672
vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go
generated
vendored
Normal file
672
vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go
generated
vendored
Normal file
@@ -0,0 +1,672 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"os"
|
||||
"strconv"
|
||||
"sync"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||
"github.com/Microsoft/hcsshim/internal/timeout"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// currentContainerStarts is used to limit the number of concurrent container
|
||||
// starts.
|
||||
var currentContainerStarts containerStarts
|
||||
|
||||
type containerStarts struct {
|
||||
maxParallel int
|
||||
inProgress int
|
||||
sync.Mutex
|
||||
}
|
||||
|
||||
func init() {
|
||||
mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
|
||||
if len(mpsS) > 0 {
|
||||
mpsI, err := strconv.Atoi(mpsS)
|
||||
if err != nil || mpsI < 0 {
|
||||
return
|
||||
}
|
||||
currentContainerStarts.maxParallel = mpsI
|
||||
}
|
||||
}
|
||||
|
||||
type System struct {
|
||||
handleLock sync.RWMutex
|
||||
handle hcsSystem
|
||||
id string
|
||||
callbackNumber uintptr
|
||||
|
||||
logctx logrus.Fields
|
||||
}
|
||||
|
||||
func newSystem(id string) *System {
|
||||
return &System{
|
||||
id: id,
|
||||
logctx: logrus.Fields{
|
||||
logfields.HCSOperation: "",
|
||||
logfields.ContainerID: id,
|
||||
},
|
||||
}
|
||||
}
|
||||
|
||||
func (computeSystem *System) logOperationBegin(operation string) {
|
||||
computeSystem.logctx[logfields.HCSOperation] = operation
|
||||
logOperationBegin(
|
||||
computeSystem.logctx,
|
||||
"hcsshim::ComputeSystem - Begin Operation")
|
||||
}
|
||||
|
||||
func (computeSystem *System) logOperationEnd(err error) {
|
||||
var result string
|
||||
if err == nil {
|
||||
result = "Success"
|
||||
} else {
|
||||
result = "Error"
|
||||
}
|
||||
|
||||
logOperationEnd(
|
||||
computeSystem.logctx,
|
||||
"hcsshim::ComputeSystem - End Operation - "+result,
|
||||
err)
|
||||
computeSystem.logctx[logfields.HCSOperation] = ""
|
||||
}
|
||||
|
||||
// CreateComputeSystem creates a new compute system with the given configuration but does not start it.
|
||||
func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) {
|
||||
operation := "hcsshim::CreateComputeSystem"
|
||||
|
||||
computeSystem := newSystem(id)
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(err) }()
|
||||
|
||||
hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
hcsDocument := string(hcsDocumentB)
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, hcsDocument).
|
||||
Debug("HCS ComputeSystem Document")
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
identity syscall.Handle
|
||||
createError error
|
||||
)
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
|
||||
})
|
||||
|
||||
if createError == nil || IsPending(createError) {
|
||||
if err = computeSystem.registerCallback(); err != nil {
|
||||
// Terminate the compute system if it still exists. We're okay to
|
||||
// ignore a failure here.
|
||||
computeSystem.Terminate()
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
}
|
||||
|
||||
events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
|
||||
if err != nil {
|
||||
if err == ErrTimeout {
|
||||
// Terminate the compute system if it still exists. We're okay to
|
||||
// ignore a failure here.
|
||||
computeSystem.Terminate()
|
||||
}
|
||||
return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
|
||||
}
|
||||
|
||||
return computeSystem, nil
|
||||
}
|
||||
|
||||
// OpenComputeSystem opens an existing compute system by ID.
|
||||
func OpenComputeSystem(id string) (_ *System, err error) {
|
||||
operation := "hcsshim::OpenComputeSystem"
|
||||
|
||||
computeSystem := newSystem(id)
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(err) }()
|
||||
|
||||
var (
|
||||
handle hcsSystem
|
||||
resultp *uint16
|
||||
)
|
||||
err = hcsOpenComputeSystem(id, &handle, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
computeSystem.handle = handle
|
||||
|
||||
if err = computeSystem.registerCallback(); err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
return computeSystem, nil
|
||||
}
|
||||
|
||||
// GetComputeSystems gets a list of the compute systems on the system that match the query
|
||||
func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) {
|
||||
operation := "hcsshim::GetComputeSystems"
|
||||
fields := logrus.Fields{
|
||||
logfields.HCSOperation: operation,
|
||||
}
|
||||
logOperationBegin(
|
||||
fields,
|
||||
"hcsshim::ComputeSystem - Begin Operation")
|
||||
|
||||
defer func() {
|
||||
var result string
|
||||
if err == nil {
|
||||
result = "Success"
|
||||
} else {
|
||||
result = "Error"
|
||||
}
|
||||
|
||||
logOperationEnd(
|
||||
fields,
|
||||
"hcsshim::ComputeSystem - End Operation - "+result,
|
||||
err)
|
||||
}()
|
||||
|
||||
queryb, err := json.Marshal(q)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
query := string(queryb)
|
||||
|
||||
logrus.WithFields(fields).
|
||||
WithField(logfields.JSON, query).
|
||||
Debug("HCS ComputeSystem Query")
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
computeSystemsp *uint16
|
||||
)
|
||||
|
||||
syscallWatcher(fields, func() {
|
||||
err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, &HcsError{Op: operation, Err: err, Events: events}
|
||||
}
|
||||
|
||||
if computeSystemsp == nil {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
|
||||
computeSystems := []schema1.ContainerProperties{}
|
||||
if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return computeSystems, nil
|
||||
}
|
||||
|
||||
// Start synchronously starts the computeSystem.
|
||||
func (computeSystem *System) Start() (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Start"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
// This is a very simple backoff-retry loop to limit the number
|
||||
// of parallel container starts if environment variable
|
||||
// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
|
||||
// It should generally only be used as a workaround to various
|
||||
// platform issues that exist between RS1 and RS4 as of Aug 2018
|
||||
if currentContainerStarts.maxParallel > 0 {
|
||||
for {
|
||||
currentContainerStarts.Lock()
|
||||
if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
|
||||
currentContainerStarts.inProgress++
|
||||
currentContainerStarts.Unlock()
|
||||
break
|
||||
}
|
||||
if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
|
||||
currentContainerStarts.Unlock()
|
||||
time.Sleep(100 * time.Millisecond)
|
||||
}
|
||||
}
|
||||
// Make sure we decrement the count when we are done.
|
||||
defer func() {
|
||||
currentContainerStarts.Lock()
|
||||
currentContainerStarts.inProgress--
|
||||
currentContainerStarts.Unlock()
|
||||
}()
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsStartComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Start", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// ID returns the compute system's identifier.
|
||||
func (computeSystem *System) ID() string {
|
||||
return computeSystem.id
|
||||
}
|
||||
|
||||
// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
|
||||
// it may not actually be shut down until Wait() succeeds.
|
||||
func (computeSystem *System) Shutdown() (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Shutdown"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Shutdown", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
|
||||
// it may not actually be shut down until Wait() succeeds.
|
||||
func (computeSystem *System) Terminate() (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Terminate"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil && err != ErrVmcomputeAlreadyStopped {
|
||||
return makeSystemError(computeSystem, "Terminate", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Wait synchronously waits for the compute system to shutdown or terminate.
|
||||
func (computeSystem *System) Wait() (err error) {
|
||||
operation := "hcsshim::ComputeSystem::Wait"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(err) }()
|
||||
|
||||
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Wait", "", err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// WaitExpectedError synchronously waits for the compute system to shutdown or
|
||||
// terminate, and ignores the passed error if it occurs.
|
||||
func (computeSystem *System) WaitExpectedError(expected error) (err error) {
|
||||
operation := "hcsshim::ComputeSystem::WaitExpectedError"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(err) }()
|
||||
|
||||
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
|
||||
if err != nil && err != expected {
|
||||
return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
|
||||
// If the timeout expires, IsTimeout(err) == true
|
||||
func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) {
|
||||
operation := "hcsshim::ComputeSystem::WaitTimeout"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(err) }()
|
||||
|
||||
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Properties"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(err) }()
|
||||
|
||||
queryj, err := json.Marshal(schema1.PropertyQuery{types})
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
|
||||
}
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, queryj).
|
||||
Debug("HCS ComputeSystem Properties Query")
|
||||
|
||||
var resultp, propertiesp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "Properties", "", err, events)
|
||||
}
|
||||
|
||||
if propertiesp == nil {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
|
||||
properties := &schema1.ContainerProperties{}
|
||||
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
|
||||
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
|
||||
}
|
||||
|
||||
return properties, nil
|
||||
}
|
||||
|
||||
// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
|
||||
func (computeSystem *System) Pause() (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Pause"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Pause", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
|
||||
func (computeSystem *System) Resume() (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Resume"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Resume", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// CreateProcess launches a new process within the computeSystem.
|
||||
func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::CreateProcess"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(err) }()
|
||||
|
||||
var (
|
||||
processInfo hcsProcessInformation
|
||||
processHandle hcsProcess
|
||||
resultp *uint16
|
||||
)
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
configurationb, err := json.Marshal(c)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
|
||||
}
|
||||
|
||||
configuration := string(configurationb)
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, configuration).
|
||||
Debug("HCS ComputeSystem Process Document")
|
||||
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
|
||||
}
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.ProcessID, processInfo.ProcessId).
|
||||
Debug("HCS ComputeSystem CreateProcess PID")
|
||||
|
||||
process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem)
|
||||
process.cachedPipes = &cachedPipes{
|
||||
stdIn: processInfo.StdInput,
|
||||
stdOut: processInfo.StdOutput,
|
||||
stdErr: processInfo.StdError,
|
||||
}
|
||||
|
||||
if err = process.registerCallback(); err != nil {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
|
||||
}
|
||||
|
||||
return process, nil
|
||||
}
|
||||
|
||||
// OpenProcess gets an interface to an existing process within the computeSystem.
|
||||
func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
// Add PID for the context of this operation
|
||||
computeSystem.logctx[logfields.ProcessID] = pid
|
||||
defer delete(computeSystem.logctx, logfields.ProcessID)
|
||||
|
||||
operation := "hcsshim::ComputeSystem::OpenProcess"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(err) }()
|
||||
|
||||
var (
|
||||
processHandle hcsProcess
|
||||
resultp *uint16
|
||||
)
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
|
||||
}
|
||||
|
||||
process := newProcess(processHandle, pid, computeSystem)
|
||||
if err = process.registerCallback(); err != nil {
|
||||
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
|
||||
}
|
||||
|
||||
return process, nil
|
||||
}
|
||||
|
||||
// Close cleans up any state associated with the compute system but does not terminate or wait for it.
|
||||
func (computeSystem *System) Close() (err error) {
|
||||
computeSystem.handleLock.Lock()
|
||||
defer computeSystem.handleLock.Unlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Close"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(err) }()
|
||||
|
||||
// Don't double free this
|
||||
if computeSystem.handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
if err = computeSystem.unregisterCallback(); err != nil {
|
||||
return makeSystemError(computeSystem, "Close", "", err, nil)
|
||||
}
|
||||
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsCloseComputeSystem(computeSystem.handle)
|
||||
})
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Close", "", err, nil)
|
||||
}
|
||||
|
||||
computeSystem.handle = 0
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) registerCallback() error {
|
||||
context := ¬ifcationWatcherContext{
|
||||
channels: newChannels(),
|
||||
}
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackNumber := nextCallback
|
||||
nextCallback++
|
||||
callbackMap[callbackNumber] = context
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
var callbackHandle hcsCallback
|
||||
err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
context.handle = callbackHandle
|
||||
computeSystem.callbackNumber = callbackNumber
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) unregisterCallback() error {
|
||||
callbackNumber := computeSystem.callbackNumber
|
||||
|
||||
callbackMapLock.RLock()
|
||||
context := callbackMap[callbackNumber]
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
if context == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
handle := context.handle
|
||||
|
||||
if handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
// hcsUnregisterComputeSystemCallback has its own syncronization
|
||||
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||
err := hcsUnregisterComputeSystemCallback(handle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
closeChannels(context.channels)
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackMap[callbackNumber] = nil
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
handle = 0
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Modify the System by sending a request to HCS
|
||||
func (computeSystem *System) Modify(config interface{}) (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Modify"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
requestJSON, err := json.Marshal(config)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
requestString := string(requestJSON)
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, requestString).
|
||||
Debug("HCS ComputeSystem Modify Document")
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Modify", requestString, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
@@ -1,4 +1,4 @@
|
||||
package hcsshim
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"io"
|
||||
@@ -1,4 +1,4 @@
|
||||
package hcsshim
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"time"
|
||||
@@ -6,13 +6,13 @@ import (
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
|
||||
err = processHcsResult(err, resultp)
|
||||
func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
|
||||
events := processHcsResult(resultp)
|
||||
if IsPending(err) {
|
||||
return waitForNotification(callbackNumber, expectedNotification, timeout)
|
||||
return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
|
||||
}
|
||||
|
||||
return err
|
||||
return events, err
|
||||
}
|
||||
|
||||
func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
|
||||
41
vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go
generated
vendored
Normal file
41
vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go
generated
vendored
Normal file
@@ -0,0 +1,41 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/Microsoft/hcsshim/internal/timeout"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// syscallWatcher is used as a very simple goroutine around calls into
|
||||
// the platform. In some cases, we have seen HCS APIs not returning due to
|
||||
// various bugs, and the goroutine making the syscall ends up not returning,
|
||||
// prior to its async callback. By spinning up a syscallWatcher, it allows
|
||||
// us to at least log a warning if a syscall doesn't complete in a reasonable
|
||||
// amount of time.
|
||||
//
|
||||
// Usage is:
|
||||
//
|
||||
// syscallWatcher(logContext, func() {
|
||||
// err = <syscall>(args...)
|
||||
// })
|
||||
//
|
||||
|
||||
func syscallWatcher(logContext logrus.Fields, syscallLambda func()) {
|
||||
ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher)
|
||||
defer cancel()
|
||||
go watchFunc(ctx, logContext)
|
||||
syscallLambda()
|
||||
}
|
||||
|
||||
func watchFunc(ctx context.Context, logContext logrus.Fields) {
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
if ctx.Err() != context.Canceled {
|
||||
logrus.WithFields(logContext).
|
||||
WithField(logfields.Timeout, timeout.SyscallWatcher).
|
||||
Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
|
||||
}
|
||||
}
|
||||
}
|
||||
533
vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go
generated
vendored
Normal file
533
vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go
generated
vendored
Normal file
@@ -0,0 +1,533 @@
|
||||
// Code generated mksyscall_windows.exe DO NOT EDIT
|
||||
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
var _ unsafe.Pointer
|
||||
|
||||
// Do the interface allocations only once for common
|
||||
// Errno values.
|
||||
const (
|
||||
errnoERROR_IO_PENDING = 997
|
||||
)
|
||||
|
||||
var (
|
||||
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||
)
|
||||
|
||||
// errnoErr returns common boxed Errno values, to prevent
|
||||
// allocations at runtime.
|
||||
func errnoErr(e syscall.Errno) error {
|
||||
switch e {
|
||||
case 0:
|
||||
return nil
|
||||
case errnoERROR_IO_PENDING:
|
||||
return errERROR_IO_PENDING
|
||||
}
|
||||
// TODO: add more here, after collecting data on the common
|
||||
// error values see on Windows. (perhaps when running
|
||||
// all.bat?)
|
||||
return e
|
||||
}
|
||||
|
||||
var (
|
||||
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
|
||||
|
||||
procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems")
|
||||
procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem")
|
||||
procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem")
|
||||
procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem")
|
||||
procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem")
|
||||
procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem")
|
||||
procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem")
|
||||
procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem")
|
||||
procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem")
|
||||
procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties")
|
||||
procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem")
|
||||
procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
|
||||
procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
|
||||
procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess")
|
||||
procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess")
|
||||
procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess")
|
||||
procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess")
|
||||
|
||||
procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo")
|
||||
procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties")
|
||||
procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess")
|
||||
procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties")
|
||||
procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback")
|
||||
procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
|
||||
)
|
||||
|
||||
func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(query)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
|
||||
}
|
||||
|
||||
func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(id)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
var _p1 *uint16
|
||||
_p1, hr = syscall.UTF16PtrFromString(configuration)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
|
||||
}
|
||||
|
||||
func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
if hr = procHcsCreateComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(id)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsOpenComputeSystem(_p0, computeSystem, result)
|
||||
}
|
||||
|
||||
func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
if hr = procHcsOpenComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
|
||||
if hr = procHcsCloseComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsStartComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsStartComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsShutdownComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsTerminateComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsPauseComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsPauseComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsResumeComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsResumeComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
|
||||
}
|
||||
|
||||
func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(configuration)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsModifyComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsModifyComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
|
||||
if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
|
||||
if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(processParameters)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
|
||||
}
|
||||
|
||||
func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
|
||||
if hr = procHcsCreateProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
|
||||
if hr = procHcsOpenProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCloseProcess(process hcsProcess) (hr error) {
|
||||
if hr = procHcsCloseProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
|
||||
if hr = procHcsTerminateProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsSignalProcess(process, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsTerminateProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
|
||||
if hr = procHcsGetProcessInfo.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsGetProcessProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(settings)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsModifyProcess(process, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsModifyProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsGetServiceProperties(_p0, properties, result)
|
||||
}
|
||||
|
||||
func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsGetServiceProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
|
||||
if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
|
||||
if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
23
vendor/github.com/Microsoft/hcsshim/internal/hcserror/BUILD
generated
vendored
Normal file
23
vendor/github.com/Microsoft/hcsshim/internal/hcserror/BUILD
generated
vendored
Normal file
@@ -0,0 +1,23 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = ["hcserror.go"],
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/internal/hcserror",
|
||||
importpath = "github.com/Microsoft/hcsshim/internal/hcserror",
|
||||
visibility = ["//vendor/github.com/Microsoft/hcsshim:__subpackages__"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
47
vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go
generated
vendored
Normal file
47
vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go
generated
vendored
Normal file
@@ -0,0 +1,47 @@
|
||||
package hcserror
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"syscall"
|
||||
)
|
||||
|
||||
const ERROR_GEN_FAILURE = syscall.Errno(31)
|
||||
|
||||
type HcsError struct {
|
||||
title string
|
||||
rest string
|
||||
Err error
|
||||
}
|
||||
|
||||
func (e *HcsError) Error() string {
|
||||
s := e.title
|
||||
if len(s) > 0 && s[len(s)-1] != ' ' {
|
||||
s += " "
|
||||
}
|
||||
s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err))
|
||||
if e.rest != "" {
|
||||
if e.rest[0] != ' ' {
|
||||
s += " "
|
||||
}
|
||||
s += e.rest
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
func New(err error, title, rest string) error {
|
||||
// Pass through DLL errors directly since they do not originate from HCS.
|
||||
if _, ok := err.(*syscall.DLLError); ok {
|
||||
return err
|
||||
}
|
||||
return &HcsError{title, rest, err}
|
||||
}
|
||||
|
||||
func Win32FromError(err error) uint32 {
|
||||
if herr, ok := err.(*HcsError); ok {
|
||||
return Win32FromError(herr.Err)
|
||||
}
|
||||
if code, ok := err.(syscall.Errno); ok {
|
||||
return uint32(code)
|
||||
}
|
||||
return uint32(ERROR_GEN_FAILURE)
|
||||
}
|
||||
44
vendor/github.com/Microsoft/hcsshim/internal/hns/BUILD
generated
vendored
Normal file
44
vendor/github.com/Microsoft/hcsshim/internal/hns/BUILD
generated
vendored
Normal file
@@ -0,0 +1,44 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = [
|
||||
"hns.go",
|
||||
"hnsendpoint.go",
|
||||
"hnsfuncs.go",
|
||||
"hnsglobals.go",
|
||||
"hnsnetwork.go",
|
||||
"hnspolicy.go",
|
||||
"hnspolicylist.go",
|
||||
"hnssupport.go",
|
||||
"namespace.go",
|
||||
"zsyscall_windows.go",
|
||||
],
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/internal/hns",
|
||||
importpath = "github.com/Microsoft/hcsshim/internal/hns",
|
||||
visibility = ["//vendor/github.com/Microsoft/hcsshim:__subpackages__"],
|
||||
deps = [
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/hcserror:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/interop:go_default_library",
|
||||
"//vendor/github.com/sirupsen/logrus:go_default_library",
|
||||
] + select({
|
||||
"@io_bazel_rules_go//go/platform:windows": [
|
||||
"//vendor/golang.org/x/sys/windows:go_default_library",
|
||||
],
|
||||
"//conditions:default": [],
|
||||
}),
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
23
vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go
generated
vendored
Normal file
23
vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go
generated
vendored
Normal file
@@ -0,0 +1,23 @@
|
||||
package hns
|
||||
|
||||
import "fmt"
|
||||
|
||||
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go
|
||||
|
||||
//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
|
||||
|
||||
type EndpointNotFoundError struct {
|
||||
EndpointName string
|
||||
}
|
||||
|
||||
func (e EndpointNotFoundError) Error() string {
|
||||
return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
|
||||
}
|
||||
|
||||
type NetworkNotFoundError struct {
|
||||
NetworkName string
|
||||
}
|
||||
|
||||
func (e NetworkNotFoundError) Error() string {
|
||||
return fmt.Sprintf("Network %s not found", e.NetworkName)
|
||||
}
|
||||
262
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go
generated
vendored
Normal file
262
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go
generated
vendored
Normal file
@@ -0,0 +1,262 @@
|
||||
package hns
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"net"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// HNSEndpoint represents a network endpoint in HNS
|
||||
type HNSEndpoint struct {
|
||||
Id string `json:"ID,omitempty"`
|
||||
Name string `json:",omitempty"`
|
||||
VirtualNetwork string `json:",omitempty"`
|
||||
VirtualNetworkName string `json:",omitempty"`
|
||||
Policies []json.RawMessage `json:",omitempty"`
|
||||
MacAddress string `json:",omitempty"`
|
||||
IPAddress net.IP `json:",omitempty"`
|
||||
DNSSuffix string `json:",omitempty"`
|
||||
DNSServerList string `json:",omitempty"`
|
||||
GatewayAddress string `json:",omitempty"`
|
||||
EnableInternalDNS bool `json:",omitempty"`
|
||||
DisableICC bool `json:",omitempty"`
|
||||
PrefixLength uint8 `json:",omitempty"`
|
||||
IsRemoteEndpoint bool `json:",omitempty"`
|
||||
EnableLowMetric bool `json:",omitempty"`
|
||||
Namespace *Namespace `json:",omitempty"`
|
||||
EncapOverhead uint16 `json:",omitempty"`
|
||||
}
|
||||
|
||||
//SystemType represents the type of the system on which actions are done
|
||||
type SystemType string
|
||||
|
||||
// SystemType const
|
||||
const (
|
||||
ContainerType SystemType = "Container"
|
||||
VirtualMachineType SystemType = "VirtualMachine"
|
||||
HostType SystemType = "Host"
|
||||
)
|
||||
|
||||
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
|
||||
// Supported resource types are Network and Request Types are Add/Remove
|
||||
type EndpointAttachDetachRequest struct {
|
||||
ContainerID string `json:"ContainerId,omitempty"`
|
||||
SystemType SystemType `json:"SystemType"`
|
||||
CompartmentID uint16 `json:"CompartmentId,omitempty"`
|
||||
VirtualNICName string `json:"VirtualNicName,omitempty"`
|
||||
}
|
||||
|
||||
// EndpointResquestResponse is object to get the endpoint request response
|
||||
type EndpointResquestResponse struct {
|
||||
Success bool
|
||||
Error string
|
||||
}
|
||||
|
||||
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
|
||||
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
|
||||
endpoint := &HNSEndpoint{}
|
||||
err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return endpoint, nil
|
||||
}
|
||||
|
||||
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
|
||||
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
|
||||
var endpoint []HNSEndpoint
|
||||
err := hnsCall("GET", "/endpoints/", "", &endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return endpoint, nil
|
||||
}
|
||||
|
||||
// GetHNSEndpointByID get the Endpoint by ID
|
||||
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
|
||||
return HNSEndpointRequest("GET", endpointID, "")
|
||||
}
|
||||
|
||||
// GetHNSEndpointByName gets the endpoint filtered by Name
|
||||
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
|
||||
hnsResponse, err := HNSListEndpointRequest()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
for _, hnsEndpoint := range hnsResponse {
|
||||
if hnsEndpoint.Name == endpointName {
|
||||
return &hnsEndpoint, nil
|
||||
}
|
||||
}
|
||||
return nil, EndpointNotFoundError{EndpointName: endpointName}
|
||||
}
|
||||
|
||||
// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
|
||||
func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
|
||||
operation := "Create"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
jsonString, err := json.Marshal(endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return HNSEndpointRequest("POST", "", string(jsonString))
|
||||
}
|
||||
|
||||
// Delete Endpoint by sending EndpointRequest to HNS
|
||||
func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
|
||||
operation := "Delete"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
return HNSEndpointRequest("DELETE", endpoint.Id, "")
|
||||
}
|
||||
|
||||
// Update Endpoint
|
||||
func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
|
||||
operation := "Update"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
jsonString, err := json.Marshal(endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
|
||||
|
||||
return endpoint, err
|
||||
}
|
||||
|
||||
// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
|
||||
func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
|
||||
operation := "ApplyACLPolicy"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
for _, policy := range policies {
|
||||
if policy == nil {
|
||||
continue
|
||||
}
|
||||
jsonString, err := json.Marshal(policy)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
endpoint.Policies = append(endpoint.Policies, jsonString)
|
||||
}
|
||||
|
||||
_, err := endpoint.Update()
|
||||
return err
|
||||
}
|
||||
|
||||
// ContainerAttach attaches an endpoint to container
|
||||
func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
|
||||
operation := "ContainerAttach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
ContainerID: containerID,
|
||||
CompartmentID: compartmentID,
|
||||
SystemType: ContainerType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// ContainerDetach detaches an endpoint from container
|
||||
func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
|
||||
operation := "ContainerDetach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
ContainerID: containerID,
|
||||
SystemType: ContainerType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// HostAttach attaches a nic on the host
|
||||
func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
|
||||
operation := "HostAttach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
CompartmentID: compartmentID,
|
||||
SystemType: HostType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||
|
||||
}
|
||||
|
||||
// HostDetach detaches a nic on the host
|
||||
func (endpoint *HNSEndpoint) HostDetach() error {
|
||||
operation := "HostDetach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
SystemType: HostType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// VirtualMachineNICAttach attaches a endpoint to a virtual machine
|
||||
func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
|
||||
operation := "VirtualMachineNicAttach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
VirtualNICName: virtualMachineNICName,
|
||||
SystemType: VirtualMachineType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// VirtualMachineNICDetach detaches a endpoint from a virtual machine
|
||||
func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
|
||||
operation := "VirtualMachineNicDetach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
SystemType: VirtualMachineType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||
}
|
||||
@@ -1,9 +1,11 @@
|
||||
package hcsshim
|
||||
package hns
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/hcserror"
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
@@ -13,9 +15,9 @@ func hnsCall(method, path, request string, returnResponse interface{}) error {
|
||||
|
||||
err := _hnsCall(method, path, request, &responseBuffer)
|
||||
if err != nil {
|
||||
return makeError(err, "hnsCall ", "")
|
||||
return hcserror.New(err, "hnsCall ", "")
|
||||
}
|
||||
response := convertAndFreeCoTaskMemString(responseBuffer)
|
||||
response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
|
||||
|
||||
hnsresponse := &hnsResponse{}
|
||||
if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {
|
||||
28
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go
generated
vendored
Normal file
28
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go
generated
vendored
Normal file
@@ -0,0 +1,28 @@
|
||||
package hns
|
||||
|
||||
type HNSGlobals struct {
|
||||
Version HNSVersion `json:"Version"`
|
||||
}
|
||||
|
||||
type HNSVersion struct {
|
||||
Major int `json:"Major"`
|
||||
Minor int `json:"Minor"`
|
||||
}
|
||||
|
||||
var (
|
||||
HNSVersion1803 = HNSVersion{Major: 7, Minor: 2}
|
||||
)
|
||||
|
||||
func GetHNSGlobals() (*HNSGlobals, error) {
|
||||
var version HNSVersion
|
||||
err := hnsCall("GET", "/globals/version", "", &version)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
globals := &HNSGlobals{
|
||||
Version: version,
|
||||
}
|
||||
|
||||
return globals, nil
|
||||
}
|
||||
141
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go
generated
vendored
Normal file
141
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go
generated
vendored
Normal file
@@ -0,0 +1,141 @@
|
||||
package hns
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"net"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// Subnet is assoicated with a network and represents a list
|
||||
// of subnets available to the network
|
||||
type Subnet struct {
|
||||
AddressPrefix string `json:",omitempty"`
|
||||
GatewayAddress string `json:",omitempty"`
|
||||
Policies []json.RawMessage `json:",omitempty"`
|
||||
}
|
||||
|
||||
// MacPool is assoicated with a network and represents a list
|
||||
// of macaddresses available to the network
|
||||
type MacPool struct {
|
||||
StartMacAddress string `json:",omitempty"`
|
||||
EndMacAddress string `json:",omitempty"`
|
||||
}
|
||||
|
||||
// HNSNetwork represents a network in HNS
|
||||
type HNSNetwork struct {
|
||||
Id string `json:"ID,omitempty"`
|
||||
Name string `json:",omitempty"`
|
||||
Type string `json:",omitempty"`
|
||||
NetworkAdapterName string `json:",omitempty"`
|
||||
SourceMac string `json:",omitempty"`
|
||||
Policies []json.RawMessage `json:",omitempty"`
|
||||
MacPools []MacPool `json:",omitempty"`
|
||||
Subnets []Subnet `json:",omitempty"`
|
||||
DNSSuffix string `json:",omitempty"`
|
||||
DNSServerList string `json:",omitempty"`
|
||||
DNSServerCompartment uint32 `json:",omitempty"`
|
||||
ManagementIP string `json:",omitempty"`
|
||||
AutomaticDNS bool `json:",omitempty"`
|
||||
}
|
||||
|
||||
type hnsNetworkResponse struct {
|
||||
Success bool
|
||||
Error string
|
||||
Output HNSNetwork
|
||||
}
|
||||
|
||||
type hnsResponse struct {
|
||||
Success bool
|
||||
Error string
|
||||
Output json.RawMessage
|
||||
}
|
||||
|
||||
// HNSNetworkRequest makes a call into HNS to update/query a single network
|
||||
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
|
||||
var network HNSNetwork
|
||||
err := hnsCall(method, "/networks/"+path, request, &network)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return &network, nil
|
||||
}
|
||||
|
||||
// HNSListNetworkRequest makes a HNS call to query the list of available networks
|
||||
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
|
||||
var network []HNSNetwork
|
||||
err := hnsCall(method, "/networks/"+path, request, &network)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return network, nil
|
||||
}
|
||||
|
||||
// GetHNSNetworkByID
|
||||
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
|
||||
return HNSNetworkRequest("GET", networkID, "")
|
||||
}
|
||||
|
||||
// GetHNSNetworkName filtered by Name
|
||||
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
|
||||
hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
for _, hnsnetwork := range hsnnetworks {
|
||||
if hnsnetwork.Name == networkName {
|
||||
return &hnsnetwork, nil
|
||||
}
|
||||
}
|
||||
return nil, NetworkNotFoundError{NetworkName: networkName}
|
||||
}
|
||||
|
||||
// Create Network by sending NetworkRequest to HNS.
|
||||
func (network *HNSNetwork) Create() (*HNSNetwork, error) {
|
||||
operation := "Create"
|
||||
title := "hcsshim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s", network.Id)
|
||||
|
||||
jsonString, err := json.Marshal(network)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return HNSNetworkRequest("POST", "", string(jsonString))
|
||||
}
|
||||
|
||||
// Delete Network by sending NetworkRequest to HNS
|
||||
func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
|
||||
operation := "Delete"
|
||||
title := "hcsshim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s", network.Id)
|
||||
|
||||
return HNSNetworkRequest("DELETE", network.Id, "")
|
||||
}
|
||||
|
||||
// Creates an endpoint on the Network.
|
||||
func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
|
||||
return &HNSEndpoint{
|
||||
VirtualNetwork: network.Id,
|
||||
IPAddress: ipAddress,
|
||||
MacAddress: string(macAddress),
|
||||
}
|
||||
}
|
||||
|
||||
func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
|
||||
operation := "CreateEndpoint"
|
||||
title := "hcsshim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
|
||||
|
||||
endpoint.VirtualNetwork = network.Id
|
||||
return endpoint.Create()
|
||||
}
|
||||
|
||||
func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
|
||||
operation := "CreateRemoteEndpoint"
|
||||
title := "hcsshim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s", network.Id)
|
||||
endpoint.IsRemoteEndpoint = true
|
||||
return network.CreateEndpoint(endpoint)
|
||||
}
|
||||
98
vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go
generated
vendored
Normal file
98
vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go
generated
vendored
Normal file
@@ -0,0 +1,98 @@
|
||||
package hns
|
||||
|
||||
// Type of Request Support in ModifySystem
|
||||
type PolicyType string
|
||||
|
||||
// RequestType const
|
||||
const (
|
||||
Nat PolicyType = "NAT"
|
||||
ACL PolicyType = "ACL"
|
||||
PA PolicyType = "PA"
|
||||
VLAN PolicyType = "VLAN"
|
||||
VSID PolicyType = "VSID"
|
||||
VNet PolicyType = "VNET"
|
||||
L2Driver PolicyType = "L2Driver"
|
||||
Isolation PolicyType = "Isolation"
|
||||
QOS PolicyType = "QOS"
|
||||
OutboundNat PolicyType = "OutBoundNAT"
|
||||
ExternalLoadBalancer PolicyType = "ELB"
|
||||
Route PolicyType = "ROUTE"
|
||||
)
|
||||
|
||||
type NatPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
Protocol string
|
||||
InternalPort uint16
|
||||
ExternalPort uint16
|
||||
}
|
||||
|
||||
type QosPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
MaximumOutgoingBandwidthInBytes uint64
|
||||
}
|
||||
|
||||
type IsolationPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
VLAN uint
|
||||
VSID uint
|
||||
InDefaultIsolation bool
|
||||
}
|
||||
|
||||
type VlanPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
VLAN uint
|
||||
}
|
||||
|
||||
type VsidPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
VSID uint
|
||||
}
|
||||
|
||||
type PaPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
PA string `json:"PA"`
|
||||
}
|
||||
|
||||
type OutboundNatPolicy struct {
|
||||
Policy
|
||||
VIP string `json:"VIP,omitempty"`
|
||||
Exceptions []string `json:"ExceptionList,omitempty"`
|
||||
}
|
||||
|
||||
type ActionType string
|
||||
type DirectionType string
|
||||
type RuleType string
|
||||
|
||||
const (
|
||||
Allow ActionType = "Allow"
|
||||
Block ActionType = "Block"
|
||||
|
||||
In DirectionType = "In"
|
||||
Out DirectionType = "Out"
|
||||
|
||||
Host RuleType = "Host"
|
||||
Switch RuleType = "Switch"
|
||||
)
|
||||
|
||||
type ACLPolicy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
Id string `json:"Id,omitempty"`
|
||||
Protocol uint16
|
||||
Protocols string `json:"Protocols,omitempty"`
|
||||
InternalPort uint16
|
||||
Action ActionType
|
||||
Direction DirectionType
|
||||
LocalAddresses string
|
||||
RemoteAddresses string
|
||||
LocalPorts string `json:"LocalPorts,omitempty"`
|
||||
LocalPort uint16
|
||||
RemotePorts string `json:"RemotePorts,omitempty"`
|
||||
RemotePort uint16
|
||||
RuleType RuleType `json:"RuleType,omitempty"`
|
||||
Priority uint16
|
||||
ServiceName string
|
||||
}
|
||||
|
||||
type Policy struct {
|
||||
Type PolicyType `json:"Type"`
|
||||
}
|
||||
201
vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go
generated
vendored
Normal file
201
vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go
generated
vendored
Normal file
@@ -0,0 +1,201 @@
|
||||
package hns
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// RoutePolicy is a structure defining schema for Route based Policy
|
||||
type RoutePolicy struct {
|
||||
Policy
|
||||
DestinationPrefix string `json:"DestinationPrefix,omitempty"`
|
||||
NextHop string `json:"NextHop,omitempty"`
|
||||
EncapEnabled bool `json:"NeedEncap,omitempty"`
|
||||
}
|
||||
|
||||
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
|
||||
type ELBPolicy struct {
|
||||
LBPolicy
|
||||
SourceVIP string `json:"SourceVIP,omitempty"`
|
||||
VIPs []string `json:"VIPs,omitempty"`
|
||||
ILB bool `json:"ILB,omitempty"`
|
||||
DSR bool `json:"IsDSR,omitempty"`
|
||||
}
|
||||
|
||||
// LBPolicy is a structure defining schema for LoadBalancing based Policy
|
||||
type LBPolicy struct {
|
||||
Policy
|
||||
Protocol uint16 `json:"Protocol,omitempty"`
|
||||
InternalPort uint16
|
||||
ExternalPort uint16
|
||||
}
|
||||
|
||||
// PolicyList is a structure defining schema for Policy list request
|
||||
type PolicyList struct {
|
||||
ID string `json:"ID,omitempty"`
|
||||
EndpointReferences []string `json:"References,omitempty"`
|
||||
Policies []json.RawMessage `json:"Policies,omitempty"`
|
||||
}
|
||||
|
||||
// HNSPolicyListRequest makes a call into HNS to update/query a single network
|
||||
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
|
||||
var policy PolicyList
|
||||
err := hnsCall(method, "/policylists/"+path, request, &policy)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return &policy, nil
|
||||
}
|
||||
|
||||
// HNSListPolicyListRequest gets all the policy list
|
||||
func HNSListPolicyListRequest() ([]PolicyList, error) {
|
||||
var plist []PolicyList
|
||||
err := hnsCall("GET", "/policylists/", "", &plist)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return plist, nil
|
||||
}
|
||||
|
||||
// PolicyListRequest makes a HNS call to modify/query a network policy list
|
||||
func PolicyListRequest(method, path, request string) (*PolicyList, error) {
|
||||
policylist := &PolicyList{}
|
||||
err := hnsCall(method, "/policylists/"+path, request, &policylist)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return policylist, nil
|
||||
}
|
||||
|
||||
// GetPolicyListByID get the policy list by ID
|
||||
func GetPolicyListByID(policyListID string) (*PolicyList, error) {
|
||||
return PolicyListRequest("GET", policyListID, "")
|
||||
}
|
||||
|
||||
// Create PolicyList by sending PolicyListRequest to HNS.
|
||||
func (policylist *PolicyList) Create() (*PolicyList, error) {
|
||||
operation := "Create"
|
||||
title := "hcsshim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s", policylist.ID)
|
||||
jsonString, err := json.Marshal(policylist)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return PolicyListRequest("POST", "", string(jsonString))
|
||||
}
|
||||
|
||||
// Delete deletes PolicyList
|
||||
func (policylist *PolicyList) Delete() (*PolicyList, error) {
|
||||
operation := "Delete"
|
||||
title := "hcsshim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s", policylist.ID)
|
||||
|
||||
return PolicyListRequest("DELETE", policylist.ID, "")
|
||||
}
|
||||
|
||||
// AddEndpoint add an endpoint to a Policy List
|
||||
func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
|
||||
operation := "AddEndpoint"
|
||||
title := "hcsshim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
|
||||
|
||||
_, err := policylist.Delete()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// Add Endpoint to the Existing List
|
||||
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
|
||||
|
||||
return policylist.Create()
|
||||
}
|
||||
|
||||
// RemoveEndpoint removes an endpoint from the Policy List
|
||||
func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
|
||||
operation := "RemoveEndpoint"
|
||||
title := "hcsshim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
|
||||
|
||||
_, err := policylist.Delete()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
elementToRemove := "/endpoints/" + endpoint.Id
|
||||
|
||||
var references []string
|
||||
|
||||
for _, endpointReference := range policylist.EndpointReferences {
|
||||
if endpointReference == elementToRemove {
|
||||
continue
|
||||
}
|
||||
references = append(references, endpointReference)
|
||||
}
|
||||
policylist.EndpointReferences = references
|
||||
return policylist.Create()
|
||||
}
|
||||
|
||||
// AddLoadBalancer policy list for the specified endpoints
|
||||
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
|
||||
operation := "AddLoadBalancer"
|
||||
title := "hcsshim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
|
||||
|
||||
policylist := &PolicyList{}
|
||||
|
||||
elbPolicy := &ELBPolicy{
|
||||
SourceVIP: sourceVIP,
|
||||
ILB: isILB,
|
||||
}
|
||||
|
||||
if len(vip) > 0 {
|
||||
elbPolicy.VIPs = []string{vip}
|
||||
}
|
||||
elbPolicy.Type = ExternalLoadBalancer
|
||||
elbPolicy.Protocol = protocol
|
||||
elbPolicy.InternalPort = internalPort
|
||||
elbPolicy.ExternalPort = externalPort
|
||||
|
||||
for _, endpoint := range endpoints {
|
||||
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
|
||||
}
|
||||
|
||||
jsonString, err := json.Marshal(elbPolicy)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
policylist.Policies = append(policylist.Policies, jsonString)
|
||||
return policylist.Create()
|
||||
}
|
||||
|
||||
// AddRoute adds route policy list for the specified endpoints
|
||||
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
|
||||
operation := "AddRoute"
|
||||
title := "hcsshim::PolicyList::" + operation
|
||||
logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
|
||||
|
||||
policylist := &PolicyList{}
|
||||
|
||||
rPolicy := &RoutePolicy{
|
||||
DestinationPrefix: destinationPrefix,
|
||||
NextHop: nextHop,
|
||||
EncapEnabled: encapEnabled,
|
||||
}
|
||||
rPolicy.Type = Route
|
||||
|
||||
for _, endpoint := range endpoints {
|
||||
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
|
||||
}
|
||||
|
||||
jsonString, err := json.Marshal(rPolicy)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
policylist.Policies = append(policylist.Policies, jsonString)
|
||||
return policylist.Create()
|
||||
}
|
||||
49
vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go
generated
vendored
Normal file
49
vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go
generated
vendored
Normal file
@@ -0,0 +1,49 @@
|
||||
package hns
|
||||
|
||||
import (
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
type HNSSupportedFeatures struct {
|
||||
Acl HNSAclFeatures `json:"ACL"`
|
||||
}
|
||||
|
||||
type HNSAclFeatures struct {
|
||||
AclAddressLists bool `json:"AclAddressLists"`
|
||||
AclNoHostRulePriority bool `json:"AclHostRulePriority"`
|
||||
AclPortRanges bool `json:"AclPortRanges"`
|
||||
AclRuleId bool `json:"AclRuleId"`
|
||||
}
|
||||
|
||||
func GetHNSSupportedFeatures() HNSSupportedFeatures {
|
||||
var hnsFeatures HNSSupportedFeatures
|
||||
|
||||
globals, err := GetHNSGlobals()
|
||||
if err != nil {
|
||||
// Expected on pre-1803 builds, all features will be false/unsupported
|
||||
logrus.Debugf("Unable to obtain HNS globals: %s", err)
|
||||
return hnsFeatures
|
||||
}
|
||||
|
||||
hnsFeatures.Acl = HNSAclFeatures{
|
||||
AclAddressLists: isHNSFeatureSupported(globals.Version, HNSVersion1803),
|
||||
AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803),
|
||||
AclPortRanges: isHNSFeatureSupported(globals.Version, HNSVersion1803),
|
||||
AclRuleId: isHNSFeatureSupported(globals.Version, HNSVersion1803),
|
||||
}
|
||||
|
||||
return hnsFeatures
|
||||
}
|
||||
|
||||
func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool {
|
||||
if currentVersion.Major < minVersionSupported.Major {
|
||||
return false
|
||||
}
|
||||
if currentVersion.Major > minVersionSupported.Major {
|
||||
return true
|
||||
}
|
||||
if currentVersion.Minor < minVersionSupported.Minor {
|
||||
return false
|
||||
}
|
||||
return true
|
||||
}
|
||||
110
vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go
generated
vendored
Normal file
110
vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go
generated
vendored
Normal file
@@ -0,0 +1,110 @@
|
||||
package hns
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"os"
|
||||
"path"
|
||||
"strings"
|
||||
)
|
||||
|
||||
type namespaceRequest struct {
|
||||
IsDefault bool `json:",omitempty"`
|
||||
}
|
||||
|
||||
type namespaceEndpointRequest struct {
|
||||
ID string `json:"Id"`
|
||||
}
|
||||
|
||||
type NamespaceResource struct {
|
||||
Type string
|
||||
Data json.RawMessage
|
||||
}
|
||||
|
||||
type namespaceResourceRequest struct {
|
||||
Type string
|
||||
Data interface{}
|
||||
}
|
||||
|
||||
type Namespace struct {
|
||||
ID string
|
||||
IsDefault bool `json:",omitempty"`
|
||||
ResourceList []NamespaceResource `json:",omitempty"`
|
||||
}
|
||||
|
||||
func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) {
|
||||
var err error
|
||||
hnspath := "/namespaces/"
|
||||
if id != nil {
|
||||
hnspath = path.Join(hnspath, *id)
|
||||
}
|
||||
if subpath != "" {
|
||||
hnspath = path.Join(hnspath, subpath)
|
||||
}
|
||||
var reqJSON []byte
|
||||
if request != nil {
|
||||
if reqJSON, err = json.Marshal(request); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
var ns Namespace
|
||||
err = hnsCall(method, hnspath, string(reqJSON), &ns)
|
||||
if err != nil {
|
||||
if strings.Contains(err.Error(), "Element not found.") {
|
||||
return nil, os.ErrNotExist
|
||||
}
|
||||
return nil, fmt.Errorf("%s %s: %s", method, hnspath, err)
|
||||
}
|
||||
return &ns, err
|
||||
}
|
||||
|
||||
func CreateNamespace() (string, error) {
|
||||
req := namespaceRequest{}
|
||||
ns, err := issueNamespaceRequest(nil, "POST", "", &req)
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
return ns.ID, nil
|
||||
}
|
||||
|
||||
func RemoveNamespace(id string) error {
|
||||
_, err := issueNamespaceRequest(&id, "DELETE", "", nil)
|
||||
return err
|
||||
}
|
||||
|
||||
func GetNamespaceEndpoints(id string) ([]string, error) {
|
||||
ns, err := issueNamespaceRequest(&id, "GET", "", nil)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
var endpoints []string
|
||||
for _, rsrc := range ns.ResourceList {
|
||||
if rsrc.Type == "Endpoint" {
|
||||
var endpoint namespaceEndpointRequest
|
||||
err = json.Unmarshal(rsrc.Data, &endpoint)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("unmarshal endpoint: %s", err)
|
||||
}
|
||||
endpoints = append(endpoints, endpoint.ID)
|
||||
}
|
||||
}
|
||||
return endpoints, nil
|
||||
}
|
||||
|
||||
func AddNamespaceEndpoint(id string, endpointID string) error {
|
||||
resource := namespaceResourceRequest{
|
||||
Type: "Endpoint",
|
||||
Data: namespaceEndpointRequest{endpointID},
|
||||
}
|
||||
_, err := issueNamespaceRequest(&id, "POST", "addresource", &resource)
|
||||
return err
|
||||
}
|
||||
|
||||
func RemoveNamespaceEndpoint(id string, endpointID string) error {
|
||||
resource := namespaceResourceRequest{
|
||||
Type: "Endpoint",
|
||||
Data: namespaceEndpointRequest{endpointID},
|
||||
}
|
||||
_, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource)
|
||||
return err
|
||||
}
|
||||
76
vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go
generated
vendored
Normal file
76
vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go
generated
vendored
Normal file
@@ -0,0 +1,76 @@
|
||||
// Code generated mksyscall_windows.exe DO NOT EDIT
|
||||
|
||||
package hns
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
var _ unsafe.Pointer
|
||||
|
||||
// Do the interface allocations only once for common
|
||||
// Errno values.
|
||||
const (
|
||||
errnoERROR_IO_PENDING = 997
|
||||
)
|
||||
|
||||
var (
|
||||
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||
)
|
||||
|
||||
// errnoErr returns common boxed Errno values, to prevent
|
||||
// allocations at runtime.
|
||||
func errnoErr(e syscall.Errno) error {
|
||||
switch e {
|
||||
case 0:
|
||||
return nil
|
||||
case errnoERROR_IO_PENDING:
|
||||
return errERROR_IO_PENDING
|
||||
}
|
||||
// TODO: add more here, after collecting data on the common
|
||||
// error values see on Windows. (perhaps when running
|
||||
// all.bat?)
|
||||
return e
|
||||
}
|
||||
|
||||
var (
|
||||
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
|
||||
|
||||
procHNSCall = modvmcompute.NewProc("HNSCall")
|
||||
)
|
||||
|
||||
func _hnsCall(method string, path string, object string, response **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(method)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
var _p1 *uint16
|
||||
_p1, hr = syscall.UTF16PtrFromString(path)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
var _p2 *uint16
|
||||
_p2, hr = syscall.UTF16PtrFromString(object)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return __hnsCall(_p0, _p1, _p2, response)
|
||||
}
|
||||
|
||||
func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) {
|
||||
if hr = procHNSCall.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
32
vendor/github.com/Microsoft/hcsshim/internal/interop/BUILD
generated
vendored
Normal file
32
vendor/github.com/Microsoft/hcsshim/internal/interop/BUILD
generated
vendored
Normal file
@@ -0,0 +1,32 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = [
|
||||
"interop.go",
|
||||
"zsyscall_windows.go",
|
||||
],
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/internal/interop",
|
||||
importpath = "github.com/Microsoft/hcsshim/internal/interop",
|
||||
visibility = ["//vendor/github.com/Microsoft/hcsshim:__subpackages__"],
|
||||
deps = select({
|
||||
"@io_bazel_rules_go//go/platform:windows": [
|
||||
"//vendor/golang.org/x/sys/windows:go_default_library",
|
||||
],
|
||||
"//conditions:default": [],
|
||||
}),
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
27
vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go
generated
vendored
Normal file
27
vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go
generated
vendored
Normal file
@@ -0,0 +1,27 @@
|
||||
package interop
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
)
|
||||
|
||||
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go interop.go
|
||||
|
||||
//sys coTaskMemFree(buffer unsafe.Pointer) = api_ms_win_core_com_l1_1_0.CoTaskMemFree
|
||||
|
||||
func ConvertAndFreeCoTaskMemString(buffer *uint16) string {
|
||||
str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:])
|
||||
coTaskMemFree(unsafe.Pointer(buffer))
|
||||
return str
|
||||
}
|
||||
|
||||
func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
|
||||
return []byte(ConvertAndFreeCoTaskMemString(buffer))
|
||||
}
|
||||
|
||||
func Win32FromHresult(hr uintptr) syscall.Errno {
|
||||
if hr&0x1fff0000 == 0x00070000 {
|
||||
return syscall.Errno(hr & 0xffff)
|
||||
}
|
||||
return syscall.Errno(hr)
|
||||
}
|
||||
48
vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go
generated
vendored
Normal file
48
vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go
generated
vendored
Normal file
@@ -0,0 +1,48 @@
|
||||
// Code generated mksyscall_windows.exe DO NOT EDIT
|
||||
|
||||
package interop
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
var _ unsafe.Pointer
|
||||
|
||||
// Do the interface allocations only once for common
|
||||
// Errno values.
|
||||
const (
|
||||
errnoERROR_IO_PENDING = 997
|
||||
)
|
||||
|
||||
var (
|
||||
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||
)
|
||||
|
||||
// errnoErr returns common boxed Errno values, to prevent
|
||||
// allocations at runtime.
|
||||
func errnoErr(e syscall.Errno) error {
|
||||
switch e {
|
||||
case 0:
|
||||
return nil
|
||||
case errnoERROR_IO_PENDING:
|
||||
return errERROR_IO_PENDING
|
||||
}
|
||||
// TODO: add more here, after collecting data on the common
|
||||
// error values see on Windows. (perhaps when running
|
||||
// all.bat?)
|
||||
return e
|
||||
}
|
||||
|
||||
var (
|
||||
modapi_ms_win_core_com_l1_1_0 = windows.NewLazySystemDLL("api-ms-win-core-com-l1-1-0.dll")
|
||||
|
||||
procCoTaskMemFree = modapi_ms_win_core_com_l1_1_0.NewProc("CoTaskMemFree")
|
||||
)
|
||||
|
||||
func coTaskMemFree(buffer unsafe.Pointer) {
|
||||
syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0)
|
||||
return
|
||||
}
|
||||
23
vendor/github.com/Microsoft/hcsshim/internal/logfields/BUILD
generated
vendored
Normal file
23
vendor/github.com/Microsoft/hcsshim/internal/logfields/BUILD
generated
vendored
Normal file
@@ -0,0 +1,23 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = ["fields.go"],
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/internal/logfields",
|
||||
importpath = "github.com/Microsoft/hcsshim/internal/logfields",
|
||||
visibility = ["//vendor/github.com/Microsoft/hcsshim:__subpackages__"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
37
vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go
generated
vendored
Normal file
37
vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go
generated
vendored
Normal file
@@ -0,0 +1,37 @@
|
||||
package logfields
|
||||
|
||||
const (
|
||||
// Identifiers
|
||||
|
||||
ContainerID = "cid"
|
||||
UVMID = "uvm-id"
|
||||
ProcessID = "pid"
|
||||
|
||||
// Common Misc
|
||||
|
||||
// Timeout represents an operation timeout.
|
||||
Timeout = "timeout"
|
||||
JSON = "json"
|
||||
|
||||
// Keys/values
|
||||
|
||||
Field = "field"
|
||||
OCIAnnotation = "oci-annotation"
|
||||
Value = "value"
|
||||
|
||||
// Golang type's
|
||||
|
||||
ExpectedType = "expected-type"
|
||||
Bool = "bool"
|
||||
Uint32 = "uint32"
|
||||
Uint64 = "uint64"
|
||||
|
||||
// HCS
|
||||
|
||||
HCSOperation = "hcs-op"
|
||||
HCSOperationResult = "hcs-op-result"
|
||||
|
||||
// runhcs
|
||||
|
||||
VMShimOperation = "vmshim-op"
|
||||
)
|
||||
23
vendor/github.com/Microsoft/hcsshim/internal/longpath/BUILD
generated
vendored
Normal file
23
vendor/github.com/Microsoft/hcsshim/internal/longpath/BUILD
generated
vendored
Normal file
@@ -0,0 +1,23 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = ["longpath.go"],
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/internal/longpath",
|
||||
importpath = "github.com/Microsoft/hcsshim/internal/longpath",
|
||||
visibility = ["//vendor/github.com/Microsoft/hcsshim:__subpackages__"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
24
vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go
generated
vendored
Normal file
24
vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go
generated
vendored
Normal file
@@ -0,0 +1,24 @@
|
||||
package longpath
|
||||
|
||||
import (
|
||||
"path/filepath"
|
||||
"strings"
|
||||
)
|
||||
|
||||
// LongAbs makes a path absolute and returns it in NT long path form.
|
||||
func LongAbs(path string) (string, error) {
|
||||
if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
|
||||
return path, nil
|
||||
}
|
||||
if !filepath.IsAbs(path) {
|
||||
absPath, err := filepath.Abs(path)
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
path = absPath
|
||||
}
|
||||
if strings.HasPrefix(path, `\\`) {
|
||||
return `\\?\UNC\` + path[2:], nil
|
||||
}
|
||||
return `\\?\` + path, nil
|
||||
}
|
||||
23
vendor/github.com/Microsoft/hcsshim/internal/mergemaps/BUILD
generated
vendored
Normal file
23
vendor/github.com/Microsoft/hcsshim/internal/mergemaps/BUILD
generated
vendored
Normal file
@@ -0,0 +1,23 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = ["merge.go"],
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/internal/mergemaps",
|
||||
importpath = "github.com/Microsoft/hcsshim/internal/mergemaps",
|
||||
visibility = ["//vendor/github.com/Microsoft/hcsshim:__subpackages__"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
52
vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go
generated
vendored
Normal file
52
vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go
generated
vendored
Normal file
@@ -0,0 +1,52 @@
|
||||
package mergemaps
|
||||
|
||||
import "encoding/json"
|
||||
|
||||
// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
|
||||
// in ToMap are overwritten. Values in fromMap are added to ToMap.
|
||||
// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
|
||||
func Merge(fromMap, ToMap interface{}) interface{} {
|
||||
switch fromMap := fromMap.(type) {
|
||||
case map[string]interface{}:
|
||||
ToMap, ok := ToMap.(map[string]interface{})
|
||||
if !ok {
|
||||
return fromMap
|
||||
}
|
||||
for keyToMap, valueToMap := range ToMap {
|
||||
if valueFromMap, ok := fromMap[keyToMap]; ok {
|
||||
fromMap[keyToMap] = Merge(valueFromMap, valueToMap)
|
||||
} else {
|
||||
fromMap[keyToMap] = valueToMap
|
||||
}
|
||||
}
|
||||
case nil:
|
||||
// merge(nil, map[string]interface{...}) -> map[string]interface{...}
|
||||
ToMap, ok := ToMap.(map[string]interface{})
|
||||
if ok {
|
||||
return ToMap
|
||||
}
|
||||
}
|
||||
return fromMap
|
||||
}
|
||||
|
||||
// MergeJSON merges the contents of a JSON string into an object representation,
|
||||
// returning a new object suitable for translating to JSON.
|
||||
func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) {
|
||||
if len(additionalJSON) == 0 {
|
||||
return object, nil
|
||||
}
|
||||
objectJSON, err := json.Marshal(object)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
var objectMap, newMap map[string]interface{}
|
||||
err = json.Unmarshal(objectJSON, &objectMap)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
err = json.Unmarshal(additionalJSON, &newMap)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return Merge(newMap, objectMap), nil
|
||||
}
|
||||
34
vendor/github.com/Microsoft/hcsshim/internal/regstate/BUILD
generated
vendored
Normal file
34
vendor/github.com/Microsoft/hcsshim/internal/regstate/BUILD
generated
vendored
Normal file
@@ -0,0 +1,34 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = [
|
||||
"regstate.go",
|
||||
"zsyscall_windows.go",
|
||||
],
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/internal/regstate",
|
||||
importpath = "github.com/Microsoft/hcsshim/internal/regstate",
|
||||
visibility = ["//vendor/github.com/Microsoft/hcsshim:__subpackages__"],
|
||||
deps = [
|
||||
"//vendor/golang.org/x/sys/windows/registry:go_default_library",
|
||||
] + select({
|
||||
"@io_bazel_rules_go//go/platform:windows": [
|
||||
"//vendor/golang.org/x/sys/windows:go_default_library",
|
||||
],
|
||||
"//conditions:default": [],
|
||||
}),
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
287
vendor/github.com/Microsoft/hcsshim/internal/regstate/regstate.go
generated
vendored
Normal file
287
vendor/github.com/Microsoft/hcsshim/internal/regstate/regstate.go
generated
vendored
Normal file
@@ -0,0 +1,287 @@
|
||||
package regstate
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"net/url"
|
||||
"os"
|
||||
"path/filepath"
|
||||
"reflect"
|
||||
"syscall"
|
||||
|
||||
"golang.org/x/sys/windows/registry"
|
||||
)
|
||||
|
||||
//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go regstate.go
|
||||
|
||||
//sys regCreateKeyEx(key syscall.Handle, subkey *uint16, reserved uint32, class *uint16, options uint32, desired uint32, sa *syscall.SecurityAttributes, result *syscall.Handle, disposition *uint32) (regerrno error) = advapi32.RegCreateKeyExW
|
||||
|
||||
const (
|
||||
_REG_OPTION_VOLATILE = 1
|
||||
|
||||
_REG_CREATED_NEW_KEY = 1
|
||||
_REG_OPENED_EXISTING_KEY = 2
|
||||
)
|
||||
|
||||
type Key struct {
|
||||
registry.Key
|
||||
Name string
|
||||
}
|
||||
|
||||
var localMachine = &Key{registry.LOCAL_MACHINE, "HKEY_LOCAL_MACHINE"}
|
||||
var localUser = &Key{registry.CURRENT_USER, "HKEY_CURRENT_USER"}
|
||||
|
||||
var rootPath = `SOFTWARE\Microsoft\runhcs`
|
||||
|
||||
type NotFoundError struct {
|
||||
Id string
|
||||
}
|
||||
|
||||
func (err *NotFoundError) Error() string {
|
||||
return fmt.Sprintf("ID '%s' was not found", err.Id)
|
||||
}
|
||||
|
||||
func IsNotFoundError(err error) bool {
|
||||
_, ok := err.(*NotFoundError)
|
||||
return ok
|
||||
}
|
||||
|
||||
type NoStateError struct {
|
||||
ID string
|
||||
Key string
|
||||
}
|
||||
|
||||
func (err *NoStateError) Error() string {
|
||||
return fmt.Sprintf("state '%s' is not present for ID '%s'", err.Key, err.ID)
|
||||
}
|
||||
|
||||
func createVolatileKey(k *Key, path string, access uint32) (newk *Key, openedExisting bool, err error) {
|
||||
var (
|
||||
h syscall.Handle
|
||||
d uint32
|
||||
)
|
||||
fullpath := filepath.Join(k.Name, path)
|
||||
err = regCreateKeyEx(syscall.Handle(k.Key), syscall.StringToUTF16Ptr(path), 0, nil, _REG_OPTION_VOLATILE, access, nil, &h, &d)
|
||||
if err != nil {
|
||||
return nil, false, &os.PathError{Op: "RegCreateKeyEx", Path: fullpath, Err: err}
|
||||
}
|
||||
return &Key{registry.Key(h), fullpath}, d == _REG_OPENED_EXISTING_KEY, nil
|
||||
}
|
||||
|
||||
func hive(perUser bool) *Key {
|
||||
r := localMachine
|
||||
if perUser {
|
||||
r = localUser
|
||||
}
|
||||
return r
|
||||
}
|
||||
|
||||
func Open(root string, perUser bool) (*Key, error) {
|
||||
k, _, err := createVolatileKey(hive(perUser), rootPath, registry.ALL_ACCESS)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
defer k.Close()
|
||||
|
||||
k2, _, err := createVolatileKey(k, url.PathEscape(root), registry.ALL_ACCESS)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return k2, nil
|
||||
}
|
||||
|
||||
func RemoveAll(root string, perUser bool) error {
|
||||
k, err := hive(perUser).open(rootPath)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
defer k.Close()
|
||||
r, err := k.open(url.PathEscape(root))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
defer r.Close()
|
||||
ids, err := r.Enumerate()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
for _, id := range ids {
|
||||
err = r.Remove(id)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
r.Close()
|
||||
return k.Remove(root)
|
||||
}
|
||||
|
||||
func (k *Key) Close() error {
|
||||
err := k.Key.Close()
|
||||
k.Key = 0
|
||||
return err
|
||||
}
|
||||
|
||||
func (k *Key) Enumerate() ([]string, error) {
|
||||
escapedIDs, err := k.ReadSubKeyNames(0)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
var ids []string
|
||||
for _, e := range escapedIDs {
|
||||
id, err := url.PathUnescape(e)
|
||||
if err == nil {
|
||||
ids = append(ids, id)
|
||||
}
|
||||
}
|
||||
return ids, nil
|
||||
}
|
||||
|
||||
func (k *Key) open(name string) (*Key, error) {
|
||||
fullpath := filepath.Join(k.Name, name)
|
||||
nk, err := registry.OpenKey(k.Key, name, registry.ALL_ACCESS)
|
||||
if err != nil {
|
||||
return nil, &os.PathError{Op: "RegOpenKey", Path: fullpath, Err: err}
|
||||
}
|
||||
return &Key{nk, fullpath}, nil
|
||||
}
|
||||
|
||||
func (k *Key) openid(id string) (*Key, error) {
|
||||
escaped := url.PathEscape(id)
|
||||
fullpath := filepath.Join(k.Name, escaped)
|
||||
nk, err := k.open(escaped)
|
||||
if perr, ok := err.(*os.PathError); ok && perr.Err == syscall.ERROR_FILE_NOT_FOUND {
|
||||
return nil, &NotFoundError{id}
|
||||
}
|
||||
if err != nil {
|
||||
return nil, &os.PathError{Op: "RegOpenKey", Path: fullpath, Err: err}
|
||||
}
|
||||
return nk, nil
|
||||
}
|
||||
|
||||
func (k *Key) Remove(id string) error {
|
||||
escaped := url.PathEscape(id)
|
||||
err := registry.DeleteKey(k.Key, escaped)
|
||||
if err != nil {
|
||||
if err == syscall.ERROR_FILE_NOT_FOUND {
|
||||
return &NotFoundError{id}
|
||||
}
|
||||
return &os.PathError{Op: "RegDeleteKey", Path: filepath.Join(k.Name, escaped), Err: err}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (k *Key) set(id string, create bool, key string, state interface{}) error {
|
||||
var sk *Key
|
||||
var err error
|
||||
if create {
|
||||
var existing bool
|
||||
eid := url.PathEscape(id)
|
||||
sk, existing, err = createVolatileKey(k, eid, registry.ALL_ACCESS)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
defer sk.Close()
|
||||
if existing {
|
||||
sk.Close()
|
||||
return fmt.Errorf("container %s already exists", id)
|
||||
}
|
||||
} else {
|
||||
sk, err = k.openid(id)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
defer sk.Close()
|
||||
}
|
||||
switch reflect.TypeOf(state).Kind() {
|
||||
case reflect.Bool:
|
||||
v := uint32(0)
|
||||
if state.(bool) {
|
||||
v = 1
|
||||
}
|
||||
err = sk.SetDWordValue(key, v)
|
||||
case reflect.Int:
|
||||
err = sk.SetQWordValue(key, uint64(state.(int)))
|
||||
case reflect.String:
|
||||
err = sk.SetStringValue(key, state.(string))
|
||||
default:
|
||||
var js []byte
|
||||
js, err = json.Marshal(state)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
err = sk.SetBinaryValue(key, js)
|
||||
}
|
||||
if err != nil {
|
||||
if err == syscall.ERROR_FILE_NOT_FOUND {
|
||||
return &NoStateError{id, key}
|
||||
}
|
||||
return &os.PathError{Op: "RegSetValueEx", Path: sk.Name + ":" + key, Err: err}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (k *Key) Create(id, key string, state interface{}) error {
|
||||
return k.set(id, true, key, state)
|
||||
}
|
||||
|
||||
func (k *Key) Set(id, key string, state interface{}) error {
|
||||
return k.set(id, false, key, state)
|
||||
}
|
||||
|
||||
func (k *Key) Clear(id, key string) error {
|
||||
sk, err := k.openid(id)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
defer sk.Close()
|
||||
err = sk.DeleteValue(key)
|
||||
if err != nil {
|
||||
if err == syscall.ERROR_FILE_NOT_FOUND {
|
||||
return &NoStateError{id, key}
|
||||
}
|
||||
return &os.PathError{Op: "RegDeleteValue", Path: sk.Name + ":" + key, Err: err}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (k *Key) Get(id, key string, state interface{}) error {
|
||||
sk, err := k.openid(id)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
defer sk.Close()
|
||||
|
||||
var js []byte
|
||||
switch reflect.TypeOf(state).Elem().Kind() {
|
||||
case reflect.Bool:
|
||||
var v uint64
|
||||
v, _, err = sk.GetIntegerValue(key)
|
||||
if err == nil {
|
||||
*state.(*bool) = v != 0
|
||||
}
|
||||
case reflect.Int:
|
||||
var v uint64
|
||||
v, _, err = sk.GetIntegerValue(key)
|
||||
if err == nil {
|
||||
*state.(*int) = int(v)
|
||||
}
|
||||
case reflect.String:
|
||||
var v string
|
||||
v, _, err = sk.GetStringValue(key)
|
||||
if err == nil {
|
||||
*state.(*string) = string(v)
|
||||
}
|
||||
default:
|
||||
js, _, err = sk.GetBinaryValue(key)
|
||||
}
|
||||
if err != nil {
|
||||
if err == syscall.ERROR_FILE_NOT_FOUND {
|
||||
return &NoStateError{id, key}
|
||||
}
|
||||
return &os.PathError{Op: "RegQueryValueEx", Path: sk.Name + ":" + key, Err: err}
|
||||
}
|
||||
if js != nil {
|
||||
err = json.Unmarshal(js, state)
|
||||
}
|
||||
return err
|
||||
}
|
||||
51
vendor/github.com/Microsoft/hcsshim/internal/regstate/zsyscall_windows.go
generated
vendored
Normal file
51
vendor/github.com/Microsoft/hcsshim/internal/regstate/zsyscall_windows.go
generated
vendored
Normal file
@@ -0,0 +1,51 @@
|
||||
// Code generated by 'go generate'; DO NOT EDIT.
|
||||
|
||||
package regstate
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
var _ unsafe.Pointer
|
||||
|
||||
// Do the interface allocations only once for common
|
||||
// Errno values.
|
||||
const (
|
||||
errnoERROR_IO_PENDING = 997
|
||||
)
|
||||
|
||||
var (
|
||||
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||
)
|
||||
|
||||
// errnoErr returns common boxed Errno values, to prevent
|
||||
// allocations at runtime.
|
||||
func errnoErr(e syscall.Errno) error {
|
||||
switch e {
|
||||
case 0:
|
||||
return nil
|
||||
case errnoERROR_IO_PENDING:
|
||||
return errERROR_IO_PENDING
|
||||
}
|
||||
// TODO: add more here, after collecting data on the common
|
||||
// error values see on Windows. (perhaps when running
|
||||
// all.bat?)
|
||||
return e
|
||||
}
|
||||
|
||||
var (
|
||||
modadvapi32 = windows.NewLazySystemDLL("advapi32.dll")
|
||||
|
||||
procRegCreateKeyExW = modadvapi32.NewProc("RegCreateKeyExW")
|
||||
)
|
||||
|
||||
func regCreateKeyEx(key syscall.Handle, subkey *uint16, reserved uint32, class *uint16, options uint32, desired uint32, sa *syscall.SecurityAttributes, result *syscall.Handle, disposition *uint32) (regerrno error) {
|
||||
r0, _, _ := syscall.Syscall9(procRegCreateKeyExW.Addr(), 9, uintptr(key), uintptr(unsafe.Pointer(subkey)), uintptr(reserved), uintptr(unsafe.Pointer(class)), uintptr(options), uintptr(desired), uintptr(unsafe.Pointer(sa)), uintptr(unsafe.Pointer(result)), uintptr(unsafe.Pointer(disposition)))
|
||||
if r0 != 0 {
|
||||
regerrno = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
31
vendor/github.com/Microsoft/hcsshim/internal/runhcs/BUILD
generated
vendored
Normal file
31
vendor/github.com/Microsoft/hcsshim/internal/runhcs/BUILD
generated
vendored
Normal file
@@ -0,0 +1,31 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = [
|
||||
"container.go",
|
||||
"util.go",
|
||||
"vm.go",
|
||||
],
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/internal/runhcs",
|
||||
importpath = "github.com/Microsoft/hcsshim/internal/runhcs",
|
||||
visibility = ["//vendor/github.com/Microsoft/hcsshim:__subpackages__"],
|
||||
deps = [
|
||||
"//vendor/github.com/Microsoft/go-winio:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/guid:go_default_library",
|
||||
],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
71
vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go
generated
vendored
Normal file
71
vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go
generated
vendored
Normal file
@@ -0,0 +1,71 @@
|
||||
package runhcs
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"errors"
|
||||
"fmt"
|
||||
"io"
|
||||
"io/ioutil"
|
||||
"os"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/guid"
|
||||
)
|
||||
|
||||
// ContainerState represents the platform agnostic pieces relating to a
|
||||
// running container's status and state
|
||||
type ContainerState struct {
|
||||
// Version is the OCI version for the container
|
||||
Version string `json:"ociVersion"`
|
||||
// ID is the container ID
|
||||
ID string `json:"id"`
|
||||
// InitProcessPid is the init process id in the parent namespace
|
||||
InitProcessPid int `json:"pid"`
|
||||
// Status is the current status of the container, running, paused, ...
|
||||
Status string `json:"status"`
|
||||
// Bundle is the path on the filesystem to the bundle
|
||||
Bundle string `json:"bundle"`
|
||||
// Rootfs is a path to a directory containing the container's root filesystem.
|
||||
Rootfs string `json:"rootfs"`
|
||||
// Created is the unix timestamp for the creation time of the container in UTC
|
||||
Created time.Time `json:"created"`
|
||||
// Annotations is the user defined annotations added to the config.
|
||||
Annotations map[string]string `json:"annotations,omitempty"`
|
||||
// The owner of the state directory (the owner of the container).
|
||||
Owner string `json:"owner"`
|
||||
}
|
||||
|
||||
// GetErrorFromPipe returns reads from `pipe` and verifies if the operation
|
||||
// returned success or error. If error converts that to an error and returns. If
|
||||
// `p` is not nill will issue a `Kill` and `Wait` for exit.
|
||||
func GetErrorFromPipe(pipe io.Reader, p *os.Process) error {
|
||||
serr, err := ioutil.ReadAll(pipe)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if bytes.Equal(serr, ShimSuccess) {
|
||||
return nil
|
||||
}
|
||||
|
||||
extra := ""
|
||||
if p != nil {
|
||||
p.Kill()
|
||||
state, err := p.Wait()
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
extra = fmt.Sprintf(", exit code %d", state.Sys().(syscall.WaitStatus).ExitCode)
|
||||
}
|
||||
if len(serr) == 0 {
|
||||
return fmt.Errorf("unknown shim failure%s", extra)
|
||||
}
|
||||
|
||||
return errors.New(string(serr))
|
||||
}
|
||||
|
||||
// VMPipePath returns the named pipe path for the vm shim.
|
||||
func VMPipePath(hostUniqueID guid.GUID) string {
|
||||
return SafePipePath("runhcs-vm-" + hostUniqueID.String())
|
||||
}
|
||||
16
vendor/github.com/Microsoft/hcsshim/internal/runhcs/util.go
generated
vendored
Normal file
16
vendor/github.com/Microsoft/hcsshim/internal/runhcs/util.go
generated
vendored
Normal file
@@ -0,0 +1,16 @@
|
||||
package runhcs
|
||||
|
||||
import "net/url"
|
||||
|
||||
const (
|
||||
SafePipePrefix = `\\.\pipe\ProtectedPrefix\Administrators\`
|
||||
)
|
||||
|
||||
// ShimSuccess is the byte stream returned on a successful operation.
|
||||
var ShimSuccess = []byte{0, 'O', 'K', 0}
|
||||
|
||||
func SafePipePath(name string) string {
|
||||
// Use a pipe in the Administrators protected prefixed to prevent malicious
|
||||
// squatting.
|
||||
return SafePipePrefix + url.PathEscape(name)
|
||||
}
|
||||
43
vendor/github.com/Microsoft/hcsshim/internal/runhcs/vm.go
generated
vendored
Normal file
43
vendor/github.com/Microsoft/hcsshim/internal/runhcs/vm.go
generated
vendored
Normal file
@@ -0,0 +1,43 @@
|
||||
package runhcs
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
|
||||
"github.com/Microsoft/go-winio"
|
||||
)
|
||||
|
||||
// VMRequestOp is an operation that can be issued to a VM shim.
|
||||
type VMRequestOp string
|
||||
|
||||
const (
|
||||
// OpCreateContainer is a create container request.
|
||||
OpCreateContainer VMRequestOp = "create"
|
||||
// OpSyncNamespace is a `cni.NamespaceTypeGuest` sync request with the UVM.
|
||||
OpSyncNamespace VMRequestOp = "sync"
|
||||
// OpUnmountContainer is a container unmount request.
|
||||
OpUnmountContainer VMRequestOp = "unmount"
|
||||
// OpUnmountContainerDiskOnly is a container unmount disk request.
|
||||
OpUnmountContainerDiskOnly VMRequestOp = "unmount-disk"
|
||||
)
|
||||
|
||||
// VMRequest is an operation request that is issued to a VM shim.
|
||||
type VMRequest struct {
|
||||
ID string
|
||||
Op VMRequestOp
|
||||
}
|
||||
|
||||
// IssueVMRequest issues a request to a shim at the given pipe.
|
||||
func IssueVMRequest(pipepath string, req *VMRequest) error {
|
||||
pipe, err := winio.DialPipe(pipepath, nil)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
defer pipe.Close()
|
||||
if err := json.NewEncoder(pipe).Encode(req); err != nil {
|
||||
return err
|
||||
}
|
||||
if err := GetErrorFromPipe(pipe, nil); err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
35
vendor/github.com/Microsoft/hcsshim/internal/safefile/BUILD
generated
vendored
Normal file
35
vendor/github.com/Microsoft/hcsshim/internal/safefile/BUILD
generated
vendored
Normal file
@@ -0,0 +1,35 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = [
|
||||
"safeopen.go",
|
||||
"zsyscall_windows.go",
|
||||
],
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/internal/safefile",
|
||||
importpath = "github.com/Microsoft/hcsshim/internal/safefile",
|
||||
visibility = ["//vendor/github.com/Microsoft/hcsshim:__subpackages__"],
|
||||
deps = [
|
||||
"//vendor/github.com/Microsoft/go-winio:go_default_library",
|
||||
"//vendor/github.com/Microsoft/hcsshim/internal/longpath:go_default_library",
|
||||
] + select({
|
||||
"@io_bazel_rules_go//go/platform:windows": [
|
||||
"//vendor/golang.org/x/sys/windows:go_default_library",
|
||||
],
|
||||
"//conditions:default": [],
|
||||
}),
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
@@ -1,4 +1,4 @@
|
||||
package hcsshim
|
||||
package safefile
|
||||
|
||||
import (
|
||||
"errors"
|
||||
@@ -10,9 +10,13 @@ import (
|
||||
"unicode/utf16"
|
||||
"unsafe"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/longpath"
|
||||
|
||||
winio "github.com/Microsoft/go-winio"
|
||||
)
|
||||
|
||||
//go:generate go run $GOROOT\src\syscall\mksyscall_windows.go -output zsyscall_windows.go safeopen.go
|
||||
|
||||
//sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile
|
||||
//sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile
|
||||
//sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb
|
||||
@@ -53,28 +57,28 @@ const (
|
||||
_FileLinkInformation = 11
|
||||
_FileDispositionInformationEx = 64
|
||||
|
||||
_FILE_READ_ATTRIBUTES = 0x0080
|
||||
_FILE_WRITE_ATTRIBUTES = 0x0100
|
||||
_DELETE = 0x10000
|
||||
FILE_READ_ATTRIBUTES = 0x0080
|
||||
FILE_WRITE_ATTRIBUTES = 0x0100
|
||||
DELETE = 0x10000
|
||||
|
||||
_FILE_OPEN = 1
|
||||
_FILE_CREATE = 2
|
||||
FILE_OPEN = 1
|
||||
FILE_CREATE = 2
|
||||
|
||||
_FILE_DIRECTORY_FILE = 0x00000001
|
||||
_FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020
|
||||
_FILE_DELETE_ON_CLOSE = 0x00001000
|
||||
_FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000
|
||||
_FILE_OPEN_REPARSE_POINT = 0x00200000
|
||||
FILE_DIRECTORY_FILE = 0x00000001
|
||||
FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020
|
||||
FILE_DELETE_ON_CLOSE = 0x00001000
|
||||
FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000
|
||||
FILE_OPEN_REPARSE_POINT = 0x00200000
|
||||
|
||||
_FILE_DISPOSITION_DELETE = 0x00000001
|
||||
FILE_DISPOSITION_DELETE = 0x00000001
|
||||
|
||||
_OBJ_DONT_REPARSE = 0x1000
|
||||
|
||||
_STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B
|
||||
)
|
||||
|
||||
func openRoot(path string) (*os.File, error) {
|
||||
longpath, err := makeLongAbsPath(path)
|
||||
func OpenRoot(path string) (*os.File, error) {
|
||||
longpath, err := longpath.LongAbs(path)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
@@ -141,7 +145,7 @@ func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFl
|
||||
0,
|
||||
shareFlags,
|
||||
createDisposition,
|
||||
_FILE_OPEN_FOR_BACKUP_INTENT|_FILE_SYNCHRONOUS_IO_NONALERT|flags,
|
||||
FILE_OPEN_FOR_BACKUP_INTENT|FILE_SYNCHRONOUS_IO_NONALERT|flags,
|
||||
nil,
|
||||
0,
|
||||
)
|
||||
@@ -149,7 +153,7 @@ func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFl
|
||||
return nil, rtlNtStatusToDosError(status)
|
||||
}
|
||||
|
||||
fullPath, err := makeLongAbsPath(filepath.Join(root.Name(), path))
|
||||
fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path))
|
||||
if err != nil {
|
||||
syscall.Close(syscall.Handle(h))
|
||||
return nil, err
|
||||
@@ -158,9 +162,9 @@ func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFl
|
||||
return os.NewFile(h, fullPath), nil
|
||||
}
|
||||
|
||||
// openRelative opens a relative path from the given root, failing if
|
||||
// OpenRelative opens a relative path from the given root, failing if
|
||||
// any of the intermediate path components are reparse points.
|
||||
func openRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
|
||||
func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
|
||||
f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags)
|
||||
if err != nil {
|
||||
err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err}
|
||||
@@ -168,17 +172,17 @@ func openRelative(path string, root *os.File, accessMask uint32, shareFlags uint
|
||||
return f, err
|
||||
}
|
||||
|
||||
// linkRelative creates a hard link from oldname to newname (relative to oldroot
|
||||
// LinkRelative creates a hard link from oldname to newname (relative to oldroot
|
||||
// and newroot), failing if any of the intermediate path components are reparse
|
||||
// points.
|
||||
func linkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error {
|
||||
func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error {
|
||||
// Open the old file.
|
||||
oldf, err := openRelativeInternal(
|
||||
oldname,
|
||||
oldroot,
|
||||
syscall.FILE_WRITE_ATTRIBUTES,
|
||||
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||
_FILE_OPEN,
|
||||
FILE_OPEN,
|
||||
0,
|
||||
)
|
||||
if err != nil {
|
||||
@@ -195,8 +199,8 @@ func linkRelative(oldname string, oldroot *os.File, newname string, newroot *os.
|
||||
newroot,
|
||||
syscall.GENERIC_READ,
|
||||
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||
_FILE_OPEN,
|
||||
_FILE_DIRECTORY_FILE)
|
||||
FILE_OPEN,
|
||||
FILE_DIRECTORY_FILE)
|
||||
if err != nil {
|
||||
return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err}
|
||||
}
|
||||
@@ -248,7 +252,7 @@ func linkRelative(oldname string, oldroot *os.File, newname string, newroot *os.
|
||||
|
||||
// deleteOnClose marks a file to be deleted when the handle is closed.
|
||||
func deleteOnClose(f *os.File) error {
|
||||
disposition := fileDispositionInformationEx{Flags: _FILE_DISPOSITION_DELETE}
|
||||
disposition := fileDispositionInformationEx{Flags: FILE_DISPOSITION_DELETE}
|
||||
var iosb ioStatusBlock
|
||||
status := ntSetInformationFile(
|
||||
f.Fd(),
|
||||
@@ -281,16 +285,16 @@ func clearReadOnly(f *os.File) error {
|
||||
return winio.SetFileBasicInfo(f, &sbi)
|
||||
}
|
||||
|
||||
// removeRelative removes a file or directory relative to a root, failing if any
|
||||
// RemoveRelative removes a file or directory relative to a root, failing if any
|
||||
// intermediate path components are reparse points.
|
||||
func removeRelative(path string, root *os.File) error {
|
||||
func RemoveRelative(path string, root *os.File) error {
|
||||
f, err := openRelativeInternal(
|
||||
path,
|
||||
root,
|
||||
_FILE_READ_ATTRIBUTES|_FILE_WRITE_ATTRIBUTES|_DELETE,
|
||||
FILE_READ_ATTRIBUTES|FILE_WRITE_ATTRIBUTES|DELETE,
|
||||
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||
_FILE_OPEN,
|
||||
_FILE_OPEN_REPARSE_POINT)
|
||||
FILE_OPEN,
|
||||
FILE_OPEN_REPARSE_POINT)
|
||||
if err == nil {
|
||||
defer f.Close()
|
||||
err = deleteOnClose(f)
|
||||
@@ -306,10 +310,10 @@ func removeRelative(path string, root *os.File) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
// removeAllRelative removes a directory tree relative to a root, failing if any
|
||||
// RemoveAllRelative removes a directory tree relative to a root, failing if any
|
||||
// intermediate path components are reparse points.
|
||||
func removeAllRelative(path string, root *os.File) error {
|
||||
fi, err := lstatRelative(path, root)
|
||||
func RemoveAllRelative(path string, root *os.File) error {
|
||||
fi, err := LstatRelative(path, root)
|
||||
if err != nil {
|
||||
if os.IsNotExist(err) {
|
||||
return nil
|
||||
@@ -319,7 +323,7 @@ func removeAllRelative(path string, root *os.File) error {
|
||||
fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes
|
||||
if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 {
|
||||
// If this is a reparse point, it can't have children. Simple remove will do.
|
||||
err := removeRelative(path, root)
|
||||
err := RemoveRelative(path, root)
|
||||
if err == nil || os.IsNotExist(err) {
|
||||
return nil
|
||||
}
|
||||
@@ -327,7 +331,7 @@ func removeAllRelative(path string, root *os.File) error {
|
||||
}
|
||||
|
||||
// It is necessary to use os.Open as Readdirnames does not work with
|
||||
// openRelative. This is safe because the above lstatrelative fails
|
||||
// OpenRelative. This is safe because the above lstatrelative fails
|
||||
// if the target is outside the root, and we know this is not a
|
||||
// symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check.
|
||||
fd, err := os.Open(filepath.Join(root.Name(), path))
|
||||
@@ -344,7 +348,7 @@ func removeAllRelative(path string, root *os.File) error {
|
||||
for {
|
||||
names, err1 := fd.Readdirnames(100)
|
||||
for _, name := range names {
|
||||
err1 := removeAllRelative(path+string(os.PathSeparator)+name, root)
|
||||
err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root)
|
||||
if err == nil {
|
||||
err = err1
|
||||
}
|
||||
@@ -363,7 +367,7 @@ func removeAllRelative(path string, root *os.File) error {
|
||||
fd.Close()
|
||||
|
||||
// Remove directory.
|
||||
err1 := removeRelative(path, root)
|
||||
err1 := RemoveRelative(path, root)
|
||||
if err1 == nil || os.IsNotExist(err1) {
|
||||
return nil
|
||||
}
|
||||
@@ -373,16 +377,16 @@ func removeAllRelative(path string, root *os.File) error {
|
||||
return err
|
||||
}
|
||||
|
||||
// mkdirRelative creates a directory relative to a root, failing if any
|
||||
// MkdirRelative creates a directory relative to a root, failing if any
|
||||
// intermediate path components are reparse points.
|
||||
func mkdirRelative(path string, root *os.File) error {
|
||||
func MkdirRelative(path string, root *os.File) error {
|
||||
f, err := openRelativeInternal(
|
||||
path,
|
||||
root,
|
||||
0,
|
||||
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||
_FILE_CREATE,
|
||||
_FILE_DIRECTORY_FILE)
|
||||
FILE_CREATE,
|
||||
FILE_DIRECTORY_FILE)
|
||||
if err == nil {
|
||||
f.Close()
|
||||
} else {
|
||||
@@ -391,16 +395,16 @@ func mkdirRelative(path string, root *os.File) error {
|
||||
return err
|
||||
}
|
||||
|
||||
// lstatRelative performs a stat operation on a file relative to a root, failing
|
||||
// LstatRelative performs a stat operation on a file relative to a root, failing
|
||||
// if any intermediate path components are reparse points.
|
||||
func lstatRelative(path string, root *os.File) (os.FileInfo, error) {
|
||||
func LstatRelative(path string, root *os.File) (os.FileInfo, error) {
|
||||
f, err := openRelativeInternal(
|
||||
path,
|
||||
root,
|
||||
_FILE_READ_ATTRIBUTES,
|
||||
FILE_READ_ATTRIBUTES,
|
||||
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||
_FILE_OPEN,
|
||||
_FILE_OPEN_REPARSE_POINT)
|
||||
FILE_OPEN,
|
||||
FILE_OPEN_REPARSE_POINT)
|
||||
if err != nil {
|
||||
return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err}
|
||||
}
|
||||
@@ -408,16 +412,16 @@ func lstatRelative(path string, root *os.File) (os.FileInfo, error) {
|
||||
return f.Stat()
|
||||
}
|
||||
|
||||
// ensureNotReparsePointRelative validates that a given file (relative to a
|
||||
// EnsureNotReparsePointRelative validates that a given file (relative to a
|
||||
// root) and all intermediate path components are not a reparse points.
|
||||
func ensureNotReparsePointRelative(path string, root *os.File) error {
|
||||
func EnsureNotReparsePointRelative(path string, root *os.File) error {
|
||||
// Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT.
|
||||
f, err := openRelative(
|
||||
f, err := OpenRelative(
|
||||
path,
|
||||
root,
|
||||
0,
|
||||
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||
_FILE_OPEN,
|
||||
FILE_OPEN,
|
||||
0)
|
||||
if err != nil {
|
||||
return err
|
||||
79
vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go
generated
vendored
Normal file
79
vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go
generated
vendored
Normal file
@@ -0,0 +1,79 @@
|
||||
// Code generated by 'go generate'; DO NOT EDIT.
|
||||
|
||||
package safefile
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
var _ unsafe.Pointer
|
||||
|
||||
// Do the interface allocations only once for common
|
||||
// Errno values.
|
||||
const (
|
||||
errnoERROR_IO_PENDING = 997
|
||||
)
|
||||
|
||||
var (
|
||||
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||
)
|
||||
|
||||
// errnoErr returns common boxed Errno values, to prevent
|
||||
// allocations at runtime.
|
||||
func errnoErr(e syscall.Errno) error {
|
||||
switch e {
|
||||
case 0:
|
||||
return nil
|
||||
case errnoERROR_IO_PENDING:
|
||||
return errERROR_IO_PENDING
|
||||
}
|
||||
// TODO: add more here, after collecting data on the common
|
||||
// error values see on Windows. (perhaps when running
|
||||
// all.bat?)
|
||||
return e
|
||||
}
|
||||
|
||||
var (
|
||||
modntdll = windows.NewLazySystemDLL("ntdll.dll")
|
||||
modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
|
||||
|
||||
procNtCreateFile = modntdll.NewProc("NtCreateFile")
|
||||
procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile")
|
||||
procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb")
|
||||
procLocalAlloc = modkernel32.NewProc("LocalAlloc")
|
||||
procLocalFree = modkernel32.NewProc("LocalFree")
|
||||
)
|
||||
|
||||
func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) {
|
||||
r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0)
|
||||
status = uint32(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) {
|
||||
r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0)
|
||||
status = uint32(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func rtlNtStatusToDosError(status uint32) (winerr error) {
|
||||
r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0)
|
||||
if r0 != 0 {
|
||||
winerr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func localAlloc(flags uint32, size int) (ptr uintptr) {
|
||||
r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0)
|
||||
ptr = uintptr(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func localFree(ptr uintptr) {
|
||||
syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0)
|
||||
return
|
||||
}
|
||||
24
vendor/github.com/Microsoft/hcsshim/internal/schema1/BUILD
generated
vendored
Normal file
24
vendor/github.com/Microsoft/hcsshim/internal/schema1/BUILD
generated
vendored
Normal file
@@ -0,0 +1,24 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = ["schema1.go"],
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/internal/schema1",
|
||||
importpath = "github.com/Microsoft/hcsshim/internal/schema1",
|
||||
visibility = ["//vendor/github.com/Microsoft/hcsshim:__subpackages__"],
|
||||
deps = ["//vendor/github.com/Microsoft/hcsshim/internal/schema2:go_default_library"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
245
vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go
generated
vendored
Normal file
245
vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go
generated
vendored
Normal file
@@ -0,0 +1,245 @@
|
||||
package schema1
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/schema2"
|
||||
)
|
||||
|
||||
// ProcessConfig is used as both the input of Container.CreateProcess
|
||||
// and to convert the parameters to JSON for passing onto the HCS
|
||||
type ProcessConfig struct {
|
||||
ApplicationName string `json:",omitempty"`
|
||||
CommandLine string `json:",omitempty"`
|
||||
CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows
|
||||
User string `json:",omitempty"`
|
||||
WorkingDirectory string `json:",omitempty"`
|
||||
Environment map[string]string `json:",omitempty"`
|
||||
EmulateConsole bool `json:",omitempty"`
|
||||
CreateStdInPipe bool `json:",omitempty"`
|
||||
CreateStdOutPipe bool `json:",omitempty"`
|
||||
CreateStdErrPipe bool `json:",omitempty"`
|
||||
ConsoleSize [2]uint `json:",omitempty"`
|
||||
CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows
|
||||
OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows
|
||||
}
|
||||
|
||||
type Layer struct {
|
||||
ID string
|
||||
Path string
|
||||
}
|
||||
|
||||
type MappedDir struct {
|
||||
HostPath string
|
||||
ContainerPath string
|
||||
ReadOnly bool
|
||||
BandwidthMaximum uint64
|
||||
IOPSMaximum uint64
|
||||
CreateInUtilityVM bool
|
||||
// LinuxMetadata - Support added in 1803/RS4+.
|
||||
LinuxMetadata bool `json:",omitempty"`
|
||||
}
|
||||
|
||||
type MappedPipe struct {
|
||||
HostPath string
|
||||
ContainerPipeName string
|
||||
}
|
||||
|
||||
type HvRuntime struct {
|
||||
ImagePath string `json:",omitempty"`
|
||||
SkipTemplate bool `json:",omitempty"`
|
||||
LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
|
||||
LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
|
||||
LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
|
||||
BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
|
||||
WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD
|
||||
}
|
||||
|
||||
type MappedVirtualDisk struct {
|
||||
HostPath string `json:",omitempty"` // Path to VHD on the host
|
||||
ContainerPath string // Platform-specific mount point path in the container
|
||||
CreateInUtilityVM bool `json:",omitempty"`
|
||||
ReadOnly bool `json:",omitempty"`
|
||||
Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
|
||||
AttachOnly bool `json:",omitempty:`
|
||||
}
|
||||
|
||||
// AssignedDevice represents a device that has been directly assigned to a container
|
||||
//
|
||||
// NOTE: Support added in RS5
|
||||
type AssignedDevice struct {
|
||||
// InterfaceClassGUID of the device to assign to container.
|
||||
InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"`
|
||||
}
|
||||
|
||||
// ContainerConfig is used as both the input of CreateContainer
|
||||
// and to convert the parameters to JSON for passing onto the HCS
|
||||
type ContainerConfig struct {
|
||||
SystemType string // HCS requires this to be hard-coded to "Container"
|
||||
Name string // Name of the container. We use the docker ID.
|
||||
Owner string `json:",omitempty"` // The management platform that created this container
|
||||
VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
|
||||
IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows
|
||||
LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID
|
||||
Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
|
||||
Credentials string `json:",omitempty"` // Credentials information
|
||||
ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container.
|
||||
ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
|
||||
ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
|
||||
StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS
|
||||
StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
|
||||
StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
|
||||
MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes
|
||||
HostName string `json:",omitempty"` // Hostname
|
||||
MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts)
|
||||
MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes
|
||||
HvPartition bool // True if it a Hyper-V Container
|
||||
NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
|
||||
EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container
|
||||
HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
|
||||
Servicing bool `json:",omitempty"` // True if this container is for servicing
|
||||
AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution
|
||||
DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
|
||||
ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
|
||||
TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
|
||||
MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
|
||||
AssignedDevices []AssignedDevice `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5
|
||||
}
|
||||
|
||||
type ComputeSystemQuery struct {
|
||||
IDs []string `json:"Ids,omitempty"`
|
||||
Types []string `json:",omitempty"`
|
||||
Names []string `json:",omitempty"`
|
||||
Owners []string `json:",omitempty"`
|
||||
}
|
||||
|
||||
type PropertyType string
|
||||
|
||||
const (
|
||||
PropertyTypeStatistics PropertyType = "Statistics" // V1 and V2
|
||||
PropertyTypeProcessList = "ProcessList" // V1 and V2
|
||||
PropertyTypeMappedVirtualDisk = "MappedVirtualDisk" // Not supported in V2 schema call
|
||||
PropertyTypeGuestConnection = "GuestConnection" // V1 and V2. Nil return from HCS before RS5
|
||||
)
|
||||
|
||||
type PropertyQuery struct {
|
||||
PropertyTypes []PropertyType `json:",omitempty"`
|
||||
}
|
||||
|
||||
// ContainerProperties holds the properties for a container and the processes running in that container
|
||||
type ContainerProperties struct {
|
||||
ID string `json:"Id"`
|
||||
State string
|
||||
Name string
|
||||
SystemType string
|
||||
Owner string
|
||||
SiloGUID string `json:"SiloGuid,omitempty"`
|
||||
RuntimeID string `json:"RuntimeId,omitempty"`
|
||||
IsRuntimeTemplate bool `json:",omitempty"`
|
||||
RuntimeImagePath string `json:",omitempty"`
|
||||
Stopped bool `json:",omitempty"`
|
||||
ExitType string `json:",omitempty"`
|
||||
AreUpdatesPending bool `json:",omitempty"`
|
||||
ObRoot string `json:",omitempty"`
|
||||
Statistics Statistics `json:",omitempty"`
|
||||
ProcessList []ProcessListItem `json:",omitempty"`
|
||||
MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
|
||||
GuestConnectionInfo GuestConnectionInfo `json:",omitempty"`
|
||||
}
|
||||
|
||||
// MemoryStats holds the memory statistics for a container
|
||||
type MemoryStats struct {
|
||||
UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"`
|
||||
UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
|
||||
UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
|
||||
}
|
||||
|
||||
// ProcessorStats holds the processor statistics for a container
|
||||
type ProcessorStats struct {
|
||||
TotalRuntime100ns uint64 `json:",omitempty"`
|
||||
RuntimeUser100ns uint64 `json:",omitempty"`
|
||||
RuntimeKernel100ns uint64 `json:",omitempty"`
|
||||
}
|
||||
|
||||
// StorageStats holds the storage statistics for a container
|
||||
type StorageStats struct {
|
||||
ReadCountNormalized uint64 `json:",omitempty"`
|
||||
ReadSizeBytes uint64 `json:",omitempty"`
|
||||
WriteCountNormalized uint64 `json:",omitempty"`
|
||||
WriteSizeBytes uint64 `json:",omitempty"`
|
||||
}
|
||||
|
||||
// NetworkStats holds the network statistics for a container
|
||||
type NetworkStats struct {
|
||||
BytesReceived uint64 `json:",omitempty"`
|
||||
BytesSent uint64 `json:",omitempty"`
|
||||
PacketsReceived uint64 `json:",omitempty"`
|
||||
PacketsSent uint64 `json:",omitempty"`
|
||||
DroppedPacketsIncoming uint64 `json:",omitempty"`
|
||||
DroppedPacketsOutgoing uint64 `json:",omitempty"`
|
||||
EndpointId string `json:",omitempty"`
|
||||
InstanceId string `json:",omitempty"`
|
||||
}
|
||||
|
||||
// Statistics is the structure returned by a statistics call on a container
|
||||
type Statistics struct {
|
||||
Timestamp time.Time `json:",omitempty"`
|
||||
ContainerStartTime time.Time `json:",omitempty"`
|
||||
Uptime100ns uint64 `json:",omitempty"`
|
||||
Memory MemoryStats `json:",omitempty"`
|
||||
Processor ProcessorStats `json:",omitempty"`
|
||||
Storage StorageStats `json:",omitempty"`
|
||||
Network []NetworkStats `json:",omitempty"`
|
||||
}
|
||||
|
||||
// ProcessList is the structure of an item returned by a ProcessList call on a container
|
||||
type ProcessListItem struct {
|
||||
CreateTimestamp time.Time `json:",omitempty"`
|
||||
ImageName string `json:",omitempty"`
|
||||
KernelTime100ns uint64 `json:",omitempty"`
|
||||
MemoryCommitBytes uint64 `json:",omitempty"`
|
||||
MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"`
|
||||
MemoryWorkingSetSharedBytes uint64 `json:",omitempty"`
|
||||
ProcessId uint32 `json:",omitempty"`
|
||||
UserTime100ns uint64 `json:",omitempty"`
|
||||
}
|
||||
|
||||
// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
|
||||
type MappedVirtualDiskController struct {
|
||||
MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
|
||||
}
|
||||
|
||||
// GuestDefinedCapabilities is part of the GuestConnectionInfo returned by a GuestConnection call on a utility VM
|
||||
type GuestDefinedCapabilities struct {
|
||||
NamespaceAddRequestSupported bool `json:",omitempty"`
|
||||
SignalProcessSupported bool `json:",omitempty"`
|
||||
}
|
||||
|
||||
// GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM
|
||||
type GuestConnectionInfo struct {
|
||||
SupportedSchemaVersions []hcsschema.Version `json:",omitempty"`
|
||||
ProtocolVersion uint32 `json:",omitempty"`
|
||||
GuestDefinedCapabilities GuestDefinedCapabilities `json:",omitempty"`
|
||||
}
|
||||
|
||||
// Type of Request Support in ModifySystem
|
||||
type RequestType string
|
||||
|
||||
// Type of Resource Support in ModifySystem
|
||||
type ResourceType string
|
||||
|
||||
// RequestType const
|
||||
const (
|
||||
Add RequestType = "Add"
|
||||
Remove RequestType = "Remove"
|
||||
Network ResourceType = "Network"
|
||||
)
|
||||
|
||||
// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
|
||||
// Supported resource types are Network and Request Types are Add/Remove
|
||||
type ResourceModificationRequestResponse struct {
|
||||
Resource ResourceType `json:"ResourceType"`
|
||||
Data interface{} `json:"Settings"`
|
||||
Request RequestType `json:"RequestType,omitempty"`
|
||||
}
|
||||
105
vendor/github.com/Microsoft/hcsshim/internal/schema2/BUILD
generated
vendored
Normal file
105
vendor/github.com/Microsoft/hcsshim/internal/schema2/BUILD
generated
vendored
Normal file
@@ -0,0 +1,105 @@
|
||||
load("@io_bazel_rules_go//go:def.bzl", "go_library")
|
||||
|
||||
go_library(
|
||||
name = "go_default_library",
|
||||
srcs = [
|
||||
"attachment.go",
|
||||
"battery.go",
|
||||
"cache_query_stats_response.go",
|
||||
"chipset.go",
|
||||
"close_handle.go",
|
||||
"com_port.go",
|
||||
"compute_system.go",
|
||||
"configuration.go",
|
||||
"console_size.go",
|
||||
"container.go",
|
||||
"container_credential_guard_state.go",
|
||||
"container_memory_information.go",
|
||||
"device.go",
|
||||
"devices.go",
|
||||
"enhanced_mode_video.go",
|
||||
"flexible_io_device.go",
|
||||
"guest_connection.go",
|
||||
"guest_connection_info.go",
|
||||
"guest_crash_reporting.go",
|
||||
"guest_os.go",
|
||||
"guest_state.go",
|
||||
"hosted_system.go",
|
||||
"hv_socket.go",
|
||||
"hv_socket_2.go",
|
||||
"hv_socket_service_config.go",
|
||||
"hv_socket_system_config.go",
|
||||
"keyboard.go",
|
||||
"layer.go",
|
||||
"linux_kernel_direct.go",
|
||||
"mapped_directory.go",
|
||||
"mapped_pipe.go",
|
||||
"memory.go",
|
||||
"memory_2.go",
|
||||
"memory_information_for_vm.go",
|
||||
"memory_stats.go",
|
||||
"modify_setting_request.go",
|
||||
"mouse.go",
|
||||
"network_adapter.go",
|
||||
"networking.go",
|
||||
"pause_notification.go",
|
||||
"pause_options.go",
|
||||
"plan9.go",
|
||||
"plan9_share.go",
|
||||
"process_details.go",
|
||||
"process_modify_request.go",
|
||||
"process_parameters.go",
|
||||
"process_status.go",
|
||||
"processor.go",
|
||||
"processor_2.go",
|
||||
"processor_stats.go",
|
||||
"properties.go",
|
||||
"property_query.go",
|
||||
"rdp_connection_options.go",
|
||||
"registry_changes.go",
|
||||
"registry_key.go",
|
||||
"registry_value.go",
|
||||
"restore_state.go",
|
||||
"save_options.go",
|
||||
"scsi.go",
|
||||
"shared_memory_configuration.go",
|
||||
"shared_memory_region.go",
|
||||
"shared_memory_region_info.go",
|
||||
"silo_properties.go",
|
||||
"statistics.go",
|
||||
"storage.go",
|
||||
"storage_qo_s.go",
|
||||
"storage_stats.go",
|
||||
"topology.go",
|
||||
"uefi.go",
|
||||
"uefi_boot_entry.go",
|
||||
"version.go",
|
||||
"video_monitor.go",
|
||||
"virtual_machine.go",
|
||||
"virtual_node_info.go",
|
||||
"virtual_p_mem_controller.go",
|
||||
"virtual_p_mem_device.go",
|
||||
"virtual_smb.go",
|
||||
"virtual_smb_share.go",
|
||||
"virtual_smb_share_options.go",
|
||||
"vm_memory.go",
|
||||
"windows_crash_reporting.go",
|
||||
],
|
||||
importmap = "k8s.io/kubernetes/vendor/github.com/Microsoft/hcsshim/internal/schema2",
|
||||
importpath = "github.com/Microsoft/hcsshim/internal/schema2",
|
||||
visibility = ["//vendor/github.com/Microsoft/hcsshim:__subpackages__"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "package-srcs",
|
||||
srcs = glob(["**"]),
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:private"],
|
||||
)
|
||||
|
||||
filegroup(
|
||||
name = "all-srcs",
|
||||
srcs = [":package-srcs"],
|
||||
tags = ["automanaged"],
|
||||
visibility = ["//visibility:public"],
|
||||
)
|
||||
31
vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go
generated
vendored
Normal file
31
vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go
generated
vendored
Normal file
@@ -0,0 +1,31 @@
|
||||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type Attachment struct {
|
||||
|
||||
Type_ string `json:"Type,omitempty"`
|
||||
|
||||
Path string `json:"Path,omitempty"`
|
||||
|
||||
IgnoreFlushes bool `json:"IgnoreFlushes,omitempty"`
|
||||
|
||||
CachingMode string `json:"CachingMode,omitempty"`
|
||||
|
||||
NoWriteHardening bool `json:"NoWriteHardening,omitempty"`
|
||||
|
||||
DisableExpansionOptimization bool `json:"DisableExpansionOptimization,omitempty"`
|
||||
|
||||
IgnoreRelativeLocator bool `json:"IgnoreRelativeLocator,omitempty"`
|
||||
|
||||
CaptureIoAttributionContext bool `json:"CaptureIoAttributionContext,omitempty"`
|
||||
|
||||
ReadOnly bool `json:"ReadOnly,omitempty"`
|
||||
}
|
||||
13
vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go
generated
vendored
Normal file
13
vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go
generated
vendored
Normal file
@@ -0,0 +1,13 @@
|
||||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type Battery struct {
|
||||
}
|
||||
19
vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go
generated
vendored
Normal file
19
vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go
generated
vendored
Normal file
@@ -0,0 +1,19 @@
|
||||
/*
|
||||
* HCS API
|
||||
*
|
||||
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||
*
|
||||
* API version: 2.1
|
||||
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||
*/
|
||||
|
||||
package hcsschema
|
||||
|
||||
type CacheQueryStatsResponse struct {
|
||||
|
||||
L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"`
|
||||
|
||||
L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"`
|
||||
|
||||
L3LocalBwBytes int32 `json:"L3LocalBwBytes,omitempty"`
|
||||
}
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user